Subversion Repositories openrisc_me

s_ceil.c Property changes : Added: svn:eol-style ## -0,0 +1 ## +native \ No newline at end of property Added: svn:keywords ## -0,0 +1 ## +Id \ No newline at end of property Index: e_asin.c =================================================================== --- e_asin.c (nonexistent) +++ e_asin.c (revision 158) @@ -0,0 +1,121 @@ + +/* @(#)e_asin.c 5.1 93/09/24 */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +/* __ieee754_asin(x) + * Method : + * Since asin(x) = x + x^3/6 + x^5*3/40 + x^7*15/336 + ... + * we approximate asin(x) on [0,0.5] by + * asin(x) = x + x*x^2*R(x^2) + * where + * R(x^2) is a rational approximation of (asin(x)-x)/x^3 + * and its remez error is bounded by + * |(asin(x)-x)/x^3 - R(x^2)| < 2^(-58.75) + * + * For x in [0.5,1] + * asin(x) = pi/2-2*asin(sqrt((1-x)/2)) + * Let y = (1-x), z = y/2, s := sqrt(z), and pio2_hi+pio2_lo=pi/2; + * then for x>0.98 + * asin(x) = pi/2 - 2*(s+s*z*R(z)) + * = pio2_hi - (2*(s+s*z*R(z)) - pio2_lo) + * For x<=0.98, let pio4_hi = pio2_hi/2, then + * f = hi part of s; + * c = sqrt(z) - f = (z-f*f)/(s+f) ...f+c=sqrt(z) + * and + * asin(x) = pi/2 - 2*(s+s*z*R(z)) + * = pio4_hi+(pio4-2s)-(2s*z*R(z)-pio2_lo) + * = pio4_hi+(pio4-2f)-(2s*z*R(z)-(pio2_lo+2c)) + * + * Special cases: + * if x is NaN, return x itself; + * if |x|>1, return NaN with invalid signal. + * + */ + + +#include "fdlibm.h" + +#ifndef _DOUBLE_IS_32BITS + +#ifdef __STDC__ +static const double +#else +static double +#endif +one = 1.00000000000000000000e+00, /* 0x3FF00000, 0x00000000 */ +huge = 1.000e+300, +pio2_hi = 1.57079632679489655800e+00, /* 0x3FF921FB, 0x54442D18 */ +pio2_lo = 6.12323399573676603587e-17, /* 0x3C91A626, 0x33145C07 */ +pio4_hi = 7.85398163397448278999e-01, /* 0x3FE921FB, 0x54442D18 */ + /* coefficient for R(x^2) */ +pS0 = 1.66666666666666657415e-01, /* 0x3FC55555, 0x55555555 */ +pS1 = -3.25565818622400915405e-01, /* 0xBFD4D612, 0x03EB6F7D */ +pS2 = 2.01212532134862925881e-01, /* 0x3FC9C155, 0x0E884455 */ +pS3 = -4.00555345006794114027e-02, /* 0xBFA48228, 0xB5688F3B */ +pS4 = 7.91534994289814532176e-04, /* 0x3F49EFE0, 0x7501B288 */ +pS5 = 3.47933107596021167570e-05, /* 0x3F023DE1, 0x0DFDF709 */ +qS1 = -2.40339491173441421878e+00, /* 0xC0033A27, 0x1C8A2D4B */ +qS2 = 2.02094576023350569471e+00, /* 0x40002AE5, 0x9C598AC8 */ +qS3 = -6.88283971605453293030e-01, /* 0xBFE6066C, 0x1B8D0159 */ +qS4 = 7.70381505559019352791e-02; /* 0x3FB3B8C5, 0xB12E9282 */ + +#ifdef __STDC__ + double __ieee754_asin(double x) +#else + double __ieee754_asin(x) + double x; +#endif +{ + double t,w,p,q,c,r,s; + __int32_t hx,ix; + GET_HIGH_WORD(hx,x); + ix = hx&0x7fffffff; + if(ix>= 0x3ff00000) { /* |x|>= 1 */ + __uint32_t lx; + GET_LOW_WORD(lx,x); + if(((ix-0x3ff00000)|lx)==0) + /* asin(1)=+-pi/2 with inexact */ + return x*pio2_hi+x*pio2_lo; + return (x-x)/(x-x); /* asin(|x|>1) is NaN */ + } else if (ix<0x3fe00000) { /* |x|<0.5 */ + if(ix<0x3e400000) { /* if |x| < 2**-27 */ + if(huge+x>one) return x;/* return x with inexact if x!=0*/ + } else { + t = x*x; + p = t*(pS0+t*(pS1+t*(pS2+t*(pS3+t*(pS4+t*pS5))))); + q = one+t*(qS1+t*(qS2+t*(qS3+t*qS4))); + w = p/q; + return x+x*w; + } + } + /* 1> |x|>= 0.5 */ + w = one-fabs(x); + t = w*0.5; + p = t*(pS0+t*(pS1+t*(pS2+t*(pS3+t*(pS4+t*pS5))))); + q = one+t*(qS1+t*(qS2+t*(qS3+t*qS4))); + s = __ieee754_sqrt(t); + if(ix>=0x3FEF3333) { /* if |x| > 0.975 */ + w = p/q; + t = pio2_hi-(2.0*(s+s*w)-pio2_lo); + } else { + w = s; + SET_LOW_WORD(w,0); + c = (t-w*w)/(s+w); + r = p/q; + p = 2.0*s*r-(pio2_lo-2.0*c); + q = pio4_hi-2.0*w; + t = pio4_hi-(p-q); + } + if(hx>0) return t; else return -t; +} + +#endif /* defined(_DOUBLE_IS_32BITS) */

e_asin.c Property changes : Added: svn:eol-style ## -0,0 +1 ## +native \ No newline at end of property Added: svn:keywords ## -0,0 +1 ## +Id \ No newline at end of property Index: s_ldexp.c =================================================================== --- s_ldexp.c (nonexistent) +++ s_ldexp.c (revision 158) @@ -0,0 +1,81 @@ + +/* @(#)s_ldexp.c 5.1 93/09/24 */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +/* +FUNCTION + <>, <>---load exponent + +INDEX + ldexp +INDEX + ldexpf + +ANSI_SYNOPSIS + #include + double ldexp(double <[val]>, int <[exp]>); + float ldexpf(float <[val]>, int <[exp]>); + +TRAD_SYNOPSIS + #include + + double ldexp(<[val]>, <[exp]>) + double <[val]>; + int <[exp]>; + + float ldexpf(<[val]>, <[exp]>) + float <[val]>; + int <[exp]>; + + +DESCRIPTION +<> calculates the value +@ifnottex +<[val]> times 2 to the power <[exp]>. +@end ifnottex +@tex +$val\times 2^{exp}$. +@end tex +<> is identical, save that it takes and returns <> +rather than <> values. + +RETURNS +<> returns the calculated value. + +Underflow and overflow both set <> to <>. +On underflow, <> and <> return 0.0. +On overflow, <> returns plus or minus <>. + +PORTABILITY +<> is ANSI. <> is an extension. + +*/ + +#include "fdlibm.h" +#include + +#ifndef _DOUBLE_IS_32BITS + +#ifdef __STDC__ + double ldexp(double value, int exp) +#else + double ldexp(value, exp) + double value; int exp; +#endif +{ + if(!finite(value)||value==0.0) return value; + value = scalbn(value,exp); + if(!finite(value)||value==0.0) errno = ERANGE; + return value; +} + +#endif /* _DOUBLE_IS_32BITS */

s_ldexp.c Property changes : Added: svn:eol-style ## -0,0 +1 ## +native \ No newline at end of property Added: svn:keywords ## -0,0 +1 ## +Id \ No newline at end of property Index: w_j0.c =================================================================== --- w_j0.c (nonexistent) +++ w_j0.c (revision 158) @@ -0,0 +1,229 @@ + +/* @(#)w_j0.c 5.1 93/09/24 */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +/* +FUNCTION +<>, <>, <>, <>---Bessel functions + +INDEX +j0 +INDEX +j0f +INDEX +j1 +INDEX +j1f +INDEX +jn +INDEX +jnf +INDEX +y0 +INDEX +y0f +INDEX +y1 +INDEX +y1f +INDEX +yn +INDEX +ynf + +ANSI_SYNOPSIS +#include +double j0(double <[x]>); +float j0f(float <[x]>); +double j1(double <[x]>); +float j1f(float <[x]>); +double jn(int <[n]>, double <[x]>); +float jnf(int <[n]>, float <[x]>); +double y0(double <[x]>); +float y0f(float <[x]>); +double y1(double <[x]>); +float y1f(float <[x]>); +double yn(int <[n]>, double <[x]>); +float ynf(int <[n]>, float <[x]>); + +TRAD_SYNOPSIS +#include + +double j0(<[x]>) +double <[x]>; +float j0f(<[x]>) +float <[x]>; +double j1(<[x]>) +double <[x]>; +float j1f(<[x]>) +float <[x]>; +double jn(<[n]>, <[x]>) +int <[n]>; +double <[x]>; +float jnf(<[n]>, <[x]>) +int <[n]>; +float <[x]>; + +double y0(<[x]>) +double <[x]>; +float y0f(<[x]>) +float <[x]>; +double y1(<[x]>) +double <[x]>; +float y1f(<[x]>) +float <[x]>; +double yn(<[n]>, <[x]>) +int <[n]>; +double <[x]>; +float ynf(<[n]>, <[x]>) +int <[n]>; +float <[x]>; + +DESCRIPTION +The Bessel functions are a family of functions that solve the +differential equation +@ifnottex +. 2 2 2 +. x y'' + xy' + (x - p )y = 0 +@end ifnottex +@tex +$$x^2{d^2y\over dx^2} + x{dy\over dx} + (x^2-p^2)y = 0$$ +@end tex +These functions have many applications in engineering and physics. + +<> calculates the Bessel function of the first kind of order +<[n]>. <> and <> are special cases for order 0 and order +1 respectively. + +Similarly, <> calculates the Bessel function of the second kind of +order <[n]>, and <> and <> are special cases for order 0 and +1. + +<>, <>, <>, <>, <>, and <> perform the +same calculations, but on <> rather than <> values. + +RETURNS +The value of each Bessel function at <[x]> is returned. + +PORTABILITY +None of the Bessel functions are in ANSI C. +*/ + +/* + * wrapper j0(double x), y0(double x) + */ + +#include "fdlibm.h" +#include + +#ifndef _DOUBLE_IS_32BITS + +#ifdef __STDC__ + double j0(double x) /* wrapper j0 */ +#else + double j0(x) /* wrapper j0 */ + double x; +#endif +{ +#ifdef _IEEE_LIBM + return __ieee754_j0(x); +#else + struct exception exc; + double z = __ieee754_j0(x); + if(_LIB_VERSION == _IEEE_ || isnan(x)) return z; + if(fabs(x)>X_TLOSS) { + /* j0(|x|>X_TLOSS) */ + exc.type = TLOSS; + exc.name = "j0"; + exc.err = 0; + exc.arg1 = exc.arg2 = x; + exc.retval = 0.0; + if (_LIB_VERSION == _POSIX_) + errno = ERANGE; + else if (!matherr(&exc)) { + errno = ERANGE; + } + if (exc.err != 0) + errno = exc.err; + return exc.retval; + } else + return z; +#endif +} + +#ifdef __STDC__ + double y0(double x) /* wrapper y0 */ +#else + double y0(x) /* wrapper y0 */ + double x; +#endif +{ +#ifdef _IEEE_LIBM + return __ieee754_y0(x); +#else + double z; + struct exception exc; + z = __ieee754_y0(x); + if(_LIB_VERSION == _IEEE_ || isnan(x) ) return z; + if(x <= 0.0){ +#ifndef HUGE_VAL +#define HUGE_VAL inf + double inf = 0.0; + + SET_HIGH_WORD(inf,0x7ff00000); /* set inf to infinite */ +#endif + /* y0(0) = -inf or y0(x<0) = NaN */ + exc.type = DOMAIN; /* should be SING for IEEE y0(0) */ + exc.name = "y0"; + exc.err = 0; + exc.arg1 = exc.arg2 = x; + if (_LIB_VERSION == _SVID_) + exc.retval = -HUGE; + else + exc.retval = -HUGE_VAL; + if (_LIB_VERSION == _POSIX_) + errno = EDOM; + else if (!matherr(&exc)) { + errno = EDOM; + } + if (exc.err != 0) + errno = exc.err; + return exc.retval; + } + if(x>X_TLOSS) { + /* y0(x>X_TLOSS) */ + exc.type = TLOSS; + exc.name = "y0"; + exc.err = 0; + exc.arg1 = exc.arg2 = x; + exc.retval = 0.0; + if (_LIB_VERSION == _POSIX_) + errno = ERANGE; + else if (!matherr(&exc)) { + errno = ERANGE; + } + if (exc.err != 0) + errno = exc.err; + return exc.retval; + } else + return z; +#endif +} + +#endif /* defined(_DOUBLE_IS_32BITS) */ + + + + + + +

w_j0.c Property changes : Added: svn:eol-style ## -0,0 +1 ## +native \ No newline at end of property Added: svn:keywords ## -0,0 +1 ## +Id \ No newline at end of property Index: sf_fabs.c =================================================================== --- sf_fabs.c (nonexistent) +++ sf_fabs.c (revision 158) @@ -0,0 +1,47 @@ +/* sf_fabs.c -- float version of s_fabs.c. + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + */ + +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +/* + * fabsf(x) returns the absolute value of x. + */ + +#include "fdlibm.h" + +#ifdef __STDC__ + float fabsf(float x) +#else + float fabsf(x) + float x; +#endif +{ + __uint32_t ix; + GET_FLOAT_WORD(ix,x); + SET_FLOAT_WORD(x,ix&0x7fffffff); + return x; +} + +#ifdef _DOUBLE_IS_32BITS + +#ifdef __STDC__ + double fabs(double x) +#else + double fabs(x) + double x; +#endif +{ + return (double) fabsf((float) x); +} + +#endif /* defined(_DOUBLE_IS_32BITS) */

sf_fabs.c Property changes : Added: svn:eol-style ## -0,0 +1 ## +native \ No newline at end of property Added: svn:keywords ## -0,0 +1 ## +Id \ No newline at end of property Index: k_sin.c =================================================================== --- k_sin.c (nonexistent) +++ k_sin.c (revision 158) @@ -0,0 +1,79 @@ + +/* @(#)k_sin.c 5.1 93/09/24 */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +/* __kernel_sin( x, y, iy) + * kernel sin function on [-pi/4, pi/4], pi/4 ~ 0.7854 + * Input x is assumed to be bounded by ~pi/4 in magnitude. + * Input y is the tail of x. + * Input iy indicates whether y is 0. (if iy=0, y assume to be 0). + * + * Algorithm + * 1. Since sin(-x) = -sin(x), we need only to consider positive x. + * 2. if x < 2^-27 (hx<0x3e400000 0), return x with inexact if x!=0. + * 3. sin(x) is approximated by a polynomial of degree 13 on + * [0,pi/4] + * 3 13 + * sin(x) ~ x + S1*x + ... + S6*x + * where + * + * |sin(x) 2 4 6 8 10 12 | -58 + * |----- - (1+S1*x +S2*x +S3*x +S4*x +S5*x +S6*x )| <= 2 + * | x | + * + * 4. sin(x+y) = sin(x) + sin'(x')*y + * ~ sin(x) + (1-x*x/2)*y + * For better accuracy, let + * 3 2 2 2 2 + * r = x *(S2+x *(S3+x *(S4+x *(S5+x *S6)))) + * then 3 2 + * sin(x) = x + (S1*x + (x *(r-y/2)+y)) + */ + +#include "fdlibm.h" + +#ifndef _DOUBLE_IS_32BITS + +#ifdef __STDC__ +static const double +#else +static double +#endif +half = 5.00000000000000000000e-01, /* 0x3FE00000, 0x00000000 */ +S1 = -1.66666666666666324348e-01, /* 0xBFC55555, 0x55555549 */ +S2 = 8.33333333332248946124e-03, /* 0x3F811111, 0x1110F8A6 */ +S3 = -1.98412698298579493134e-04, /* 0xBF2A01A0, 0x19C161D5 */ +S4 = 2.75573137070700676789e-06, /* 0x3EC71DE3, 0x57B1FE7D */ +S5 = -2.50507602534068634195e-08, /* 0xBE5AE5E6, 0x8A2B9CEB */ +S6 = 1.58969099521155010221e-10; /* 0x3DE5D93A, 0x5ACFD57C */ + +#ifdef __STDC__ + double __kernel_sin(double x, double y, int iy) +#else + double __kernel_sin(x, y, iy) + double x,y; int iy; /* iy=0 if y is zero */ +#endif +{ + double z,r,v; + __int32_t ix; + GET_HIGH_WORD(ix,x); + ix &= 0x7fffffff; /* high word of x */ + if(ix<0x3e400000) /* |x| < 2**-27 */ + {if((int)x==0) return x;} /* generate inexact */ + z = x*x; + v = z*x; + r = S2+z*(S3+z*(S4+z*(S5+z*S6))); + if(iy==0) return x+v*(S1+z*r); + else return x-((z*(half*y-v*r)-y)-v*S1); +} + +#endif /* defined(_DOUBLE_IS_32BITS) */

k_sin.c Property changes : Added: svn:eol-style ## -0,0 +1 ## +native \ No newline at end of property Added: svn:keywords ## -0,0 +1 ## +Id \ No newline at end of property Index: sf_ceil.c =================================================================== --- sf_ceil.c (nonexistent) +++ sf_ceil.c (revision 158) @@ -0,0 +1,70 @@ +/* sf_ceil.c -- float version of s_ceil.c. + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + */ + +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#include "fdlibm.h" + +#ifdef __STDC__ +static const float huge = 1.0e30; +#else +static float huge = 1.0e30; +#endif + +#ifdef __STDC__ + float ceilf(float x) +#else + float ceilf(x) + float x; +#endif +{ + __int32_t i0,j0; + __uint32_t i,ix; + GET_FLOAT_WORD(i0,x); + ix = (i0&0x7fffffff); + j0 = (ix>>23)-0x7f; + if(j0<23) { + if(j0<0) { /* raise inexact if x != 0 */ + if(huge+x>(float)0.0) {/* return 0*sign(x) if |x|<1 */ + if(i0<0) {i0=0x80000000;} + else if(!FLT_UWORD_IS_ZERO(ix)) { i0=0x3f800000;} + } + } else { + i = (0x007fffff)>>j0; + if((i0&i)==0) return x; /* x is integral */ + if(huge+x>(float)0.0) { /* raise inexact flag */ + if(i0>0) i0 += (0x00800000)>>j0; + i0 &= (~i); + } + } + } else { + if(!FLT_UWORD_IS_FINITE(ix)) return x+x; /* inf or NaN */ + else return x; /* x is integral */ + } + SET_FLOAT_WORD(x,i0); + return x; +} + +#ifdef _DOUBLE_IS_32BITS + +#ifdef __STDC__ + double ceil(double x) +#else + double ceil(x) + double x; +#endif +{ + return (double) ceilf((float) x); +} + +#endif /* defined(_DOUBLE_IS_32BITS) */

sf_ceil.c Property changes : Added: svn:eol-style ## -0,0 +1 ## +native \ No newline at end of property Added: svn:keywords ## -0,0 +1 ## +Id \ No newline at end of property Index: wf_j0.c =================================================================== --- wf_j0.c (nonexistent) +++ wf_j0.c (revision 158) @@ -0,0 +1,137 @@ +/* wf_j0.c -- float version of w_j0.c. + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + */ + +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +/* + * wrapper j0f(float x), y0f(float x) + */ + +#include "fdlibm.h" +#include + +#ifdef __STDC__ + float j0f(float x) /* wrapper j0f */ +#else + float j0f(x) /* wrapper j0f */ + float x; +#endif +{ +#ifdef _IEEE_LIBM + return __ieee754_j0f(x); +#else + struct exception exc; + float z = __ieee754_j0f(x); + if(_LIB_VERSION == _IEEE_ || isnanf(x)) return z; + if(fabsf(x)>(float)X_TLOSS) { + /* j0f(|x|>X_TLOSS) */ + exc.type = TLOSS; + exc.name = "j0f"; + exc.err = 0; + exc.arg1 = exc.arg2 = (double)x; + exc.retval = 0.0; + if (_LIB_VERSION == _POSIX_) + errno = ERANGE; + else if (!matherr(&exc)) { + errno = ERANGE; + } + if (exc.err != 0) + errno = exc.err; + return (float)exc.retval; + } else + return z; +#endif +} + +#ifdef __STDC__ + float y0f(float x) /* wrapper y0f */ +#else + float y0f(x) /* wrapper y0f */ + float x; +#endif +{ +#ifdef _IEEE_LIBM + return __ieee754_y0f(x); +#else + float z; + struct exception exc; + z = __ieee754_y0f(x); + if(_LIB_VERSION == _IEEE_ || isnanf(x) ) return z; + if(x <= (float)0.0){ +#ifndef HUGE_VAL +#define HUGE_VAL inf + double inf = 0.0; + + SET_HIGH_WORD(inf,0x7ff00000); /* set inf to infinite */ +#endif + /* y0f(0) = -inf or y0f(x<0) = NaN */ + exc.type = DOMAIN; /* should be SING for IEEE y0f(0) */ + exc.name = "y0f"; + exc.err = 0; + exc.arg1 = exc.arg2 = (double)x; + if (_LIB_VERSION == _SVID_) + exc.retval = -HUGE; + else + exc.retval = -HUGE_VAL; + if (_LIB_VERSION == _POSIX_) + errno = EDOM; + else if (!matherr(&exc)) { + errno = EDOM; + } + if (exc.err != 0) + errno = exc.err; + return (float)exc.retval; + } + if(x>(float)X_TLOSS) { + /* y0f(x>X_TLOSS) */ + exc.type = TLOSS; + exc.name = "y0f"; + exc.err = 0; + exc.arg1 = exc.arg2 = (double)x; + exc.retval = 0.0; + if (_LIB_VERSION == _POSIX_) + errno = ERANGE; + else if (!matherr(&exc)) { + errno = ERANGE; + } + if (exc.err != 0) + errno = exc.err; + return (float)exc.retval; + } else + return z; +#endif +} + +#ifdef _DOUBLE_IS_32BITS + +#ifdef __STDC__ + double j0(double x) +#else + double j0(x) + double x; +#endif +{ + return (double) j0f((float) x); +} + +#ifdef __STDC__ + double y0(double x) +#else + double y0(x) + double x; +#endif +{ + return (double) y0f((float) x); +} + +#endif /* defined(_DOUBLE_IS_32BITS) */

wf_j0.c Property changes : Added: svn:eol-style ## -0,0 +1 ## +native \ No newline at end of property Added: svn:keywords ## -0,0 +1 ## +Id \ No newline at end of property Index: w_log.c =================================================================== --- w_log.c (nonexistent) +++ w_log.c (revision 158) @@ -0,0 +1,116 @@ + +/* @(#)w_log.c 5.1 93/09/24 */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +/* +FUNCTION + <>, <>---natural logarithms + +INDEX + log +INDEX + logf + +ANSI_SYNOPSIS + #include + double log(double <[x]>); + float logf(float <[x]>); + +TRAD_SYNOPSIS + #include + double log(<[x]>); + double <[x]>; + + float logf(<[x]>); + float <[x]>; + +DESCRIPTION +Return the natural logarithm of <[x]>, that is, its logarithm base e +(where e is the base of the natural system of logarithms, 2.71828@dots{}). +<> and <> are identical save for the return and argument types. + +You can use the (non-ANSI) function <> to specify error +handling for these functions. + +RETURNS +Normally, returns the calculated value. When <[x]> is zero, the +returned value is <<-HUGE_VAL>> and <> is set to <>. +When <[x]> is negative, the returned value is NaN (not a number) and +<> is set to <>. You can control the error behavior via +<>. + +PORTABILITY +<> is ANSI. <> is an extension. +*/ + +/* + * wrapper log(x) + */ + +#include "fdlibm.h" +#include + +#ifndef _DOUBLE_IS_32BITS + +#ifdef __STDC__ + double log(double x) /* wrapper log */ +#else + double log(x) /* wrapper log */ + double x; +#endif +{ +#ifdef _IEEE_LIBM + return __ieee754_log(x); +#else + double z; + struct exception exc; + z = __ieee754_log(x); + if(_LIB_VERSION == _IEEE_ || isnan(x) || x > 0.0) return z; +#ifndef HUGE_VAL +#define HUGE_VAL inf + double inf = 0.0; + + SET_HIGH_WORD(inf,0x7ff00000); /* set inf to infinite */ +#endif + exc.name = "log"; + exc.err = 0; + exc.arg1 = x; + exc.arg2 = x; + if (_LIB_VERSION == _SVID_) + exc.retval = -HUGE; + else + exc.retval = -HUGE_VAL; + if(x==0.0) { + /* log(0) */ + exc.type = SING; + if (_LIB_VERSION == _POSIX_) + errno = ERANGE; + else if (!matherr(&exc)) { + errno = ERANGE; + } + } else { + /* log(x<0) */ + exc.type = DOMAIN; + if (_LIB_VERSION == _POSIX_) + errno = EDOM; + else if (!matherr(&exc)) { + errno = EDOM; + } + exc.retval = nan(""); + } + if (exc.err != 0) + errno = exc.err; + return exc.retval; +#endif +} + +#endif /* defined(_DOUBLE_IS_32BITS) */

w_log.c Property changes : Added: svn:eol-style ## -0,0 +1 ## +native \ No newline at end of property Added: svn:keywords ## -0,0 +1 ## +Id \ No newline at end of property Index: s_sin.c =================================================================== --- s_sin.c (nonexistent) +++ s_sin.c (revision 158) @@ -0,0 +1,132 @@ + +/* @(#)s_sin.c 5.1 93/09/24 */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +/* +FUNCTION + <>, <>, <>, <>---sine or cosine +INDEX +sin +INDEX +sinf +INDEX +cos +INDEX +cosf +ANSI_SYNOPSIS + #include + double sin(double <[x]>); + float sinf(float <[x]>); + double cos(double <[x]>); + float cosf(float <[x]>); + +TRAD_SYNOPSIS + #include + double sin(<[x]>) + double <[x]>; + float sinf(<[x]>) + float <[x]>; + + double cos(<[x]>) + double <[x]>; + float cosf(<[x]>) + float <[x]>; + +DESCRIPTION + <> and <> compute (respectively) the sine and cosine + of the argument <[x]>. Angles are specified in radians. + + <> and <> are identical, save that they take and + return <> values. + + +RETURNS + The sine or cosine of <[x]> is returned. + +PORTABILITY + <> and <> are ANSI C. + <> and <> are extensions. + +QUICKREF + sin ansi pure + sinf - pure +*/ + +/* sin(x) + * Return sine function of x. + * + * kernel function: + * __kernel_sin ... sine function on [-pi/4,pi/4] + * __kernel_cos ... cose function on [-pi/4,pi/4] + * __ieee754_rem_pio2 ... argument reduction routine + * + * Method. + * Let S,C and T denote the sin, cos and tan respectively on + * [-PI/4, +PI/4]. Reduce the argument x to y1+y2 = x-k*pi/2 + * in [-pi/4 , +pi/4], and let n = k mod 4. + * We have + * + * n sin(x) cos(x) tan(x) + * ---------------------------------------------------------- + * 0 S C T + * 1 C -S -1/T + * 2 -S -C T + * 3 -C S -1/T + * ---------------------------------------------------------- + * + * Special cases: + * Let trig be any of sin, cos, or tan. + * trig(+-INF) is NaN, with signals; + * trig(NaN) is that NaN; + * + * Accuracy: + * TRIG(x) returns trig(x) nearly rounded + */ + +#include "fdlibm.h" + +#ifndef _DOUBLE_IS_32BITS + +#ifdef __STDC__ + double sin(double x) +#else + double sin(x) + double x; +#endif +{ + double y[2],z=0.0; + __int32_t n,ix; + + /* High word of x. */ + GET_HIGH_WORD(ix,x); + + /* |x| ~< pi/4 */ + ix &= 0x7fffffff; + if(ix <= 0x3fe921fb) return __kernel_sin(x,z,0); + + /* sin(Inf or NaN) is NaN */ + else if (ix>=0x7ff00000) return x-x; + + /* argument reduction needed */ + else { + n = __ieee754_rem_pio2(x,y); + switch(n&3) { + case 0: return __kernel_sin(y[0],y[1],1); + case 1: return __kernel_cos(y[0],y[1]); + case 2: return -__kernel_sin(y[0],y[1],1); + default: + return -__kernel_cos(y[0],y[1]); + } + } +} + +#endif /* _DOUBLE_IS_32BITS */

s_sin.c Property changes : Added: svn:eol-style ## -0,0 +1 ## +native \ No newline at end of property Added: svn:keywords ## -0,0 +1 ## +Id \ No newline at end of property Index: sf_frexp.c =================================================================== --- sf_frexp.c (nonexistent) +++ sf_frexp.c (revision 158) @@ -0,0 +1,61 @@ +/* sf_frexp.c -- float version of s_frexp.c. + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + */ + +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#include "fdlibm.h" + +#ifdef __STDC__ +static const float +#else +static float +#endif +two25 = 3.3554432000e+07; /* 0x4c000000 */ + +#ifdef __STDC__ + float frexpf(float x, int *eptr) +#else + float frexpf(x, eptr) + float x; int *eptr; +#endif +{ + __int32_t hx, ix; + GET_FLOAT_WORD(hx,x); + ix = 0x7fffffff&hx; + *eptr = 0; + if(!FLT_UWORD_IS_FINITE(ix)||FLT_UWORD_IS_ZERO(ix)) return x; /* 0,inf,nan */ + if (FLT_UWORD_IS_SUBNORMAL(ix)) { /* subnormal */ + x *= two25; + GET_FLOAT_WORD(hx,x); + ix = hx&0x7fffffff; + *eptr = -25; + } + *eptr += (ix>>23)-126; + hx = (hx&0x807fffff)|0x3f000000; + SET_FLOAT_WORD(x,hx); + return x; +} + +#ifdef _DOUBLE_IS_32BITS + +#ifdef __STDC__ + double frexp(double x, int *eptr) +#else + double frexp(x, eptr) + double x; int *eptr; +#endif +{ + return (double) frexpf((float) x, eptr); +} + +#endif /* defined(_DOUBLE_IS_32BITS) */

sf_frexp.c Property changes : Added: svn:eol-style ## -0,0 +1 ## +native \ No newline at end of property Added: svn:keywords ## -0,0 +1 ## +Id \ No newline at end of property Index: wf_log10.c =================================================================== --- wf_log10.c (nonexistent) +++ wf_log10.c (revision 158) @@ -0,0 +1,89 @@ +/* wf_log10.c -- float version of w_log10.c. + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + */ + +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +/* + * wrapper log10f(X) + */ + +#include "fdlibm.h" +#include + +#ifdef __STDC__ + float log10f(float x) /* wrapper log10f */ +#else + float log10f(x) /* wrapper log10f */ + float x; +#endif +{ +#ifdef _IEEE_LIBM + return __ieee754_log10f(x); +#else + float z; + struct exception exc; + z = __ieee754_log10f(x); + if(_LIB_VERSION == _IEEE_ || isnanf(x)) return z; + if(x<=(float)0.0) { +#ifndef HUGE_VAL +#define HUGE_VAL inf + double inf = 0.0; + + SET_HIGH_WORD(inf,0x7ff00000); /* set inf to infinite */ +#endif + exc.name = "log10f"; + exc.err = 0; + exc.arg1 = exc.arg2 = (double)x; + if (_LIB_VERSION == _SVID_) + exc.retval = -HUGE; + else + exc.retval = -HUGE_VAL; + if(x==(float)0.0) { + /* log10f(0) */ + exc.type = SING; + if (_LIB_VERSION == _POSIX_) + errno = ERANGE; + else if (!matherr(&exc)) { + errno = ERANGE; + } + } else { + /* log10f(x<0) */ + exc.type = DOMAIN; + if (_LIB_VERSION == _POSIX_) + errno = EDOM; + else if (!matherr(&exc)) { + errno = EDOM; + } + exc.retval = nan(""); + } + if (exc.err != 0) + errno = exc.err; + return (float)exc.retval; + } else + return z; +#endif +} + +#ifdef _DOUBLE_IS_32BITS + +#ifdef __STDC__ + double log10(double x) +#else + double log10(x) + double x; +#endif +{ + return (double) log10f((float) x); +} + +#endif /* defined(_DOUBLE_IS_32BITS) */

wf_log10.c Property changes : Added: svn:eol-style ## -0,0 +1 ## +native \ No newline at end of property Added: svn:keywords ## -0,0 +1 ## +Id \ No newline at end of property Index: ef_pow.c =================================================================== --- ef_pow.c (nonexistent) +++ ef_pow.c (revision 158) @@ -0,0 +1,254 @@ +/* ef_pow.c -- float version of e_pow.c. + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + */ + +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#include "fdlibm.h" + +#ifdef __v810__ +#define const +#endif + +#ifdef __STDC__ +static const float +#else +static float +#endif +bp[] = {1.0, 1.5,}, +dp_h[] = { 0.0, 5.84960938e-01,}, /* 0x3f15c000 */ +dp_l[] = { 0.0, 1.56322085e-06,}, /* 0x35d1cfdc */ +zero = 0.0, +one = 1.0, +two = 2.0, +two24 = 16777216.0, /* 0x4b800000 */ +huge = 1.0e30, +tiny = 1.0e-30, + /* poly coefs for (3/2)*(log(x)-2s-2/3*s**3 */ +L1 = 6.0000002384e-01, /* 0x3f19999a */ +L2 = 4.2857143283e-01, /* 0x3edb6db7 */ +L3 = 3.3333334327e-01, /* 0x3eaaaaab */ +L4 = 2.7272811532e-01, /* 0x3e8ba305 */ +L5 = 2.3066075146e-01, /* 0x3e6c3255 */ +L6 = 2.0697501302e-01, /* 0x3e53f142 */ +P1 = 1.6666667163e-01, /* 0x3e2aaaab */ +P2 = -2.7777778450e-03, /* 0xbb360b61 */ +P3 = 6.6137559770e-05, /* 0x388ab355 */ +P4 = -1.6533901999e-06, /* 0xb5ddea0e */ +P5 = 4.1381369442e-08, /* 0x3331bb4c */ +lg2 = 6.9314718246e-01, /* 0x3f317218 */ +lg2_h = 6.93145752e-01, /* 0x3f317200 */ +lg2_l = 1.42860654e-06, /* 0x35bfbe8c */ +ovt = 4.2995665694e-08, /* -(128-log2(ovfl+.5ulp)) */ +cp = 9.6179670095e-01, /* 0x3f76384f =2/(3ln2) */ +cp_h = 9.6179199219e-01, /* 0x3f763800 =head of cp */ +cp_l = 4.7017383622e-06, /* 0x369dc3a0 =tail of cp_h */ +ivln2 = 1.4426950216e+00, /* 0x3fb8aa3b =1/ln2 */ +ivln2_h = 1.4426879883e+00, /* 0x3fb8aa00 =16b 1/ln2*/ +ivln2_l = 7.0526075433e-06; /* 0x36eca570 =1/ln2 tail*/ + +#ifdef __STDC__ + float __ieee754_powf(float x, float y) +#else + float __ieee754_powf(x,y) + float x, y; +#endif +{ + float z,ax,z_h,z_l,p_h,p_l; + float y1,t1,t2,r,s,t,u,v,w; + __int32_t i,j,k,yisint,n; + __int32_t hx,hy,ix,iy,is; + + GET_FLOAT_WORD(hx,x); + GET_FLOAT_WORD(hy,y); + ix = hx&0x7fffffff; iy = hy&0x7fffffff; + + /* y==zero: x**0 = 1 */ + if(FLT_UWORD_IS_ZERO(iy)) return one; + + /* x|y==NaN return NaN unless x==1 then return 1 */ + if(FLT_UWORD_IS_NAN(ix) || + FLT_UWORD_IS_NAN(iy)) + if(ix==0x3f800000) return one; + else return nanf(""); + + /* determine if y is an odd int when x < 0 + * yisint = 0 ... y is not an integer + * yisint = 1 ... y is an odd int + * yisint = 2 ... y is an even int + */ + yisint = 0; + if(hx<0) { + if(iy>=0x4b800000) yisint = 2; /* even integer y */ + else if(iy>=0x3f800000) { + k = (iy>>23)-0x7f; /* exponent */ + j = iy>>(23-k); + if((j<<(23-k))==iy) yisint = 2-(j&1); + } + } + + /* special value of y */ + if (FLT_UWORD_IS_INFINITE(iy)) { /* y is +-inf */ + if (ix==0x3f800000) + return one; /* +-1**+-inf = 1 */ + else if (ix > 0x3f800000)/* (|x|>1)**+-inf = inf,0 */ + return (hy>=0)? y: zero; + else /* (|x|<1)**-,+inf = inf,0 */ + return (hy<0)?-y: zero; + } + if(iy==0x3f800000) { /* y is +-1 */ + if(hy<0) return one/x; else return x; + } + if(hy==0x40000000) return x*x; /* y is 2 */ + if(hy==0x3f000000) { /* y is 0.5 */ + if(hx>=0) /* x >= +0 */ + return __ieee754_sqrtf(x); + } + + ax = fabsf(x); + /* special value of x */ + if(FLT_UWORD_IS_INFINITE(ix)||FLT_UWORD_IS_ZERO(ix)||ix==0x3f800000){ + z = ax; /*x is +-0,+-inf,+-1*/ + if(hy<0) z = one/z; /* z = (1/|x|) */ + if(hx<0) { + if(((ix-0x3f800000)|yisint)==0) { + z = (z-z)/(z-z); /* (-1)**non-int is NaN */ + } else if(yisint==1) + z = -z; /* (x<0)**odd = -(|x|**odd) */ + } + return z; + } + + /* (x<0)**(non-int) is NaN */ + if(((((__uint32_t)hx>>31)-1)|yisint)==0) return (x-x)/(x-x); + + /* |y| is huge */ + if(iy>0x4d000000) { /* if |y| > 2**27 */ + /* over/underflow if x is not close to one */ + if(ix<0x3f7ffff8) return (hy<0)? huge*huge:tiny*tiny; + if(ix>0x3f800007) return (hy>0)? huge*huge:tiny*tiny; + /* now |1-x| is tiny <= 2**-20, suffice to compute + log(x) by x-x^2/2+x^3/3-x^4/4 */ + t = ax-1; /* t has 20 trailing zeros */ + w = (t*t)*((float)0.5-t*((float)0.333333333333-t*(float)0.25)); + u = ivln2_h*t; /* ivln2_h has 16 sig. bits */ + v = t*ivln2_l-w*ivln2; + t1 = u+v; + GET_FLOAT_WORD(is,t1); + SET_FLOAT_WORD(t1,is&0xfffff000); + t2 = v-(t1-u); + } else { + float s2,s_h,s_l,t_h,t_l; + n = 0; + /* take care subnormal number */ + if(FLT_UWORD_IS_SUBNORMAL(ix)) + {ax *= two24; n -= 24; GET_FLOAT_WORD(ix,ax); } + n += ((ix)>>23)-0x7f; + j = ix&0x007fffff; + /* determine interval */ + ix = j|0x3f800000; /* normalize ix */ + if(j<=0x1cc471) k=0; /* |x|>1)|0x20000000)+0x0040000+(k<<21)); + t_l = ax - (t_h-bp[k]); + s_l = v*((u-s_h*t_h)-s_h*t_l); + /* compute log(ax) */ + s2 = s*s; + r = s2*s2*(L1+s2*(L2+s2*(L3+s2*(L4+s2*(L5+s2*L6))))); + r += s_l*(s_h+s); + s2 = s_h*s_h; + t_h = (float)3.0+s2+r; + GET_FLOAT_WORD(is,t_h); + SET_FLOAT_WORD(t_h,is&0xfffff000); + t_l = r-((t_h-(float)3.0)-s2); + /* u+v = s*(1+...) */ + u = s_h*t_h; + v = s_l*t_h+t_l*s; + /* 2/(3log2)*(s+...) */ + p_h = u+v; + GET_FLOAT_WORD(is,p_h); + SET_FLOAT_WORD(p_h,is&0xfffff000); + p_l = v-(p_h-u); + z_h = cp_h*p_h; /* cp_h+cp_l = 2/(3*log2) */ + z_l = cp_l*p_h+p_l*cp+dp_l[k]; + /* log2(ax) = (s+..)*2/(3*log2) = n + dp_h + z_h + z_l */ + t = (float)n; + t1 = (((z_h+z_l)+dp_h[k])+t); + GET_FLOAT_WORD(is,t1); + SET_FLOAT_WORD(t1,is&0xfffff000); + t2 = z_l-(((t1-t)-dp_h[k])-z_h); + } + + s = one; /* s (sign of result -ve**odd) = -1 else = 1 */ + if(((((__uint32_t)hx>>31)-1)|(yisint-1))==0) + s = -one; /* (-ve)**(odd int) */ + + /* split up y into y1+y2 and compute (y1+y2)*(t1+t2) */ + GET_FLOAT_WORD(is,y); + SET_FLOAT_WORD(y1,is&0xfffff000); + p_l = (y-y1)*t1+y*t2; + p_h = y1*t1; + z = p_l+p_h; + GET_FLOAT_WORD(j,z); + i = j&0x7fffffff; + if (j>0) { + if (i>FLT_UWORD_EXP_MAX) + return s*huge*huge; /* overflow */ + else if (i==FLT_UWORD_EXP_MAX) + if(p_l+ovt>z-p_h) return s*huge*huge; /* overflow */ + } else { + if (i>FLT_UWORD_EXP_MIN) + return s*tiny*tiny; /* underflow */ + else if (i==FLT_UWORD_EXP_MIN) + if(p_l<=z-p_h) return s*tiny*tiny; /* underflow */ + } + /* + * compute 2**(p_h+p_l) + */ + k = (i>>23)-0x7f; + n = 0; + if(i>0x3f000000) { /* if |z| > 0.5, set n = [z+0.5] */ + n = j+(0x00800000>>(k+1)); + k = ((n&0x7fffffff)>>23)-0x7f; /* new k for n */ + SET_FLOAT_WORD(t,n&~(0x007fffff>>k)); + n = ((n&0x007fffff)|0x00800000)>>(23-k); + if(j<0) n = -n; + p_h -= t; + } + t = p_l+p_h; + GET_FLOAT_WORD(is,t); + SET_FLOAT_WORD(t,is&0xfffff000); + u = t*lg2_h; + v = (p_l-(t-p_h))*lg2+t*lg2_l; + z = u+v; + w = v-(z-u); + t = z*z; + t1 = z - t*(P1+t*(P2+t*(P3+t*(P4+t*P5)))); + r = (z*t1)/(t1-two)-(w+z*w); + z = one-(r-z); + GET_FLOAT_WORD(j,z); + j += (n<<23); + if((j>>23)<=0) z = scalbnf(z,(int)n); /* subnormal output */ + else SET_FLOAT_WORD(z,j); + return s*z; +}

ef_pow.c Property changes : Added: svn:eol-style ## -0,0 +1 ## +native \ No newline at end of property Added: svn:keywords ## -0,0 +1 ## +Id \ No newline at end of property Index: w_sqrt.c =================================================================== --- w_sqrt.c (nonexistent) +++ w_sqrt.c (revision 158) @@ -0,0 +1,93 @@ + +/* @(#)w_sqrt.c 5.1 93/09/24 */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +/* +FUNCTION + <>, <>---positive square root + +INDEX + sqrt +INDEX + sqrtf + +ANSI_SYNOPSIS + #include + double sqrt(double <[x]>); + float sqrtf(float <[x]>); + +TRAD_SYNOPSIS + #include + double sqrt(<[x]>); + float sqrtf(<[x]>); + +DESCRIPTION + <> computes the positive square root of the argument. + You can modify error handling for this function with + <>. + +RETURNS + On success, the square root is returned. If <[x]> is real and + positive, then the result is positive. If <[x]> is real and + negative, the global value <> is set to <> (domain error). + + +PORTABILITY + <> is ANSI C. <> is an extension. +*/ + +/* + * wrapper sqrt(x) + */ + +#include "fdlibm.h" +#include + +#ifndef _DOUBLE_IS_32BITS + +#ifdef __STDC__ + double sqrt(double x) /* wrapper sqrt */ +#else + double sqrt(x) /* wrapper sqrt */ + double x; +#endif +{ +#ifdef _IEEE_LIBM + return __ieee754_sqrt(x); +#else + struct exception exc; + double z; + z = __ieee754_sqrt(x); + if(_LIB_VERSION == _IEEE_ || isnan(x)) return z; + if(x<0.0) { + exc.type = DOMAIN; + exc.name = "sqrt"; + exc.err = 0; + exc.arg1 = exc.arg2 = x; + if (_LIB_VERSION == _SVID_) + exc.retval = 0.0; + else + exc.retval = 0.0/0.0; + if (_LIB_VERSION == _POSIX_) + errno = EDOM; + else if (!matherr(&exc)) { + errno = EDOM; + } + if (exc.err != 0) + errno = exc.err; + return exc.retval; + } else + return z; +#endif +} + +#endif /* defined(_DOUBLE_IS_32BITS) */

w_sqrt.c Property changes : Added: svn:eol-style ## -0,0 +1 ## +native \ No newline at end of property Added: svn:keywords ## -0,0 +1 ## +Id \ No newline at end of property Index: er_lgamma.c =================================================================== --- er_lgamma.c (nonexistent) +++ er_lgamma.c (revision 158) @@ -0,0 +1,309 @@ + +/* @(#)er_lgamma.c 5.1 93/09/24 */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + * + */ + +/* __ieee754_lgamma_r(x, signgamp) + * Reentrant version of the logarithm of the Gamma function + * with user provide pointer for the sign of Gamma(x). + * + * Method: + * 1. Argument Reduction for 0 < x <= 8 + * Since gamma(1+s)=s*gamma(s), for x in [0,8], we may + * reduce x to a number in [1.5,2.5] by + * lgamma(1+s) = log(s) + lgamma(s) + * for example, + * lgamma(7.3) = log(6.3) + lgamma(6.3) + * = log(6.3*5.3) + lgamma(5.3) + * = log(6.3*5.3*4.3*3.3*2.3) + lgamma(2.3) + * 2. Polynomial approximation of lgamma around its + * minimun ymin=1.461632144968362245 to maintain monotonicity. + * On [ymin-0.23, ymin+0.27] (i.e., [1.23164,1.73163]), use + * Let z = x-ymin; + * lgamma(x) = -1.214862905358496078218 + z^2*poly(z) + * where + * poly(z) is a 14 degree polynomial. + * 2. Rational approximation in the primary interval [2,3] + * We use the following approximation: + * s = x-2.0; + * lgamma(x) = 0.5*s + s*P(s)/Q(s) + * with accuracy + * |P/Q - (lgamma(x)-0.5s)| < 2**-61.71 + * Our algorithms are based on the following observation + * + * zeta(2)-1 2 zeta(3)-1 3 + * lgamma(2+s) = s*(1-Euler) + --------- * s - --------- * s + ... + * 2 3 + * + * where Euler = 0.5771... is the Euler constant, which is very + * close to 0.5. + * + * 3. For x>=8, we have + * lgamma(x)~(x-0.5)log(x)-x+0.5*log(2pi)+1/(12x)-1/(360x**3)+.... + * (better formula: + * lgamma(x)~(x-0.5)*(log(x)-1)-.5*(log(2pi)-1) + ...) + * Let z = 1/x, then we approximation + * f(z) = lgamma(x) - (x-0.5)(log(x)-1) + * by + * 3 5 11 + * w = w0 + w1*z + w2*z + w3*z + ... + w6*z + * where + * |w - f(z)| < 2**-58.74 + * + * 4. For negative x, since (G is gamma function) + * -x*G(-x)*G(x) = pi/sin(pi*x), + * we have + * G(x) = pi/(sin(pi*x)*(-x)*G(-x)) + * since G(-x) is positive, sign(G(x)) = sign(sin(pi*x)) for x<0 + * Hence, for x<0, signgam = sign(sin(pi*x)) and + * lgamma(x) = log(|Gamma(x)|) + * = log(pi/(|x*sin(pi*x)|)) - lgamma(-x); + * Note: one should avoid compute pi*(-x) directly in the + * computation of sin(pi*(-x)). + * + * 5. Special Cases + * lgamma(2+s) ~ s*(1-Euler) for tiny s + * lgamma(1)=lgamma(2)=0 + * lgamma(x) ~ -log(x) for tiny x + * lgamma(0) = lgamma(inf) = inf + * lgamma(-integer) = +-inf + * + */ + +#include "fdlibm.h" + +#ifdef __STDC__ +static const double +#else +static double +#endif +two52= 4.50359962737049600000e+15, /* 0x43300000, 0x00000000 */ +half= 5.00000000000000000000e-01, /* 0x3FE00000, 0x00000000 */ +one = 1.00000000000000000000e+00, /* 0x3FF00000, 0x00000000 */ +pi = 3.14159265358979311600e+00, /* 0x400921FB, 0x54442D18 */ +a0 = 7.72156649015328655494e-02, /* 0x3FB3C467, 0xE37DB0C8 */ +a1 = 3.22467033424113591611e-01, /* 0x3FD4A34C, 0xC4A60FAD */ +a2 = 6.73523010531292681824e-02, /* 0x3FB13E00, 0x1A5562A7 */ +a3 = 2.05808084325167332806e-02, /* 0x3F951322, 0xAC92547B */ +a4 = 7.38555086081402883957e-03, /* 0x3F7E404F, 0xB68FEFE8 */ +a5 = 2.89051383673415629091e-03, /* 0x3F67ADD8, 0xCCB7926B */ +a6 = 1.19270763183362067845e-03, /* 0x3F538A94, 0x116F3F5D */ +a7 = 5.10069792153511336608e-04, /* 0x3F40B6C6, 0x89B99C00 */ +a8 = 2.20862790713908385557e-04, /* 0x3F2CF2EC, 0xED10E54D */ +a9 = 1.08011567247583939954e-04, /* 0x3F1C5088, 0x987DFB07 */ +a10 = 2.52144565451257326939e-05, /* 0x3EFA7074, 0x428CFA52 */ +a11 = 4.48640949618915160150e-05, /* 0x3F07858E, 0x90A45837 */ +tc = 1.46163214496836224576e+00, /* 0x3FF762D8, 0x6356BE3F */ +tf = -1.21486290535849611461e-01, /* 0xBFBF19B9, 0xBCC38A42 */ +/* tt = -(tail of tf) */ +tt = -3.63867699703950536541e-18, /* 0xBC50C7CA, 0xA48A971F */ +t0 = 4.83836122723810047042e-01, /* 0x3FDEF72B, 0xC8EE38A2 */ +t1 = -1.47587722994593911752e-01, /* 0xBFC2E427, 0x8DC6C509 */ +t2 = 6.46249402391333854778e-02, /* 0x3FB08B42, 0x94D5419B */ +t3 = -3.27885410759859649565e-02, /* 0xBFA0C9A8, 0xDF35B713 */ +t4 = 1.79706750811820387126e-02, /* 0x3F9266E7, 0x970AF9EC */ +t5 = -1.03142241298341437450e-02, /* 0xBF851F9F, 0xBA91EC6A */ +t6 = 6.10053870246291332635e-03, /* 0x3F78FCE0, 0xE370E344 */ +t7 = -3.68452016781138256760e-03, /* 0xBF6E2EFF, 0xB3E914D7 */ +t8 = 2.25964780900612472250e-03, /* 0x3F6282D3, 0x2E15C915 */ +t9 = -1.40346469989232843813e-03, /* 0xBF56FE8E, 0xBF2D1AF1 */ +t10 = 8.81081882437654011382e-04, /* 0x3F4CDF0C, 0xEF61A8E9 */ +t11 = -5.38595305356740546715e-04, /* 0xBF41A610, 0x9C73E0EC */ +t12 = 3.15632070903625950361e-04, /* 0x3F34AF6D, 0x6C0EBBF7 */ +t13 = -3.12754168375120860518e-04, /* 0xBF347F24, 0xECC38C38 */ +t14 = 3.35529192635519073543e-04, /* 0x3F35FD3E, 0xE8C2D3F4 */ +u0 = -7.72156649015328655494e-02, /* 0xBFB3C467, 0xE37DB0C8 */ +u1 = 6.32827064025093366517e-01, /* 0x3FE4401E, 0x8B005DFF */ +u2 = 1.45492250137234768737e+00, /* 0x3FF7475C, 0xD119BD6F */ +u3 = 9.77717527963372745603e-01, /* 0x3FEF4976, 0x44EA8450 */ +u4 = 2.28963728064692451092e-01, /* 0x3FCD4EAE, 0xF6010924 */ +u5 = 1.33810918536787660377e-02, /* 0x3F8B678B, 0xBF2BAB09 */ +v1 = 2.45597793713041134822e+00, /* 0x4003A5D7, 0xC2BD619C */ +v2 = 2.12848976379893395361e+00, /* 0x40010725, 0xA42B18F5 */ +v3 = 7.69285150456672783825e-01, /* 0x3FE89DFB, 0xE45050AF */ +v4 = 1.04222645593369134254e-01, /* 0x3FBAAE55, 0xD6537C88 */ +v5 = 3.21709242282423911810e-03, /* 0x3F6A5ABB, 0x57D0CF61 */ +s0 = -7.72156649015328655494e-02, /* 0xBFB3C467, 0xE37DB0C8 */ +s1 = 2.14982415960608852501e-01, /* 0x3FCB848B, 0x36E20878 */ +s2 = 3.25778796408930981787e-01, /* 0x3FD4D98F, 0x4F139F59 */ +s3 = 1.46350472652464452805e-01, /* 0x3FC2BB9C, 0xBEE5F2F7 */ +s4 = 2.66422703033638609560e-02, /* 0x3F9B481C, 0x7E939961 */ +s5 = 1.84028451407337715652e-03, /* 0x3F5E26B6, 0x7368F239 */ +s6 = 3.19475326584100867617e-05, /* 0x3F00BFEC, 0xDD17E945 */ +r1 = 1.39200533467621045958e+00, /* 0x3FF645A7, 0x62C4AB74 */ +r2 = 7.21935547567138069525e-01, /* 0x3FE71A18, 0x93D3DCDC */ +r3 = 1.71933865632803078993e-01, /* 0x3FC601ED, 0xCCFBDF27 */ +r4 = 1.86459191715652901344e-02, /* 0x3F9317EA, 0x742ED475 */ +r5 = 7.77942496381893596434e-04, /* 0x3F497DDA, 0xCA41A95B */ +r6 = 7.32668430744625636189e-06, /* 0x3EDEBAF7, 0xA5B38140 */ +w0 = 4.18938533204672725052e-01, /* 0x3FDACFE3, 0x90C97D69 */ +w1 = 8.33333333333329678849e-02, /* 0x3FB55555, 0x5555553B */ +w2 = -2.77777777728775536470e-03, /* 0xBF66C16C, 0x16B02E5C */ +w3 = 7.93650558643019558500e-04, /* 0x3F4A019F, 0x98CF38B6 */ +w4 = -5.95187557450339963135e-04, /* 0xBF4380CB, 0x8C0FE741 */ +w5 = 8.36339918996282139126e-04, /* 0x3F4B67BA, 0x4CDAD5D1 */ +w6 = -1.63092934096575273989e-03; /* 0xBF5AB89D, 0x0B9E43E4 */ + +#ifdef __STDC__ +static const double zero= 0.00000000000000000000e+00; +#else +static double zero= 0.00000000000000000000e+00; +#endif + +#ifdef __STDC__ + static double sin_pi(double x) +#else + static double sin_pi(x) + double x; +#endif +{ + double y,z; + __int32_t n,ix; + + GET_HIGH_WORD(ix,x); + ix &= 0x7fffffff; + + if(ix<0x3fd00000) return __kernel_sin(pi*x,zero,0); + y = -x; /* x is assume negative */ + + /* + * argument reduction, make sure inexact flag not raised if input + * is an integer + */ + z = floor(y); + if(z!=y) { /* inexact anyway */ + y *= 0.5; + y = 2.0*(y - floor(y)); /* y = |x| mod 2.0 */ + n = (__int32_t) (y*4.0); + } else { + if(ix>=0x43400000) { + y = zero; n = 0; /* y must be even */ + } else { + if(ix<0x43300000) z = y+two52; /* exact */ + GET_LOW_WORD(n,z); + n &= 1; + y = n; + n<<= 2; + } + } + switch (n) { + case 0: y = __kernel_sin(pi*y,zero,0); break; + case 1: + case 2: y = __kernel_cos(pi*(0.5-y),zero); break; + case 3: + case 4: y = __kernel_sin(pi*(one-y),zero,0); break; + case 5: + case 6: y = -__kernel_cos(pi*(y-1.5),zero); break; + default: y = __kernel_sin(pi*(y-2.0),zero,0); break; + } + return -y; +} + + +#ifdef __STDC__ + double __ieee754_lgamma_r(double x, int *signgamp) +#else + double __ieee754_lgamma_r(x,signgamp) + double x; int *signgamp; +#endif +{ + double t,y,z,nadj,p,p1,p2,p3,q,r,w; + __int32_t i,hx,lx,ix; + + EXTRACT_WORDS(hx,lx,x); + + /* purge off +-inf, NaN, +-0, and negative arguments */ + *signgamp = 1; + ix = hx&0x7fffffff; + if(ix>=0x7ff00000) return x*x; + if((ix|lx)==0) return one/zero; + if(ix<0x3b900000) { /* |x|<2**-70, return -log(|x|) */ + if(hx<0) { + *signgamp = -1; + return -__ieee754_log(-x); + } else return -__ieee754_log(x); + } + if(hx<0) { + if(ix>=0x43300000) /* |x|>=2**52, must be -integer */ + return one/zero; + t = sin_pi(x); + if(t==zero) return one/zero; /* -integer */ + nadj = __ieee754_log(pi/fabs(t*x)); + if(t=0x3FE76944) {y = one-x; i= 0;} + else if(ix>=0x3FCDA661) {y= x-(tc-one); i=1;} + else {y = x; i=2;} + } else { + r = zero; + if(ix>=0x3FFBB4C3) {y=2.0-x;i=0;} /* [1.7316,2] */ + else if(ix>=0x3FF3B4C4) {y=x-tc;i=1;} /* [1.23,1.73] */ + else {y=x-one;i=2;} + } + switch(i) { + case 0: + z = y*y; + p1 = a0+z*(a2+z*(a4+z*(a6+z*(a8+z*a10)))); + p2 = z*(a1+z*(a3+z*(a5+z*(a7+z*(a9+z*a11))))); + p = y*p1+p2; + r += (p-0.5*y); break; + case 1: + z = y*y; + w = z*y; + p1 = t0+w*(t3+w*(t6+w*(t9 +w*t12))); /* parallel comp */ + p2 = t1+w*(t4+w*(t7+w*(t10+w*t13))); + p3 = t2+w*(t5+w*(t8+w*(t11+w*t14))); + p = z*p1-(tt-w*(p2+y*p3)); + r += (tf + p); break; + case 2: + p1 = y*(u0+y*(u1+y*(u2+y*(u3+y*(u4+y*u5))))); + p2 = one+y*(v1+y*(v2+y*(v3+y*(v4+y*v5)))); + r += (-0.5*y + p1/p2); + } + } + else if(ix<0x40200000) { /* x < 8.0 */ + i = (__int32_t)x; + t = zero; + y = x-(double)i; + p = y*(s0+y*(s1+y*(s2+y*(s3+y*(s4+y*(s5+y*s6)))))); + q = one+y*(r1+y*(r2+y*(r3+y*(r4+y*(r5+y*r6))))); + r = half*y+p/q; + z = one; /* lgamma(1+s) = log(s) + lgamma(s) */ + switch(i) { + case 7: z *= (y+6.0); /* FALLTHRU */ + case 6: z *= (y+5.0); /* FALLTHRU */ + case 5: z *= (y+4.0); /* FALLTHRU */ + case 4: z *= (y+3.0); /* FALLTHRU */ + case 3: z *= (y+2.0); /* FALLTHRU */ + r += __ieee754_log(z); break; + } + /* 8.0 <= x < 2**58 */ + } else if (ix < 0x43900000) { + t = __ieee754_log(x); + z = one/x; + y = z*z; + w = w0+z*(w1+y*(w2+y*(w3+y*(w4+y*(w5+y*w6))))); + r = (x-half)*(t-one)+w; + } else + /* 2**58 <= x <= inf */ + r = x*(__ieee754_log(x)-one); + if(hx<0) r = nadj - r; + return r; +}

er_lgamma.c Property changes : Added: svn:eol-style ## -0,0 +1 ## +native \ No newline at end of property Added: svn:keywords ## -0,0 +1 ## +Id \ No newline at end of property Index: w_lgamma.c =================================================================== --- w_lgamma.c (nonexistent) +++ w_lgamma.c (revision 158) @@ -0,0 +1,89 @@ + +/* @(#)w_lgamma.c 5.1 93/09/24 */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + * + */ + +/* double lgamma(double x) + * Return the logarithm of the Gamma function of x. + * + * Method: call __ieee754_lgamma_r + */ + +#include "fdlibm.h" +#include +#include + +#ifndef _DOUBLE_IS_32BITS + +#ifdef __STDC__ + double lgamma(double x) +#else + double lgamma(x) + double x; +#endif +{ +#ifdef _IEEE_LIBM + return __ieee754_lgamma_r(x,&(_REENT_SIGNGAM(_REENT))); +#else + double y; + struct exception exc; + y = __ieee754_lgamma_r(x,&(_REENT_SIGNGAM(_REENT))); + if(_LIB_VERSION == _IEEE_) return y; + if(!finite(y)&&finite(x)) { +#ifndef HUGE_VAL +#define HUGE_VAL inf + double inf = 0.0; + + SET_HIGH_WORD(inf,0x7ff00000); /* set inf to infinite */ +#endif + exc.name = "lgamma"; + exc.err = 0; + exc.arg1 = x; + exc.arg2 = x; + if (_LIB_VERSION == _SVID_) + exc.retval = HUGE; + else + exc.retval = HUGE_VAL; + if(floor(x)==x&&x<=0.0) { + /* lgamma(-integer) */ + exc.type = SING; + if (_LIB_VERSION == _POSIX_) + errno = EDOM; + else if (!matherr(&exc)) { + errno = EDOM; + } + + } else { + /* lgamma(finite) overflow */ + exc.type = OVERFLOW; + if (_LIB_VERSION == _POSIX_) + errno = ERANGE; + else if (!matherr(&exc)) { + errno = ERANGE; + } + } + if (exc.err != 0) + errno = exc.err; + return exc.retval; + } else + return y; +#endif +} + +#endif /* defined(_DOUBLE_IS_32BITS) */ + + + + + + +

w_lgamma.c Property changes : Added: svn:eol-style ## -0,0 +1 ## +native \ No newline at end of property Added: svn:keywords ## -0,0 +1 ## +Id \ No newline at end of property Index: Makefile.am =================================================================== --- Makefile.am (nonexistent) +++ Makefile.am (revision 158) @@ -0,0 +1,182 @@ +## Process this file with automake to generate Makefile.in + +AUTOMAKE_OPTIONS = cygnus + +INCLUDES = -I$(srcdir)/../common $(NEWLIB_CFLAGS) $(CROSS_CFLAGS) $(TARGET_CFLAGS) + +src = k_standard.c k_rem_pio2.c \ + k_cos.c k_sin.c k_tan.c \ + e_acos.c e_acosh.c e_asin.c e_atan2.c \ + e_atanh.c e_cosh.c e_exp.c e_fmod.c \ + er_gamma.c e_hypot.c e_j0.c \ + e_j1.c e_jn.c er_lgamma.c \ + e_log.c e_log10.c e_pow.c e_rem_pio2.c e_remainder.c \ + e_scalb.c e_sinh.c e_sqrt.c \ + w_acos.c w_acosh.c w_asin.c w_atan2.c \ + w_atanh.c w_cosh.c w_exp.c w_fmod.c \ + w_gamma.c wr_gamma.c w_hypot.c w_j0.c \ + w_j1.c w_jn.c w_lgamma.c wr_lgamma.c \ + w_log.c w_log10.c w_pow.c w_remainder.c \ + w_scalb.c w_sinh.c w_sqrt.c \ + w_sincos.c \ + w_cabs.c w_drem.c \ + s_asinh.c s_atan.c s_ceil.c \ + s_cos.c s_erf.c s_fabs.c s_floor.c \ + s_frexp.c s_ldexp.c \ + s_signif.c s_sin.c \ + s_tan.c s_tanh.c \ + w_exp2.c w_tgamma.c + +fsrc = kf_rem_pio2.c \ + kf_cos.c kf_sin.c kf_tan.c \ + ef_acos.c ef_acosh.c ef_asin.c ef_atan2.c \ + ef_atanh.c ef_cosh.c ef_exp.c ef_fmod.c \ + erf_gamma.c ef_hypot.c ef_j0.c \ + ef_j1.c ef_jn.c erf_lgamma.c \ + ef_log.c ef_log10.c ef_pow.c ef_rem_pio2.c ef_remainder.c \ + ef_scalb.c ef_sinh.c ef_sqrt.c \ + wf_acos.c wf_acosh.c wf_asin.c wf_atan2.c \ + wf_atanh.c wf_cosh.c wf_exp.c wf_fmod.c \ + wf_gamma.c wrf_gamma.c wf_hypot.c wf_j0.c \ + wf_j1.c wf_jn.c wf_lgamma.c wrf_lgamma.c \ + wf_log.c wf_log10.c wf_pow.c wf_remainder.c \ + wf_scalb.c wf_sinh.c wf_sqrt.c \ + wf_sincos.c \ + wf_cabs.c wf_drem.c \ + sf_asinh.c sf_atan.c sf_ceil.c \ + sf_cos.c sf_erf.c sf_fabs.c sf_floor.c \ + sf_frexp.c sf_ldexp.c \ + sf_signif.c sf_sin.c \ + sf_tan.c sf_tanh.c \ + wf_exp2.c wf_tgamma.c + +libmath_la_LDFLAGS = -Xcompiler -nostdlib + +if USE_LIBTOOL +noinst_LTLIBRARIES = libmath.la +libmath_la_SOURCES = $(src) $(fsrc) +noinst_DATA = objectlist.awk.in +else +noinst_LIBRARIES = lib.a +lib_a_SOURCES = $(src) $(fsrc) +lib_a_CFLAGS = $(AM_CFLAGS) +noinst_DATA = +endif # USE_LIBTOOL + +include $(srcdir)/../../Makefile.shared + +chobj = wacos.def wacosh.def wasin.def sasinh.def \ + satan.def watan2.def watanh.def wj0.def \ + wcosh.def serf.def wexp.def \ + sfabs.def sfloor.def wfmod.def sfrexp.def \ + wgamma.def whypot.def sldexp.def wlog.def \ + wlog10.def \ + wpow.def wremainder.def ssin.def wsinh.def \ + wsqrt.def stan.def stanh.def + +SUFFIXES = .def + +CHEW = ../../doc/makedoc -f $(srcdir)/../../doc/doc.str + +.c.def: + $(CHEW) < $< > $*.def 2> $*.ref + touch stmp-def + +TARGETDOC = ../tmp.texi + +doc: $(chobj) + cat $(srcdir)/math.tex >> $(TARGETDOC) + +CLEANFILES = $(chobj) *.ref + +# Texinfo does not appear to support underscores in file names, so we +# name the .def files without underscores. + +wacos.def: w_acos.c + $(CHEW) < $(srcdir)/w_acos.c >$@ 2>/dev/null + touch stmp-def +wacosh.def: w_acosh.c + $(CHEW) < $(srcdir)/w_acosh.c >$@ 2>/dev/null + touch stmp-def +wasin.def: w_asin.c + $(CHEW) < $(srcdir)/w_asin.c >$@ 2>/dev/null + touch stmp-def +sasinh.def: s_asinh.c + $(CHEW) < $(srcdir)/s_asinh.c >$@ 2>/dev/null + touch stmp-def +satan.def: s_atan.c + $(CHEW) < $(srcdir)/s_atan.c >$@ 2>/dev/null + touch stmp-def +watan2.def: w_atan2.c + $(CHEW) < $(srcdir)/w_atan2.c >$@ 2>/dev/null + touch stmp-def +watanh.def: w_atanh.c + $(CHEW) < $(srcdir)/w_atanh.c >$@ 2>/dev/null + touch stmp-def +wj0.def: w_j0.c + $(CHEW) < $(srcdir)/w_j0.c >$@ 2>/dev/null + touch stmp-def +scopysign.def: s_copysign.c + $(CHEW) < $(srcdir)/../common/s_copysign.c >$@ 2>/dev/null + touch stmp-def +wcosh.def: w_cosh.c + $(CHEW) < $(srcdir)/w_cosh.c >$@ 2>/dev/null + touch stmp-def +serf.def: s_erf.c + $(CHEW) < $(srcdir)/s_erf.c >$@ 2>/dev/null + touch stmp-def +wexp.def: w_exp.c + $(CHEW) < $(srcdir)/w_exp.c >$@ 2>/dev/null + touch stmp-def +sfabs.def: s_fabs.c + $(CHEW) < $(srcdir)/s_fabs.c >$@ 2>/dev/null + touch stmp-def +sfloor.def: s_floor.c + $(CHEW) < $(srcdir)/s_floor.c >$@ 2>/dev/null + touch stmp-def +wfmod.def: w_fmod.c + $(CHEW) < $(srcdir)/w_fmod.c >$@ 2>/dev/null + touch stmp-def +sfrexp.def: s_frexp.c + $(CHEW) < $(srcdir)/s_frexp.c >$@ 2>/dev/null + touch stmp-def +wgamma.def: w_gamma.c + $(CHEW) < $(srcdir)/w_gamma.c >$@ 2>/dev/null + touch stmp-def +whypot.def: w_hypot.c + $(CHEW) < $(srcdir)/w_hypot.c >$@ 2>/dev/null + touch stmp-def +sldexp.def: s_ldexp.c + $(CHEW) < $(srcdir)/s_ldexp.c >$@ 2>/dev/null + touch stmp-def +wlog.def: w_log.c + $(CHEW) < $(srcdir)/w_log.c >$@ 2>/dev/null + touch stmp-def +wlog10.def: w_log10.c + $(CHEW) < $(srcdir)/w_log10.c >$@ 2>/dev/null + touch stmp-def +wpow.def: w_pow.c + $(CHEW) < $(srcdir)/w_pow.c >$@ 2>/dev/null + touch stmp-def +wremainder.def: w_remainder.c + $(CHEW) < $(srcdir)/w_remainder.c >$@ 2>/dev/null + touch stmp-def +ssin.def: s_sin.c + $(CHEW) < $(srcdir)/s_sin.c >$@ 2>/dev/null + touch stmp-def +wsinh.def: w_sinh.c + $(CHEW) < $(srcdir)/w_sinh.c >$@ 2>/dev/null + touch stmp-def +wsqrt.def: w_sqrt.c + $(CHEW) < $(srcdir)/w_sqrt.c >$@ 2>/dev/null + touch stmp-def +stan.def: s_tan.c + $(CHEW) < $(srcdir)/s_tan.c >$@ 2>/dev/null + touch stmp-def +stanh.def: s_tanh.c + $(CHEW) < $(srcdir)/s_tanh.c >$@ 2>/dev/null + touch stmp-def + +# A partial dependency list. + +$(lib_a_OBJECTS): $(srcdir)/../../libc/include/math.h $(srcdir)/../common/fdlibm.h

Makefile.am Property changes : Added: svn:eol-style ## -0,0 +1 ## +native \ No newline at end of property Added: svn:keywords ## -0,0 +1 ## +Id \ No newline at end of property Index: sf_asinh.c =================================================================== --- sf_asinh.c (nonexistent) +++ sf_asinh.c (revision 158) @@ -0,0 +1,66 @@ +/* sf_asinh.c -- float version of s_asinh.c. + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + */ + +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#include "fdlibm.h" + +#ifdef __STDC__ +static const float +#else +static float +#endif +one = 1.0000000000e+00, /* 0x3F800000 */ +ln2 = 6.9314718246e-01, /* 0x3f317218 */ +huge= 1.0000000000e+30; + +#ifdef __STDC__ + float asinhf(float x) +#else + float asinhf(x) + float x; +#endif +{ + float t,w; + __int32_t hx,ix; + GET_FLOAT_WORD(hx,x); + ix = hx&0x7fffffff; + if(!FLT_UWORD_IS_FINITE(ix)) return x+x; /* x is inf or NaN */ + if(ix< 0x31800000) { /* |x|<2**-28 */ + if(huge+x>one) return x; /* return x inexact except 0 */ + } + if(ix>0x4d800000) { /* |x| > 2**28 */ + w = __ieee754_logf(fabsf(x))+ln2; + } else if (ix>0x40000000) { /* 2**28 > |x| > 2.0 */ + t = fabsf(x); + w = __ieee754_logf((float)2.0*t+one/(__ieee754_sqrtf(x*x+one)+t)); + } else { /* 2.0 > |x| > 2**-28 */ + t = x*x; + w =log1pf(fabsf(x)+t/(one+__ieee754_sqrtf(one+t))); + } + if(hx>0) return w; else return -w; +} + +#ifdef _DOUBLE_IS_32BITS + +#ifdef __STDC__ + double asinh(double x) +#else + double asinh(x) + double x; +#endif +{ + return (double) asinhf((float) x); +} + +#endif /* defined(_DOUBLE_IS_32BITS) */

sf_asinh.c Property changes : Added: svn:eol-style ## -0,0 +1 ## +native \ No newline at end of property Added: svn:keywords ## -0,0 +1 ## +Id \ No newline at end of property Index: wf_lgamma.c =================================================================== --- wf_lgamma.c (nonexistent) +++ wf_lgamma.c (revision 158) @@ -0,0 +1,87 @@ +/* wf_lgamma.c -- float version of w_lgamma.c. + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + */ + +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + * + */ + +#include "fdlibm.h" +#include +#include + +#ifdef __STDC__ + float lgammaf(float x) +#else + float lgammaf(x) + float x; +#endif +{ +#ifdef _IEEE_LIBM + return __ieee754_lgammaf_r(x,&(_REENT_SIGNGAM(_REENT))); +#else + float y; + struct exception exc; + y = __ieee754_lgammaf_r(x,&(_REENT_SIGNGAM(_REENT))); + if(_LIB_VERSION == _IEEE_) return y; + if(!finitef(y)&&finitef(x)) { +#ifndef HUGE_VAL +#define HUGE_VAL inf + double inf = 0.0; + + SET_HIGH_WORD(inf,0x7ff00000); /* set inf to infinite */ +#endif + exc.name = "lgammaf"; + exc.err = 0; + exc.arg1 = exc.arg2 = (double)x; + if (_LIB_VERSION == _SVID_) + exc.retval = HUGE; + else + exc.retval = HUGE_VAL; + if(floorf(x)==x&&x<=(float)0.0) { + /* lgammaf(-integer) */ + exc.type = SING; + if (_LIB_VERSION == _POSIX_) + errno = EDOM; + else if (!matherr(&exc)) { + errno = EDOM; + } + + } else { + /* lgammaf(finite) overflow */ + exc.type = OVERFLOW; + if (_LIB_VERSION == _POSIX_) + errno = ERANGE; + else if (!matherr(&exc)) { + errno = ERANGE; + } + } + if (exc.err != 0) + errno = exc.err; + return (float)exc.retval; + } else + return y; +#endif +} + +#ifdef _DOUBLE_IS_32BITS + +#ifdef __STDC__ + double lgamma(double x) +#else + double lgamma(x) + double x; +#endif +{ + return (double) lgammaf((float) x); +} + +#endif /* defined(_DOUBLE_IS_32BITS) */

wf_lgamma.c Property changes : Added: svn:eol-style ## -0,0 +1 ## +native \ No newline at end of property Added: svn:keywords ## -0,0 +1 ## +Id \ No newline at end of property Index: erf_lgamma.c =================================================================== --- erf_lgamma.c (nonexistent) +++ erf_lgamma.c (revision 158) @@ -0,0 +1,244 @@ +/* erf_lgamma.c -- float version of er_lgamma.c. + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + */ + +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + * + */ + +#include "fdlibm.h" + +#ifdef __STDC__ +static const float +#else +static float +#endif +two23= 8.3886080000e+06, /* 0x4b000000 */ +half= 5.0000000000e-01, /* 0x3f000000 */ +one = 1.0000000000e+00, /* 0x3f800000 */ +pi = 3.1415927410e+00, /* 0x40490fdb */ +a0 = 7.7215664089e-02, /* 0x3d9e233f */ +a1 = 3.2246702909e-01, /* 0x3ea51a66 */ +a2 = 6.7352302372e-02, /* 0x3d89f001 */ +a3 = 2.0580807701e-02, /* 0x3ca89915 */ +a4 = 7.3855509982e-03, /* 0x3bf2027e */ +a5 = 2.8905137442e-03, /* 0x3b3d6ec6 */ +a6 = 1.1927076848e-03, /* 0x3a9c54a1 */ +a7 = 5.1006977446e-04, /* 0x3a05b634 */ +a8 = 2.2086278477e-04, /* 0x39679767 */ +a9 = 1.0801156895e-04, /* 0x38e28445 */ +a10 = 2.5214456400e-05, /* 0x37d383a2 */ +a11 = 4.4864096708e-05, /* 0x383c2c75 */ +tc = 1.4616321325e+00, /* 0x3fbb16c3 */ +tf = -1.2148628384e-01, /* 0xbdf8cdcd */ +/* tt = -(tail of tf) */ +tt = 6.6971006518e-09, /* 0x31e61c52 */ +t0 = 4.8383611441e-01, /* 0x3ef7b95e */ +t1 = -1.4758771658e-01, /* 0xbe17213c */ +t2 = 6.4624942839e-02, /* 0x3d845a15 */ +t3 = -3.2788541168e-02, /* 0xbd064d47 */ +t4 = 1.7970675603e-02, /* 0x3c93373d */ +t5 = -1.0314224288e-02, /* 0xbc28fcfe */ +t6 = 6.1005386524e-03, /* 0x3bc7e707 */ +t7 = -3.6845202558e-03, /* 0xbb7177fe */ +t8 = 2.2596477065e-03, /* 0x3b141699 */ +t9 = -1.4034647029e-03, /* 0xbab7f476 */ +t10 = 8.8108185446e-04, /* 0x3a66f867 */ +t11 = -5.3859531181e-04, /* 0xba0d3085 */ +t12 = 3.1563205994e-04, /* 0x39a57b6b */ +t13 = -3.1275415677e-04, /* 0xb9a3f927 */ +t14 = 3.3552918467e-04, /* 0x39afe9f7 */ +u0 = -7.7215664089e-02, /* 0xbd9e233f */ +u1 = 6.3282704353e-01, /* 0x3f2200f4 */ +u2 = 1.4549225569e+00, /* 0x3fba3ae7 */ +u3 = 9.7771751881e-01, /* 0x3f7a4bb2 */ +u4 = 2.2896373272e-01, /* 0x3e6a7578 */ +u5 = 1.3381091878e-02, /* 0x3c5b3c5e */ +v1 = 2.4559779167e+00, /* 0x401d2ebe */ +v2 = 2.1284897327e+00, /* 0x4008392d */ +v3 = 7.6928514242e-01, /* 0x3f44efdf */ +v4 = 1.0422264785e-01, /* 0x3dd572af */ +v5 = 3.2170924824e-03, /* 0x3b52d5db */ +s0 = -7.7215664089e-02, /* 0xbd9e233f */ +s1 = 2.1498242021e-01, /* 0x3e5c245a */ +s2 = 3.2577878237e-01, /* 0x3ea6cc7a */ +s3 = 1.4635047317e-01, /* 0x3e15dce6 */ +s4 = 2.6642270386e-02, /* 0x3cda40e4 */ +s5 = 1.8402845599e-03, /* 0x3af135b4 */ +s6 = 3.1947532989e-05, /* 0x3805ff67 */ +r1 = 1.3920053244e+00, /* 0x3fb22d3b */ +r2 = 7.2193557024e-01, /* 0x3f38d0c5 */ +r3 = 1.7193385959e-01, /* 0x3e300f6e */ +r4 = 1.8645919859e-02, /* 0x3c98bf54 */ +r5 = 7.7794247773e-04, /* 0x3a4beed6 */ +r6 = 7.3266842264e-06, /* 0x36f5d7bd */ +w0 = 4.1893854737e-01, /* 0x3ed67f1d */ +w1 = 8.3333335817e-02, /* 0x3daaaaab */ +w2 = -2.7777778450e-03, /* 0xbb360b61 */ +w3 = 7.9365057172e-04, /* 0x3a500cfd */ +w4 = -5.9518753551e-04, /* 0xba1c065c */ +w5 = 8.3633989561e-04, /* 0x3a5b3dd2 */ +w6 = -1.6309292987e-03; /* 0xbad5c4e8 */ + +#ifdef __STDC__ +static const float zero= 0.0000000000e+00; +#else +static float zero= 0.0000000000e+00; +#endif + +#ifdef __STDC__ + static float sin_pif(float x) +#else + static float sin_pif(x) + float x; +#endif +{ + float y,z; + __int32_t n,ix; + + GET_FLOAT_WORD(ix,x); + ix &= 0x7fffffff; + + if(ix<0x3e800000) return __kernel_sinf(pi*x,zero,0); + y = -x; /* x is assume negative */ + + /* + * argument reduction, make sure inexact flag not raised if input + * is an integer + */ + z = floorf(y); + if(z!=y) { /* inexact anyway */ + y *= (float)0.5; + y = (float)2.0*(y - floorf(y)); /* y = |x| mod 2.0 */ + n = (__int32_t) (y*(float)4.0); + } else { + if(ix>=0x4b800000) { + y = zero; n = 0; /* y must be even */ + } else { + if(ix<0x4b000000) z = y+two23; /* exact */ + GET_FLOAT_WORD(n,z); + n &= 1; + y = n; + n<<= 2; + } + } + switch (n) { + case 0: y = __kernel_sinf(pi*y,zero,0); break; + case 1: + case 2: y = __kernel_cosf(pi*((float)0.5-y),zero); break; + case 3: + case 4: y = __kernel_sinf(pi*(one-y),zero,0); break; + case 5: + case 6: y = -__kernel_cosf(pi*(y-(float)1.5),zero); break; + default: y = __kernel_sinf(pi*(y-(float)2.0),zero,0); break; + } + return -y; +} + + +#ifdef __STDC__ + float __ieee754_lgammaf_r(float x, int *signgamp) +#else + float __ieee754_lgammaf_r(x,signgamp) + float x; int *signgamp; +#endif +{ + float t,y,z,nadj,p,p1,p2,p3,q,r,w; + __int32_t i,hx,ix; + + GET_FLOAT_WORD(hx,x); + + /* purge off +-inf, NaN, +-0, and negative arguments */ + *signgamp = 1; + ix = hx&0x7fffffff; + if(ix>=0x7f800000) return x*x; + if(ix==0) return one/zero; + if(ix<0x1c800000) { /* |x|<2**-70, return -log(|x|) */ + if(hx<0) { + *signgamp = -1; + return -__ieee754_logf(-x); + } else return -__ieee754_logf(x); + } + if(hx<0) { + if(ix>=0x4b000000) /* |x|>=2**23, must be -integer */ + return one/zero; + t = sin_pif(x); + if(t==zero) return one/zero; /* -integer */ + nadj = __ieee754_logf(pi/fabsf(t*x)); + if(t=0x3f3b4a20) {y = one-x; i= 0;} + else if(ix>=0x3e6d3308) {y= x-(tc-one); i=1;} + else {y = x; i=2;} + } else { + r = zero; + if(ix>=0x3fdda618) {y=(float)2.0-x;i=0;} /* [1.7316,2] */ + else if(ix>=0x3F9da620) {y=x-tc;i=1;} /* [1.23,1.73] */ + else {y=x-one;i=2;} + } + switch(i) { + case 0: + z = y*y; + p1 = a0+z*(a2+z*(a4+z*(a6+z*(a8+z*a10)))); + p2 = z*(a1+z*(a3+z*(a5+z*(a7+z*(a9+z*a11))))); + p = y*p1+p2; + r += (p-(float)0.5*y); break; + case 1: + z = y*y; + w = z*y; + p1 = t0+w*(t3+w*(t6+w*(t9 +w*t12))); /* parallel comp */ + p2 = t1+w*(t4+w*(t7+w*(t10+w*t13))); + p3 = t2+w*(t5+w*(t8+w*(t11+w*t14))); + p = z*p1-(tt-w*(p2+y*p3)); + r += (tf + p); break; + case 2: + p1 = y*(u0+y*(u1+y*(u2+y*(u3+y*(u4+y*u5))))); + p2 = one+y*(v1+y*(v2+y*(v3+y*(v4+y*v5)))); + r += (-(float)0.5*y + p1/p2); + } + } + else if(ix<0x41000000) { /* x < 8.0 */ + i = (__int32_t)x; + t = zero; + y = x-(float)i; + p = y*(s0+y*(s1+y*(s2+y*(s3+y*(s4+y*(s5+y*s6)))))); + q = one+y*(r1+y*(r2+y*(r3+y*(r4+y*(r5+y*r6))))); + r = half*y+p/q; + z = one; /* lgamma(1+s) = log(s) + lgamma(s) */ + switch(i) { + case 7: z *= (y+(float)6.0); /* FALLTHRU */ + case 6: z *= (y+(float)5.0); /* FALLTHRU */ + case 5: z *= (y+(float)4.0); /* FALLTHRU */ + case 4: z *= (y+(float)3.0); /* FALLTHRU */ + case 3: z *= (y+(float)2.0); /* FALLTHRU */ + r += __ieee754_logf(z); break; + } + /* 8.0 <= x < 2**58 */ + } else if (ix < 0x5c800000) { + t = __ieee754_logf(x); + z = one/x; + y = z*z; + w = w0+z*(w1+y*(w2+y*(w3+y*(w4+y*(w5+y*w6))))); + r = (x-half)*(t-one)+w; + } else + /* 2**58 <= x <= inf */ + r = x*(__ieee754_logf(x)-one); + if(hx<0) r = nadj - r; + return r; +}

erf_lgamma.c Property changes : Added: svn:eol-style ## -0,0 +1 ## +native \ No newline at end of property Added: svn:keywords ## -0,0 +1 ## +Id \ No newline at end of property Index: w_pow.c =================================================================== --- w_pow.c (nonexistent) +++ w_pow.c (revision 158) @@ -0,0 +1,231 @@ + + +/* @(#)w_pow.c 5.2 93/10/01 */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +/* +FUNCTION + <>, <>---x to the power y +INDEX + pow +INDEX + powf + + +ANSI_SYNOPSIS + #include + double pow(double <[x]>, double <[y]>); + float powf(float <[x]>, float <[y]>); + +TRAD_SYNOPSIS + #include + double pow(<[x]>, <[y]>); + double <[x]>, <[y]>; + + float powf(<[x]>, <[y]>); + float <[x]>, <[y]>; + +DESCRIPTION + <> and <> calculate <[x]> raised to the exponent <[y]>. + @tex + (That is, $x^y$.) + @end tex + +RETURNS + On success, <> and <> return the value calculated. + + When the argument values would produce overflow, <> + returns <> and set <> to <>. If the + argument <[x]> passed to <> or <> is a negative + noninteger, and <[y]> is also not an integer, then <> + is set to <>. If <[x]> and <[y]> are both 0, then + <> and <> return <<1>>. + + You can modify error handling for these functions using <>. + +PORTABILITY + <> is ANSI C. <> is an extension. */ + +/* + * wrapper pow(x,y) return x**y + */ + +#include "fdlibm.h" +#include + +#ifndef _DOUBLE_IS_32BITS + +#ifdef __STDC__ + double pow(double x, double y) /* wrapper pow */ +#else + double pow(x,y) /* wrapper pow */ + double x,y; +#endif +{ +#ifdef _IEEE_LIBM + return __ieee754_pow(x,y); +#else + double z; +#ifndef HUGE_VAL +#define HUGE_VAL inf + double inf = 0.0; + + SET_HIGH_WORD(inf,0x7ff00000); /* set inf to infinite */ +#endif + struct exception exc; + z=__ieee754_pow(x,y); + if(_LIB_VERSION == _IEEE_|| isnan(y)) return z; + if(isnan(x)) { + if(y==0.0) { + /* pow(NaN,0.0) */ + /* error only if _LIB_VERSION == _SVID_ & _XOPEN_ */ + exc.type = DOMAIN; + exc.name = "pow"; + exc.err = 0; + exc.arg1 = x; + exc.arg2 = y; + exc.retval = 1.0; + if (_LIB_VERSION == _IEEE_ || + _LIB_VERSION == _POSIX_) exc.retval = 1.0; + else if (!matherr(&exc)) { + errno = EDOM; + } + if (exc.err != 0) + errno = exc.err; + return exc.retval; + } else + return z; + } + if(x==0.0){ + if(y==0.0) { + /* pow(0.0,0.0) */ + /* error only if _LIB_VERSION == _SVID_ */ + exc.type = DOMAIN; + exc.name = "pow"; + exc.err = 0; + exc.arg1 = x; + exc.arg2 = y; + exc.retval = 0.0; + if (_LIB_VERSION != _SVID_) exc.retval = 1.0; + else if (!matherr(&exc)) { + errno = EDOM; + } + if (exc.err != 0) + errno = exc.err; + return exc.retval; + } + if(finite(y)&&y<0.0) { + /* 0**neg */ + exc.type = DOMAIN; + exc.name = "pow"; + exc.err = 0; + exc.arg1 = x; + exc.arg2 = y; + if (_LIB_VERSION == _SVID_) + exc.retval = 0.0; + else + exc.retval = -HUGE_VAL; + if (_LIB_VERSION == _POSIX_) + errno = EDOM; + else if (!matherr(&exc)) { + errno = EDOM; + } + if (exc.err != 0) + errno = exc.err; + return exc.retval; + } + return z; + } + if(!finite(z)) { + if(finite(x)&&finite(y)) { + if(isnan(z)) { + /* neg**non-integral */ + exc.type = DOMAIN; + exc.name = "pow"; + exc.err = 0; + exc.arg1 = x; + exc.arg2 = y; + if (_LIB_VERSION == _SVID_) + exc.retval = 0.0; + else + exc.retval = 0.0/0.0; /* X/Open allow NaN */ + if (_LIB_VERSION == _POSIX_) + errno = EDOM; + else if (!matherr(&exc)) { + errno = EDOM; + } + if (exc.err != 0) + errno = exc.err; + return exc.retval; + } else { + /* pow(x,y) overflow */ + exc.type = OVERFLOW; + exc.name = "pow"; + exc.err = 0; + exc.arg1 = x; + exc.arg2 = y; + if (_LIB_VERSION == _SVID_) { + exc.retval = HUGE; + y *= 0.5; + if(x<0.0&&rint(y)!=y) exc.retval = -HUGE; + } else { + exc.retval = HUGE_VAL; + y *= 0.5; + if(x<0.0&&rint(y)!=y) exc.retval = -HUGE_VAL; + } + if (_LIB_VERSION == _POSIX_) + errno = ERANGE; + else if (!matherr(&exc)) { + errno = ERANGE; + } + if (exc.err != 0) + errno = exc.err; + return exc.retval; + } + } + } + if(z==0.0&&finite(x)&&finite(y)) { + /* pow(x,y) underflow */ + exc.type = UNDERFLOW; + exc.name = "pow"; + exc.err = 0; + exc.arg1 = x; + exc.arg2 = y; + exc.retval = 0.0; + if (_LIB_VERSION == _POSIX_) + errno = ERANGE; + else if (!matherr(&exc)) { + errno = ERANGE; + } + if (exc.err != 0) + errno = exc.err; + return exc.retval; + } + return z; +#endif +} + +#endif /* defined(_DOUBLE_IS_32BITS) */ + + + + + + + + + + + + + +

w_pow.c Property changes : Added: svn:eol-style ## -0,0 +1 ## +native \ No newline at end of property Added: svn:keywords ## -0,0 +1 ## +Id \ No newline at end of property Index: w_tgamma.c =================================================================== --- w_tgamma.c (nonexistent) +++ w_tgamma.c (revision 158) @@ -0,0 +1,44 @@ +/* @(#)w_gamma.c 5.1 93/09/24 */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +/* double gamma(double x) + * Return the logarithm of the Gamma function of x or the Gamma function of x, + * depending on the library mode. + */ + +#include "fdlibm.h" + +#ifdef __STDC__ + double tgamma(double x) +#else + double tgamma(x) + double x; +#endif +{ + double y; + int local_signgam; + y = __ieee754_gamma_r(x,&local_signgam); + if (local_signgam < 0) y = -y; +#ifdef _IEEE_LIBM + return y; +#else + if(_LIB_VERSION == _IEEE_) return y; + + if(!finite(y)&&finite(x)) { + if(floor(x)==x&&x<=0.0) + return __kernel_standard(x,x,41); /* tgamma pole */ + else + return __kernel_standard(x,x,40); /* tgamma overflow */ + } + return y; +#endif +}

w_tgamma.c Property changes : Added: svn:eol-style ## -0,0 +1 ## +native \ No newline at end of property Added: svn:keywords ## -0,0 +1 ## +Id \ No newline at end of property Index: ef_fmod.c =================================================================== --- ef_fmod.c (nonexistent) +++ ef_fmod.c (revision 158) @@ -0,0 +1,113 @@ +/* ef_fmod.c -- float version of e_fmod.c. + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + */ + +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +/* + * __ieee754_fmodf(x,y) + * Return x mod y in exact arithmetic + * Method: shift and subtract + */ + +#include "fdlibm.h" + +#ifdef __STDC__ +static const float one = 1.0, Zero[] = {0.0, -0.0,}; +#else +static float one = 1.0, Zero[] = {0.0, -0.0,}; +#endif + +#ifdef __STDC__ + float __ieee754_fmodf(float x, float y) +#else + float __ieee754_fmodf(x,y) + float x,y ; +#endif +{ + __int32_t n,hx,hy,hz,ix,iy,sx,i; + + GET_FLOAT_WORD(hx,x); + GET_FLOAT_WORD(hy,y); + sx = hx&0x80000000; /* sign of x */ + hx ^=sx; /* |x| */ + hy &= 0x7fffffff; /* |y| */ + + /* purge off exception values */ + if(FLT_UWORD_IS_ZERO(hy)|| + !FLT_UWORD_IS_FINITE(hx)|| + FLT_UWORD_IS_NAN(hy)) + return (x*y)/(x*y); + if(hx>31]; /* |x|=|y| return x*0*/ + + /* Note: y cannot be zero if we reach here. */ + + /* determine ix = ilogb(x) */ + if(FLT_UWORD_IS_SUBNORMAL(hx)) { /* subnormal x */ + for (ix = -126,i=(hx<<8); i>0; i<<=1) ix -=1; + } else ix = (hx>>23)-127; + + /* determine iy = ilogb(y) */ + if(FLT_UWORD_IS_SUBNORMAL(hy)) { /* subnormal y */ + for (iy = -126,i=(hy<<8); i>=0; i<<=1) iy -=1; + } else iy = (hy>>23)-127; + + /* set up {hx,lx}, {hy,ly} and align y to x */ + if(ix >= -126) + hx = 0x00800000|(0x007fffff&hx); + else { /* subnormal x, shift x to normal */ + n = -126-ix; + hx = hx<= -126) + hy = 0x00800000|(0x007fffff&hy); + else { /* subnormal y, shift y to normal */ + n = -126-iy; + hy = hy<>31]; + hx = hz+hz; + } + } + hz=hx-hy; + if(hz>=0) {hx=hz;} + + /* convert back to floating value and restore the sign */ + if(hx==0) /* return sign(x)*0 */ + return Zero[(__uint32_t)sx>>31]; + while(hx<0x00800000) { /* normalize x */ + hx = hx+hx; + iy -= 1; + } + if(iy>= -126) { /* normalize output */ + hx = ((hx-0x00800000)|((iy+127)<<23)); + SET_FLOAT_WORD(x,hx|sx); + } else { /* subnormal output */ + /* If denormals are not supported, this code will generate a + zero representation. */ + n = -126 - iy; + hx >>= n; + SET_FLOAT_WORD(x,hx|sx); + x *= one; /* create necessary signal */ + } + return x; /* exact output */ +}

ef_fmod.c Property changes : Added: svn:eol-style ## -0,0 +1 ## +native \ No newline at end of property Added: svn:keywords ## -0,0 +1 ## +Id \ No newline at end of property Index: Makefile.in =================================================================== --- Makefile.in (nonexistent) +++ Makefile.in (revision 158) @@ -0,0 +1,1520 @@ +# Makefile.in generated by automake 1.9.6 from Makefile.am. +# @configure_input@ + +# Copyright (C) 1994, 1995, 1996, 1997, 1998, 1999, 2000, 2001, 2002, +# 2003, 2004, 2005 Free Software Foundation, Inc. +# This Makefile.in is free software; the Free Software Foundation +# gives unlimited permission to copy and/or distribute it, +# with or without modifications, as long as this notice is preserved. + +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY, to the extent permitted by law; without +# even the implied warranty of MERCHANTABILITY or FITNESS FOR A +# PARTICULAR PURPOSE. + +@SET_MAKE@ + + + +srcdir = @srcdir@ +top_srcdir = @top_srcdir@ +VPATH = @srcdir@ +pkgdatadir = $(datadir)/@PACKAGE@ +pkglibdir = $(libdir)/@PACKAGE@ +pkgincludedir = $(includedir)/@PACKAGE@ +top_builddir = .. +am__cd = CDPATH="$${ZSH_VERSION+.}$(PATH_SEPARATOR)" && cd +INSTALL = @INSTALL@ +install_sh_DATA = $(install_sh) -c -m 644 +install_sh_PROGRAM = $(install_sh) -c +install_sh_SCRIPT = $(install_sh) -c +INSTALL_HEADER = $(INSTALL_DATA) +transform = $(program_transform_name) +NORMAL_INSTALL = : +PRE_INSTALL = : +POST_INSTALL = : +NORMAL_UNINSTALL = : +PRE_UNINSTALL = : +POST_UNINSTALL = : +build_triplet = @build@ +host_triplet = @host@ +DIST_COMMON = $(srcdir)/../../Makefile.shared $(srcdir)/Makefile.in \ + $(srcdir)/Makefile.am +subdir = math +ACLOCAL_M4 = $(top_srcdir)/aclocal.m4 +am__aclocal_m4_deps = $(top_srcdir)/../../libtool.m4 \ + $(top_srcdir)/../../ltoptions.m4 \ + $(top_srcdir)/../../ltsugar.m4 \ + $(top_srcdir)/../../ltversion.m4 \ + $(top_srcdir)/../../lt~obsolete.m4 \ + $(top_srcdir)/../acinclude.m4 $(top_srcdir)/../confsubdir.m4 \ + $(top_srcdir)/configure.in +am__configure_deps = $(am__aclocal_m4_deps) $(CONFIGURE_DEPENDENCIES) \ + $(ACLOCAL_M4) +mkinstalldirs = $(SHELL) $(top_srcdir)/../../mkinstalldirs +CONFIG_CLEAN_FILES = +LIBRARIES = $(noinst_LIBRARIES) +ARFLAGS = cru +lib_a_AR = $(AR) $(ARFLAGS) +lib_a_LIBADD = +am__objects_1 = lib_a-k_standard.$(OBJEXT) lib_a-k_rem_pio2.$(OBJEXT) \ + lib_a-k_cos.$(OBJEXT) lib_a-k_sin.$(OBJEXT) \ + lib_a-k_tan.$(OBJEXT) lib_a-e_acos.$(OBJEXT) \ + lib_a-e_acosh.$(OBJEXT) lib_a-e_asin.$(OBJEXT) \ + lib_a-e_atan2.$(OBJEXT) lib_a-e_atanh.$(OBJEXT) \ + lib_a-e_cosh.$(OBJEXT) lib_a-e_exp.$(OBJEXT) \ + lib_a-e_fmod.$(OBJEXT) lib_a-er_gamma.$(OBJEXT) \ + lib_a-e_hypot.$(OBJEXT) lib_a-e_j0.$(OBJEXT) \ + lib_a-e_j1.$(OBJEXT) lib_a-e_jn.$(OBJEXT) \ + lib_a-er_lgamma.$(OBJEXT) lib_a-e_log.$(OBJEXT) \ + lib_a-e_log10.$(OBJEXT) lib_a-e_pow.$(OBJEXT) \ + lib_a-e_rem_pio2.$(OBJEXT) lib_a-e_remainder.$(OBJEXT) \ + lib_a-e_scalb.$(OBJEXT) lib_a-e_sinh.$(OBJEXT) \ + lib_a-e_sqrt.$(OBJEXT) lib_a-w_acos.$(OBJEXT) \ + lib_a-w_acosh.$(OBJEXT) lib_a-w_asin.$(OBJEXT) \ + lib_a-w_atan2.$(OBJEXT) lib_a-w_atanh.$(OBJEXT) \ + lib_a-w_cosh.$(OBJEXT) lib_a-w_exp.$(OBJEXT) \ + lib_a-w_fmod.$(OBJEXT) lib_a-w_gamma.$(OBJEXT) \ + lib_a-wr_gamma.$(OBJEXT) lib_a-w_hypot.$(OBJEXT) \ + lib_a-w_j0.$(OBJEXT) lib_a-w_j1.$(OBJEXT) lib_a-w_jn.$(OBJEXT) \ + lib_a-w_lgamma.$(OBJEXT) lib_a-wr_lgamma.$(OBJEXT) \ + lib_a-w_log.$(OBJEXT) lib_a-w_log10.$(OBJEXT) \ + lib_a-w_pow.$(OBJEXT) lib_a-w_remainder.$(OBJEXT) \ + lib_a-w_scalb.$(OBJEXT) lib_a-w_sinh.$(OBJEXT) \ + lib_a-w_sqrt.$(OBJEXT) lib_a-w_sincos.$(OBJEXT) \ + lib_a-w_cabs.$(OBJEXT) lib_a-w_drem.$(OBJEXT) \ + lib_a-s_asinh.$(OBJEXT) lib_a-s_atan.$(OBJEXT) \ + lib_a-s_ceil.$(OBJEXT) lib_a-s_cos.$(OBJEXT) \ + lib_a-s_erf.$(OBJEXT) lib_a-s_fabs.$(OBJEXT) \ + lib_a-s_floor.$(OBJEXT) lib_a-s_frexp.$(OBJEXT) \ + lib_a-s_ldexp.$(OBJEXT) lib_a-s_signif.$(OBJEXT) \ + lib_a-s_sin.$(OBJEXT) lib_a-s_tan.$(OBJEXT) \ + lib_a-s_tanh.$(OBJEXT) lib_a-w_exp2.$(OBJEXT) \ + lib_a-w_tgamma.$(OBJEXT) +am__objects_2 = lib_a-kf_rem_pio2.$(OBJEXT) lib_a-kf_cos.$(OBJEXT) \ + lib_a-kf_sin.$(OBJEXT) lib_a-kf_tan.$(OBJEXT) \ + lib_a-ef_acos.$(OBJEXT) lib_a-ef_acosh.$(OBJEXT) \ + lib_a-ef_asin.$(OBJEXT) lib_a-ef_atan2.$(OBJEXT) \ + lib_a-ef_atanh.$(OBJEXT) lib_a-ef_cosh.$(OBJEXT) \ + lib_a-ef_exp.$(OBJEXT) lib_a-ef_fmod.$(OBJEXT) \ + lib_a-erf_gamma.$(OBJEXT) lib_a-ef_hypot.$(OBJEXT) \ + lib_a-ef_j0.$(OBJEXT) lib_a-ef_j1.$(OBJEXT) \ + lib_a-ef_jn.$(OBJEXT) lib_a-erf_lgamma.$(OBJEXT) \ + lib_a-ef_log.$(OBJEXT) lib_a-ef_log10.$(OBJEXT) \ + lib_a-ef_pow.$(OBJEXT) lib_a-ef_rem_pio2.$(OBJEXT) \ + lib_a-ef_remainder.$(OBJEXT) lib_a-ef_scalb.$(OBJEXT) \ + lib_a-ef_sinh.$(OBJEXT) lib_a-ef_sqrt.$(OBJEXT) \ + lib_a-wf_acos.$(OBJEXT) lib_a-wf_acosh.$(OBJEXT) \ + lib_a-wf_asin.$(OBJEXT) lib_a-wf_atan2.$(OBJEXT) \ + lib_a-wf_atanh.$(OBJEXT) lib_a-wf_cosh.$(OBJEXT) \ + lib_a-wf_exp.$(OBJEXT) lib_a-wf_fmod.$(OBJEXT) \ + lib_a-wf_gamma.$(OBJEXT) lib_a-wrf_gamma.$(OBJEXT) \ + lib_a-wf_hypot.$(OBJEXT) lib_a-wf_j0.$(OBJEXT) \ + lib_a-wf_j1.$(OBJEXT) lib_a-wf_jn.$(OBJEXT) \ + lib_a-wf_lgamma.$(OBJEXT) lib_a-wrf_lgamma.$(OBJEXT) \ + lib_a-wf_log.$(OBJEXT) lib_a-wf_log10.$(OBJEXT) \ + lib_a-wf_pow.$(OBJEXT) lib_a-wf_remainder.$(OBJEXT) \ + lib_a-wf_scalb.$(OBJEXT) lib_a-wf_sinh.$(OBJEXT) \ + lib_a-wf_sqrt.$(OBJEXT) lib_a-wf_sincos.$(OBJEXT) \ + lib_a-wf_cabs.$(OBJEXT) lib_a-wf_drem.$(OBJEXT) \ + lib_a-sf_asinh.$(OBJEXT) lib_a-sf_atan.$(OBJEXT) \ + lib_a-sf_ceil.$(OBJEXT) lib_a-sf_cos.$(OBJEXT) \ + lib_a-sf_erf.$(OBJEXT) lib_a-sf_fabs.$(OBJEXT) \ + lib_a-sf_floor.$(OBJEXT) lib_a-sf_frexp.$(OBJEXT) \ + lib_a-sf_ldexp.$(OBJEXT) lib_a-sf_signif.$(OBJEXT) \ + lib_a-sf_sin.$(OBJEXT) lib_a-sf_tan.$(OBJEXT) \ + lib_a-sf_tanh.$(OBJEXT) lib_a-wf_exp2.$(OBJEXT) \ + lib_a-wf_tgamma.$(OBJEXT) +@USE_LIBTOOL_FALSE@am_lib_a_OBJECTS = $(am__objects_1) \ +@USE_LIBTOOL_FALSE@ $(am__objects_2) +lib_a_OBJECTS = $(am_lib_a_OBJECTS) +LTLIBRARIES = $(noinst_LTLIBRARIES) +libmath_la_LIBADD = +am__objects_3 = k_standard.lo k_rem_pio2.lo k_cos.lo k_sin.lo k_tan.lo \ + e_acos.lo e_acosh.lo e_asin.lo e_atan2.lo e_atanh.lo e_cosh.lo \ + e_exp.lo e_fmod.lo er_gamma.lo e_hypot.lo e_j0.lo e_j1.lo \ + e_jn.lo er_lgamma.lo e_log.lo e_log10.lo e_pow.lo \ + e_rem_pio2.lo e_remainder.lo e_scalb.lo e_sinh.lo e_sqrt.lo \ + w_acos.lo w_acosh.lo w_asin.lo w_atan2.lo w_atanh.lo w_cosh.lo \ + w_exp.lo w_fmod.lo w_gamma.lo wr_gamma.lo w_hypot.lo w_j0.lo \ + w_j1.lo w_jn.lo w_lgamma.lo wr_lgamma.lo w_log.lo w_log10.lo \ + w_pow.lo w_remainder.lo w_scalb.lo w_sinh.lo w_sqrt.lo \ + w_sincos.lo w_cabs.lo w_drem.lo s_asinh.lo s_atan.lo s_ceil.lo \ + s_cos.lo s_erf.lo s_fabs.lo s_floor.lo s_frexp.lo s_ldexp.lo \ + s_signif.lo s_sin.lo s_tan.lo s_tanh.lo w_exp2.lo w_tgamma.lo +am__objects_4 = kf_rem_pio2.lo kf_cos.lo kf_sin.lo kf_tan.lo \ + ef_acos.lo ef_acosh.lo ef_asin.lo ef_atan2.lo ef_atanh.lo \ + ef_cosh.lo ef_exp.lo ef_fmod.lo erf_gamma.lo ef_hypot.lo \ + ef_j0.lo ef_j1.lo ef_jn.lo erf_lgamma.lo ef_log.lo ef_log10.lo \ + ef_pow.lo ef_rem_pio2.lo ef_remainder.lo ef_scalb.lo \ + ef_sinh.lo ef_sqrt.lo wf_acos.lo wf_acosh.lo wf_asin.lo \ + wf_atan2.lo wf_atanh.lo wf_cosh.lo wf_exp.lo wf_fmod.lo \ + wf_gamma.lo wrf_gamma.lo wf_hypot.lo wf_j0.lo wf_j1.lo \ + wf_jn.lo wf_lgamma.lo wrf_lgamma.lo wf_log.lo wf_log10.lo \ + wf_pow.lo wf_remainder.lo wf_scalb.lo wf_sinh.lo wf_sqrt.lo \ + wf_sincos.lo wf_cabs.lo wf_drem.lo sf_asinh.lo sf_atan.lo \ + sf_ceil.lo sf_cos.lo sf_erf.lo sf_fabs.lo sf_floor.lo \ + sf_frexp.lo sf_ldexp.lo sf_signif.lo sf_sin.lo sf_tan.lo \ + sf_tanh.lo wf_exp2.lo wf_tgamma.lo +@USE_LIBTOOL_TRUE@am_libmath_la_OBJECTS = $(am__objects_3) \ +@USE_LIBTOOL_TRUE@ $(am__objects_4) +libmath_la_OBJECTS = $(am_libmath_la_OBJECTS) +@USE_LIBTOOL_TRUE@am_libmath_la_rpath = +DEFAULT_INCLUDES = -I. -I$(srcdir) +depcomp = +am__depfiles_maybe = +COMPILE = $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) \ + $(CPPFLAGS) $(AM_CFLAGS) $(CFLAGS) +LTCOMPILE = $(LIBTOOL) --tag=CC --mode=compile $(CC) $(DEFS) \ + $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) \ + $(AM_CFLAGS) $(CFLAGS) +CCLD = $(CC) +LINK = $(LIBTOOL) --tag=CC --mode=link $(CCLD) $(AM_CFLAGS) $(CFLAGS) \ + $(AM_LDFLAGS) $(LDFLAGS) -o $@ +SOURCES = $(lib_a_SOURCES) $(libmath_la_SOURCES) +DATA = $(noinst_DATA) +ETAGS = etags +CTAGS = ctags +ACLOCAL = @ACLOCAL@ +AMDEP_FALSE = @AMDEP_FALSE@ +AMDEP_TRUE = @AMDEP_TRUE@ +AMTAR = @AMTAR@ +AR = @AR@ +AS = @AS@ +AUTOCONF = @AUTOCONF@ +AUTOHEADER = @AUTOHEADER@ +AUTOMAKE = @AUTOMAKE@ +AWK = @AWK@ +CC = @CC@ +CCAS = @CCAS@ +CCASFLAGS = @CCASFLAGS@ +CCDEPMODE = @CCDEPMODE@ +CFLAGS = @CFLAGS@ +CPP = @CPP@ +CPPFLAGS = @CPPFLAGS@ +CYGPATH_W = @CYGPATH_W@ +DEFS = @DEFS@ +DEPDIR = @DEPDIR@ +DLLTOOL = @DLLTOOL@ +DSYMUTIL = @DSYMUTIL@ +DUMPBIN = @DUMPBIN@ +ECHO_C = @ECHO_C@ +ECHO_N = @ECHO_N@ +ECHO_T = @ECHO_T@ +EGREP = @EGREP@ +ELIX_LEVEL_0_FALSE = @ELIX_LEVEL_0_FALSE@ +ELIX_LEVEL_0_TRUE = @ELIX_LEVEL_0_TRUE@ +ELIX_LEVEL_1_FALSE = @ELIX_LEVEL_1_FALSE@ +ELIX_LEVEL_1_TRUE = @ELIX_LEVEL_1_TRUE@ +ELIX_LEVEL_2_FALSE = @ELIX_LEVEL_2_FALSE@ +ELIX_LEVEL_2_TRUE = @ELIX_LEVEL_2_TRUE@ +ELIX_LEVEL_3_FALSE = @ELIX_LEVEL_3_FALSE@ +ELIX_LEVEL_3_TRUE = @ELIX_LEVEL_3_TRUE@ +ELIX_LEVEL_4_FALSE = @ELIX_LEVEL_4_FALSE@ +ELIX_LEVEL_4_TRUE = @ELIX_LEVEL_4_TRUE@ +EXEEXT = @EXEEXT@ +FGREP = @FGREP@ +GREP = @GREP@ +INSTALL_DATA = @INSTALL_DATA@ +INSTALL_PROGRAM = @INSTALL_PROGRAM@ +INSTALL_SCRIPT = @INSTALL_SCRIPT@ +INSTALL_STRIP_PROGRAM = @INSTALL_STRIP_PROGRAM@ +LD = @LD@ +LDFLAGS = @LDFLAGS@ +LIBM_MACHINE_LIB = @LIBM_MACHINE_LIB@ +LIBOBJS = @LIBOBJS@ +LIBS = @LIBS@ +LIBTOOL = @LIBTOOL@ +LIPO = @LIPO@ +LN_S = @LN_S@ +LTLIBOBJS = @LTLIBOBJS@ +MAINT = @MAINT@ +MAINTAINER_MODE_FALSE = @MAINTAINER_MODE_FALSE@ +MAINTAINER_MODE_TRUE = @MAINTAINER_MODE_TRUE@ +MAKEINFO = @MAKEINFO@ +MAY_SUPPLY_SYSCALLS_FALSE = @MAY_SUPPLY_SYSCALLS_FALSE@ +MAY_SUPPLY_SYSCALLS_TRUE = @MAY_SUPPLY_SYSCALLS_TRUE@ +NEWLIB_CFLAGS = @NEWLIB_CFLAGS@ +NEWLIB_HW_FP_FALSE = @NEWLIB_HW_FP_FALSE@ +NEWLIB_HW_FP_TRUE = @NEWLIB_HW_FP_TRUE@ +NM = @NM@ +NMEDIT = @NMEDIT@ +OBJDUMP = @OBJDUMP@ +OBJEXT = @OBJEXT@ +OTOOL = @OTOOL@ +OTOOL64 = @OTOOL64@ +PACKAGE = @PACKAGE@ +PACKAGE_BUGREPORT = @PACKAGE_BUGREPORT@ +PACKAGE_NAME = @PACKAGE_NAME@ +PACKAGE_STRING = @PACKAGE_STRING@ +PACKAGE_TARNAME = @PACKAGE_TARNAME@ +PACKAGE_VERSION = @PACKAGE_VERSION@ +PATH_SEPARATOR = @PATH_SEPARATOR@ +RANLIB = @RANLIB@ +READELF = @READELF@ +SED = @SED@ +SET_MAKE = @SET_MAKE@ +SHELL = @SHELL@ +STRIP = @STRIP@ +USE_LIBTOOL_FALSE = @USE_LIBTOOL_FALSE@ +USE_LIBTOOL_TRUE = @USE_LIBTOOL_TRUE@ +VERSION = @VERSION@ +ac_ct_AR = @ac_ct_AR@ +ac_ct_AS = @ac_ct_AS@ +ac_ct_CC = @ac_ct_CC@ +ac_ct_DLLTOOL = @ac_ct_DLLTOOL@ +ac_ct_DSYMUTIL = @ac_ct_DSYMUTIL@ +ac_ct_DUMPBIN = @ac_ct_DUMPBIN@ +ac_ct_LIPO = @ac_ct_LIPO@ +ac_ct_NMEDIT = @ac_ct_NMEDIT@ +ac_ct_OBJDUMP = @ac_ct_OBJDUMP@ +ac_ct_OTOOL = @ac_ct_OTOOL@ +ac_ct_OTOOL64 = @ac_ct_OTOOL64@ +ac_ct_RANLIB = @ac_ct_RANLIB@ +ac_ct_READELF = @ac_ct_READELF@ +ac_ct_STRIP = @ac_ct_STRIP@ +aext = @aext@ +am__fastdepCC_FALSE = @am__fastdepCC_FALSE@ +am__fastdepCC_TRUE = @am__fastdepCC_TRUE@ +am__include = @am__include@ +am__leading_dot = @am__leading_dot@ +am__quote = @am__quote@ +am__tar = @am__tar@ +am__untar = @am__untar@ +bindir = @bindir@ +build = @build@ +build_alias = @build_alias@ +build_cpu = @build_cpu@ +build_os = @build_os@ +build_vendor = @build_vendor@ +datadir = @datadir@ +exec_prefix = @exec_prefix@ +host = @host@ +host_alias = @host_alias@ +host_cpu = @host_cpu@ +host_os = @host_os@ +host_vendor = @host_vendor@ +includedir = @includedir@ +infodir = @infodir@ +install_sh = @install_sh@ +libdir = @libdir@ +libexecdir = @libexecdir@ +libm_machine_dir = @libm_machine_dir@ +localstatedir = @localstatedir@ +lpfx = @lpfx@ +lt_ECHO = @lt_ECHO@ +machine_dir = @machine_dir@ +mandir = @mandir@ +mkdir_p = @mkdir_p@ +newlib_basedir = @newlib_basedir@ +oext = @oext@ +oldincludedir = @oldincludedir@ +prefix = @prefix@ +program_transform_name = @program_transform_name@ +sbindir = @sbindir@ +sharedstatedir = @sharedstatedir@ +subdirs = @subdirs@ +sys_dir = @sys_dir@ +sysconfdir = @sysconfdir@ +target_alias = @target_alias@ +AUTOMAKE_OPTIONS = cygnus +INCLUDES = -I$(srcdir)/../common $(NEWLIB_CFLAGS) $(CROSS_CFLAGS) $(TARGET_CFLAGS) +src = k_standard.c k_rem_pio2.c \ + k_cos.c k_sin.c k_tan.c \ + e_acos.c e_acosh.c e_asin.c e_atan2.c \ + e_atanh.c e_cosh.c e_exp.c e_fmod.c \ + er_gamma.c e_hypot.c e_j0.c \ + e_j1.c e_jn.c er_lgamma.c \ + e_log.c e_log10.c e_pow.c e_rem_pio2.c e_remainder.c \ + e_scalb.c e_sinh.c e_sqrt.c \ + w_acos.c w_acosh.c w_asin.c w_atan2.c \ + w_atanh.c w_cosh.c w_exp.c w_fmod.c \ + w_gamma.c wr_gamma.c w_hypot.c w_j0.c \ + w_j1.c w_jn.c w_lgamma.c wr_lgamma.c \ + w_log.c w_log10.c w_pow.c w_remainder.c \ + w_scalb.c w_sinh.c w_sqrt.c \ + w_sincos.c \ + w_cabs.c w_drem.c \ + s_asinh.c s_atan.c s_ceil.c \ + s_cos.c s_erf.c s_fabs.c s_floor.c \ + s_frexp.c s_ldexp.c \ + s_signif.c s_sin.c \ + s_tan.c s_tanh.c \ + w_exp2.c w_tgamma.c + +fsrc = kf_rem_pio2.c \ + kf_cos.c kf_sin.c kf_tan.c \ + ef_acos.c ef_acosh.c ef_asin.c ef_atan2.c \ + ef_atanh.c ef_cosh.c ef_exp.c ef_fmod.c \ + erf_gamma.c ef_hypot.c ef_j0.c \ + ef_j1.c ef_jn.c erf_lgamma.c \ + ef_log.c ef_log10.c ef_pow.c ef_rem_pio2.c ef_remainder.c \ + ef_scalb.c ef_sinh.c ef_sqrt.c \ + wf_acos.c wf_acosh.c wf_asin.c wf_atan2.c \ + wf_atanh.c wf_cosh.c wf_exp.c wf_fmod.c \ + wf_gamma.c wrf_gamma.c wf_hypot.c wf_j0.c \ + wf_j1.c wf_jn.c wf_lgamma.c wrf_lgamma.c \ + wf_log.c wf_log10.c wf_pow.c wf_remainder.c \ + wf_scalb.c wf_sinh.c wf_sqrt.c \ + wf_sincos.c \ + wf_cabs.c wf_drem.c \ + sf_asinh.c sf_atan.c sf_ceil.c \ + sf_cos.c sf_erf.c sf_fabs.c sf_floor.c \ + sf_frexp.c sf_ldexp.c \ + sf_signif.c sf_sin.c \ + sf_tan.c sf_tanh.c \ + wf_exp2.c wf_tgamma.c + +libmath_la_LDFLAGS = -Xcompiler -nostdlib +@USE_LIBTOOL_TRUE@noinst_LTLIBRARIES = libmath.la +@USE_LIBTOOL_TRUE@libmath_la_SOURCES = $(src) $(fsrc) +@USE_LIBTOOL_FALSE@noinst_DATA = +@USE_LIBTOOL_TRUE@noinst_DATA = objectlist.awk.in +@USE_LIBTOOL_FALSE@noinst_LIBRARIES = lib.a +@USE_LIBTOOL_FALSE@lib_a_SOURCES = $(src) $(fsrc) +@USE_LIBTOOL_FALSE@lib_a_CFLAGS = $(AM_CFLAGS) +chobj = wacos.def wacosh.def wasin.def sasinh.def \ + satan.def watan2.def watanh.def wj0.def \ + wcosh.def serf.def wexp.def \ + sfabs.def sfloor.def wfmod.def sfrexp.def \ + wgamma.def whypot.def sldexp.def wlog.def \ + wlog10.def \ + wpow.def wremainder.def ssin.def wsinh.def \ + wsqrt.def stan.def stanh.def + +SUFFIXES = .def +CHEW = ../../doc/makedoc -f $(srcdir)/../../doc/doc.str +TARGETDOC = ../tmp.texi +CLEANFILES = $(chobj) *.ref +all: all-am + +.SUFFIXES: +.SUFFIXES: .def .c .lo .o .obj +$(srcdir)/Makefile.in: @MAINTAINER_MODE_TRUE@ $(srcdir)/Makefile.am $(srcdir)/../../Makefile.shared $(am__configure_deps) + @for dep in $?; do \ + case '$(am__configure_deps)' in \ + *$$dep*) \ + cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh \ + && exit 0; \ + exit 1;; \ + esac; \ + done; \ + echo ' cd $(top_srcdir) && $(AUTOMAKE) --cygnus math/Makefile'; \ + cd $(top_srcdir) && \ + $(AUTOMAKE) --cygnus math/Makefile +.PRECIOUS: Makefile +Makefile: $(srcdir)/Makefile.in $(top_builddir)/config.status + @case '$?' in \ + *config.status*) \ + cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh;; \ + *) \ + echo ' cd $(top_builddir) && $(SHELL) ./config.status $(subdir)/$@ $(am__depfiles_maybe)'; \ + cd $(top_builddir) && $(SHELL) ./config.status $(subdir)/$@ $(am__depfiles_maybe);; \ + esac; + +$(top_builddir)/config.status: $(top_srcdir)/configure $(CONFIG_STATUS_DEPENDENCIES) + cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh + +$(top_srcdir)/configure: @MAINTAINER_MODE_TRUE@ $(am__configure_deps) + cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh +$(ACLOCAL_M4): @MAINTAINER_MODE_TRUE@ $(am__aclocal_m4_deps) + cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh + +clean-noinstLIBRARIES: + -test -z "$(noinst_LIBRARIES)" || rm -f $(noinst_LIBRARIES) +lib.a: $(lib_a_OBJECTS) $(lib_a_DEPENDENCIES) + -rm -f lib.a + $(lib_a_AR) lib.a $(lib_a_OBJECTS) $(lib_a_LIBADD) + $(RANLIB) lib.a + +clean-noinstLTLIBRARIES: + -test -z "$(noinst_LTLIBRARIES)" || rm -f $(noinst_LTLIBRARIES) + @list='$(noinst_LTLIBRARIES)'; for p in $$list; do \ + dir="`echo $$p | sed -e 's|/[^/]*$$||'`"; \ + test "$$dir" != "$$p" || dir=.; \ + echo "rm -f \"$${dir}/so_locations\""; \ + rm -f "$${dir}/so_locations"; \ + done +libmath.la: $(libmath_la_OBJECTS) $(libmath_la_DEPENDENCIES) + $(LINK) $(am_libmath_la_rpath) $(libmath_la_LDFLAGS) $(libmath_la_OBJECTS) $(libmath_la_LIBADD) $(LIBS) + +mostlyclean-compile: + -rm -f *.$(OBJEXT) + +distclean-compile: + -rm -f *.tab.c + +.c.o: + $(COMPILE) -c $< + +.c.obj: + $(COMPILE) -c `$(CYGPATH_W) '$<'` + +.c.lo: + $(LTCOMPILE) -c -o $@ $< + +lib_a-k_standard.o: k_standard.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-k_standard.o `test -f 'k_standard.c' || echo '$(srcdir)/'`k_standard.c + +lib_a-k_standard.obj: k_standard.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-k_standard.obj `if test -f 'k_standard.c'; then $(CYGPATH_W) 'k_standard.c'; else $(CYGPATH_W) '$(srcdir)/k_standard.c'; fi` + +lib_a-k_rem_pio2.o: k_rem_pio2.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-k_rem_pio2.o `test -f 'k_rem_pio2.c' || echo '$(srcdir)/'`k_rem_pio2.c + +lib_a-k_rem_pio2.obj: k_rem_pio2.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-k_rem_pio2.obj `if test -f 'k_rem_pio2.c'; then $(CYGPATH_W) 'k_rem_pio2.c'; else $(CYGPATH_W) '$(srcdir)/k_rem_pio2.c'; fi` + +lib_a-k_cos.o: k_cos.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-k_cos.o `test -f 'k_cos.c' || echo '$(srcdir)/'`k_cos.c + +lib_a-k_cos.obj: k_cos.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-k_cos.obj `if test -f 'k_cos.c'; then $(CYGPATH_W) 'k_cos.c'; else $(CYGPATH_W) '$(srcdir)/k_cos.c'; fi` + +lib_a-k_sin.o: k_sin.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-k_sin.o `test -f 'k_sin.c' || echo '$(srcdir)/'`k_sin.c + +lib_a-k_sin.obj: k_sin.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-k_sin.obj `if test -f 'k_sin.c'; then $(CYGPATH_W) 'k_sin.c'; else $(CYGPATH_W) '$(srcdir)/k_sin.c'; fi` + +lib_a-k_tan.o: k_tan.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-k_tan.o `test -f 'k_tan.c' || echo '$(srcdir)/'`k_tan.c + +lib_a-k_tan.obj: k_tan.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-k_tan.obj `if test -f 'k_tan.c'; then $(CYGPATH_W) 'k_tan.c'; else $(CYGPATH_W) '$(srcdir)/k_tan.c'; fi` + +lib_a-e_acos.o: e_acos.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-e_acos.o `test -f 'e_acos.c' || echo '$(srcdir)/'`e_acos.c + +lib_a-e_acos.obj: e_acos.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-e_acos.obj `if test -f 'e_acos.c'; then $(CYGPATH_W) 'e_acos.c'; else $(CYGPATH_W) '$(srcdir)/e_acos.c'; fi` + +lib_a-e_acosh.o: e_acosh.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-e_acosh.o `test -f 'e_acosh.c' || echo '$(srcdir)/'`e_acosh.c + +lib_a-e_acosh.obj: e_acosh.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-e_acosh.obj `if test -f 'e_acosh.c'; then $(CYGPATH_W) 'e_acosh.c'; else $(CYGPATH_W) '$(srcdir)/e_acosh.c'; fi` + +lib_a-e_asin.o: e_asin.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-e_asin.o `test -f 'e_asin.c' || echo '$(srcdir)/'`e_asin.c + +lib_a-e_asin.obj: e_asin.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-e_asin.obj `if test -f 'e_asin.c'; then $(CYGPATH_W) 'e_asin.c'; else $(CYGPATH_W) '$(srcdir)/e_asin.c'; fi` + +lib_a-e_atan2.o: e_atan2.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-e_atan2.o `test -f 'e_atan2.c' || echo '$(srcdir)/'`e_atan2.c + +lib_a-e_atan2.obj: e_atan2.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-e_atan2.obj `if test -f 'e_atan2.c'; then $(CYGPATH_W) 'e_atan2.c'; else $(CYGPATH_W) '$(srcdir)/e_atan2.c'; fi` + +lib_a-e_atanh.o: e_atanh.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-e_atanh.o `test -f 'e_atanh.c' || echo '$(srcdir)/'`e_atanh.c + +lib_a-e_atanh.obj: e_atanh.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-e_atanh.obj `if test -f 'e_atanh.c'; then $(CYGPATH_W) 'e_atanh.c'; else $(CYGPATH_W) '$(srcdir)/e_atanh.c'; fi` + +lib_a-e_cosh.o: e_cosh.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-e_cosh.o `test -f 'e_cosh.c' || echo '$(srcdir)/'`e_cosh.c + +lib_a-e_cosh.obj: e_cosh.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-e_cosh.obj `if test -f 'e_cosh.c'; then $(CYGPATH_W) 'e_cosh.c'; else $(CYGPATH_W) '$(srcdir)/e_cosh.c'; fi` + +lib_a-e_exp.o: e_exp.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-e_exp.o `test -f 'e_exp.c' || echo '$(srcdir)/'`e_exp.c + +lib_a-e_exp.obj: e_exp.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-e_exp.obj `if test -f 'e_exp.c'; then $(CYGPATH_W) 'e_exp.c'; else $(CYGPATH_W) '$(srcdir)/e_exp.c'; fi` + +lib_a-e_fmod.o: e_fmod.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-e_fmod.o `test -f 'e_fmod.c' || echo '$(srcdir)/'`e_fmod.c + +lib_a-e_fmod.obj: e_fmod.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-e_fmod.obj `if test -f 'e_fmod.c'; then $(CYGPATH_W) 'e_fmod.c'; else $(CYGPATH_W) '$(srcdir)/e_fmod.c'; fi` + +lib_a-er_gamma.o: er_gamma.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-er_gamma.o `test -f 'er_gamma.c' || echo '$(srcdir)/'`er_gamma.c + +lib_a-er_gamma.obj: er_gamma.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-er_gamma.obj `if test -f 'er_gamma.c'; then $(CYGPATH_W) 'er_gamma.c'; else $(CYGPATH_W) '$(srcdir)/er_gamma.c'; fi` + +lib_a-e_hypot.o: e_hypot.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-e_hypot.o `test -f 'e_hypot.c' || echo '$(srcdir)/'`e_hypot.c + +lib_a-e_hypot.obj: e_hypot.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-e_hypot.obj `if test -f 'e_hypot.c'; then $(CYGPATH_W) 'e_hypot.c'; else $(CYGPATH_W) '$(srcdir)/e_hypot.c'; fi` + +lib_a-e_j0.o: e_j0.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-e_j0.o `test -f 'e_j0.c' || echo '$(srcdir)/'`e_j0.c + +lib_a-e_j0.obj: e_j0.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-e_j0.obj `if test -f 'e_j0.c'; then $(CYGPATH_W) 'e_j0.c'; else $(CYGPATH_W) '$(srcdir)/e_j0.c'; fi` + +lib_a-e_j1.o: e_j1.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-e_j1.o `test -f 'e_j1.c' || echo '$(srcdir)/'`e_j1.c + +lib_a-e_j1.obj: e_j1.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-e_j1.obj `if test -f 'e_j1.c'; then $(CYGPATH_W) 'e_j1.c'; else $(CYGPATH_W) '$(srcdir)/e_j1.c'; fi` + +lib_a-e_jn.o: e_jn.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-e_jn.o `test -f 'e_jn.c' || echo '$(srcdir)/'`e_jn.c + +lib_a-e_jn.obj: e_jn.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-e_jn.obj `if test -f 'e_jn.c'; then $(CYGPATH_W) 'e_jn.c'; else $(CYGPATH_W) '$(srcdir)/e_jn.c'; fi` + +lib_a-er_lgamma.o: er_lgamma.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-er_lgamma.o `test -f 'er_lgamma.c' || echo '$(srcdir)/'`er_lgamma.c + +lib_a-er_lgamma.obj: er_lgamma.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-er_lgamma.obj `if test -f 'er_lgamma.c'; then $(CYGPATH_W) 'er_lgamma.c'; else $(CYGPATH_W) '$(srcdir)/er_lgamma.c'; fi` + +lib_a-e_log.o: e_log.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-e_log.o `test -f 'e_log.c' || echo '$(srcdir)/'`e_log.c + +lib_a-e_log.obj: e_log.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-e_log.obj `if test -f 'e_log.c'; then $(CYGPATH_W) 'e_log.c'; else $(CYGPATH_W) '$(srcdir)/e_log.c'; fi` + +lib_a-e_log10.o: e_log10.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-e_log10.o `test -f 'e_log10.c' || echo '$(srcdir)/'`e_log10.c + +lib_a-e_log10.obj: e_log10.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-e_log10.obj `if test -f 'e_log10.c'; then $(CYGPATH_W) 'e_log10.c'; else $(CYGPATH_W) '$(srcdir)/e_log10.c'; fi` + +lib_a-e_pow.o: e_pow.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-e_pow.o `test -f 'e_pow.c' || echo '$(srcdir)/'`e_pow.c + +lib_a-e_pow.obj: e_pow.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-e_pow.obj `if test -f 'e_pow.c'; then $(CYGPATH_W) 'e_pow.c'; else $(CYGPATH_W) '$(srcdir)/e_pow.c'; fi` + +lib_a-e_rem_pio2.o: e_rem_pio2.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-e_rem_pio2.o `test -f 'e_rem_pio2.c' || echo '$(srcdir)/'`e_rem_pio2.c + +lib_a-e_rem_pio2.obj: e_rem_pio2.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-e_rem_pio2.obj `if test -f 'e_rem_pio2.c'; then $(CYGPATH_W) 'e_rem_pio2.c'; else $(CYGPATH_W) '$(srcdir)/e_rem_pio2.c'; fi` + +lib_a-e_remainder.o: e_remainder.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-e_remainder.o `test -f 'e_remainder.c' || echo '$(srcdir)/'`e_remainder.c + +lib_a-e_remainder.obj: e_remainder.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-e_remainder.obj `if test -f 'e_remainder.c'; then $(CYGPATH_W) 'e_remainder.c'; else $(CYGPATH_W) '$(srcdir)/e_remainder.c'; fi` + +lib_a-e_scalb.o: e_scalb.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-e_scalb.o `test -f 'e_scalb.c' || echo '$(srcdir)/'`e_scalb.c + +lib_a-e_scalb.obj: e_scalb.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-e_scalb.obj `if test -f 'e_scalb.c'; then $(CYGPATH_W) 'e_scalb.c'; else $(CYGPATH_W) '$(srcdir)/e_scalb.c'; fi` + +lib_a-e_sinh.o: e_sinh.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-e_sinh.o `test -f 'e_sinh.c' || echo '$(srcdir)/'`e_sinh.c + +lib_a-e_sinh.obj: e_sinh.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-e_sinh.obj `if test -f 'e_sinh.c'; then $(CYGPATH_W) 'e_sinh.c'; else $(CYGPATH_W) '$(srcdir)/e_sinh.c'; fi` + +lib_a-e_sqrt.o: e_sqrt.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-e_sqrt.o `test -f 'e_sqrt.c' || echo '$(srcdir)/'`e_sqrt.c + +lib_a-e_sqrt.obj: e_sqrt.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-e_sqrt.obj `if test -f 'e_sqrt.c'; then $(CYGPATH_W) 'e_sqrt.c'; else $(CYGPATH_W) '$(srcdir)/e_sqrt.c'; fi` + +lib_a-w_acos.o: w_acos.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-w_acos.o `test -f 'w_acos.c' || echo '$(srcdir)/'`w_acos.c + +lib_a-w_acos.obj: w_acos.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-w_acos.obj `if test -f 'w_acos.c'; then $(CYGPATH_W) 'w_acos.c'; else $(CYGPATH_W) '$(srcdir)/w_acos.c'; fi` + +lib_a-w_acosh.o: w_acosh.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-w_acosh.o `test -f 'w_acosh.c' || echo '$(srcdir)/'`w_acosh.c + +lib_a-w_acosh.obj: w_acosh.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-w_acosh.obj `if test -f 'w_acosh.c'; then $(CYGPATH_W) 'w_acosh.c'; else $(CYGPATH_W) '$(srcdir)/w_acosh.c'; fi` + +lib_a-w_asin.o: w_asin.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-w_asin.o `test -f 'w_asin.c' || echo '$(srcdir)/'`w_asin.c + +lib_a-w_asin.obj: w_asin.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-w_asin.obj `if test -f 'w_asin.c'; then $(CYGPATH_W) 'w_asin.c'; else $(CYGPATH_W) '$(srcdir)/w_asin.c'; fi` + +lib_a-w_atan2.o: w_atan2.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-w_atan2.o `test -f 'w_atan2.c' || echo '$(srcdir)/'`w_atan2.c + +lib_a-w_atan2.obj: w_atan2.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-w_atan2.obj `if test -f 'w_atan2.c'; then $(CYGPATH_W) 'w_atan2.c'; else $(CYGPATH_W) '$(srcdir)/w_atan2.c'; fi` + +lib_a-w_atanh.o: w_atanh.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-w_atanh.o `test -f 'w_atanh.c' || echo '$(srcdir)/'`w_atanh.c + +lib_a-w_atanh.obj: w_atanh.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-w_atanh.obj `if test -f 'w_atanh.c'; then $(CYGPATH_W) 'w_atanh.c'; else $(CYGPATH_W) '$(srcdir)/w_atanh.c'; fi` + +lib_a-w_cosh.o: w_cosh.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-w_cosh.o `test -f 'w_cosh.c' || echo '$(srcdir)/'`w_cosh.c + +lib_a-w_cosh.obj: w_cosh.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-w_cosh.obj `if test -f 'w_cosh.c'; then $(CYGPATH_W) 'w_cosh.c'; else $(CYGPATH_W) '$(srcdir)/w_cosh.c'; fi` + +lib_a-w_exp.o: w_exp.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-w_exp.o `test -f 'w_exp.c' || echo '$(srcdir)/'`w_exp.c + +lib_a-w_exp.obj: w_exp.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-w_exp.obj `if test -f 'w_exp.c'; then $(CYGPATH_W) 'w_exp.c'; else $(CYGPATH_W) '$(srcdir)/w_exp.c'; fi` + +lib_a-w_fmod.o: w_fmod.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-w_fmod.o `test -f 'w_fmod.c' || echo '$(srcdir)/'`w_fmod.c + +lib_a-w_fmod.obj: w_fmod.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-w_fmod.obj `if test -f 'w_fmod.c'; then $(CYGPATH_W) 'w_fmod.c'; else $(CYGPATH_W) '$(srcdir)/w_fmod.c'; fi` + +lib_a-w_gamma.o: w_gamma.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-w_gamma.o `test -f 'w_gamma.c' || echo '$(srcdir)/'`w_gamma.c + +lib_a-w_gamma.obj: w_gamma.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-w_gamma.obj `if test -f 'w_gamma.c'; then $(CYGPATH_W) 'w_gamma.c'; else $(CYGPATH_W) '$(srcdir)/w_gamma.c'; fi` + +lib_a-wr_gamma.o: wr_gamma.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-wr_gamma.o `test -f 'wr_gamma.c' || echo '$(srcdir)/'`wr_gamma.c + +lib_a-wr_gamma.obj: wr_gamma.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-wr_gamma.obj `if test -f 'wr_gamma.c'; then $(CYGPATH_W) 'wr_gamma.c'; else $(CYGPATH_W) '$(srcdir)/wr_gamma.c'; fi` + +lib_a-w_hypot.o: w_hypot.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-w_hypot.o `test -f 'w_hypot.c' || echo '$(srcdir)/'`w_hypot.c + +lib_a-w_hypot.obj: w_hypot.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-w_hypot.obj `if test -f 'w_hypot.c'; then $(CYGPATH_W) 'w_hypot.c'; else $(CYGPATH_W) '$(srcdir)/w_hypot.c'; fi` + +lib_a-w_j0.o: w_j0.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-w_j0.o `test -f 'w_j0.c' || echo '$(srcdir)/'`w_j0.c + +lib_a-w_j0.obj: w_j0.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-w_j0.obj `if test -f 'w_j0.c'; then $(CYGPATH_W) 'w_j0.c'; else $(CYGPATH_W) '$(srcdir)/w_j0.c'; fi` + +lib_a-w_j1.o: w_j1.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-w_j1.o `test -f 'w_j1.c' || echo '$(srcdir)/'`w_j1.c + +lib_a-w_j1.obj: w_j1.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-w_j1.obj `if test -f 'w_j1.c'; then $(CYGPATH_W) 'w_j1.c'; else $(CYGPATH_W) '$(srcdir)/w_j1.c'; fi` + +lib_a-w_jn.o: w_jn.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-w_jn.o `test -f 'w_jn.c' || echo '$(srcdir)/'`w_jn.c + +lib_a-w_jn.obj: w_jn.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-w_jn.obj `if test -f 'w_jn.c'; then $(CYGPATH_W) 'w_jn.c'; else $(CYGPATH_W) '$(srcdir)/w_jn.c'; fi` + +lib_a-w_lgamma.o: w_lgamma.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-w_lgamma.o `test -f 'w_lgamma.c' || echo '$(srcdir)/'`w_lgamma.c + +lib_a-w_lgamma.obj: w_lgamma.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-w_lgamma.obj `if test -f 'w_lgamma.c'; then $(CYGPATH_W) 'w_lgamma.c'; else $(CYGPATH_W) '$(srcdir)/w_lgamma.c'; fi` + +lib_a-wr_lgamma.o: wr_lgamma.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-wr_lgamma.o `test -f 'wr_lgamma.c' || echo '$(srcdir)/'`wr_lgamma.c + +lib_a-wr_lgamma.obj: wr_lgamma.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-wr_lgamma.obj `if test -f 'wr_lgamma.c'; then $(CYGPATH_W) 'wr_lgamma.c'; else $(CYGPATH_W) '$(srcdir)/wr_lgamma.c'; fi` + +lib_a-w_log.o: w_log.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-w_log.o `test -f 'w_log.c' || echo '$(srcdir)/'`w_log.c + +lib_a-w_log.obj: w_log.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-w_log.obj `if test -f 'w_log.c'; then $(CYGPATH_W) 'w_log.c'; else $(CYGPATH_W) '$(srcdir)/w_log.c'; fi` + +lib_a-w_log10.o: w_log10.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-w_log10.o `test -f 'w_log10.c' || echo '$(srcdir)/'`w_log10.c + +lib_a-w_log10.obj: w_log10.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-w_log10.obj `if test -f 'w_log10.c'; then $(CYGPATH_W) 'w_log10.c'; else $(CYGPATH_W) '$(srcdir)/w_log10.c'; fi` + +lib_a-w_pow.o: w_pow.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-w_pow.o `test -f 'w_pow.c' || echo '$(srcdir)/'`w_pow.c + +lib_a-w_pow.obj: w_pow.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-w_pow.obj `if test -f 'w_pow.c'; then $(CYGPATH_W) 'w_pow.c'; else $(CYGPATH_W) '$(srcdir)/w_pow.c'; fi` + +lib_a-w_remainder.o: w_remainder.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-w_remainder.o `test -f 'w_remainder.c' || echo '$(srcdir)/'`w_remainder.c + +lib_a-w_remainder.obj: w_remainder.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-w_remainder.obj `if test -f 'w_remainder.c'; then $(CYGPATH_W) 'w_remainder.c'; else $(CYGPATH_W) '$(srcdir)/w_remainder.c'; fi` + +lib_a-w_scalb.o: w_scalb.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-w_scalb.o `test -f 'w_scalb.c' || echo '$(srcdir)/'`w_scalb.c + +lib_a-w_scalb.obj: w_scalb.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-w_scalb.obj `if test -f 'w_scalb.c'; then $(CYGPATH_W) 'w_scalb.c'; else $(CYGPATH_W) '$(srcdir)/w_scalb.c'; fi` + +lib_a-w_sinh.o: w_sinh.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-w_sinh.o `test -f 'w_sinh.c' || echo '$(srcdir)/'`w_sinh.c + +lib_a-w_sinh.obj: w_sinh.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-w_sinh.obj `if test -f 'w_sinh.c'; then $(CYGPATH_W) 'w_sinh.c'; else $(CYGPATH_W) '$(srcdir)/w_sinh.c'; fi` + +lib_a-w_sqrt.o: w_sqrt.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-w_sqrt.o `test -f 'w_sqrt.c' || echo '$(srcdir)/'`w_sqrt.c + +lib_a-w_sqrt.obj: w_sqrt.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-w_sqrt.obj `if test -f 'w_sqrt.c'; then $(CYGPATH_W) 'w_sqrt.c'; else $(CYGPATH_W) '$(srcdir)/w_sqrt.c'; fi` + +lib_a-w_sincos.o: w_sincos.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-w_sincos.o `test -f 'w_sincos.c' || echo '$(srcdir)/'`w_sincos.c + +lib_a-w_sincos.obj: w_sincos.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-w_sincos.obj `if test -f 'w_sincos.c'; then $(CYGPATH_W) 'w_sincos.c'; else $(CYGPATH_W) '$(srcdir)/w_sincos.c'; fi` + +lib_a-w_cabs.o: w_cabs.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-w_cabs.o `test -f 'w_cabs.c' || echo '$(srcdir)/'`w_cabs.c + +lib_a-w_cabs.obj: w_cabs.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-w_cabs.obj `if test -f 'w_cabs.c'; then $(CYGPATH_W) 'w_cabs.c'; else $(CYGPATH_W) '$(srcdir)/w_cabs.c'; fi` + +lib_a-w_drem.o: w_drem.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-w_drem.o `test -f 'w_drem.c' || echo '$(srcdir)/'`w_drem.c + +lib_a-w_drem.obj: w_drem.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-w_drem.obj `if test -f 'w_drem.c'; then $(CYGPATH_W) 'w_drem.c'; else $(CYGPATH_W) '$(srcdir)/w_drem.c'; fi` + +lib_a-s_asinh.o: s_asinh.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-s_asinh.o `test -f 's_asinh.c' || echo '$(srcdir)/'`s_asinh.c + +lib_a-s_asinh.obj: s_asinh.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-s_asinh.obj `if test -f 's_asinh.c'; then $(CYGPATH_W) 's_asinh.c'; else $(CYGPATH_W) '$(srcdir)/s_asinh.c'; fi` + +lib_a-s_atan.o: s_atan.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-s_atan.o `test -f 's_atan.c' || echo '$(srcdir)/'`s_atan.c + +lib_a-s_atan.obj: s_atan.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-s_atan.obj `if test -f 's_atan.c'; then $(CYGPATH_W) 's_atan.c'; else $(CYGPATH_W) '$(srcdir)/s_atan.c'; fi` + +lib_a-s_ceil.o: s_ceil.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-s_ceil.o `test -f 's_ceil.c' || echo '$(srcdir)/'`s_ceil.c + +lib_a-s_ceil.obj: s_ceil.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-s_ceil.obj `if test -f 's_ceil.c'; then $(CYGPATH_W) 's_ceil.c'; else $(CYGPATH_W) '$(srcdir)/s_ceil.c'; fi` + +lib_a-s_cos.o: s_cos.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-s_cos.o `test -f 's_cos.c' || echo '$(srcdir)/'`s_cos.c + +lib_a-s_cos.obj: s_cos.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-s_cos.obj `if test -f 's_cos.c'; then $(CYGPATH_W) 's_cos.c'; else $(CYGPATH_W) '$(srcdir)/s_cos.c'; fi` + +lib_a-s_erf.o: s_erf.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-s_erf.o `test -f 's_erf.c' || echo '$(srcdir)/'`s_erf.c + +lib_a-s_erf.obj: s_erf.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-s_erf.obj `if test -f 's_erf.c'; then $(CYGPATH_W) 's_erf.c'; else $(CYGPATH_W) '$(srcdir)/s_erf.c'; fi` + +lib_a-s_fabs.o: s_fabs.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-s_fabs.o `test -f 's_fabs.c' || echo '$(srcdir)/'`s_fabs.c + +lib_a-s_fabs.obj: s_fabs.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-s_fabs.obj `if test -f 's_fabs.c'; then $(CYGPATH_W) 's_fabs.c'; else $(CYGPATH_W) '$(srcdir)/s_fabs.c'; fi` + +lib_a-s_floor.o: s_floor.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-s_floor.o `test -f 's_floor.c' || echo '$(srcdir)/'`s_floor.c + +lib_a-s_floor.obj: s_floor.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-s_floor.obj `if test -f 's_floor.c'; then $(CYGPATH_W) 's_floor.c'; else $(CYGPATH_W) '$(srcdir)/s_floor.c'; fi` + +lib_a-s_frexp.o: s_frexp.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-s_frexp.o `test -f 's_frexp.c' || echo '$(srcdir)/'`s_frexp.c + +lib_a-s_frexp.obj: s_frexp.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-s_frexp.obj `if test -f 's_frexp.c'; then $(CYGPATH_W) 's_frexp.c'; else $(CYGPATH_W) '$(srcdir)/s_frexp.c'; fi` + +lib_a-s_ldexp.o: s_ldexp.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-s_ldexp.o `test -f 's_ldexp.c' || echo '$(srcdir)/'`s_ldexp.c + +lib_a-s_ldexp.obj: s_ldexp.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-s_ldexp.obj `if test -f 's_ldexp.c'; then $(CYGPATH_W) 's_ldexp.c'; else $(CYGPATH_W) '$(srcdir)/s_ldexp.c'; fi` + +lib_a-s_signif.o: s_signif.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-s_signif.o `test -f 's_signif.c' || echo '$(srcdir)/'`s_signif.c + +lib_a-s_signif.obj: s_signif.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-s_signif.obj `if test -f 's_signif.c'; then $(CYGPATH_W) 's_signif.c'; else $(CYGPATH_W) '$(srcdir)/s_signif.c'; fi` + +lib_a-s_sin.o: s_sin.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-s_sin.o `test -f 's_sin.c' || echo '$(srcdir)/'`s_sin.c + +lib_a-s_sin.obj: s_sin.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-s_sin.obj `if test -f 's_sin.c'; then $(CYGPATH_W) 's_sin.c'; else $(CYGPATH_W) '$(srcdir)/s_sin.c'; fi` + +lib_a-s_tan.o: s_tan.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-s_tan.o `test -f 's_tan.c' || echo '$(srcdir)/'`s_tan.c + +lib_a-s_tan.obj: s_tan.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-s_tan.obj `if test -f 's_tan.c'; then $(CYGPATH_W) 's_tan.c'; else $(CYGPATH_W) '$(srcdir)/s_tan.c'; fi` + +lib_a-s_tanh.o: s_tanh.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-s_tanh.o `test -f 's_tanh.c' || echo '$(srcdir)/'`s_tanh.c + +lib_a-s_tanh.obj: s_tanh.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-s_tanh.obj `if test -f 's_tanh.c'; then $(CYGPATH_W) 's_tanh.c'; else $(CYGPATH_W) '$(srcdir)/s_tanh.c'; fi` + +lib_a-w_exp2.o: w_exp2.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-w_exp2.o `test -f 'w_exp2.c' || echo '$(srcdir)/'`w_exp2.c + +lib_a-w_exp2.obj: w_exp2.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-w_exp2.obj `if test -f 'w_exp2.c'; then $(CYGPATH_W) 'w_exp2.c'; else $(CYGPATH_W) '$(srcdir)/w_exp2.c'; fi` + +lib_a-w_tgamma.o: w_tgamma.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-w_tgamma.o `test -f 'w_tgamma.c' || echo '$(srcdir)/'`w_tgamma.c + +lib_a-w_tgamma.obj: w_tgamma.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-w_tgamma.obj `if test -f 'w_tgamma.c'; then $(CYGPATH_W) 'w_tgamma.c'; else $(CYGPATH_W) '$(srcdir)/w_tgamma.c'; fi` + +lib_a-kf_rem_pio2.o: kf_rem_pio2.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-kf_rem_pio2.o `test -f 'kf_rem_pio2.c' || echo '$(srcdir)/'`kf_rem_pio2.c + +lib_a-kf_rem_pio2.obj: kf_rem_pio2.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-kf_rem_pio2.obj `if test -f 'kf_rem_pio2.c'; then $(CYGPATH_W) 'kf_rem_pio2.c'; else $(CYGPATH_W) '$(srcdir)/kf_rem_pio2.c'; fi` + +lib_a-kf_cos.o: kf_cos.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-kf_cos.o `test -f 'kf_cos.c' || echo '$(srcdir)/'`kf_cos.c + +lib_a-kf_cos.obj: kf_cos.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-kf_cos.obj `if test -f 'kf_cos.c'; then $(CYGPATH_W) 'kf_cos.c'; else $(CYGPATH_W) '$(srcdir)/kf_cos.c'; fi` + +lib_a-kf_sin.o: kf_sin.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-kf_sin.o `test -f 'kf_sin.c' || echo '$(srcdir)/'`kf_sin.c + +lib_a-kf_sin.obj: kf_sin.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-kf_sin.obj `if test -f 'kf_sin.c'; then $(CYGPATH_W) 'kf_sin.c'; else $(CYGPATH_W) '$(srcdir)/kf_sin.c'; fi` + +lib_a-kf_tan.o: kf_tan.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-kf_tan.o `test -f 'kf_tan.c' || echo '$(srcdir)/'`kf_tan.c + +lib_a-kf_tan.obj: kf_tan.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-kf_tan.obj `if test -f 'kf_tan.c'; then $(CYGPATH_W) 'kf_tan.c'; else $(CYGPATH_W) '$(srcdir)/kf_tan.c'; fi` + +lib_a-ef_acos.o: ef_acos.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-ef_acos.o `test -f 'ef_acos.c' || echo '$(srcdir)/'`ef_acos.c + +lib_a-ef_acos.obj: ef_acos.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-ef_acos.obj `if test -f 'ef_acos.c'; then $(CYGPATH_W) 'ef_acos.c'; else $(CYGPATH_W) '$(srcdir)/ef_acos.c'; fi` + +lib_a-ef_acosh.o: ef_acosh.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-ef_acosh.o `test -f 'ef_acosh.c' || echo '$(srcdir)/'`ef_acosh.c + +lib_a-ef_acosh.obj: ef_acosh.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-ef_acosh.obj `if test -f 'ef_acosh.c'; then $(CYGPATH_W) 'ef_acosh.c'; else $(CYGPATH_W) '$(srcdir)/ef_acosh.c'; fi` + +lib_a-ef_asin.o: ef_asin.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-ef_asin.o `test -f 'ef_asin.c' || echo '$(srcdir)/'`ef_asin.c + +lib_a-ef_asin.obj: ef_asin.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-ef_asin.obj `if test -f 'ef_asin.c'; then $(CYGPATH_W) 'ef_asin.c'; else $(CYGPATH_W) '$(srcdir)/ef_asin.c'; fi` + +lib_a-ef_atan2.o: ef_atan2.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-ef_atan2.o `test -f 'ef_atan2.c' || echo '$(srcdir)/'`ef_atan2.c + +lib_a-ef_atan2.obj: ef_atan2.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-ef_atan2.obj `if test -f 'ef_atan2.c'; then $(CYGPATH_W) 'ef_atan2.c'; else $(CYGPATH_W) '$(srcdir)/ef_atan2.c'; fi` + +lib_a-ef_atanh.o: ef_atanh.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-ef_atanh.o `test -f 'ef_atanh.c' || echo '$(srcdir)/'`ef_atanh.c + +lib_a-ef_atanh.obj: ef_atanh.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-ef_atanh.obj `if test -f 'ef_atanh.c'; then $(CYGPATH_W) 'ef_atanh.c'; else $(CYGPATH_W) '$(srcdir)/ef_atanh.c'; fi` + +lib_a-ef_cosh.o: ef_cosh.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-ef_cosh.o `test -f 'ef_cosh.c' || echo '$(srcdir)/'`ef_cosh.c + +lib_a-ef_cosh.obj: ef_cosh.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-ef_cosh.obj `if test -f 'ef_cosh.c'; then $(CYGPATH_W) 'ef_cosh.c'; else $(CYGPATH_W) '$(srcdir)/ef_cosh.c'; fi` + +lib_a-ef_exp.o: ef_exp.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-ef_exp.o `test -f 'ef_exp.c' || echo '$(srcdir)/'`ef_exp.c + +lib_a-ef_exp.obj: ef_exp.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-ef_exp.obj `if test -f 'ef_exp.c'; then $(CYGPATH_W) 'ef_exp.c'; else $(CYGPATH_W) '$(srcdir)/ef_exp.c'; fi` + +lib_a-ef_fmod.o: ef_fmod.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-ef_fmod.o `test -f 'ef_fmod.c' || echo '$(srcdir)/'`ef_fmod.c + +lib_a-ef_fmod.obj: ef_fmod.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-ef_fmod.obj `if test -f 'ef_fmod.c'; then $(CYGPATH_W) 'ef_fmod.c'; else $(CYGPATH_W) '$(srcdir)/ef_fmod.c'; fi` + +lib_a-erf_gamma.o: erf_gamma.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-erf_gamma.o `test -f 'erf_gamma.c' || echo '$(srcdir)/'`erf_gamma.c + +lib_a-erf_gamma.obj: erf_gamma.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-erf_gamma.obj `if test -f 'erf_gamma.c'; then $(CYGPATH_W) 'erf_gamma.c'; else $(CYGPATH_W) '$(srcdir)/erf_gamma.c'; fi` + +lib_a-ef_hypot.o: ef_hypot.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-ef_hypot.o `test -f 'ef_hypot.c' || echo '$(srcdir)/'`ef_hypot.c + +lib_a-ef_hypot.obj: ef_hypot.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-ef_hypot.obj `if test -f 'ef_hypot.c'; then $(CYGPATH_W) 'ef_hypot.c'; else $(CYGPATH_W) '$(srcdir)/ef_hypot.c'; fi` + +lib_a-ef_j0.o: ef_j0.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-ef_j0.o `test -f 'ef_j0.c' || echo '$(srcdir)/'`ef_j0.c + +lib_a-ef_j0.obj: ef_j0.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-ef_j0.obj `if test -f 'ef_j0.c'; then $(CYGPATH_W) 'ef_j0.c'; else $(CYGPATH_W) '$(srcdir)/ef_j0.c'; fi` + +lib_a-ef_j1.o: ef_j1.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-ef_j1.o `test -f 'ef_j1.c' || echo '$(srcdir)/'`ef_j1.c + +lib_a-ef_j1.obj: ef_j1.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-ef_j1.obj `if test -f 'ef_j1.c'; then $(CYGPATH_W) 'ef_j1.c'; else $(CYGPATH_W) '$(srcdir)/ef_j1.c'; fi` + +lib_a-ef_jn.o: ef_jn.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-ef_jn.o `test -f 'ef_jn.c' || echo '$(srcdir)/'`ef_jn.c + +lib_a-ef_jn.obj: ef_jn.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-ef_jn.obj `if test -f 'ef_jn.c'; then $(CYGPATH_W) 'ef_jn.c'; else $(CYGPATH_W) '$(srcdir)/ef_jn.c'; fi` + +lib_a-erf_lgamma.o: erf_lgamma.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-erf_lgamma.o `test -f 'erf_lgamma.c' || echo '$(srcdir)/'`erf_lgamma.c + +lib_a-erf_lgamma.obj: erf_lgamma.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-erf_lgamma.obj `if test -f 'erf_lgamma.c'; then $(CYGPATH_W) 'erf_lgamma.c'; else $(CYGPATH_W) '$(srcdir)/erf_lgamma.c'; fi` + +lib_a-ef_log.o: ef_log.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-ef_log.o `test -f 'ef_log.c' || echo '$(srcdir)/'`ef_log.c + +lib_a-ef_log.obj: ef_log.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-ef_log.obj `if test -f 'ef_log.c'; then $(CYGPATH_W) 'ef_log.c'; else $(CYGPATH_W) '$(srcdir)/ef_log.c'; fi` + +lib_a-ef_log10.o: ef_log10.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-ef_log10.o `test -f 'ef_log10.c' || echo '$(srcdir)/'`ef_log10.c + +lib_a-ef_log10.obj: ef_log10.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-ef_log10.obj `if test -f 'ef_log10.c'; then $(CYGPATH_W) 'ef_log10.c'; else $(CYGPATH_W) '$(srcdir)/ef_log10.c'; fi` + +lib_a-ef_pow.o: ef_pow.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-ef_pow.o `test -f 'ef_pow.c' || echo '$(srcdir)/'`ef_pow.c + +lib_a-ef_pow.obj: ef_pow.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-ef_pow.obj `if test -f 'ef_pow.c'; then $(CYGPATH_W) 'ef_pow.c'; else $(CYGPATH_W) '$(srcdir)/ef_pow.c'; fi` + +lib_a-ef_rem_pio2.o: ef_rem_pio2.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-ef_rem_pio2.o `test -f 'ef_rem_pio2.c' || echo '$(srcdir)/'`ef_rem_pio2.c + +lib_a-ef_rem_pio2.obj: ef_rem_pio2.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-ef_rem_pio2.obj `if test -f 'ef_rem_pio2.c'; then $(CYGPATH_W) 'ef_rem_pio2.c'; else $(CYGPATH_W) '$(srcdir)/ef_rem_pio2.c'; fi` + +lib_a-ef_remainder.o: ef_remainder.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-ef_remainder.o `test -f 'ef_remainder.c' || echo '$(srcdir)/'`ef_remainder.c + +lib_a-ef_remainder.obj: ef_remainder.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-ef_remainder.obj `if test -f 'ef_remainder.c'; then $(CYGPATH_W) 'ef_remainder.c'; else $(CYGPATH_W) '$(srcdir)/ef_remainder.c'; fi` + +lib_a-ef_scalb.o: ef_scalb.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-ef_scalb.o `test -f 'ef_scalb.c' || echo '$(srcdir)/'`ef_scalb.c + +lib_a-ef_scalb.obj: ef_scalb.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-ef_scalb.obj `if test -f 'ef_scalb.c'; then $(CYGPATH_W) 'ef_scalb.c'; else $(CYGPATH_W) '$(srcdir)/ef_scalb.c'; fi` + +lib_a-ef_sinh.o: ef_sinh.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-ef_sinh.o `test -f 'ef_sinh.c' || echo '$(srcdir)/'`ef_sinh.c + +lib_a-ef_sinh.obj: ef_sinh.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-ef_sinh.obj `if test -f 'ef_sinh.c'; then $(CYGPATH_W) 'ef_sinh.c'; else $(CYGPATH_W) '$(srcdir)/ef_sinh.c'; fi` + +lib_a-ef_sqrt.o: ef_sqrt.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-ef_sqrt.o `test -f 'ef_sqrt.c' || echo '$(srcdir)/'`ef_sqrt.c + +lib_a-ef_sqrt.obj: ef_sqrt.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-ef_sqrt.obj `if test -f 'ef_sqrt.c'; then $(CYGPATH_W) 'ef_sqrt.c'; else $(CYGPATH_W) '$(srcdir)/ef_sqrt.c'; fi` + +lib_a-wf_acos.o: wf_acos.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-wf_acos.o `test -f 'wf_acos.c' || echo '$(srcdir)/'`wf_acos.c + +lib_a-wf_acos.obj: wf_acos.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-wf_acos.obj `if test -f 'wf_acos.c'; then $(CYGPATH_W) 'wf_acos.c'; else $(CYGPATH_W) '$(srcdir)/wf_acos.c'; fi` + +lib_a-wf_acosh.o: wf_acosh.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-wf_acosh.o `test -f 'wf_acosh.c' || echo '$(srcdir)/'`wf_acosh.c + +lib_a-wf_acosh.obj: wf_acosh.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-wf_acosh.obj `if test -f 'wf_acosh.c'; then $(CYGPATH_W) 'wf_acosh.c'; else $(CYGPATH_W) '$(srcdir)/wf_acosh.c'; fi` + +lib_a-wf_asin.o: wf_asin.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-wf_asin.o `test -f 'wf_asin.c' || echo '$(srcdir)/'`wf_asin.c + +lib_a-wf_asin.obj: wf_asin.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-wf_asin.obj `if test -f 'wf_asin.c'; then $(CYGPATH_W) 'wf_asin.c'; else $(CYGPATH_W) '$(srcdir)/wf_asin.c'; fi` + +lib_a-wf_atan2.o: wf_atan2.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-wf_atan2.o `test -f 'wf_atan2.c' || echo '$(srcdir)/'`wf_atan2.c + +lib_a-wf_atan2.obj: wf_atan2.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-wf_atan2.obj `if test -f 'wf_atan2.c'; then $(CYGPATH_W) 'wf_atan2.c'; else $(CYGPATH_W) '$(srcdir)/wf_atan2.c'; fi` + +lib_a-wf_atanh.o: wf_atanh.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-wf_atanh.o `test -f 'wf_atanh.c' || echo '$(srcdir)/'`wf_atanh.c + +lib_a-wf_atanh.obj: wf_atanh.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-wf_atanh.obj `if test -f 'wf_atanh.c'; then $(CYGPATH_W) 'wf_atanh.c'; else $(CYGPATH_W) '$(srcdir)/wf_atanh.c'; fi` + +lib_a-wf_cosh.o: wf_cosh.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-wf_cosh.o `test -f 'wf_cosh.c' || echo '$(srcdir)/'`wf_cosh.c + +lib_a-wf_cosh.obj: wf_cosh.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-wf_cosh.obj `if test -f 'wf_cosh.c'; then $(CYGPATH_W) 'wf_cosh.c'; else $(CYGPATH_W) '$(srcdir)/wf_cosh.c'; fi` + +lib_a-wf_exp.o: wf_exp.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-wf_exp.o `test -f 'wf_exp.c' || echo '$(srcdir)/'`wf_exp.c + +lib_a-wf_exp.obj: wf_exp.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-wf_exp.obj `if test -f 'wf_exp.c'; then $(CYGPATH_W) 'wf_exp.c'; else $(CYGPATH_W) '$(srcdir)/wf_exp.c'; fi` + +lib_a-wf_fmod.o: wf_fmod.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-wf_fmod.o `test -f 'wf_fmod.c' || echo '$(srcdir)/'`wf_fmod.c + +lib_a-wf_fmod.obj: wf_fmod.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-wf_fmod.obj `if test -f 'wf_fmod.c'; then $(CYGPATH_W) 'wf_fmod.c'; else $(CYGPATH_W) '$(srcdir)/wf_fmod.c'; fi` + +lib_a-wf_gamma.o: wf_gamma.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-wf_gamma.o `test -f 'wf_gamma.c' || echo '$(srcdir)/'`wf_gamma.c + +lib_a-wf_gamma.obj: wf_gamma.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-wf_gamma.obj `if test -f 'wf_gamma.c'; then $(CYGPATH_W) 'wf_gamma.c'; else $(CYGPATH_W) '$(srcdir)/wf_gamma.c'; fi` + +lib_a-wrf_gamma.o: wrf_gamma.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-wrf_gamma.o `test -f 'wrf_gamma.c' || echo '$(srcdir)/'`wrf_gamma.c + +lib_a-wrf_gamma.obj: wrf_gamma.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-wrf_gamma.obj `if test -f 'wrf_gamma.c'; then $(CYGPATH_W) 'wrf_gamma.c'; else $(CYGPATH_W) '$(srcdir)/wrf_gamma.c'; fi` + +lib_a-wf_hypot.o: wf_hypot.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-wf_hypot.o `test -f 'wf_hypot.c' || echo '$(srcdir)/'`wf_hypot.c + +lib_a-wf_hypot.obj: wf_hypot.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-wf_hypot.obj `if test -f 'wf_hypot.c'; then $(CYGPATH_W) 'wf_hypot.c'; else $(CYGPATH_W) '$(srcdir)/wf_hypot.c'; fi` + +lib_a-wf_j0.o: wf_j0.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-wf_j0.o `test -f 'wf_j0.c' || echo '$(srcdir)/'`wf_j0.c + +lib_a-wf_j0.obj: wf_j0.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-wf_j0.obj `if test -f 'wf_j0.c'; then $(CYGPATH_W) 'wf_j0.c'; else $(CYGPATH_W) '$(srcdir)/wf_j0.c'; fi` + +lib_a-wf_j1.o: wf_j1.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-wf_j1.o `test -f 'wf_j1.c' || echo '$(srcdir)/'`wf_j1.c + +lib_a-wf_j1.obj: wf_j1.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-wf_j1.obj `if test -f 'wf_j1.c'; then $(CYGPATH_W) 'wf_j1.c'; else $(CYGPATH_W) '$(srcdir)/wf_j1.c'; fi` + +lib_a-wf_jn.o: wf_jn.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-wf_jn.o `test -f 'wf_jn.c' || echo '$(srcdir)/'`wf_jn.c + +lib_a-wf_jn.obj: wf_jn.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-wf_jn.obj `if test -f 'wf_jn.c'; then $(CYGPATH_W) 'wf_jn.c'; else $(CYGPATH_W) '$(srcdir)/wf_jn.c'; fi` + +lib_a-wf_lgamma.o: wf_lgamma.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-wf_lgamma.o `test -f 'wf_lgamma.c' || echo '$(srcdir)/'`wf_lgamma.c + +lib_a-wf_lgamma.obj: wf_lgamma.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-wf_lgamma.obj `if test -f 'wf_lgamma.c'; then $(CYGPATH_W) 'wf_lgamma.c'; else $(CYGPATH_W) '$(srcdir)/wf_lgamma.c'; fi` + +lib_a-wrf_lgamma.o: wrf_lgamma.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-wrf_lgamma.o `test -f 'wrf_lgamma.c' || echo '$(srcdir)/'`wrf_lgamma.c + +lib_a-wrf_lgamma.obj: wrf_lgamma.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-wrf_lgamma.obj `if test -f 'wrf_lgamma.c'; then $(CYGPATH_W) 'wrf_lgamma.c'; else $(CYGPATH_W) '$(srcdir)/wrf_lgamma.c'; fi` + +lib_a-wf_log.o: wf_log.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-wf_log.o `test -f 'wf_log.c' || echo '$(srcdir)/'`wf_log.c + +lib_a-wf_log.obj: wf_log.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-wf_log.obj `if test -f 'wf_log.c'; then $(CYGPATH_W) 'wf_log.c'; else $(CYGPATH_W) '$(srcdir)/wf_log.c'; fi` + +lib_a-wf_log10.o: wf_log10.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-wf_log10.o `test -f 'wf_log10.c' || echo '$(srcdir)/'`wf_log10.c + +lib_a-wf_log10.obj: wf_log10.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-wf_log10.obj `if test -f 'wf_log10.c'; then $(CYGPATH_W) 'wf_log10.c'; else $(CYGPATH_W) '$(srcdir)/wf_log10.c'; fi` + +lib_a-wf_pow.o: wf_pow.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-wf_pow.o `test -f 'wf_pow.c' || echo '$(srcdir)/'`wf_pow.c + +lib_a-wf_pow.obj: wf_pow.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-wf_pow.obj `if test -f 'wf_pow.c'; then $(CYGPATH_W) 'wf_pow.c'; else $(CYGPATH_W) '$(srcdir)/wf_pow.c'; fi` + +lib_a-wf_remainder.o: wf_remainder.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-wf_remainder.o `test -f 'wf_remainder.c' || echo '$(srcdir)/'`wf_remainder.c + +lib_a-wf_remainder.obj: wf_remainder.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-wf_remainder.obj `if test -f 'wf_remainder.c'; then $(CYGPATH_W) 'wf_remainder.c'; else $(CYGPATH_W) '$(srcdir)/wf_remainder.c'; fi` + +lib_a-wf_scalb.o: wf_scalb.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-wf_scalb.o `test -f 'wf_scalb.c' || echo '$(srcdir)/'`wf_scalb.c + +lib_a-wf_scalb.obj: wf_scalb.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-wf_scalb.obj `if test -f 'wf_scalb.c'; then $(CYGPATH_W) 'wf_scalb.c'; else $(CYGPATH_W) '$(srcdir)/wf_scalb.c'; fi` + +lib_a-wf_sinh.o: wf_sinh.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-wf_sinh.o `test -f 'wf_sinh.c' || echo '$(srcdir)/'`wf_sinh.c + +lib_a-wf_sinh.obj: wf_sinh.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-wf_sinh.obj `if test -f 'wf_sinh.c'; then $(CYGPATH_W) 'wf_sinh.c'; else $(CYGPATH_W) '$(srcdir)/wf_sinh.c'; fi` + +lib_a-wf_sqrt.o: wf_sqrt.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-wf_sqrt.o `test -f 'wf_sqrt.c' || echo '$(srcdir)/'`wf_sqrt.c + +lib_a-wf_sqrt.obj: wf_sqrt.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-wf_sqrt.obj `if test -f 'wf_sqrt.c'; then $(CYGPATH_W) 'wf_sqrt.c'; else $(CYGPATH_W) '$(srcdir)/wf_sqrt.c'; fi` + +lib_a-wf_sincos.o: wf_sincos.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-wf_sincos.o `test -f 'wf_sincos.c' || echo '$(srcdir)/'`wf_sincos.c + +lib_a-wf_sincos.obj: wf_sincos.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-wf_sincos.obj `if test -f 'wf_sincos.c'; then $(CYGPATH_W) 'wf_sincos.c'; else $(CYGPATH_W) '$(srcdir)/wf_sincos.c'; fi` + +lib_a-wf_cabs.o: wf_cabs.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-wf_cabs.o `test -f 'wf_cabs.c' || echo '$(srcdir)/'`wf_cabs.c + +lib_a-wf_cabs.obj: wf_cabs.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-wf_cabs.obj `if test -f 'wf_cabs.c'; then $(CYGPATH_W) 'wf_cabs.c'; else $(CYGPATH_W) '$(srcdir)/wf_cabs.c'; fi` + +lib_a-wf_drem.o: wf_drem.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-wf_drem.o `test -f 'wf_drem.c' || echo '$(srcdir)/'`wf_drem.c + +lib_a-wf_drem.obj: wf_drem.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-wf_drem.obj `if test -f 'wf_drem.c'; then $(CYGPATH_W) 'wf_drem.c'; else $(CYGPATH_W) '$(srcdir)/wf_drem.c'; fi` + +lib_a-sf_asinh.o: sf_asinh.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-sf_asinh.o `test -f 'sf_asinh.c' || echo '$(srcdir)/'`sf_asinh.c + +lib_a-sf_asinh.obj: sf_asinh.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-sf_asinh.obj `if test -f 'sf_asinh.c'; then $(CYGPATH_W) 'sf_asinh.c'; else $(CYGPATH_W) '$(srcdir)/sf_asinh.c'; fi` + +lib_a-sf_atan.o: sf_atan.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-sf_atan.o `test -f 'sf_atan.c' || echo '$(srcdir)/'`sf_atan.c + +lib_a-sf_atan.obj: sf_atan.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-sf_atan.obj `if test -f 'sf_atan.c'; then $(CYGPATH_W) 'sf_atan.c'; else $(CYGPATH_W) '$(srcdir)/sf_atan.c'; fi` + +lib_a-sf_ceil.o: sf_ceil.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-sf_ceil.o `test -f 'sf_ceil.c' || echo '$(srcdir)/'`sf_ceil.c + +lib_a-sf_ceil.obj: sf_ceil.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-sf_ceil.obj `if test -f 'sf_ceil.c'; then $(CYGPATH_W) 'sf_ceil.c'; else $(CYGPATH_W) '$(srcdir)/sf_ceil.c'; fi` + +lib_a-sf_cos.o: sf_cos.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-sf_cos.o `test -f 'sf_cos.c' || echo '$(srcdir)/'`sf_cos.c + +lib_a-sf_cos.obj: sf_cos.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-sf_cos.obj `if test -f 'sf_cos.c'; then $(CYGPATH_W) 'sf_cos.c'; else $(CYGPATH_W) '$(srcdir)/sf_cos.c'; fi` + +lib_a-sf_erf.o: sf_erf.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-sf_erf.o `test -f 'sf_erf.c' || echo '$(srcdir)/'`sf_erf.c + +lib_a-sf_erf.obj: sf_erf.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-sf_erf.obj `if test -f 'sf_erf.c'; then $(CYGPATH_W) 'sf_erf.c'; else $(CYGPATH_W) '$(srcdir)/sf_erf.c'; fi` + +lib_a-sf_fabs.o: sf_fabs.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-sf_fabs.o `test -f 'sf_fabs.c' || echo '$(srcdir)/'`sf_fabs.c + +lib_a-sf_fabs.obj: sf_fabs.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-sf_fabs.obj `if test -f 'sf_fabs.c'; then $(CYGPATH_W) 'sf_fabs.c'; else $(CYGPATH_W) '$(srcdir)/sf_fabs.c'; fi` + +lib_a-sf_floor.o: sf_floor.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-sf_floor.o `test -f 'sf_floor.c' || echo '$(srcdir)/'`sf_floor.c + +lib_a-sf_floor.obj: sf_floor.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-sf_floor.obj `if test -f 'sf_floor.c'; then $(CYGPATH_W) 'sf_floor.c'; else $(CYGPATH_W) '$(srcdir)/sf_floor.c'; fi` + +lib_a-sf_frexp.o: sf_frexp.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-sf_frexp.o `test -f 'sf_frexp.c' || echo '$(srcdir)/'`sf_frexp.c + +lib_a-sf_frexp.obj: sf_frexp.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-sf_frexp.obj `if test -f 'sf_frexp.c'; then $(CYGPATH_W) 'sf_frexp.c'; else $(CYGPATH_W) '$(srcdir)/sf_frexp.c'; fi` + +lib_a-sf_ldexp.o: sf_ldexp.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-sf_ldexp.o `test -f 'sf_ldexp.c' || echo '$(srcdir)/'`sf_ldexp.c + +lib_a-sf_ldexp.obj: sf_ldexp.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-sf_ldexp.obj `if test -f 'sf_ldexp.c'; then $(CYGPATH_W) 'sf_ldexp.c'; else $(CYGPATH_W) '$(srcdir)/sf_ldexp.c'; fi` + +lib_a-sf_signif.o: sf_signif.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-sf_signif.o `test -f 'sf_signif.c' || echo '$(srcdir)/'`sf_signif.c + +lib_a-sf_signif.obj: sf_signif.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-sf_signif.obj `if test -f 'sf_signif.c'; then $(CYGPATH_W) 'sf_signif.c'; else $(CYGPATH_W) '$(srcdir)/sf_signif.c'; fi` + +lib_a-sf_sin.o: sf_sin.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-sf_sin.o `test -f 'sf_sin.c' || echo '$(srcdir)/'`sf_sin.c + +lib_a-sf_sin.obj: sf_sin.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-sf_sin.obj `if test -f 'sf_sin.c'; then $(CYGPATH_W) 'sf_sin.c'; else $(CYGPATH_W) '$(srcdir)/sf_sin.c'; fi` + +lib_a-sf_tan.o: sf_tan.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-sf_tan.o `test -f 'sf_tan.c' || echo '$(srcdir)/'`sf_tan.c + +lib_a-sf_tan.obj: sf_tan.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-sf_tan.obj `if test -f 'sf_tan.c'; then $(CYGPATH_W) 'sf_tan.c'; else $(CYGPATH_W) '$(srcdir)/sf_tan.c'; fi` + +lib_a-sf_tanh.o: sf_tanh.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-sf_tanh.o `test -f 'sf_tanh.c' || echo '$(srcdir)/'`sf_tanh.c + +lib_a-sf_tanh.obj: sf_tanh.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-sf_tanh.obj `if test -f 'sf_tanh.c'; then $(CYGPATH_W) 'sf_tanh.c'; else $(CYGPATH_W) '$(srcdir)/sf_tanh.c'; fi` + +lib_a-wf_exp2.o: wf_exp2.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-wf_exp2.o `test -f 'wf_exp2.c' || echo '$(srcdir)/'`wf_exp2.c + +lib_a-wf_exp2.obj: wf_exp2.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-wf_exp2.obj `if test -f 'wf_exp2.c'; then $(CYGPATH_W) 'wf_exp2.c'; else $(CYGPATH_W) '$(srcdir)/wf_exp2.c'; fi` + +lib_a-wf_tgamma.o: wf_tgamma.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-wf_tgamma.o `test -f 'wf_tgamma.c' || echo '$(srcdir)/'`wf_tgamma.c + +lib_a-wf_tgamma.obj: wf_tgamma.c + $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(lib_a_CFLAGS) $(CFLAGS) -c -o lib_a-wf_tgamma.obj `if test -f 'wf_tgamma.c'; then $(CYGPATH_W) 'wf_tgamma.c'; else $(CYGPATH_W) '$(srcdir)/wf_tgamma.c'; fi` + +mostlyclean-libtool: + -rm -f *.lo + +clean-libtool: + -rm -rf .libs _libs + +distclean-libtool: + -rm -f libtool +uninstall-info-am: + +ID: $(HEADERS) $(SOURCES) $(LISP) $(TAGS_FILES) + list='$(SOURCES) $(HEADERS) $(LISP) $(TAGS_FILES)'; \ + unique=`for i in $$list; do \ + if test -f "$$i"; then echo $$i; else echo $(srcdir)/$$i; fi; \ + done | \ + $(AWK) ' { files[$$0] = 1; } \ + END { for (i in files) print i; }'`; \ + mkid -fID $$unique +tags: TAGS + +TAGS: $(HEADERS) $(SOURCES) $(TAGS_DEPENDENCIES) \ + $(TAGS_FILES) $(LISP) + tags=; \ + here=`pwd`; \ + list='$(SOURCES) $(HEADERS) $(LISP) $(TAGS_FILES)'; \ + unique=`for i in $$list; do \ + if test -f "$$i"; then echo $$i; else echo $(srcdir)/$$i; fi; \ + done | \ + $(AWK) ' { files[$$0] = 1; } \ + END { for (i in files) print i; }'`; \ + if test -z "$(ETAGS_ARGS)$$tags$$unique"; then :; else \ + test -n "$$unique" || unique=$$empty_fix; \ + $(ETAGS) $(ETAGSFLAGS) $(AM_ETAGSFLAGS) $(ETAGS_ARGS) \ + $$tags $$unique; \ + fi +ctags: CTAGS +CTAGS: $(HEADERS) $(SOURCES) $(TAGS_DEPENDENCIES) \ + $(TAGS_FILES) $(LISP) + tags=; \ + here=`pwd`; \ + list='$(SOURCES) $(HEADERS) $(LISP) $(TAGS_FILES)'; \ + unique=`for i in $$list; do \ + if test -f "$$i"; then echo $$i; else echo $(srcdir)/$$i; fi; \ + done | \ + $(AWK) ' { files[$$0] = 1; } \ + END { for (i in files) print i; }'`; \ + test -z "$(CTAGS_ARGS)$$tags$$unique" \ + || $(CTAGS) $(CTAGSFLAGS) $(AM_CTAGSFLAGS) $(CTAGS_ARGS) \ + $$tags $$unique + +GTAGS: + here=`$(am__cd) $(top_builddir) && pwd` \ + && cd $(top_srcdir) \ + && gtags -i $(GTAGS_ARGS) $$here + +distclean-tags: + -rm -f TAGS ID GTAGS GRTAGS GSYMS GPATH tags +check-am: +check: check-am +all-am: Makefile $(LIBRARIES) $(LTLIBRARIES) $(DATA) +installdirs: +install: install-am +install-exec: install-exec-am +install-data: install-data-am +uninstall: uninstall-am + +install-am: all-am + @$(MAKE) $(AM_MAKEFLAGS) install-exec-am install-data-am + +installcheck: installcheck-am +install-strip: + $(MAKE) $(AM_MAKEFLAGS) INSTALL_PROGRAM="$(INSTALL_STRIP_PROGRAM)" \ + install_sh_PROGRAM="$(INSTALL_STRIP_PROGRAM)" INSTALL_STRIP_FLAG=-s \ + `test -z '$(STRIP)' || \ + echo "INSTALL_PROGRAM_ENV=STRIPPROG='$(STRIP)'"` install +mostlyclean-generic: + +clean-generic: + -test -z "$(CLEANFILES)" || rm -f $(CLEANFILES) + +distclean-generic: + -test -z "$(CONFIG_CLEAN_FILES)" || rm -f $(CONFIG_CLEAN_FILES) + +maintainer-clean-generic: + @echo "This command is intended for maintainers to use" + @echo "it deletes files that may require special tools to rebuild." +clean: clean-am + +clean-am: clean-generic clean-libtool clean-noinstLIBRARIES \ + clean-noinstLTLIBRARIES mostlyclean-am + +distclean: distclean-am + -rm -f Makefile +distclean-am: clean-am distclean-compile distclean-generic \ + distclean-libtool distclean-tags + +dvi: dvi-am + +dvi-am: + +html: html-am + +info: info-am + +info-am: + +install-data-am: + +install-exec-am: + +install-info: install-info-am + +install-man: + +installcheck-am: + +maintainer-clean: maintainer-clean-am + -rm -f Makefile +maintainer-clean-am: distclean-am maintainer-clean-generic + +mostlyclean: mostlyclean-am + +mostlyclean-am: mostlyclean-compile mostlyclean-generic \ + mostlyclean-libtool + +pdf: pdf-am + +pdf-am: + +ps: ps-am + +ps-am: + +uninstall-am: + +.PHONY: CTAGS GTAGS all all-am check check-am clean clean-generic \ + clean-libtool clean-noinstLIBRARIES clean-noinstLTLIBRARIES \ + ctags distclean distclean-compile distclean-generic \ + distclean-libtool distclean-tags dvi dvi-am html html-am info \ + info-am install install-am install-data install-data-am \ + install-exec install-exec-am install-info install-info-am \ + install-man install-strip installcheck installcheck-am \ + installdirs maintainer-clean maintainer-clean-generic \ + mostlyclean mostlyclean-compile mostlyclean-generic \ + mostlyclean-libtool pdf pdf-am ps ps-am tags uninstall \ + uninstall-am uninstall-info-am + +objectlist.awk.in: $(noinst_LTLIBRARIES) + -rm -f objectlist.awk.in + for i in `ls *.lo` ; \ + do \ + echo $$i `pwd`/$$i >> objectlist.awk.in ; \ + done + +.c.def: + $(CHEW) < $< > $*.def 2> $*.ref + touch stmp-def + +doc: $(chobj) + cat $(srcdir)/math.tex >> $(TARGETDOC) + +# Texinfo does not appear to support underscores in file names, so we +# name the .def files without underscores. + +wacos.def: w_acos.c + $(CHEW) < $(srcdir)/w_acos.c >$@ 2>/dev/null + touch stmp-def +wacosh.def: w_acosh.c + $(CHEW) < $(srcdir)/w_acosh.c >$@ 2>/dev/null + touch stmp-def +wasin.def: w_asin.c + $(CHEW) < $(srcdir)/w_asin.c >$@ 2>/dev/null + touch stmp-def +sasinh.def: s_asinh.c + $(CHEW) < $(srcdir)/s_asinh.c >$@ 2>/dev/null + touch stmp-def +satan.def: s_atan.c + $(CHEW) < $(srcdir)/s_atan.c >$@ 2>/dev/null + touch stmp-def +watan2.def: w_atan2.c + $(CHEW) < $(srcdir)/w_atan2.c >$@ 2>/dev/null + touch stmp-def +watanh.def: w_atanh.c + $(CHEW) < $(srcdir)/w_atanh.c >$@ 2>/dev/null + touch stmp-def +wj0.def: w_j0.c + $(CHEW) < $(srcdir)/w_j0.c >$@ 2>/dev/null + touch stmp-def +scopysign.def: s_copysign.c + $(CHEW) < $(srcdir)/../common/s_copysign.c >$@ 2>/dev/null + touch stmp-def +wcosh.def: w_cosh.c + $(CHEW) < $(srcdir)/w_cosh.c >$@ 2>/dev/null + touch stmp-def +serf.def: s_erf.c + $(CHEW) < $(srcdir)/s_erf.c >$@ 2>/dev/null + touch stmp-def +wexp.def: w_exp.c + $(CHEW) < $(srcdir)/w_exp.c >$@ 2>/dev/null + touch stmp-def +sfabs.def: s_fabs.c + $(CHEW) < $(srcdir)/s_fabs.c >$@ 2>/dev/null + touch stmp-def +sfloor.def: s_floor.c + $(CHEW) < $(srcdir)/s_floor.c >$@ 2>/dev/null + touch stmp-def +wfmod.def: w_fmod.c + $(CHEW) < $(srcdir)/w_fmod.c >$@ 2>/dev/null + touch stmp-def +sfrexp.def: s_frexp.c + $(CHEW) < $(srcdir)/s_frexp.c >$@ 2>/dev/null + touch stmp-def +wgamma.def: w_gamma.c + $(CHEW) < $(srcdir)/w_gamma.c >$@ 2>/dev/null + touch stmp-def +whypot.def: w_hypot.c + $(CHEW) < $(srcdir)/w_hypot.c >$@ 2>/dev/null + touch stmp-def +sldexp.def: s_ldexp.c + $(CHEW) < $(srcdir)/s_ldexp.c >$@ 2>/dev/null + touch stmp-def +wlog.def: w_log.c + $(CHEW) < $(srcdir)/w_log.c >$@ 2>/dev/null + touch stmp-def +wlog10.def: w_log10.c + $(CHEW) < $(srcdir)/w_log10.c >$@ 2>/dev/null + touch stmp-def +wpow.def: w_pow.c + $(CHEW) < $(srcdir)/w_pow.c >$@ 2>/dev/null + touch stmp-def +wremainder.def: w_remainder.c + $(CHEW) < $(srcdir)/w_remainder.c >$@ 2>/dev/null + touch stmp-def +ssin.def: s_sin.c + $(CHEW) < $(srcdir)/s_sin.c >$@ 2>/dev/null + touch stmp-def +wsinh.def: w_sinh.c + $(CHEW) < $(srcdir)/w_sinh.c >$@ 2>/dev/null + touch stmp-def +wsqrt.def: w_sqrt.c + $(CHEW) < $(srcdir)/w_sqrt.c >$@ 2>/dev/null + touch stmp-def +stan.def: s_tan.c + $(CHEW) < $(srcdir)/s_tan.c >$@ 2>/dev/null + touch stmp-def +stanh.def: s_tanh.c + $(CHEW) < $(srcdir)/s_tanh.c >$@ 2>/dev/null + touch stmp-def + +# A partial dependency list. + +$(lib_a_OBJECTS): $(srcdir)/../../libc/include/math.h $(srcdir)/../common/fdlibm.h +# Tell versions [3.59,3.63) of GNU make to not export all variables. +# Otherwise a system limit (for SysV at least) may be exceeded. +.NOEXPORT: Index: e_acosh.c =================================================================== --- e_acosh.c (nonexistent) +++ e_acosh.c (revision 158) @@ -0,0 +1,70 @@ + +/* @(#)e_acosh.c 5.1 93/09/24 */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + * + */ + +/* __ieee754_acosh(x) + * Method : + * Based on + * acosh(x) = log [ x + sqrt(x*x-1) ] + * we have + * acosh(x) := log(x)+ln2, if x is large; else + * acosh(x) := log(2x-1/(sqrt(x*x-1)+x)) if x>2; else + * acosh(x) := log1p(t+sqrt(2.0*t+t*t)); where t=x-1. + * + * Special cases: + * acosh(x) is NaN with signal if x<1. + * acosh(NaN) is NaN without signal. + */ + +#include "fdlibm.h" + +#ifndef _DOUBLE_IS_32BITS + +#ifdef __STDC__ +static const double +#else +static double +#endif +one = 1.0, +ln2 = 6.93147180559945286227e-01; /* 0x3FE62E42, 0xFEFA39EF */ + +#ifdef __STDC__ + double __ieee754_acosh(double x) +#else + double __ieee754_acosh(x) + double x; +#endif +{ + double t; + __int32_t hx; + __uint32_t lx; + EXTRACT_WORDS(hx,lx,x); + if(hx<0x3ff00000) { /* x < 1 */ + return (x-x)/(x-x); + } else if(hx >=0x41b00000) { /* x > 2**28 */ + if(hx >=0x7ff00000) { /* x is inf of NaN */ + return x+x; + } else + return __ieee754_log(x)+ln2; /* acosh(huge)=log(2x) */ + } else if(((hx-0x3ff00000)|lx)==0) { + return 0.0; /* acosh(1) = 0 */ + } else if (hx > 0x40000000) { /* 2**28 > x > 2 */ + t=x*x; + return __ieee754_log(2.0*x-one/(x+__ieee754_sqrt(t-one))); + } else { /* 1

e_acosh.c Property changes : Added: svn:eol-style ## -0,0 +1 ## +native \ No newline at end of property Added: svn:keywords ## -0,0 +1 ## +Id \ No newline at end of property Index: wf_tgamma.c =================================================================== --- wf_tgamma.c (nonexistent) +++ wf_tgamma.c (revision 158) @@ -0,0 +1,45 @@ +/* w_gammaf.c -- float version of w_gamma.c. + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + */ + +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#include "math.h" +#include "fdlibm.h" + +#ifdef __STDC__ + float tgammaf(float x) +#else + float tgammaf(x) + float x; +#endif +{ + float y; + int local_signgam; + y = __ieee754_gammaf_r(x,&local_signgam); + if (local_signgam < 0) y = -y; +#ifdef _IEEE_LIBM + return y; +#else + if(_LIB_VERSION == _IEEE_) return y; + + if(!finitef(y)&&finitef(x)) { + if(floorf(x)==x&&x<=(float)0.0) + /* tgammaf pole */ + return (float)__kernel_standard((double)x,(double)x,141); + else + /* tgammaf overflow */ + return (float)__kernel_standard((double)x,(double)x,140); + } + return y; +#endif +}

wf_tgamma.c Property changes : Added: svn:eol-style ## -0,0 +1 ## +native \ No newline at end of property Added: svn:keywords ## -0,0 +1 ## +Id \ No newline at end of property Index: wf_cabs.c =================================================================== --- wf_cabs.c (nonexistent) +++ wf_cabs.c (revision 158) @@ -0,0 +1,20 @@ +/* + * cabsf() wrapper for hypotf(). + * + * Written by J.T. Conklin, + * Placed into the Public Domain, 1994. + */ + +#include "fdlibm.h" + +struct complex { + float x; + float y; +}; + +float +cabsf(z) + struct complex z; +{ + return hypotf(z.x, z.y); +}

wf_cabs.c Property changes : Added: svn:eol-style ## -0,0 +1 ## +native \ No newline at end of property Added: svn:keywords ## -0,0 +1 ## +Id \ No newline at end of property Index: ef_exp.c =================================================================== --- ef_exp.c (nonexistent) +++ ef_exp.c (revision 158) @@ -0,0 +1,100 @@ +/* ef_exp.c -- float version of e_exp.c. + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + */ + +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#include "fdlibm.h" + +#ifdef __v810__ +#define const +#endif + +#ifdef __STDC__ +static const float +#else +static float +#endif +one = 1.0, +halF[2] = {0.5,-0.5,}, +huge = 1.0e+30, +twom100 = 7.8886090522e-31, /* 2**-100=0x0d800000 */ +ln2HI[2] ={ 6.9313812256e-01, /* 0x3f317180 */ + -6.9313812256e-01,}, /* 0xbf317180 */ +ln2LO[2] ={ 9.0580006145e-06, /* 0x3717f7d1 */ + -9.0580006145e-06,}, /* 0xb717f7d1 */ +invln2 = 1.4426950216e+00, /* 0x3fb8aa3b */ +P1 = 1.6666667163e-01, /* 0x3e2aaaab */ +P2 = -2.7777778450e-03, /* 0xbb360b61 */ +P3 = 6.6137559770e-05, /* 0x388ab355 */ +P4 = -1.6533901999e-06, /* 0xb5ddea0e */ +P5 = 4.1381369442e-08; /* 0x3331bb4c */ + +#ifdef __STDC__ + float __ieee754_expf(float x) /* default IEEE double exp */ +#else + float __ieee754_expf(x) /* default IEEE double exp */ + float x; +#endif +{ + float y,hi,lo,c,t; + __int32_t k,xsb,sx; + __uint32_t hx; + + GET_FLOAT_WORD(sx,x); + xsb = (sx>>31)&1; /* sign bit of x */ + hx = sx & 0x7fffffff; /* high word of |x| */ + + /* filter out non-finite argument */ + if(FLT_UWORD_IS_NAN(hx)) + return x+x; /* NaN */ + if(FLT_UWORD_IS_INFINITE(hx)) + return (xsb==0)? x:0.0; /* exp(+-inf)={inf,0} */ + if(sx > FLT_UWORD_LOG_MAX) + return huge*huge; /* overflow */ + if(sx < 0 && hx > FLT_UWORD_LOG_MIN) + return twom100*twom100; /* underflow */ + + /* argument reduction */ + if(hx > 0x3eb17218) { /* if |x| > 0.5 ln2 */ + if(hx < 0x3F851592) { /* and |x| < 1.5 ln2 */ + hi = x-ln2HI[xsb]; lo=ln2LO[xsb]; k = 1-xsb-xsb; + } else { + k = invln2*x+halF[xsb]; + t = k; + hi = x - t*ln2HI[0]; /* t*ln2HI is exact here */ + lo = t*ln2LO[0]; + } + x = hi - lo; + } + else if(hx < 0x31800000) { /* when |x|<2**-28 */ + if(huge+x>one) return one+x;/* trigger inexact */ + } + else k = 0; + + /* x is now in primary range */ + t = x*x; + c = x - t*(P1+t*(P2+t*(P3+t*(P4+t*P5)))); + if(k==0) return one-((x*c)/(c-(float)2.0)-x); + else y = one-((lo-(x*c)/((float)2.0-c))-hi); + if(k >= -125) { + __uint32_t hy; + GET_FLOAT_WORD(hy,y); + SET_FLOAT_WORD(y,hy+(k<<23)); /* add k to y's exponent */ + return y; + } else { + __uint32_t hy; + GET_FLOAT_WORD(hy,y); + SET_FLOAT_WORD(y,hy+((k+100)<<23)); /* add k to y's exponent */ + return y*twom100; + } +}

ef_exp.c Property changes : Added: svn:eol-style ## -0,0 +1 ## +native \ No newline at end of property Added: svn:keywords ## -0,0 +1 ## +Id \ No newline at end of property Index: ef_acosh.c =================================================================== --- ef_acosh.c (nonexistent) +++ ef_acosh.c (revision 158) @@ -0,0 +1,53 @@ +/* ef_acosh.c -- float version of e_acosh.c. + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + */ + +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + * + */ + +#include "fdlibm.h" + +#ifdef __STDC__ +static const float +#else +static float +#endif +one = 1.0, +ln2 = 6.9314718246e-01; /* 0x3f317218 */ + +#ifdef __STDC__ + float __ieee754_acoshf(float x) +#else + float __ieee754_acoshf(x) + float x; +#endif +{ + float t; + __int32_t hx; + GET_FLOAT_WORD(hx,x); + if(hx<0x3f800000) { /* x < 1 */ + return (x-x)/(x-x); + } else if(hx >=0x4d800000) { /* x > 2**28 */ + if(!FLT_UWORD_IS_FINITE(hx)) { /* x is inf of NaN */ + return x+x; + } else + return __ieee754_logf(x)+ln2; /* acosh(huge)=log(2x) */ + } else if (hx==0x3f800000) { + return 0.0; /* acosh(1) = 0 */ + } else if (hx > 0x40000000) { /* 2**28 > x > 2 */ + t=x*x; + return __ieee754_logf((float)2.0*x-one/(x+__ieee754_sqrtf(t-one))); + } else { /* 1

ef_acosh.c Property changes : Added: svn:eol-style ## -0,0 +1 ## +native \ No newline at end of property Added: svn:keywords ## -0,0 +1 ## +Id \ No newline at end of property Index: e_atan2.c =================================================================== --- e_atan2.c (nonexistent) +++ e_atan2.c (revision 158) @@ -0,0 +1,131 @@ + +/* @(#)e_atan2.c 5.1 93/09/24 */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + * + */ + +/* __ieee754_atan2(y,x) + * Method : + * 1. Reduce y to positive by atan2(y,x)=-atan2(-y,x). + * 2. Reduce x to positive by (if x and y are unexceptional): + * ARG (x+iy) = arctan(y/x) ... if x > 0, + * ARG (x+iy) = pi - arctan[y/(-x)] ... if x < 0, + * + * Special cases: + * + * ATAN2((anything), NaN ) is NaN; + * ATAN2(NAN , (anything) ) is NaN; + * ATAN2(+-0, +(anything but NaN)) is +-0 ; + * ATAN2(+-0, -(anything but NaN)) is +-pi ; + * ATAN2(+-(anything but 0 and NaN), 0) is +-pi/2; + * ATAN2(+-(anything but INF and NaN), +INF) is +-0 ; + * ATAN2(+-(anything but INF and NaN), -INF) is +-pi; + * ATAN2(+-INF,+INF ) is +-pi/4 ; + * ATAN2(+-INF,-INF ) is +-3pi/4; + * ATAN2(+-INF, (anything but,0,NaN, and INF)) is +-pi/2; + * + * Constants: + * The hexadecimal values are the intended ones for the following + * constants. The decimal values may be used, provided that the + * compiler will convert from decimal to binary accurately enough + * to produce the hexadecimal values shown. + */ + +#include "fdlibm.h" + +#ifndef _DOUBLE_IS_32BITS + +#ifdef __STDC__ +static const double +#else +static double +#endif +tiny = 1.0e-300, +zero = 0.0, +pi_o_4 = 7.8539816339744827900E-01, /* 0x3FE921FB, 0x54442D18 */ +pi_o_2 = 1.5707963267948965580E+00, /* 0x3FF921FB, 0x54442D18 */ +pi = 3.1415926535897931160E+00, /* 0x400921FB, 0x54442D18 */ +pi_lo = 1.2246467991473531772E-16; /* 0x3CA1A626, 0x33145C07 */ + +#ifdef __STDC__ + double __ieee754_atan2(double y, double x) +#else + double __ieee754_atan2(y,x) + double y,x; +#endif +{ + double z; + __int32_t k,m,hx,hy,ix,iy; + __uint32_t lx,ly; + + EXTRACT_WORDS(hx,lx,x); + ix = hx&0x7fffffff; + EXTRACT_WORDS(hy,ly,y); + iy = hy&0x7fffffff; + if(((ix|((lx|-lx)>>31))>0x7ff00000)|| + ((iy|((ly|-ly)>>31))>0x7ff00000)) /* x or y is NaN */ + return x+y; + if((hx-0x3ff00000|lx)==0) return atan(y); /* x=1.0 */ + m = ((hy>>31)&1)|((hx>>30)&2); /* 2*sign(x)+sign(y) */ + + /* when y = 0 */ + if((iy|ly)==0) { + switch(m) { + case 0: + case 1: return y; /* atan(+-0,+anything)=+-0 */ + case 2: return pi+tiny;/* atan(+0,-anything) = pi */ + case 3: return -pi-tiny;/* atan(-0,-anything) =-pi */ + } + } + /* when x = 0 */ + if((ix|lx)==0) return (hy<0)? -pi_o_2-tiny: pi_o_2+tiny; + + /* when x is INF */ + if(ix==0x7ff00000) { + if(iy==0x7ff00000) { + switch(m) { + case 0: return pi_o_4+tiny;/* atan(+INF,+INF) */ + case 1: return -pi_o_4-tiny;/* atan(-INF,+INF) */ + case 2: return 3.0*pi_o_4+tiny;/*atan(+INF,-INF)*/ + case 3: return -3.0*pi_o_4-tiny;/*atan(-INF,-INF)*/ + } + } else { + switch(m) { + case 0: return zero ; /* atan(+...,+INF) */ + case 1: return -zero ; /* atan(-...,+INF) */ + case 2: return pi+tiny ; /* atan(+...,-INF) */ + case 3: return -pi-tiny ; /* atan(-...,-INF) */ + } + } + } + /* when y is INF */ + if(iy==0x7ff00000) return (hy<0)? -pi_o_2-tiny: pi_o_2+tiny; + + /* compute y/x */ + k = (iy-ix)>>20; + if(k > 60) z=pi_o_2+0.5*pi_lo; /* |y/x| > 2**60 */ + else if(hx<0&&k<-60) z=0.0; /* |y|/x < -2**60 */ + else z=atan(fabs(y/x)); /* safe to do y/x */ + switch (m) { + case 0: return z ; /* atan(+,+) */ + case 1: { + __uint32_t zh; + GET_HIGH_WORD(zh,z); + SET_HIGH_WORD(z,zh ^ 0x80000000); + } + return z ; /* atan(-,+) */ + case 2: return pi-(z-pi_lo);/* atan(+,-) */ + default: /* case 3 */ + return (z-pi_lo)-pi;/* atan(-,-) */ + } +} + +#endif /* defined(_DOUBLE_IS_32BITS) */

e_atan2.c Property changes : Added: svn:eol-style ## -0,0 +1 ## +native \ No newline at end of property Added: svn:keywords ## -0,0 +1 ## +Id \ No newline at end of property Index: ef_atan2.c =================================================================== --- ef_atan2.c (nonexistent) +++ ef_atan2.c (revision 158) @@ -0,0 +1,101 @@ +/* ef_atan2.c -- float version of e_atan2.c. + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + */ + +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + * + */ + +#include "fdlibm.h" + +#ifdef __STDC__ +static const float +#else +static float +#endif +tiny = 1.0e-30, +zero = 0.0, +pi_o_4 = 7.8539818525e-01, /* 0x3f490fdb */ +pi_o_2 = 1.5707963705e+00, /* 0x3fc90fdb */ +pi = 3.1415927410e+00, /* 0x40490fdb */ +pi_lo = -8.7422776573e-08; /* 0xb3bbbd2e */ + +#ifdef __STDC__ + float __ieee754_atan2f(float y, float x) +#else + float __ieee754_atan2f(y,x) + float y,x; +#endif +{ + float z; + __int32_t k,m,hx,hy,ix,iy; + + GET_FLOAT_WORD(hx,x); + ix = hx&0x7fffffff; + GET_FLOAT_WORD(hy,y); + iy = hy&0x7fffffff; + if(FLT_UWORD_IS_NAN(ix)|| + FLT_UWORD_IS_NAN(iy)) /* x or y is NaN */ + return x+y; + if(hx==0x3f800000) return atanf(y); /* x=1.0 */ + m = ((hy>>31)&1)|((hx>>30)&2); /* 2*sign(x)+sign(y) */ + + /* when y = 0 */ + if(FLT_UWORD_IS_ZERO(iy)) { + switch(m) { + case 0: + case 1: return y; /* atan(+-0,+anything)=+-0 */ + case 2: return pi+tiny;/* atan(+0,-anything) = pi */ + case 3: return -pi-tiny;/* atan(-0,-anything) =-pi */ + } + } + /* when x = 0 */ + if(FLT_UWORD_IS_ZERO(ix)) return (hy<0)? -pi_o_2-tiny: pi_o_2+tiny; + + /* when x is INF */ + if(FLT_UWORD_IS_INFINITE(ix)) { + if(FLT_UWORD_IS_INFINITE(iy)) { + switch(m) { + case 0: return pi_o_4+tiny;/* atan(+INF,+INF) */ + case 1: return -pi_o_4-tiny;/* atan(-INF,+INF) */ + case 2: return (float)3.0*pi_o_4+tiny;/*atan(+INF,-INF)*/ + case 3: return (float)-3.0*pi_o_4-tiny;/*atan(-INF,-INF)*/ + } + } else { + switch(m) { + case 0: return zero ; /* atan(+...,+INF) */ + case 1: return -zero ; /* atan(-...,+INF) */ + case 2: return pi+tiny ; /* atan(+...,-INF) */ + case 3: return -pi-tiny ; /* atan(-...,-INF) */ + } + } + } + /* when y is INF */ + if(FLT_UWORD_IS_INFINITE(iy)) return (hy<0)? -pi_o_2-tiny: pi_o_2+tiny; + + /* compute y/x */ + k = (iy-ix)>>23; + if(k > 60) z=pi_o_2+(float)0.5*pi_lo; /* |y/x| > 2**60 */ + else if(hx<0&&k<-60) z=0.0; /* |y|/x < -2**60 */ + else z=atanf(fabsf(y/x)); /* safe to do y/x */ + switch (m) { + case 0: return z ; /* atan(+,+) */ + case 1: { + __uint32_t zh; + GET_FLOAT_WORD(zh,z); + SET_FLOAT_WORD(z,zh ^ 0x80000000); + } + return z ; /* atan(-,+) */ + case 2: return pi-(z-pi_lo);/* atan(+,-) */ + default: /* case 3 */ + return (z-pi_lo)-pi;/* atan(-,-) */ + } +}

ef_atan2.c Property changes : Added: svn:eol-style ## -0,0 +1 ## +native \ No newline at end of property Added: svn:keywords ## -0,0 +1 ## +Id \ No newline at end of property Index: wf_fmod.c =================================================================== --- wf_fmod.c (nonexistent) +++ wf_fmod.c (revision 158) @@ -0,0 +1,73 @@ +/* wf_fmod.c -- float version of w_fmod.c. + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + */ + +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +/* + * wrapper fmodf(x,y) + */ + +#include "fdlibm.h" +#include + +#ifdef __STDC__ + float fmodf(float x, float y) /* wrapper fmodf */ +#else + float fmodf(x,y) /* wrapper fmodf */ + float x,y; +#endif +{ +#ifdef _IEEE_LIBM + return __ieee754_fmodf(x,y); +#else + float z; + struct exception exc; + z = __ieee754_fmodf(x,y); + if(_LIB_VERSION == _IEEE_ ||isnanf(y)||isnanf(x)) return z; + if(y==(float)0.0) { + /* fmodf(x,0) */ + exc.type = DOMAIN; + exc.name = "fmodf"; + exc.err = 0; + exc.arg1 = (double)x; + exc.arg2 = (double)y; + if (_LIB_VERSION == _SVID_) + exc.retval = x; + else + exc.retval = 0.0/0.0; + if (_LIB_VERSION == _POSIX_) + errno = EDOM; + else if (!matherr(&exc)) { + errno = EDOM; + } + if (exc.err != 0) + errno = exc.err; + return (float)exc.retval; + } else + return z; +#endif +} + +#ifdef _DOUBLE_IS_32BITS + +#ifdef __STDC__ + double fmod(double x, double y) +#else + double fmod(x,y) + double x,y; +#endif +{ + return (double) fmodf((float) x, (float) y); +} + +#endif /* defined(_DOUBLE_IS_32BITS) */

wf_fmod.c Property changes : Added: svn:eol-style ## -0,0 +1 ## +native \ No newline at end of property Added: svn:keywords ## -0,0 +1 ## +Id \ No newline at end of property Index: ef_jn.c =================================================================== --- ef_jn.c (nonexistent) +++ ef_jn.c (revision 158) @@ -0,0 +1,207 @@ +/* ef_jn.c -- float version of e_jn.c. + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + */ + +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#include "fdlibm.h" + +#ifdef __STDC__ +static const float +#else +static float +#endif +invsqrtpi= 5.6418961287e-01, /* 0x3f106ebb */ +two = 2.0000000000e+00, /* 0x40000000 */ +one = 1.0000000000e+00; /* 0x3F800000 */ + +#ifdef __STDC__ +static const float zero = 0.0000000000e+00; +#else +static float zero = 0.0000000000e+00; +#endif + +#ifdef __STDC__ + float __ieee754_jnf(int n, float x) +#else + float __ieee754_jnf(n,x) + int n; float x; +#endif +{ + __int32_t i,hx,ix, sgn; + float a, b, temp, di; + float z, w; + + /* J(-n,x) = (-1)^n * J(n, x), J(n, -x) = (-1)^n * J(n, x) + * Thus, J(-n,x) = J(n,-x) + */ + GET_FLOAT_WORD(hx,x); + ix = 0x7fffffff&hx; + /* if J(n,NaN) is NaN */ + if(FLT_UWORD_IS_NAN(ix)) return x+x; + if(n<0){ + n = -n; + x = -x; + hx ^= 0x80000000; + } + if(n==0) return(__ieee754_j0f(x)); + if(n==1) return(__ieee754_j1f(x)); + sgn = (n&1)&(hx>>31); /* even n -- 0, odd n -- sign(x) */ + x = fabsf(x); + if(FLT_UWORD_IS_ZERO(ix)||FLT_UWORD_IS_INFINITE(ix)) + b = zero; + else if((float)n<=x) { + /* Safe to use J(n+1,x)=2n/x *J(n,x)-J(n-1,x) */ + a = __ieee754_j0f(x); + b = __ieee754_j1f(x); + for(i=1;i33) /* underflow */ + b = zero; + else { + temp = x*(float)0.5; b = temp; + for (a=one,i=2;i<=n;i++) { + a *= (float)i; /* a = n! */ + b *= temp; /* b = (x/2)^n */ + } + b = b/a; + } + } else { + /* use backward recurrence */ + /* x x^2 x^2 + * J(n,x)/J(n-1,x) = ---- ------ ------ ..... + * 2n - 2(n+1) - 2(n+2) + * + * 1 1 1 + * (for large x) = ---- ------ ------ ..... + * 2n 2(n+1) 2(n+2) + * -- - ------ - ------ - + * x x x + * + * Let w = 2n/x and h=2/x, then the above quotient + * is equal to the continued fraction: + * 1 + * = ----------------------- + * 1 + * w - ----------------- + * 1 + * w+h - --------- + * w+2h - ... + * + * To determine how many terms needed, let + * Q(0) = w, Q(1) = w(w+h) - 1, + * Q(k) = (w+k*h)*Q(k-1) - Q(k-2), + * When Q(k) > 1e4 good for single + * When Q(k) > 1e9 good for double + * When Q(k) > 1e17 good for quadruple + */ + /* determine k */ + float t,v; + float q0,q1,h,tmp; __int32_t k,m; + w = (n+n)/(float)x; h = (float)2.0/(float)x; + q0 = w; z = w+h; q1 = w*z - (float)1.0; k=1; + while(q1<(float)1.0e9) { + k += 1; z += h; + tmp = z*q1 - q0; + q0 = q1; + q1 = tmp; + } + m = n+n; + for(t=zero, i = 2*(n+k); i>=m; i -= 2) t = one/(i/x-t); + a = t; + b = one; + /* estimate log((2/x)^n*n!) = n*log(2/x)+n*ln(n) + * Hence, if n*(log(2n/x)) > ... + * single 8.8722839355e+01 + * double 7.09782712893383973096e+02 + * long double 1.1356523406294143949491931077970765006170e+04 + * then recurrent value may overflow and the result is + * likely underflow to zero + */ + tmp = n; + v = two/x; + tmp = tmp*__ieee754_logf(fabsf(v*tmp)); + if(tmp<(float)8.8721679688e+01) { + for(i=n-1,di=(float)(i+i);i>0;i--){ + temp = b; + b *= di; + b = b/x - a; + a = temp; + di -= two; + } + } else { + for(i=n-1,di=(float)(i+i);i>0;i--){ + temp = b; + b *= di; + b = b/x - a; + a = temp; + di -= two; + /* scale b to avoid spurious overflow */ + if(b>(float)1e10) { + a /= b; + t /= b; + b = one; + } + } + } + b = (t*__ieee754_j0f(x)/b); + } + } + if(sgn==1) return -b; else return b; +} + +#ifdef __STDC__ + float __ieee754_ynf(int n, float x) +#else + float __ieee754_ynf(n,x) + int n; float x; +#endif +{ + __int32_t i,hx,ix,ib; + __int32_t sign; + float a, b, temp; + + GET_FLOAT_WORD(hx,x); + ix = 0x7fffffff&hx; + /* if Y(n,NaN) is NaN */ + if(FLT_UWORD_IS_NAN(ix)) return x+x; + if(FLT_UWORD_IS_ZERO(ix)) return -one/zero; + if(hx<0) return zero/zero; + sign = 1; + if(n<0){ + n = -n; + sign = 1 - ((n&1)<<1); + } + if(n==0) return(__ieee754_y0f(x)); + if(n==1) return(sign*__ieee754_y1f(x)); + if(FLT_UWORD_IS_INFINITE(ix)) return zero; + + a = __ieee754_y0f(x); + b = __ieee754_y1f(x); + /* quit if b is -inf */ + GET_FLOAT_WORD(ib,b); + for(i=1;i0) return b; else return -b; +}

ef_jn.c Property changes : Added: svn:eol-style ## -0,0 +1 ## +native \ No newline at end of property Added: svn:keywords ## -0,0 +1 ## +Id \ No newline at end of property Index: w_exp.c =================================================================== --- w_exp.c (nonexistent) +++ w_exp.c (revision 158) @@ -0,0 +1,136 @@ + +/* @(#)w_exp.c 5.1 93/09/24 */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +/* +FUNCTION + <>, <>---exponential +INDEX + exp +INDEX + expf + +ANSI_SYNOPSIS + #include + double exp(double <[x]>); + float expf(float <[x]>); + +TRAD_SYNOPSIS + #include + double exp(<[x]>); + double <[x]>; + + float expf(<[x]>); + float <[x]>; + +DESCRIPTION + <> and <> calculate the exponential of <[x]>, that is, + @ifnottex + e raised to the power <[x]> (where e + @end ifnottex + @tex + $e^x$ (where $e$ + @end tex + is the base of the natural system of logarithms, approximately 2.71828). + + You can use the (non-ANSI) function <> to specify + error handling for these functions. + +RETURNS + On success, <> and <> return the calculated value. + If the result underflows, the returned value is <<0>>. If the + result overflows, the returned value is <>. In + either case, <> is set to <>. + +PORTABILITY + <> is ANSI C. <> is an extension. + +*/ + +/* + * wrapper exp(x) + */ + +#include "fdlibm.h" +#include + +#ifndef _DOUBLE_IS_32BITS + +#ifdef __STDC__ +static const double +#else +static double +#endif +o_threshold= 7.09782712893383973096e+02, /* 0x40862E42, 0xFEFA39EF */ +u_threshold= -7.45133219101941108420e+02; /* 0xc0874910, 0xD52D3051 */ + +#ifdef __STDC__ + double exp(double x) /* wrapper exp */ +#else + double exp(x) /* wrapper exp */ + double x; +#endif +{ +#ifdef _IEEE_LIBM + return __ieee754_exp(x); +#else + double z; + struct exception exc; + z = __ieee754_exp(x); + if(_LIB_VERSION == _IEEE_) return z; + if(finite(x)) { + if(x>o_threshold) { + /* exp(finite) overflow */ +#ifndef HUGE_VAL +#define HUGE_VAL inf + double inf = 0.0; + + SET_HIGH_WORD(inf,0x7ff00000); /* set inf to infinite */ +#endif + exc.type = OVERFLOW; + exc.name = "exp"; + exc.err = 0; + exc.arg1 = exc.arg2 = x; + if (_LIB_VERSION == _SVID_) + exc.retval = HUGE; + else + exc.retval = HUGE_VAL; + if (_LIB_VERSION == _POSIX_) + errno = ERANGE; + else if (!matherr(&exc)) { + errno = ERANGE; + } + if (exc.err != 0) + errno = exc.err; + return exc.retval; + } else if(x

w_exp.c Property changes : Added: svn:eol-style ## -0,0 +1 ## +native \ No newline at end of property Added: svn:keywords ## -0,0 +1 ## +Id \ No newline at end of property Index: w_acosh.c =================================================================== --- w_acosh.c (nonexistent) +++ w_acosh.c (revision 158) @@ -0,0 +1,122 @@ + +/* @(#)w_acosh.c 5.1 93/09/24 */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + * + */ + +/* +FUNCTION +<>, <>---inverse hyperbolic cosine + +INDEX +acosh +INDEX +acoshf + +ANSI_SYNOPSIS + #include + double acosh(double <[x]>); + float acoshf(float <[x]>); + +TRAD_SYNOPSIS + #include + double acosh(<[x]>) + double <[x]>; + + float acoshf(<[x]>) + float <[x]>; + +DESCRIPTION +<> calculates the inverse hyperbolic cosine of <[x]>. +<> is defined as +@ifnottex +. log(<[x]> + sqrt(<[x]>*<[x]>-1)) +@end ifnottex +@tex +$$ln\Bigl(x + \sqrt{x^2-1}\Bigr)$$ +@end tex + +<[x]> must be a number greater than or equal to 1. + +<> is identical, other than taking and returning floats. + +RETURNS +<> and <> return the calculated value. If <[x]> +less than 1, the return value is NaN and <> is set to <>. + +You can change the error-handling behavior with the non-ANSI +<> function. + +PORTABILITY +Neither <> nor <> are ANSI C. They are not recommended +for portable programs. + + +QUICKREF ANSI SVID POSIX RENTRANT + acos n,n,n,m + acosf n,n,n,m + +MATHREF + acosh, NAN, arg,DOMAIN,EDOM + acosh, < 1.0, NAN,DOMAIN,EDOM + acosh, >=1.0, acosh(arg),,, + +MATHREF + acoshf, NAN, arg,DOMAIN,EDOM + acoshf, < 1.0, NAN,DOMAIN,EDOM + acoshf, >=1.0, acosh(arg),,, + +*/ + +/* + * wrapper acosh(x) + */ + +#include "fdlibm.h" +#include + +#ifndef _DOUBLE_IS_32BITS + +#ifdef __STDC__ + double acosh(double x) /* wrapper acosh */ +#else + double acosh(x) /* wrapper acosh */ + double x; +#endif +{ +#ifdef _IEEE_LIBM + return __ieee754_acosh(x); +#else + double z; + struct exception exc; + z = __ieee754_acosh(x); + if(_LIB_VERSION == _IEEE_ || isnan(x)) return z; + if(x<1.0) { + /* acosh(x<1) */ + exc.type = DOMAIN; + exc.name = "acosh"; + exc.err = 0; + exc.arg1 = exc.arg2 = x; + exc.retval = 0.0/0.0; + if (_LIB_VERSION == _POSIX_) + errno = EDOM; + else if (!matherr(&exc)) { + errno = EDOM; + } + if (exc.err != 0) + errno = exc.err; + return exc.retval; + } else + return z; +#endif +} + +#endif /* defined(_DOUBLE_IS_32BITS) */

w_acosh.c Property changes : Added: svn:eol-style ## -0,0 +1 ## +native \ No newline at end of property Added: svn:keywords ## -0,0 +1 ## +Id \ No newline at end of property Index: w_sincos.c =================================================================== --- w_sincos.c (nonexistent) +++ w_sincos.c (revision 158) @@ -0,0 +1,22 @@ +/* sincos -- currently no more efficient than two separate calls to + sin and cos. */ + +#include "fdlibm.h" +#include + +#ifndef _DOUBLE_IS_32BITS + +#ifdef __STDC__ + void sincos(double x, double *sinx, double *cosx) +#else + void sincos(x, sinx, cosx) + double x; + double *sinx; + double *cosx; +#endif +{ + *sinx = sin (x); + *cosx = cos (x); +} + +#endif /* defined(_DOUBLE_IS_32BITS) */

w_sincos.c Property changes : Added: svn:eol-style ## -0,0 +1 ## +native \ No newline at end of property Added: svn:keywords ## -0,0 +1 ## +Id \ No newline at end of property Index: ef_rem_pio2.c =================================================================== --- ef_rem_pio2.c (nonexistent) +++ ef_rem_pio2.c (revision 158) @@ -0,0 +1,193 @@ +/* ef_rem_pio2.c -- float version of e_rem_pio2.c + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + */ + +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + * + */ + +/* __ieee754_rem_pio2f(x,y) + * + * return the remainder of x rem pi/2 in y[0]+y[1] + * use __kernel_rem_pio2f() + */ + +#include "fdlibm.h" + +/* + * Table of constants for 2/pi, 396 Hex digits (476 decimal) of 2/pi + */ +#ifdef __STDC__ +static const __int32_t two_over_pi[] = { +#else +static __int32_t two_over_pi[] = { +#endif +0xA2, 0xF9, 0x83, 0x6E, 0x4E, 0x44, 0x15, 0x29, 0xFC, +0x27, 0x57, 0xD1, 0xF5, 0x34, 0xDD, 0xC0, 0xDB, 0x62, +0x95, 0x99, 0x3C, 0x43, 0x90, 0x41, 0xFE, 0x51, 0x63, +0xAB, 0xDE, 0xBB, 0xC5, 0x61, 0xB7, 0x24, 0x6E, 0x3A, +0x42, 0x4D, 0xD2, 0xE0, 0x06, 0x49, 0x2E, 0xEA, 0x09, +0xD1, 0x92, 0x1C, 0xFE, 0x1D, 0xEB, 0x1C, 0xB1, 0x29, +0xA7, 0x3E, 0xE8, 0x82, 0x35, 0xF5, 0x2E, 0xBB, 0x44, +0x84, 0xE9, 0x9C, 0x70, 0x26, 0xB4, 0x5F, 0x7E, 0x41, +0x39, 0x91, 0xD6, 0x39, 0x83, 0x53, 0x39, 0xF4, 0x9C, +0x84, 0x5F, 0x8B, 0xBD, 0xF9, 0x28, 0x3B, 0x1F, 0xF8, +0x97, 0xFF, 0xDE, 0x05, 0x98, 0x0F, 0xEF, 0x2F, 0x11, +0x8B, 0x5A, 0x0A, 0x6D, 0x1F, 0x6D, 0x36, 0x7E, 0xCF, +0x27, 0xCB, 0x09, 0xB7, 0x4F, 0x46, 0x3F, 0x66, 0x9E, +0x5F, 0xEA, 0x2D, 0x75, 0x27, 0xBA, 0xC7, 0xEB, 0xE5, +0xF1, 0x7B, 0x3D, 0x07, 0x39, 0xF7, 0x8A, 0x52, 0x92, +0xEA, 0x6B, 0xFB, 0x5F, 0xB1, 0x1F, 0x8D, 0x5D, 0x08, +0x56, 0x03, 0x30, 0x46, 0xFC, 0x7B, 0x6B, 0xAB, 0xF0, +0xCF, 0xBC, 0x20, 0x9A, 0xF4, 0x36, 0x1D, 0xA9, 0xE3, +0x91, 0x61, 0x5E, 0xE6, 0x1B, 0x08, 0x65, 0x99, 0x85, +0x5F, 0x14, 0xA0, 0x68, 0x40, 0x8D, 0xFF, 0xD8, 0x80, +0x4D, 0x73, 0x27, 0x31, 0x06, 0x06, 0x15, 0x56, 0xCA, +0x73, 0xA8, 0xC9, 0x60, 0xE2, 0x7B, 0xC0, 0x8C, 0x6B, +}; + +/* This array is like the one in e_rem_pio2.c, but the numbers are + single precision and the last 8 bits are forced to 0. */ +#ifdef __STDC__ +static const __int32_t npio2_hw[] = { +#else +static __int32_t npio2_hw[] = { +#endif +0x3fc90f00, 0x40490f00, 0x4096cb00, 0x40c90f00, 0x40fb5300, 0x4116cb00, +0x412fed00, 0x41490f00, 0x41623100, 0x417b5300, 0x418a3a00, 0x4196cb00, +0x41a35c00, 0x41afed00, 0x41bc7e00, 0x41c90f00, 0x41d5a000, 0x41e23100, +0x41eec200, 0x41fb5300, 0x4203f200, 0x420a3a00, 0x42108300, 0x4216cb00, +0x421d1400, 0x42235c00, 0x4229a500, 0x422fed00, 0x42363600, 0x423c7e00, +0x4242c700, 0x42490f00 +}; + +/* + * invpio2: 24 bits of 2/pi + * pio2_1: first 17 bit of pi/2 + * pio2_1t: pi/2 - pio2_1 + * pio2_2: second 17 bit of pi/2 + * pio2_2t: pi/2 - (pio2_1+pio2_2) + * pio2_3: third 17 bit of pi/2 + * pio2_3t: pi/2 - (pio2_1+pio2_2+pio2_3) + */ + +#ifdef __STDC__ +static const float +#else +static float +#endif +zero = 0.0000000000e+00, /* 0x00000000 */ +half = 5.0000000000e-01, /* 0x3f000000 */ +two8 = 2.5600000000e+02, /* 0x43800000 */ +invpio2 = 6.3661980629e-01, /* 0x3f22f984 */ +pio2_1 = 1.5707855225e+00, /* 0x3fc90f80 */ +pio2_1t = 1.0804334124e-05, /* 0x37354443 */ +pio2_2 = 1.0804273188e-05, /* 0x37354400 */ +pio2_2t = 6.0770999344e-11, /* 0x2e85a308 */ +pio2_3 = 6.0770943833e-11, /* 0x2e85a300 */ +pio2_3t = 6.1232342629e-17; /* 0x248d3132 */ + +#ifdef __STDC__ + __int32_t __ieee754_rem_pio2f(float x, float *y) +#else + __int32_t __ieee754_rem_pio2f(x,y) + float x,y[]; +#endif +{ + float z,w,t,r,fn; + float tx[3]; + __int32_t i,j,n,ix,hx; + int e0,nx; + + GET_FLOAT_WORD(hx,x); + ix = hx&0x7fffffff; + if(ix<=0x3f490fd8) /* |x| ~<= pi/4 , no need for reduction */ + {y[0] = x; y[1] = 0; return 0;} + if(ix<0x4016cbe4) { /* |x| < 3pi/4, special case with n=+-1 */ + if(hx>0) { + z = x - pio2_1; + if((ix&0xfffffff0)!=0x3fc90fd0) { /* 24+24 bit pi OK */ + y[0] = z - pio2_1t; + y[1] = (z-y[0])-pio2_1t; + } else { /* near pi/2, use 24+24+24 bit pi */ + z -= pio2_2; + y[0] = z - pio2_2t; + y[1] = (z-y[0])-pio2_2t; + } + return 1; + } else { /* negative x */ + z = x + pio2_1; + if((ix&0xfffffff0)!=0x3fc90fd0) { /* 24+24 bit pi OK */ + y[0] = z + pio2_1t; + y[1] = (z-y[0])+pio2_1t; + } else { /* near pi/2, use 24+24+24 bit pi */ + z += pio2_2; + y[0] = z + pio2_2t; + y[1] = (z-y[0])+pio2_2t; + } + return -1; + } + } + if(ix<=0x43490f80) { /* |x| ~<= 2^7*(pi/2), medium size */ + t = fabsf(x); + n = (__int32_t) (t*invpio2+half); + fn = (float)n; + r = t-fn*pio2_1; + w = fn*pio2_1t; /* 1st round good to 40 bit */ + if(n<32&&(ix&0xffffff00)!=npio2_hw[n-1]) { + y[0] = r-w; /* quick check no cancellation */ + } else { + __uint32_t high; + j = ix>>23; + y[0] = r-w; + GET_FLOAT_WORD(high,y[0]); + i = j-((high>>23)&0xff); + if(i>8) { /* 2nd iteration needed, good to 57 */ + t = r; + w = fn*pio2_2; + r = t-w; + w = fn*pio2_2t-((t-r)-w); + y[0] = r-w; + GET_FLOAT_WORD(high,y[0]); + i = j-((high>>23)&0xff); + if(i>25) { /* 3rd iteration need, 74 bits acc */ + t = r; /* will cover all possible cases */ + w = fn*pio2_3; + r = t-w; + w = fn*pio2_3t-((t-r)-w); + y[0] = r-w; + } + } + } + y[1] = (r-y[0])-w; + if(hx<0) {y[0] = -y[0]; y[1] = -y[1]; return -n;} + else return n; + } + /* + * all other (large) arguments + */ + if(!FLT_UWORD_IS_FINITE(ix)) { + y[0]=y[1]=x-x; return 0; + } + /* set z = scalbn(|x|,ilogb(x)-7) */ + e0 = (int)((ix>>23)-134); /* e0 = ilogb(z)-7; */ + SET_FLOAT_WORD(z, ix - ((__int32_t)e0<<23)); + for(i=0;i<2;i++) { + tx[i] = (float)((__int32_t)(z)); + z = (z-tx[i])*two8; + } + tx[2] = z; + nx = 3; + while(tx[nx-1]==zero) nx--; /* skip zero term */ + n = __kernel_rem_pio2f(tx,y,e0,nx,2,two_over_pi); + if(hx<0) {y[0] = -y[0]; y[1] = -y[1]; return -n;} + return n; +}

ef_rem_pio2.c Property changes : Added: svn:eol-style ## -0,0 +1 ## +native \ No newline at end of property Added: svn:keywords ## -0,0 +1 ## +Id \ No newline at end of property Index: k_rem_pio2.c =================================================================== --- k_rem_pio2.c (nonexistent) +++ k_rem_pio2.c (revision 158) @@ -0,0 +1,320 @@ + +/* @(#)k_rem_pio2.c 5.1 93/09/24 */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +/* + * __kernel_rem_pio2(x,y,e0,nx,prec,ipio2) + * double x[],y[]; int e0,nx,prec; int ipio2[]; + * + * __kernel_rem_pio2 return the last three digits of N with + * y = x - N*pi/2 + * so that |y| < pi/2. + * + * The method is to compute the integer (mod 8) and fraction parts of + * (2/pi)*x without doing the full multiplication. In general we + * skip the part of the product that are known to be a huge integer ( + * more accurately, = 0 mod 8 ). Thus the number of operations are + * independent of the exponent of the input. + * + * (2/pi) is represented by an array of 24-bit integers in ipio2[]. + * + * Input parameters: + * x[] The input value (must be positive) is broken into nx + * pieces of 24-bit integers in double precision format. + * x[i] will be the i-th 24 bit of x. The scaled exponent + * of x[0] is given in input parameter e0 (i.e., x[0]*2^e0 + * match x's up to 24 bits. + * + * Example of breaking a double positive z into x[0]+x[1]+x[2]: + * e0 = ilogb(z)-23 + * z = scalbn(z,-e0) + * for i = 0,1,2 + * x[i] = floor(z) + * z = (z-x[i])*2**24 + * + * + * y[] ouput result in an array of double precision numbers. + * The dimension of y[] is: + * 24-bit precision 1 + * 53-bit precision 2 + * 64-bit precision 2 + * 113-bit precision 3 + * The actual value is the sum of them. Thus for 113-bit + * precison, one may have to do something like: + * + * long double t,w,r_head, r_tail; + * t = (long double)y[2] + (long double)y[1]; + * w = (long double)y[0]; + * r_head = t+w; + * r_tail = w - (r_head - t); + * + * e0 The exponent of x[0] + * + * nx dimension of x[] + * + * prec an integer indicating the precision: + * 0 24 bits (single) + * 1 53 bits (double) + * 2 64 bits (extended) + * 3 113 bits (quad) + * + * ipio2[] + * integer array, contains the (24*i)-th to (24*i+23)-th + * bit of 2/pi after binary point. The corresponding + * floating value is + * + * ipio2[i] * 2^(-24(i+1)). + * + * External function: + * double scalbn(), floor(); + * + * + * Here is the description of some local variables: + * + * jk jk+1 is the initial number of terms of ipio2[] needed + * in the computation. The recommended value is 2,3,4, + * 6 for single, double, extended,and quad. + * + * jz local integer variable indicating the number of + * terms of ipio2[] used. + * + * jx nx - 1 + * + * jv index for pointing to the suitable ipio2[] for the + * computation. In general, we want + * ( 2^e0*x[0] * ipio2[jv-1]*2^(-24jv) )/8 + * is an integer. Thus + * e0-3-24*jv >= 0 or (e0-3)/24 >= jv + * Hence jv = max(0,(e0-3)/24). + * + * jp jp+1 is the number of terms in PIo2[] needed, jp = jk. + * + * q[] double array with integral value, representing the + * 24-bits chunk of the product of x and 2/pi. + * + * q0 the corresponding exponent of q[0]. Note that the + * exponent for q[i] would be q0-24*i. + * + * PIo2[] double precision array, obtained by cutting pi/2 + * into 24 bits chunks. + * + * f[] ipio2[] in floating point + * + * iq[] integer array by breaking up q[] in 24-bits chunk. + * + * fq[] final product of x*(2/pi) in fq[0],..,fq[jk] + * + * ih integer. If >0 it indicates q[] is >= 0.5, hence + * it also indicates the *sign* of the result. + * + */ + + +/* + * Constants: + * The hexadecimal values are the intended ones for the following + * constants. The decimal values may be used, provided that the + * compiler will convert from decimal to binary accurately enough + * to produce the hexadecimal values shown. + */ + +#include "fdlibm.h" + +#ifndef _DOUBLE_IS_32BITS + +#ifdef __STDC__ +static const int init_jk[] = {2,3,4,6}; /* initial value for jk */ +#else +static int init_jk[] = {2,3,4,6}; +#endif + +#ifdef __STDC__ +static const double PIo2[] = { +#else +static double PIo2[] = { +#endif + 1.57079625129699707031e+00, /* 0x3FF921FB, 0x40000000 */ + 7.54978941586159635335e-08, /* 0x3E74442D, 0x00000000 */ + 5.39030252995776476554e-15, /* 0x3CF84698, 0x80000000 */ + 3.28200341580791294123e-22, /* 0x3B78CC51, 0x60000000 */ + 1.27065575308067607349e-29, /* 0x39F01B83, 0x80000000 */ + 1.22933308981111328932e-36, /* 0x387A2520, 0x40000000 */ + 2.73370053816464559624e-44, /* 0x36E38222, 0x80000000 */ + 2.16741683877804819444e-51, /* 0x3569F31D, 0x00000000 */ +}; + +#ifdef __STDC__ +static const double +#else +static double +#endif +zero = 0.0, +one = 1.0, +two24 = 1.67772160000000000000e+07, /* 0x41700000, 0x00000000 */ +twon24 = 5.96046447753906250000e-08; /* 0x3E700000, 0x00000000 */ + +#ifdef __STDC__ + int __kernel_rem_pio2(double *x, double *y, int e0, int nx, int prec, const __int32_t *ipio2) +#else + int __kernel_rem_pio2(x,y,e0,nx,prec,ipio2) + double x[], y[]; int e0,nx,prec; __int32_t ipio2[]; +#endif +{ + __int32_t jz,jx,jv,jp,jk,carry,n,iq[20],i,j,k,m,q0,ih; + double z,fw,f[20],fq[20],q[20]; + + /* initialize jk*/ + jk = init_jk[prec]; + jp = jk; + + /* determine jx,jv,q0, note that 3>q0 */ + jx = nx-1; + jv = (e0-3)/24; if(jv<0) jv=0; + q0 = e0-24*(jv+1); + + /* set up f[0] to f[jx+jk] where f[jx+jk] = ipio2[jv+jk] */ + j = jv-jx; m = jx+jk; + for(i=0;i<=m;i++,j++) f[i] = (j<0)? zero : (double) ipio2[j]; + + /* compute q[0],q[1],...q[jk] */ + for (i=0;i<=jk;i++) { + for(j=0,fw=0.0;j<=jx;j++) fw += x[j]*f[jx+i-j]; q[i] = fw; + } + + jz = jk; +recompute: + /* distill q[] into iq[] reversingly */ + for(i=0,j=jz,z=q[jz];j>0;i++,j--) { + fw = (double)((__int32_t)(twon24* z)); + iq[i] = (__int32_t)(z-two24*fw); + z = q[j-1]+fw; + } + + /* compute n */ + z = scalbn(z,(int)q0); /* actual value of z */ + z -= 8.0*floor(z*0.125); /* trim off integer >= 8 */ + n = (__int32_t) z; + z -= (double)n; + ih = 0; + if(q0>0) { /* need iq[jz-1] to determine n */ + i = (iq[jz-1]>>(24-q0)); n += i; + iq[jz-1] -= i<<(24-q0); + ih = iq[jz-1]>>(23-q0); + } + else if(q0==0) ih = iq[jz-1]>>23; + else if(z>=0.5) ih=2; + + if(ih>0) { /* q > 0.5 */ + n += 1; carry = 0; + for(i=0;i0) { /* rare case: chance is 1 in 12 */ + switch(q0) { + case 1: + iq[jz-1] &= 0x7fffff; break; + case 2: + iq[jz-1] &= 0x3fffff; break; + } + } + if(ih==2) { + z = one - z; + if(carry!=0) z -= scalbn(one,(int)q0); + } + } + + /* check if recomputation is needed */ + if(z==zero) { + j = 0; + for (i=jz-1;i>=jk;i--) j |= iq[i]; + if(j==0) { /* need recomputation */ + for(k=1;iq[jk-k]==0;k++); /* k = no. of terms needed */ + + for(i=jz+1;i<=jz+k;i++) { /* add q[jz+1] to q[jz+k] */ + f[jx+i] = (double) ipio2[jv+i]; + for(j=0,fw=0.0;j<=jx;j++) fw += x[j]*f[jx+i-j]; + q[i] = fw; + } + jz += k; + goto recompute; + } + } + + /* chop off zero terms */ + if(z==0.0) { + jz -= 1; q0 -= 24; + while(iq[jz]==0) { jz--; q0-=24;} + } else { /* break z into 24-bit if necessary */ + z = scalbn(z,-(int)q0); + if(z>=two24) { + fw = (double)((__int32_t)(twon24*z)); + iq[jz] = (__int32_t)(z-two24*fw); + jz += 1; q0 += 24; + iq[jz] = (__int32_t) fw; + } else iq[jz] = (__int32_t) z ; + } + + /* convert integer "bit" chunk to floating-point value */ + fw = scalbn(one,(int)q0); + for(i=jz;i>=0;i--) { + q[i] = fw*(double)iq[i]; fw*=twon24; + } + + /* compute PIo2[0,...,jp]*q[jz,...,0] */ + for(i=jz;i>=0;i--) { + for(fw=0.0,k=0;k<=jp&&k<=jz-i;k++) fw += PIo2[k]*q[i+k]; + fq[jz-i] = fw; + } + + /* compress fq[] into y[] */ + switch(prec) { + case 0: + fw = 0.0; + for (i=jz;i>=0;i--) fw += fq[i]; + y[0] = (ih==0)? fw: -fw; + break; + case 1: + case 2: + fw = 0.0; + for (i=jz;i>=0;i--) fw += fq[i]; + y[0] = (ih==0)? fw: -fw; + fw = fq[0]-fw; + for (i=1;i<=jz;i++) fw += fq[i]; + y[1] = (ih==0)? fw: -fw; + break; + case 3: /* painful */ + for (i=jz;i>0;i--) { + fw = fq[i-1]+fq[i]; + fq[i] += fq[i-1]-fw; + fq[i-1] = fw; + } + for (i=jz;i>1;i--) { + fw = fq[i-1]+fq[i]; + fq[i] += fq[i-1]-fw; + fq[i-1] = fw; + } + for (fw=0.0,i=jz;i>=2;i--) fw += fq[i]; + if(ih==0) { + y[0] = fq[0]; y[1] = fq[1]; y[2] = fw; + } else { + y[0] = -fq[0]; y[1] = -fq[1]; y[2] = -fw; + } + } + return n&7; +} + +#endif /* defined(_DOUBLE_IS_32BITS) */

k_rem_pio2.c Property changes : Added: svn:eol-style ## -0,0 +1 ## +native \ No newline at end of property Added: svn:keywords ## -0,0 +1 ## +Id \ No newline at end of property Index: wf_atanh.c =================================================================== --- wf_atanh.c (nonexistent) +++ wf_atanh.c (revision 158) @@ -0,0 +1,83 @@ +/* wf_atanh.c -- float version of w_atanh.c. + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + */ + +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ +/* + * wrapper atanhf(x) + */ + +#include "fdlibm.h" +#include + +#ifdef __STDC__ + float atanhf(float x) /* wrapper atanhf */ +#else + float atanhf(x) /* wrapper atanhf */ + float x; +#endif +{ +#ifdef _IEEE_LIBM + return __ieee754_atanhf(x); +#else + float z,y; + struct exception exc; + z = __ieee754_atanhf(x); + if(_LIB_VERSION == _IEEE_ || isnanf(x)) return z; + y = fabsf(x); + if(y>=(float)1.0) { + if(y>(float)1.0) { + /* atanhf(|x|>1) */ + exc.type = DOMAIN; + exc.name = "atanhf"; + exc.err = 0; + exc.arg1 = exc.arg2 = (double)x; + exc.retval = 0.0/0.0; + if (_LIB_VERSION == _POSIX_) + errno = EDOM; + else if (!matherr(&exc)) { + errno = EDOM; + } + } else { + /* atanhf(|x|=1) */ + exc.type = SING; + exc.name = "atanhf"; + exc.err = 0; + exc.arg1 = exc.arg2 = (double)x; + exc.retval = x/0.0; /* sign(x)*inf */ + if (_LIB_VERSION == _POSIX_) + errno = EDOM; + else if (!matherr(&exc)) { + errno = EDOM; + } + } + if (exc.err != 0) + errno = exc.err; + return (float)exc.retval; + } else + return z; +#endif +} + +#ifdef _DOUBLE_IS_32BITS + +#ifdef __STDC__ + double atanh(double x) +#else + double atanh(x) + double x; +#endif +{ + return (double) atanhf((float) x); +} + +#endif /* defined(_DOUBLE_IS_32BITS) */

wf_atanh.c Property changes : Added: svn:eol-style ## -0,0 +1 ## +native \ No newline at end of property Added: svn:keywords ## -0,0 +1 ## +Id \ No newline at end of property Index: wf_sincos.c =================================================================== --- wf_sincos.c (nonexistent) +++ wf_sincos.c (revision 158) @@ -0,0 +1,33 @@ +/* sincos -- currently no more efficient than two separate calls to + sin and cos. */ +#include "fdlibm.h" +#include + +#ifdef __STDC__ + void sincosf(float x, float *sinx, float *cosx) +#else + void sincosf(x, sinx, cosx) + float x; + float *sinx; + float *cosx; +#endif +{ + *sinx = sinf (x); + *cosx = cosf (x); +} + +#ifdef _DOUBLE_IS_32BITS + +#ifdef __STDC__ + void sincos(double x, double *sinx, double *cosx) +#else + void sincos(x, sinx, cosx) + double x; + double sinx; + double cosx; +#endif +{ + *sinx = sinf((float) x); + *cosx = cosf((float) x); +} +#endif /* defined(_DOUBLE_IS_32BITS) */

wf_sincos.c Property changes : Added: svn:eol-style ## -0,0 +1 ## +native \ No newline at end of property Added: svn:keywords ## -0,0 +1 ## +Id \ No newline at end of property Index: w_atan2.c =================================================================== --- w_atan2.c (nonexistent) +++ w_atan2.c (revision 158) @@ -0,0 +1,90 @@ + +/* @(#)w_atan2.c 5.1 93/09/24 */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + * + */ + +/* +FUNCTION + <>, <>---arc tangent of y/x + +INDEX + atan2 +INDEX + atan2f + +ANSI_SYNOPSIS + #include + double atan2(double <[y]>,double <[x]>); + float atan2f(float <[y]>,float <[x]>); + +TRAD_SYNOPSIS + #include + double atan2(<[y]>,<[x]>); + double <[y]>; + double <[x]>; + + float atan2f(<[y]>,<[x]>); + float <[y]>; + float <[x]>; + +DESCRIPTION + +<> computes the inverse tangent (arc tangent) of <[y]>/<[x]>. +<> produces the correct result even for angles near +@ifnottex +pi/2 or -pi/2 +@end ifnottex +@tex +$\pi/2$ or $-\pi/2$ +@end tex +(that is, when <[x]> is near 0). + +<> is identical to <>, save that it takes and returns +<>. + +RETURNS +<> and <> return a value in radians, in the range of +@ifnottex +-pi to pi. +@end ifnottex +@tex +$-\pi$ to $\pi$. +@end tex + +You can modify error handling for these functions using <>. + +PORTABILITY +<> is ANSI C. <> is an extension. + + +*/ + +/* + * wrapper atan2(y,x) + */ + +#include "fdlibm.h" +#include + +#ifndef _DOUBLE_IS_32BITS + +#ifdef __STDC__ + double atan2(double y, double x) /* wrapper atan2 */ +#else + double atan2(y,x) /* wrapper atan2 */ + double y,x; +#endif +{ + return __ieee754_atan2(y,x); +} + +#endif /* defined(_DOUBLE_IS_32BITS) */

w_atan2.c Property changes : Added: svn:eol-style ## -0,0 +1 ## +native \ No newline at end of property Added: svn:keywords ## -0,0 +1 ## +Id \ No newline at end of property Index: kf_rem_pio2.c =================================================================== --- kf_rem_pio2.c (nonexistent) +++ kf_rem_pio2.c (revision 158) @@ -0,0 +1,208 @@ +/* kf_rem_pio2.c -- float version of k_rem_pio2.c + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + */ + +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#include "fdlibm.h" + +/* In the float version, the input parameter x contains 8 bit + integers, not 24 bit integers. 113 bit precision is not supported. */ + +#ifdef __STDC__ +static const int init_jk[] = {4,7,9}; /* initial value for jk */ +#else +static int init_jk[] = {4,7,9}; +#endif + +#ifdef __STDC__ +static const float PIo2[] = { +#else +static float PIo2[] = { +#endif + 1.5703125000e+00, /* 0x3fc90000 */ + 4.5776367188e-04, /* 0x39f00000 */ + 2.5987625122e-05, /* 0x37da0000 */ + 7.5437128544e-08, /* 0x33a20000 */ + 6.0026650317e-11, /* 0x2e840000 */ + 7.3896444519e-13, /* 0x2b500000 */ + 5.3845816694e-15, /* 0x27c20000 */ + 5.6378512969e-18, /* 0x22d00000 */ + 8.3009228831e-20, /* 0x1fc40000 */ + 3.2756352257e-22, /* 0x1bc60000 */ + 6.3331015649e-25, /* 0x17440000 */ +}; + +#ifdef __STDC__ +static const float +#else +static float +#endif +zero = 0.0, +one = 1.0, +two8 = 2.5600000000e+02, /* 0x43800000 */ +twon8 = 3.9062500000e-03; /* 0x3b800000 */ + +#ifdef __STDC__ + int __kernel_rem_pio2f(float *x, float *y, int e0, int nx, int prec, const __int32_t *ipio2) +#else + int __kernel_rem_pio2f(x,y,e0,nx,prec,ipio2) + float x[], y[]; int e0,nx,prec; __int32_t ipio2[]; +#endif +{ + __int32_t jz,jx,jv,jp,jk,carry,n,iq[20],i,j,k,m,q0,ih; + float z,fw,f[20],fq[20],q[20]; + + /* initialize jk*/ + jk = init_jk[prec]; + jp = jk; + + /* determine jx,jv,q0, note that 3>q0 */ + jx = nx-1; + jv = (e0-3)/8; if(jv<0) jv=0; + q0 = e0-8*(jv+1); + + /* set up f[0] to f[jx+jk] where f[jx+jk] = ipio2[jv+jk] */ + j = jv-jx; m = jx+jk; + for(i=0;i<=m;i++,j++) f[i] = (j<0)? zero : (float) ipio2[j]; + + /* compute q[0],q[1],...q[jk] */ + for (i=0;i<=jk;i++) { + for(j=0,fw=0.0;j<=jx;j++) fw += x[j]*f[jx+i-j]; q[i] = fw; + } + + jz = jk; +recompute: + /* distill q[] into iq[] reversingly */ + for(i=0,j=jz,z=q[jz];j>0;i++,j--) { + fw = (float)((__int32_t)(twon8* z)); + iq[i] = (__int32_t)(z-two8*fw); + z = q[j-1]+fw; + } + + /* compute n */ + z = scalbnf(z,(int)q0); /* actual value of z */ + z -= (float)8.0*floorf(z*(float)0.125); /* trim off integer >= 8 */ + n = (__int32_t) z; + z -= (float)n; + ih = 0; + if(q0>0) { /* need iq[jz-1] to determine n */ + i = (iq[jz-1]>>(8-q0)); n += i; + iq[jz-1] -= i<<(8-q0); + ih = iq[jz-1]>>(7-q0); + } + else if(q0==0) ih = iq[jz-1]>>8; + else if(z>=(float)0.5) ih=2; + + if(ih>0) { /* q > 0.5 */ + n += 1; carry = 0; + for(i=0;i0) { /* rare case: chance is 1 in 12 */ + switch(q0) { + case 1: + iq[jz-1] &= 0x7f; break; + case 2: + iq[jz-1] &= 0x3f; break; + } + } + if(ih==2) { + z = one - z; + if(carry!=0) z -= scalbnf(one,(int)q0); + } + } + + /* check if recomputation is needed */ + if(z==zero) { + j = 0; + for (i=jz-1;i>=jk;i--) j |= iq[i]; + if(j==0) { /* need recomputation */ + for(k=1;iq[jk-k]==0;k++); /* k = no. of terms needed */ + + for(i=jz+1;i<=jz+k;i++) { /* add q[jz+1] to q[jz+k] */ + f[jx+i] = (float) ipio2[jv+i]; + for(j=0,fw=0.0;j<=jx;j++) fw += x[j]*f[jx+i-j]; + q[i] = fw; + } + jz += k; + goto recompute; + } + } + + /* chop off zero terms */ + if(z==(float)0.0) { + jz -= 1; q0 -= 8; + while(iq[jz]==0) { jz--; q0-=8;} + } else { /* break z into 8-bit if necessary */ + z = scalbnf(z,-(int)q0); + if(z>=two8) { + fw = (float)((__int32_t)(twon8*z)); + iq[jz] = (__int32_t)(z-two8*fw); + jz += 1; q0 += 8; + iq[jz] = (__int32_t) fw; + } else iq[jz] = (__int32_t) z ; + } + + /* convert integer "bit" chunk to floating-point value */ + fw = scalbnf(one,(int)q0); + for(i=jz;i>=0;i--) { + q[i] = fw*(float)iq[i]; fw*=twon8; + } + + /* compute PIo2[0,...,jp]*q[jz,...,0] */ + for(i=jz;i>=0;i--) { + for(fw=0.0,k=0;k<=jp&&k<=jz-i;k++) fw += PIo2[k]*q[i+k]; + fq[jz-i] = fw; + } + + /* compress fq[] into y[] */ + switch(prec) { + case 0: + fw = 0.0; + for (i=jz;i>=0;i--) fw += fq[i]; + y[0] = (ih==0)? fw: -fw; + break; + case 1: + case 2: + fw = 0.0; + for (i=jz;i>=0;i--) fw += fq[i]; + y[0] = (ih==0)? fw: -fw; + fw = fq[0]-fw; + for (i=1;i<=jz;i++) fw += fq[i]; + y[1] = (ih==0)? fw: -fw; + break; + case 3: /* painful */ + for (i=jz;i>0;i--) { + fw = fq[i-1]+fq[i]; + fq[i] += fq[i-1]-fw; + fq[i-1] = fw; + } + for (i=jz;i>1;i--) { + fw = fq[i-1]+fq[i]; + fq[i] += fq[i-1]-fw; + fq[i-1] = fw; + } + for (fw=0.0,i=jz;i>=2;i--) fw += fq[i]; + if(ih==0) { + y[0] = fq[0]; y[1] = fq[1]; y[2] = fw; + } else { + y[0] = -fq[0]; y[1] = -fq[1]; y[2] = -fw; + } + } + return n&7; +}

kf_rem_pio2.c Property changes : Added: svn:eol-style ## -0,0 +1 ## +native \ No newline at end of property Added: svn:keywords ## -0,0 +1 ## +Id \ No newline at end of property Index: e_sqrt.c =================================================================== --- e_sqrt.c (nonexistent) +++ e_sqrt.c (revision 158) @@ -0,0 +1,452 @@ + +/* @(#)e_sqrt.c 5.1 93/09/24 */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +/* __ieee754_sqrt(x) + * Return correctly rounded sqrt. + * ------------------------------------------ + * | Use the hardware sqrt if you have one | + * ------------------------------------------ + * Method: + * Bit by bit method using integer arithmetic. (Slow, but portable) + * 1. Normalization + * Scale x to y in [1,4) with even powers of 2: + * find an integer k such that 1 <= (y=x*2^(2k)) < 4, then + * sqrt(x) = 2^k * sqrt(y) + * 2. Bit by bit computation + * Let q = sqrt(y) truncated to i bit after binary point (q = 1), + * i 0 + * i+1 2 + * s = 2*q , and y = 2 * ( y - q ). (1) + * i i i i + * + * To compute q from q , one checks whether + * i+1 i + * + * -(i+1) 2 + * (q + 2 ) <= y. (2) + * i + * -(i+1) + * If (2) is false, then q = q ; otherwise q = q + 2 . + * i+1 i i+1 i + * + * With some algebric manipulation, it is not difficult to see + * that (2) is equivalent to + * -(i+1) + * s + 2 <= y (3) + * i i + * + * The advantage of (3) is that s and y can be computed by + * i i + * the following recurrence formula: + * if (3) is false + * + * s = s , y = y ; (4) + * i+1 i i+1 i + * + * otherwise, + * -i -(i+1) + * s = s + 2 , y = y - s - 2 (5) + * i+1 i i+1 i i + * + * One may easily use induction to prove (4) and (5). + * Note. Since the left hand side of (3) contain only i+2 bits, + * it does not necessary to do a full (53-bit) comparison + * in (3). + * 3. Final rounding + * After generating the 53 bits result, we compute one more bit. + * Together with the remainder, we can decide whether the + * result is exact, bigger than 1/2ulp, or less than 1/2ulp + * (it will never equal to 1/2ulp). + * The rounding mode can be detected by checking whether + * huge + tiny is equal to huge, and whether huge - tiny is + * equal to huge for some floating point number "huge" and "tiny". + * + * Special cases: + * sqrt(+-0) = +-0 ... exact + * sqrt(inf) = inf + * sqrt(-ve) = NaN ... with invalid signal + * sqrt(NaN) = NaN ... with invalid signal for signaling NaN + * + * Other methods : see the appended file at the end of the program below. + *--------------- + */ + +#include "fdlibm.h" + +#ifndef _DOUBLE_IS_32BITS + +#ifdef __STDC__ +static const double one = 1.0, tiny=1.0e-300; +#else +static double one = 1.0, tiny=1.0e-300; +#endif + +#ifdef __STDC__ + double __ieee754_sqrt(double x) +#else + double __ieee754_sqrt(x) + double x; +#endif +{ + double z; + __int32_t sign = (int)0x80000000; + __uint32_t r,t1,s1,ix1,q1; + __int32_t ix0,s0,q,m,t,i; + + EXTRACT_WORDS(ix0,ix1,x); + + /* take care of Inf and NaN */ + if((ix0&0x7ff00000)==0x7ff00000) { + return x*x+x; /* sqrt(NaN)=NaN, sqrt(+inf)=+inf + sqrt(-inf)=sNaN */ + } + /* take care of zero */ + if(ix0<=0) { + if(((ix0&(~sign))|ix1)==0) return x;/* sqrt(+-0) = +-0 */ + else if(ix0<0) + return (x-x)/(x-x); /* sqrt(-ve) = sNaN */ + } + /* normalize x */ + m = (ix0>>20); + if(m==0) { /* subnormal x */ + while(ix0==0) { + m -= 21; + ix0 |= (ix1>>11); ix1 <<= 21; + } + for(i=0;(ix0&0x00100000)==0;i++) ix0<<=1; + m -= i-1; + ix0 |= (ix1>>(32-i)); + ix1 <<= i; + } + m -= 1023; /* unbias exponent */ + ix0 = (ix0&0x000fffff)|0x00100000; + if(m&1){ /* odd m, double x to make it even */ + ix0 += ix0 + ((ix1&sign)>>31); + ix1 += ix1; + } + m >>= 1; /* m = [m/2] */ + + /* generate sqrt(x) bit by bit */ + ix0 += ix0 + ((ix1&sign)>>31); + ix1 += ix1; + q = q1 = s0 = s1 = 0; /* [q,q1] = sqrt(x) */ + r = 0x00200000; /* r = moving bit from right to left */ + + while(r!=0) { + t = s0+r; + if(t<=ix0) { + s0 = t+r; + ix0 -= t; + q += r; + } + ix0 += ix0 + ((ix1&sign)>>31); + ix1 += ix1; + r>>=1; + } + + r = sign; + while(r!=0) { + t1 = s1+r; + t = s0; + if((t>31); + ix1 += ix1; + r>>=1; + } + + /* use floating add to find out rounding direction */ + if((ix0|ix1)!=0) { + z = one-tiny; /* trigger inexact flag */ + if (z>=one) { + z = one+tiny; + if (q1==(__uint32_t)0xffffffff) { q1=0; q += 1;} + else if (z>one) { + if (q1==(__uint32_t)0xfffffffe) q+=1; + q1+=2; + } else + q1 += (q1&1); + } + } + ix0 = (q>>1)+0x3fe00000; + ix1 = q1>>1; + if ((q&1)==1) ix1 |= sign; + ix0 += (m <<20); + INSERT_WORDS(z,ix0,ix1); + return z; +} + +#endif /* defined(_DOUBLE_IS_32BITS) */ + +/* +Other methods (use floating-point arithmetic) +------------- +(This is a copy of a drafted paper by Prof W. Kahan +and K.C. Ng, written in May, 1986) + + Two algorithms are given here to implement sqrt(x) + (IEEE double precision arithmetic) in software. + Both supply sqrt(x) correctly rounded. The first algorithm (in + Section A) uses newton iterations and involves four divisions. + The second one uses reciproot iterations to avoid division, but + requires more multiplications. Both algorithms need the ability + to chop results of arithmetic operations instead of round them, + and the INEXACT flag to indicate when an arithmetic operation + is executed exactly with no roundoff error, all part of the + standard (IEEE 754-1985). The ability to perform shift, add, + subtract and logical AND operations upon 32-bit words is needed + too, though not part of the standard. + +A. sqrt(x) by Newton Iteration + + (1) Initial approximation + + Let x0 and x1 be the leading and the trailing 32-bit words of + a floating point number x (in IEEE double format) respectively + + 1 11 52 ...widths + ------------------------------------------------------ + x: |s| e | f | + ------------------------------------------------------ + msb lsb msb lsb ...order + + + ------------------------ ------------------------ + x0: |s| e | f1 | x1: | f2 | + ------------------------ ------------------------ + + By performing shifts and subtracts on x0 and x1 (both regarded + as integers), we obtain an 8-bit approximation of sqrt(x) as + follows. + + k := (x0>>1) + 0x1ff80000; + y0 := k - T1[31&(k>>15)]. ... y ~ sqrt(x) to 8 bits + Here k is a 32-bit integer and T1[] is an integer array containing + correction terms. Now magically the floating value of y (y's + leading 32-bit word is y0, the value of its trailing word is 0) + approximates sqrt(x) to almost 8-bit. + + Value of T1: + static int T1[32]= { + 0, 1024, 3062, 5746, 9193, 13348, 18162, 23592, + 29598, 36145, 43202, 50740, 58733, 67158, 75992, 85215, + 83599, 71378, 60428, 50647, 41945, 34246, 27478, 21581, + 16499, 12183, 8588, 5674, 3403, 1742, 661, 130,}; + + (2) Iterative refinement + + Apply Heron's rule three times to y, we have y approximates + sqrt(x) to within 1 ulp (Unit in the Last Place): + + y := (y+x/y)/2 ... almost 17 sig. bits + y := (y+x/y)/2 ... almost 35 sig. bits + y := y-(y-x/y)/2 ... within 1 ulp + + + Remark 1. + Another way to improve y to within 1 ulp is: + + y := (y+x/y) ... almost 17 sig. bits to 2*sqrt(x) + y := y - 0x00100006 ... almost 18 sig. bits to sqrt(x) + + 2 + (x-y )*y + y := y + 2* ---------- ...within 1 ulp + 2 + 3y + x + + + This formula has one division fewer than the one above; however, + it requires more multiplications and additions. Also x must be + scaled in advance to avoid spurious overflow in evaluating the + expression 3y*y+x. Hence it is not recommended uless division + is slow. If division is very slow, then one should use the + reciproot algorithm given in section B. + + (3) Final adjustment + + By twiddling y's last bit it is possible to force y to be + correctly rounded according to the prevailing rounding mode + as follows. Let r and i be copies of the rounding mode and + inexact flag before entering the square root program. Also we + use the expression y+-ulp for the next representable floating + numbers (up and down) of y. Note that y+-ulp = either fixed + point y+-1, or multiply y by nextafter(1,+-inf) in chopped + mode. + + I := FALSE; ... reset INEXACT flag I + R := RZ; ... set rounding mode to round-toward-zero + z := x/y; ... chopped quotient, possibly inexact + If(not I) then { ... if the quotient is exact + if(z=y) { + I := i; ... restore inexact flag + R := r; ... restore rounded mode + return sqrt(x):=y. + } else { + z := z - ulp; ... special rounding + } + } + i := TRUE; ... sqrt(x) is inexact + If (r=RN) then z=z+ulp ... rounded-to-nearest + If (r=RP) then { ... round-toward-+inf + y = y+ulp; z=z+ulp; + } + y := y+z; ... chopped sum + y0:=y0-0x00100000; ... y := y/2 is correctly rounded. + I := i; ... restore inexact flag + R := r; ... restore rounded mode + return sqrt(x):=y. + + (4) Special cases + + Square root of +inf, +-0, or NaN is itself; + Square root of a negative number is NaN with invalid signal. + + +B. sqrt(x) by Reciproot Iteration + + (1) Initial approximation + + Let x0 and x1 be the leading and the trailing 32-bit words of + a floating point number x (in IEEE double format) respectively + (see section A). By performing shifs and subtracts on x0 and y0, + we obtain a 7.8-bit approximation of 1/sqrt(x) as follows. + + k := 0x5fe80000 - (x0>>1); + y0:= k - T2[63&(k>>14)]. ... y ~ 1/sqrt(x) to 7.8 bits + + Here k is a 32-bit integer and T2[] is an integer array + containing correction terms. Now magically the floating + value of y (y's leading 32-bit word is y0, the value of + its trailing word y1 is set to zero) approximates 1/sqrt(x) + to almost 7.8-bit. + + Value of T2: + static int T2[64]= { + 0x1500, 0x2ef8, 0x4d67, 0x6b02, 0x87be, 0xa395, 0xbe7a, 0xd866, + 0xf14a, 0x1091b,0x11fcd,0x13552,0x14999,0x15c98,0x16e34,0x17e5f, + 0x18d03,0x19a01,0x1a545,0x1ae8a,0x1b5c4,0x1bb01,0x1bfde,0x1c28d, + 0x1c2de,0x1c0db,0x1ba73,0x1b11c,0x1a4b5,0x1953d,0x18266,0x16be0, + 0x1683e,0x179d8,0x18a4d,0x19992,0x1a789,0x1b445,0x1bf61,0x1c989, + 0x1d16d,0x1d77b,0x1dddf,0x1e2ad,0x1e5bf,0x1e6e8,0x1e654,0x1e3cd, + 0x1df2a,0x1d635,0x1cb16,0x1be2c,0x1ae4e,0x19bde,0x1868e,0x16e2e, + 0x1527f,0x1334a,0x11051,0xe951, 0xbe01, 0x8e0d, 0x5924, 0x1edd,}; + + (2) Iterative refinement + + Apply Reciproot iteration three times to y and multiply the + result by x to get an approximation z that matches sqrt(x) + to about 1 ulp. To be exact, we will have + -1ulp < sqrt(x)-z<1.0625ulp. + + ... set rounding mode to Round-to-nearest + y := y*(1.5-0.5*x*y*y) ... almost 15 sig. bits to 1/sqrt(x) + y := y*((1.5-2^-30)+0.5*x*y*y)... about 29 sig. bits to 1/sqrt(x) + ... special arrangement for better accuracy + z := x*y ... 29 bits to sqrt(x), with z*y<1 + z := z + 0.5*z*(1-z*y) ... about 1 ulp to sqrt(x) + + Remark 2. The constant 1.5-2^-30 is chosen to bias the error so that + (a) the term z*y in the final iteration is always less than 1; + (b) the error in the final result is biased upward so that + -1 ulp < sqrt(x) - z < 1.0625 ulp + instead of |sqrt(x)-z|<1.03125ulp. + + (3) Final adjustment + + By twiddling y's last bit it is possible to force y to be + correctly rounded according to the prevailing rounding mode + as follows. Let r and i be copies of the rounding mode and + inexact flag before entering the square root program. Also we + use the expression y+-ulp for the next representable floating + numbers (up and down) of y. Note that y+-ulp = either fixed + point y+-1, or multiply y by nextafter(1,+-inf) in chopped + mode. + + R := RZ; ... set rounding mode to round-toward-zero + switch(r) { + case RN: ... round-to-nearest + if(x<= z*(z-ulp)...chopped) z = z - ulp; else + if(x<= z*(z+ulp)...chopped) z = z; else z = z+ulp; + break; + case RZ:case RM: ... round-to-zero or round-to--inf + R:=RP; ... reset rounding mod to round-to-+inf + if(x=(z+ulp)*(z+ulp) ...rounded up) z = z+ulp; + break; + case RP: ... round-to-+inf + if(x>(z+ulp)*(z+ulp)...chopped) z = z+2*ulp; else + if(x>z*z ...chopped) z = z+ulp; + break; + } + + Remark 3. The above comparisons can be done in fixed point. For + example, to compare x and w=z*z chopped, it suffices to compare + x1 and w1 (the trailing parts of x and w), regarding them as + two's complement integers. + + ...Is z an exact square root? + To determine whether z is an exact square root of x, let z1 be the + trailing part of z, and also let x0 and x1 be the leading and + trailing parts of x. + + If ((z1&0x03ffffff)!=0) ... not exact if trailing 26 bits of z!=0 + I := 1; ... Raise Inexact flag: z is not exact + else { + j := 1 - [(x0>>20)&1] ... j = logb(x) mod 2 + k := z1 >> 26; ... get z's 25-th and 26-th + fraction bits + I := i or (k&j) or ((k&(j+j+1))!=(x1&3)); + } + R:= r ... restore rounded mode + return sqrt(x):=z. + + If multiplication is cheaper then the foregoing red tape, the + Inexact flag can be evaluated by + + I := i; + I := (z*z!=x) or I. + + Note that z*z can overwrite I; this value must be sensed if it is + True. + + Remark 4. If z*z = x exactly, then bit 25 to bit 0 of z1 must be + zero. + + -------------------- + z1: | f2 | + -------------------- + bit 31 bit 0 + + Further more, bit 27 and 26 of z1, bit 0 and 1 of x1, and the odd + or even of logb(x) have the following relations: + + ------------------------------------------------- + bit 27,26 of z1 bit 1,0 of x1 logb(x) + ------------------------------------------------- + 00 00 odd and even + 01 01 even + 10 10 odd + 10 00 even + 11 01 even + ------------------------------------------------- + + (4) Special cases (see (4) of Section A). + + */

e_sqrt.c Property changes : Added: svn:eol-style ## -0,0 +1 ## +native \ No newline at end of property Added: svn:keywords ## -0,0 +1 ## +Id \ No newline at end of property Index: w_j1.c =================================================================== --- w_j1.c (nonexistent) +++ w_j1.c (revision 158) @@ -0,0 +1,121 @@ + +/* @(#)w_j1.c 5.1 93/09/24 */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +/* + * wrapper of j1,y1 + */ + +#include "fdlibm.h" +#include + +#ifndef _DOUBLE_IS_32BITS + +#ifdef __STDC__ + double j1(double x) /* wrapper j1 */ +#else + double j1(x) /* wrapper j1 */ + double x; +#endif +{ +#ifdef _IEEE_LIBM + return __ieee754_j1(x); +#else + double z; + struct exception exc; + z = __ieee754_j1(x); + if(_LIB_VERSION == _IEEE_ || isnan(x) ) return z; + if(fabs(x)>X_TLOSS) { + /* j1(|x|>X_TLOSS) */ + exc.type = TLOSS; + exc.name = "j1"; + exc.err = 0; + exc.arg1 = exc.arg2 = x; + exc.retval = 0.0; + if (_LIB_VERSION == _POSIX_) + errno = ERANGE; + else if (!matherr(&exc)) { + errno = ERANGE; + } + if (exc.err != 0) + errno = exc.err; + return exc.retval; + } else + return z; +#endif +} + +#ifdef __STDC__ + double y1(double x) /* wrapper y1 */ +#else + double y1(x) /* wrapper y1 */ + double x; +#endif +{ +#ifdef _IEEE_LIBM + return __ieee754_y1(x); +#else + double z; + struct exception exc; + z = __ieee754_y1(x); + if(_LIB_VERSION == _IEEE_ || isnan(x) ) return z; + if(x <= 0.0){ +#ifndef HUGE_VAL +#define HUGE_VAL inf + double inf = 0.0; + + SET_HIGH_WORD(inf,0x7ff00000); /* set inf to infinite */ +#endif + /* y1(0) = -inf or y1(x<0) = NaN */ + exc.type = DOMAIN; /* should be SING for IEEE */ + exc.name = "y1"; + exc.err = 0; + exc.arg1 = exc.arg2 = x; + if (_LIB_VERSION == _SVID_) + exc.retval = -HUGE; + else + exc.retval = -HUGE_VAL; + if (_LIB_VERSION == _POSIX_) + errno = EDOM; + else if (!matherr(&exc)) { + errno = EDOM; + } + if (exc.err != 0) + errno = exc.err; + return exc.retval; + } + if(x>X_TLOSS) { + /* y1(x>X_TLOSS) */ + exc.type = TLOSS; + exc.name = "y1"; + exc.err = 0; + exc.arg1 = exc.arg2 = x; + exc.retval = 0.0; + if (_LIB_VERSION == _POSIX_) + errno = ERANGE; + else if (!matherr(&exc)) { + errno = ERANGE; + } + if (exc.err != 0) + errno = exc.err; + return exc.retval; + } else + return z; +#endif +} + +#endif /* defined(_DOUBLE_IS_32BITS) */ + + + + +

w_j1.c Property changes : Added: svn:eol-style ## -0,0 +1 ## +native \ No newline at end of property Added: svn:keywords ## -0,0 +1 ## +Id \ No newline at end of property Index: wrf_gamma.c =================================================================== --- wrf_gamma.c (nonexistent) +++ wrf_gamma.c (revision 158) @@ -0,0 +1,74 @@ +/* wrf_gamma.c -- float version of wr_gamma.c. + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + */ + +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +/* + * wrapper float gammaf_r(float x, int *signgamp) + */ + +#include "fdlibm.h" +#include + +#ifdef __STDC__ + float gammaf_r(float x, int *signgamp) /* wrapper lgammaf_r */ +#else + float gammaf_r(x,signgamp) /* wrapper lgammaf_r */ + float x; int *signgamp; +#endif +{ +#ifdef _IEEE_LIBM + return __ieee754_gammaf_r(x,signgamp); +#else + float y; + struct exception exc; + y = __ieee754_gammaf_r(x,signgamp); + if(_LIB_VERSION == _IEEE_) return y; + if(!finitef(y)&&finitef(x)) { +#ifndef HUGE_VAL +#define HUGE_VAL inf + double inf = 0.0; + + SET_HIGH_WORD(inf,0x7ff00000); /* set inf to infinite */ +#endif + exc.name = "gammaf"; + exc.err = 0; + exc.arg1 = exc.arg2 = (double)x; + if (_LIB_VERSION == _SVID_) + exc.retval = HUGE; + else + exc.retval = HUGE_VAL; + if(floorf(x)==x&&x<=(float)0.0) { + /* gammaf(-integer) or gamma(0) */ + exc.type = SING; + if (_LIB_VERSION == _POSIX_) + errno = EDOM; + else if (!matherr(&exc)) { + errno = EDOM; + } + } else { + /* gammaf(finite) overflow */ + exc.type = OVERFLOW; + if (_LIB_VERSION == _POSIX_) + errno = ERANGE; + else if (!matherr(&exc)) { + errno = ERANGE; + } + } + if (exc.err != 0) + errno = exc.err; + return (float)exc.retval; + } else + return y; +#endif +}

wrf_gamma.c Property changes : Added: svn:eol-style ## -0,0 +1 ## +native \ No newline at end of property Added: svn:keywords ## -0,0 +1 ## +Id \ No newline at end of property Index: s_signif.c =================================================================== --- s_signif.c (nonexistent) +++ s_signif.c (revision 158) @@ -0,0 +1,34 @@ + +/* @(#)s_signif.c 5.1 93/09/24 */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +/* + * significand(x) computes just + * scalb(x, (double) -ilogb(x)), + * for exercising the fraction-part(F) IEEE 754-1985 test vector. + */ + +#include "fdlibm.h" + +#ifndef _DOUBLE_IS_32BITS + +#ifdef __STDC__ + double significand(double x) +#else + double significand(x) + double x; +#endif +{ + return __ieee754_scalb(x,(double) -ilogb(x)); +} + +#endif /* _DOUBLE_IS_32BITS */

s_signif.c Property changes : Added: svn:eol-style ## -0,0 +1 ## +native \ No newline at end of property Added: svn:keywords ## -0,0 +1 ## +Id \ No newline at end of property Index: w_exp2.c =================================================================== --- w_exp2.c (nonexistent) +++ w_exp2.c (revision 158) @@ -0,0 +1,75 @@ + +/* @(#)w_exp2.c 5.1 93/09/24 */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +/* +FUNCTION + <>, <>---exponential +INDEX + exp2 +INDEX + exp2f + +ANSI_SYNOPSIS + #include + double exp2(double <[x]>); + float exp2f(float <[x]>); + +TRAD_SYNOPSIS + #include + double exp2(<[x]>); + double <[x]>; + + float exp2f(<[x]>); + float <[x]>; + +DESCRIPTION + <> and <> calculate 2 ^ <[x]>, that is, + @ifnottex + 2 raised to the power <[x]>. + @end ifnottex + @tex + $2^x$ + @end tex + + You can use the (non-ANSI) function <> to specify + error handling for these functions. + +RETURNS + On success, <> and <> return the calculated value. + If the result underflows, the returned value is <<0>>. If the + result overflows, the returned value is <>. In + either case, <> is set to <>. + +*/ + +/* + * wrapper exp2(x) + */ + +#include "fdlibm.h" +#include +#include + +#ifndef _DOUBLE_IS_32BITS + +#ifdef __STDC__ + double exp2(double x) /* wrapper exp2 */ +#else + double exp2(x) /* wrapper exp2 */ + double x; +#endif +{ + return pow(2.0, x); +} + +#endif /* defined(_DOUBLE_IS_32BITS) */

w_exp2.c Property changes : Added: svn:eol-style ## -0,0 +1 ## +native \ No newline at end of property Added: svn:keywords ## -0,0 +1 ## +Id \ No newline at end of property Index: ef_asin.c =================================================================== --- ef_asin.c (nonexistent) +++ ef_asin.c (revision 158) @@ -0,0 +1,88 @@ +/* ef_asin.c -- float version of e_asin.c. + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + */ + +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#include "fdlibm.h" + +#ifdef __STDC__ +static const float +#else +static float +#endif +one = 1.0000000000e+00, /* 0x3F800000 */ +huge = 1.000e+30, +pio2_hi = 1.57079637050628662109375f, +pio2_lo = -4.37113900018624283e-8f, +pio4_hi = 0.785398185253143310546875f, + /* coefficient for R(x^2) */ +pS0 = 1.6666667163e-01, /* 0x3e2aaaab */ +pS1 = -3.2556581497e-01, /* 0xbea6b090 */ +pS2 = 2.0121252537e-01, /* 0x3e4e0aa8 */ +pS3 = -4.0055535734e-02, /* 0xbd241146 */ +pS4 = 7.9153501429e-04, /* 0x3a4f7f04 */ +pS5 = 3.4793309169e-05, /* 0x3811ef08 */ +qS1 = -2.4033949375e+00, /* 0xc019d139 */ +qS2 = 2.0209457874e+00, /* 0x4001572d */ +qS3 = -6.8828397989e-01, /* 0xbf303361 */ +qS4 = 7.7038154006e-02; /* 0x3d9dc62e */ + +#ifdef __STDC__ + float __ieee754_asinf(float x) +#else + float __ieee754_asinf(x) + float x; +#endif +{ + float t,w,p,q,c,r,s; + __int32_t hx,ix; + GET_FLOAT_WORD(hx,x); + ix = hx&0x7fffffff; + if(ix==0x3f800000) { + /* asin(1)=+-pi/2 with inexact */ + return x*pio2_hi+x*pio2_lo; + } else if(ix> 0x3f800000) { /* |x|>= 1 */ + return (x-x)/(x-x); /* asin(|x|>1) is NaN */ + } else if (ix<0x3f000000) { /* |x|<0.5 */ + if(ix<0x32000000) { /* if |x| < 2**-27 */ + if(huge+x>one) return x;/* return x with inexact if x!=0*/ + } else { + t = x*x; + p = t*(pS0+t*(pS1+t*(pS2+t*(pS3+t*(pS4+t*pS5))))); + q = one+t*(qS1+t*(qS2+t*(qS3+t*qS4))); + w = p/q; + return x+x*w; + } + } + /* 1> |x|>= 0.5 */ + w = one-fabsf(x); + t = w*(float)0.5; + p = t*(pS0+t*(pS1+t*(pS2+t*(pS3+t*(pS4+t*pS5))))); + q = one+t*(qS1+t*(qS2+t*(qS3+t*qS4))); + s = __ieee754_sqrtf(t); + if(ix>=0x3F79999A) { /* if |x| > 0.975 */ + w = p/q; + t = pio2_hi-((float)2.0*(s+s*w)-pio2_lo); + } else { + __int32_t iw; + w = s; + GET_FLOAT_WORD(iw,w); + SET_FLOAT_WORD(w,iw&0xfffff000); + c = (t-w*w)/(s+w); + r = p/q; + p = (float)2.0*s*r-(pio2_lo-(float)2.0*c); + q = pio4_hi-(float)2.0*w; + t = pio4_hi-(p-q); + } + if(hx>0) return t; else return -t; +}

ef_asin.c Property changes : Added: svn:eol-style ## -0,0 +1 ## +native \ No newline at end of property Added: svn:keywords ## -0,0 +1 ## +Id \ No newline at end of property Index: wf_j1.c =================================================================== --- wf_j1.c (nonexistent) +++ wf_j1.c (revision 158) @@ -0,0 +1,139 @@ +/* wf_j1.c -- float version of w_j1.c. + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + */ + +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +/* + * wrapper of j1f,y1f + */ + +#include "fdlibm.h" +#include + + +#ifdef __STDC__ + float j1f(float x) /* wrapper j1f */ +#else + float j1f(x) /* wrapper j1f */ + float x; +#endif +{ +#ifdef _IEEE_LIBM + return __ieee754_j1f(x); +#else + float z; + struct exception exc; + z = __ieee754_j1f(x); + if(_LIB_VERSION == _IEEE_ || isnanf(x) ) return z; + if(fabsf(x)>(float)X_TLOSS) { + /* j1f(|x|>X_TLOSS) */ + exc.type = TLOSS; + exc.name = "j1f"; + exc.err = 0; + exc.arg1 = exc.arg2 = (double)x; + exc.retval = 0.0; + if (_LIB_VERSION == _POSIX_) + errno = ERANGE; + else if (!matherr(&exc)) { + errno = ERANGE; + } + if (exc.err != 0) + errno = exc.err; + return exc.retval; + } else + return z; +#endif +} + +#ifdef __STDC__ + float y1f(float x) /* wrapper y1f */ +#else + float y1f(x) /* wrapper y1f */ + float x; +#endif +{ +#ifdef _IEEE_LIBM + return __ieee754_y1f(x); +#else + float z; + struct exception exc; + z = __ieee754_y1f(x); + if(_LIB_VERSION == _IEEE_ || isnanf(x) ) return z; + if(x <= (float)0.0){ + /* y1f(0) = -inf or y1f(x<0) = NaN */ +#ifndef HUGE_VAL +#define HUGE_VAL inf + double inf = 0.0; + + SET_HIGH_WORD(inf,0x7ff00000); /* set inf to infinite */ +#endif + exc.type = DOMAIN; /* should be SING for IEEE */ + exc.name = "y1f"; + exc.err = 0; + exc.arg1 = exc.arg2 = (double)x; + if (_LIB_VERSION == _SVID_) + exc.retval = -HUGE; + else + exc.retval = -HUGE_VAL; + if (_LIB_VERSION == _POSIX_) + errno = EDOM; + else if (!matherr(&exc)) { + errno = EDOM; + } + if (exc.err != 0) + errno = exc.err; + return (float)exc.retval; + } + if(x>(float)X_TLOSS) { + /* y1f(x>X_TLOSS) */ + exc.type = TLOSS; + exc.name = "y1f"; + exc.err = 0; + exc.arg1 = exc.arg2 = (double)x; + exc.retval = 0.0; + if (_LIB_VERSION == _POSIX_) + errno = ERANGE; + else if (!matherr(&exc)) { + errno = ERANGE; + } + if (exc.err != 0) + errno = exc.err; + return (float)exc.retval; + } else + return z; +#endif +} + +#ifdef _DOUBLE_IS_32BITS + +#ifdef __STDC__ + double j1(double x) +#else + double j1(x) + double x; +#endif +{ + return (double) j1f((float) x); +} + +#ifdef __STDC__ + double y1(double x) +#else + double y1(x) + double x; +#endif +{ + return (double) y1f((float) x); +} + +#endif /* defined(_DOUBLE_IS_32BITS) */

wf_j1.c Property changes : Added: svn:eol-style ## -0,0 +1 ## +native \ No newline at end of property Added: svn:keywords ## -0,0 +1 ## +Id \ No newline at end of property Index: s_frexp.c =================================================================== --- s_frexp.c (nonexistent) +++ s_frexp.c (revision 158) @@ -0,0 +1,114 @@ + +/* @(#)s_frexp.c 5.1 93/09/24 */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +/* +FUNCTION + <>, <>---split floating-point number +INDEX + frexp +INDEX + frexpf + +ANSI_SYNOPSIS + #include + double frexp(double <[val]>, int *<[exp]>); + float frexpf(float <[val]>, int *<[exp]>); + +TRAD_SYNOPSIS + #include + double frexp(<[val]>, <[exp]>) + double <[val]>; + int *<[exp]>; + + float frexpf(<[val]>, <[exp]>) + float <[val]>; + int *<[exp]>; + + +DESCRIPTION + All nonzero, normal numbers can be described as <[m]> * 2**<[p]>. + <> represents the double <[val]> as a mantissa <[m]> + and a power of two <[p]>. The resulting mantissa will always + be greater than or equal to <<0.5>>, and less than <<1.0>> (as + long as <[val]> is nonzero). The power of two will be stored + in <<*>><[exp]>. + +@ifnottex +<[m]> and <[p]> are calculated so that +<[val]> is <[m]> times <<2>> to the power <[p]>. +@end ifnottex +@tex +<[m]> and <[p]> are calculated so that +$ val = m \times 2^p $. +@end tex + +<> is identical, other than taking and returning +floats rather than doubles. + +RETURNS +<> returns the mantissa <[m]>. If <[val]> is <<0>>, infinity, +or Nan, <> will set <<*>><[exp]> to <<0>> and return <[val]>. + +PORTABILITY +<> is ANSI. +<> is an extension. + + +*/ + +/* + * for non-zero x + * x = frexp(arg,&exp); + * return a double fp quantity x such that 0.5 <= |x| <1.0 + * and the corresponding binary exponent "exp". That is + * arg = x*2^exp. + * If arg is inf, 0.0, or NaN, then frexp(arg,&exp) returns arg + * with *exp=0. + */ + +#include "fdlibm.h" + +#ifndef _DOUBLE_IS_32BITS + +#ifdef __STDC__ +static const double +#else +static double +#endif +two54 = 1.80143985094819840000e+16; /* 0x43500000, 0x00000000 */ + +#ifdef __STDC__ + double frexp(double x, int *eptr) +#else + double frexp(x, eptr) + double x; int *eptr; +#endif +{ + __int32_t hx, ix, lx; + EXTRACT_WORDS(hx,lx,x); + ix = 0x7fffffff&hx; + *eptr = 0; + if(ix>=0x7ff00000||((ix|lx)==0)) return x; /* 0,inf,nan */ + if (ix<0x00100000) { /* subnormal */ + x *= two54; + GET_HIGH_WORD(hx,x); + ix = hx&0x7fffffff; + *eptr = -54; + } + *eptr += (ix>>20)-1022; + hx = (hx&0x800fffff)|0x3fe00000; + SET_HIGH_WORD(x,hx); + return x; +} + +#endif /* _DOUBLE_IS_32BITS */

s_frexp.c Property changes : Added: svn:eol-style ## -0,0 +1 ## +native \ No newline at end of property Added: svn:keywords ## -0,0 +1 ## +Id \ No newline at end of property Index: math.tex =================================================================== --- math.tex (nonexistent) +++ math.tex (revision 158) @@ -0,0 +1,232 @@ +@node Math +@chapter Mathematical Functions (@file{math.h}) + +This chapter groups a wide variety of mathematical functions. The +corresponding definitions and declarations are in @file{math.h}. +Two definitions from @file{math.h} are of particular interest. + +@enumerate +@item +The representation of infinity as a @code{double} is defined as +@code{HUGE_VAL}; this number is returned on overflow by many functions. + +@item +The structure @code{exception} is used when you write customized error +handlers for the mathematical functions. You can customize error +handling for most of these functions by defining your own version of +@code{matherr}; see the section on @code{matherr} for details. +@end enumerate + +@cindex system calls +@cindex support subroutines +@cindex stubs +@cindex OS stubs +Since the error handling code calls @code{fputs}, the mathematical +subroutines require stubs or minimal implementations for the same list +of OS subroutines as @code{fputs}: @code{close}, @code{fstat}, +@code{isatty}, @code{lseek}, @code{read}, @code{sbrk}, @code{write}. +@xref{syscalls,,System Calls, libc.info, The Red Hat newlib C Library}, +for a discussion and for sample minimal implementations of these support +subroutines. + +Alternative declarations of the mathematical functions, which exploit +specific machine capabilities to operate faster---but generally have +less error checking and may reflect additional limitations on some +machines---are available when you include @file{fastmath.h} instead of +@file{math.h}. + +@menu +* version:: Version of library +* acos:: Arccosine +* acosh:: Inverse hyperbolic cosine +* asin:: Arcsine +* asinh:: Inverse hyperbolic sine +* atan:: Arctangent +* atan2:: Arctangent of y/x +* atanh:: Inverse hyperbolic tangent +* jN:: Bessel functions (jN, yN) +* cbrt:: Cube root +* copysign:: Sign of Y, magnitude of X +* cosh:: Hyperbolic cosine +* erf:: Error function (erf, erfc) +* exp:: Exponential +* expm1:: Exponential of x, - 1 +* fabs:: Absolute value (magnitude) +* floor:: Floor and ceiling (floor, ceil) +* fmod:: Floating-point remainder (modulo) +* frexp:: Split floating-point number +* gamma:: Logarithmic gamma function +* hypot:: Distance from origin +* ilogb:: Get exponent +* infinity:: Floating infinity +* isnan:: Check type of number +* ldexp:: Load exponent +* log:: Natural logarithms +* log10:: Base 10 logarithms +* log1p:: Log of 1 + X +* matherr:: Modifiable math error handler +* modf:: Split fractional and integer parts +* nan:: Floating Not a Number +* nextafter:: Get next representable number +* pow:: X to the power Y +* remainder:: remainder of X divided by Y +* scalbn:: scalbn +* sin:: Sine or cosine (sin, cos) +* sinh:: Hyperbolic sine +* sqrt:: Positive square root +* tan:: Tangent +* tanh:: Hyperbolic tangent +@end menu + +@page +@node version +@section Version of library + +There are four different versions of the math library routines: IEEE, +POSIX, X/Open, or SVID. The version may be selected at runtime by +setting the global variable @code{_LIB_VERSION}, defined in +@file{math.h}. It may be set to one of the following constants defined +in @file{math.h}: @code{_IEEE_}, @code{_POSIX_}, @code{_XOPEN_}, or +@code{_SVID_}. The @code{_LIB_VERSION} variable is not specific to any +thread, and changing it will affect all threads. + +The versions of the library differ only in how errors are handled. + +In IEEE mode, the @code{matherr} function is never called, no warning +messages are printed, and @code{errno} is never set. + +In POSIX mode, @code{errno} is set correctly, but the @code{matherr} +function is never called and no warning messages are printed. + +In X/Open mode, @code{errno} is set correctly, and @code{matherr} is +called, but warning message are not printed. + +In SVID mode, functions which overflow return 3.40282346638528860e+38, +the maximum single-precision floating-point value, rather than infinity. +Also, @code{errno} is set correctly, @code{matherr} is called, and, if +@code{matherr} returns 0, warning messages are printed for some errors. +For example, by default @samp{log(-1.0)} writes this message on standard +error output: + +@example +log: DOMAIN error +@end example + +The library is set to X/Open mode by default. + +@page +@include math/wacos.def + +@page +@include math/wacosh.def + +@page +@include math/wasin.def + +@page +@include math/sasinh.def + +@page +@include math/satan.def + +@page +@include math/watan2.def + +@page +@include math/watanh.def + +@page +@include math/wj0.def + +@page +@include common/scbrt.def + +@page +@include common/scopysign.def + +@page +@include math/wcosh.def + +@page +@include math/serf.def + +@page +@include math/wexp.def + +@page +@include common/sexpm1.def + +@page +@include math/sfabs.def + +@page +@include math/sfloor.def + +@page +@include math/wfmod.def + +@page +@include math/sfrexp.def + +@page +@include math/wgamma.def + +@page +@include math/whypot.def + +@page +@include common/silogb.def + +@page +@include common/sinfinity.def + +@page +@include common/sisnan.def + +@page +@include math/sldexp.def + +@page +@include math/wlog.def + +@page +@include math/wlog10.def + +@page +@include common/slog1p.def + +@page +@include common/smatherr.def + +@page +@include common/smodf.def + +@page +@include common/snan.def + +@page +@include common/snextafter.def + +@page +@include math/wpow.def + +@page +@include math/wremainder.def + +@page +@include common/sscalbn.def + +@page +@include math/wsqrt.def + +@page +@include math/ssin.def + +@page +@include math/wsinh.def + +@page +@include math/stan.def + +@page +@include math/stanh.def Index: e_hypot.c =================================================================== --- e_hypot.c (nonexistent) +++ e_hypot.c (revision 158) @@ -0,0 +1,128 @@ + +/* @(#)e_hypot.c 5.1 93/09/24 */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +/* __ieee754_hypot(x,y) + * + * Method : + * If (assume round-to-nearest) z=x*x+y*y + * has error less than sqrt(2)/2 ulp, than + * sqrt(z) has error less than 1 ulp (exercise). + * + * So, compute sqrt(x*x+y*y) with some care as + * follows to get the error below 1 ulp: + * + * Assume x>y>0; + * (if possible, set rounding to round-to-nearest) + * 1. if x > 2y use + * x1*x1+(y*y+(x2*(x+x1))) for x*x+y*y + * where x1 = x with lower 32 bits cleared, x2 = x-x1; else + * 2. if x <= 2y use + * t1*y1+((x-y)*(x-y)+(t1*y2+t2*y)) + * where t1 = 2x with lower 32 bits cleared, t2 = 2x-t1, + * y1= y with lower 32 bits chopped, y2 = y-y1. + * + * NOTE: scaling may be necessary if some argument is too + * large or too tiny + * + * Special cases: + * hypot(x,y) is INF if x or y is +INF or -INF; else + * hypot(x,y) is NAN if x or y is NAN. + * + * Accuracy: + * hypot(x,y) returns sqrt(x^2+y^2) with error less + * than 1 ulps (units in the last place) + */ + +#include "fdlibm.h" + +#ifndef _DOUBLE_IS_32BITS + +#ifdef __STDC__ + double __ieee754_hypot(double x, double y) +#else + double __ieee754_hypot(x,y) + double x, y; +#endif +{ + double a=x,b=y,t1,t2,y1,y2,w; + __int32_t j,k,ha,hb; + + GET_HIGH_WORD(ha,x); + ha &= 0x7fffffff; + GET_HIGH_WORD(hb,y); + hb &= 0x7fffffff; + if(hb > ha) {a=y;b=x;j=ha; ha=hb;hb=j;} else {a=x;b=y;} + SET_HIGH_WORD(a,ha); /* a <- |a| */ + SET_HIGH_WORD(b,hb); /* b <- |b| */ + if((ha-hb)>0x3c00000) {return a+b;} /* x/y > 2**60 */ + k=0; + if(ha > 0x5f300000) { /* a>2**500 */ + if(ha >= 0x7ff00000) { /* Inf or NaN */ + __uint32_t low; + w = a+b; /* for sNaN */ + GET_LOW_WORD(low,a); + if(((ha&0xfffff)|low)==0) w = a; + GET_LOW_WORD(low,b); + if(((hb^0x7ff00000)|low)==0) w = b; + return w; + } + /* scale a and b by 2**-600 */ + ha -= 0x25800000; hb -= 0x25800000; k += 600; + SET_HIGH_WORD(a,ha); + SET_HIGH_WORD(b,hb); + } + if(hb < 0x20b00000) { /* b < 2**-500 */ + if(hb <= 0x000fffff) { /* subnormal b or 0 */ + __uint32_t low; + GET_LOW_WORD(low,b); + if((hb|low)==0) return a; + t1=0; + SET_HIGH_WORD(t1,0x7fd00000); /* t1=2^1022 */ + b *= t1; + a *= t1; + k -= 1022; + } else { /* scale a and b by 2^600 */ + ha += 0x25800000; /* a *= 2^600 */ + hb += 0x25800000; /* b *= 2^600 */ + k -= 600; + SET_HIGH_WORD(a,ha); + SET_HIGH_WORD(b,hb); + } + } + /* medium size a and b */ + w = a-b; + if (w>b) { + t1 = 0; + SET_HIGH_WORD(t1,ha); + t2 = a-t1; + w = __ieee754_sqrt(t1*t1-(b*(-b)-t2*(a+t1))); + } else { + a = a+a; + y1 = 0; + SET_HIGH_WORD(y1,hb); + y2 = b - y1; + t1 = 0; + SET_HIGH_WORD(t1,ha+0x00100000); + t2 = a - t1; + w = __ieee754_sqrt(t1*y1-(w*(-w)-(t1*y2+t2*b))); + } + if(k!=0) { + __uint32_t high; + t1 = 1.0; + GET_HIGH_WORD(high,t1); + SET_HIGH_WORD(t1,high+(k<<20)); + return t1*w; + } else return w; +} + +#endif /* defined(_DOUBLE_IS_32BITS) */

e_hypot.c Property changes : Added: svn:eol-style ## -0,0 +1 ## +native \ No newline at end of property Added: svn:keywords ## -0,0 +1 ## +Id \ No newline at end of property Index: kf_sin.c =================================================================== --- kf_sin.c (nonexistent) +++ kf_sin.c (revision 158) @@ -0,0 +1,49 @@ +/* kf_sin.c -- float version of k_sin.c + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + */ + +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#include "fdlibm.h" + +#ifdef __STDC__ +static const float +#else +static float +#endif +half = 5.0000000000e-01,/* 0x3f000000 */ +S1 = -1.6666667163e-01, /* 0xbe2aaaab */ +S2 = 8.3333337680e-03, /* 0x3c088889 */ +S3 = -1.9841270114e-04, /* 0xb9500d01 */ +S4 = 2.7557314297e-06, /* 0x3638ef1b */ +S5 = -2.5050759689e-08, /* 0xb2d72f34 */ +S6 = 1.5896910177e-10; /* 0x2f2ec9d3 */ + +#ifdef __STDC__ + float __kernel_sinf(float x, float y, int iy) +#else + float __kernel_sinf(x, y, iy) + float x,y; int iy; /* iy=0 if y is zero */ +#endif +{ + float z,r,v; + __int32_t ix; + GET_FLOAT_WORD(ix,x); + ix &= 0x7fffffff; /* high word of x */ + if(ix<0x32000000) /* |x| < 2**-27 */ + {if((int)x==0) return x;} /* generate inexact */ + z = x*x; + v = z*x; + r = S2+z*(S3+z*(S4+z*(S5+z*S6))); + if(iy==0) return x+v*(S1+z*r); + else return x-((z*(half*y-v*r)-y)-v*S1); +}

kf_sin.c Property changes : Added: svn:eol-style ## -0,0 +1 ## +native \ No newline at end of property Added: svn:keywords ## -0,0 +1 ## +Id \ No newline at end of property Index: w_acos.c =================================================================== --- w_acos.c (nonexistent) +++ w_acos.c (revision 158) @@ -0,0 +1,118 @@ + +/* @(#)w_acos.c 5.1 93/09/24 */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +/* +FUNCTION + <>, <>---arc cosine + +INDEX + acos +INDEX + acosf + +ANSI_SYNOPSIS + #include + double acos(double <[x]>); + float acosf(float <[x]>); + +TRAD_SYNOPSIS + #include + double acos(<[x]>) + double <[x]>; + + float acosf(<[x]>) + float <[x]>; + + + +DESCRIPTION + + <> computes the inverse cosine (arc cosine) of the input value. + Arguments to <> must be in the range @minus{}1 to 1. + + <> is identical to <>, except that it performs + its calculations on <>. + +RETURNS + @ifnottex + <> and <> return values in radians, in the range of 0 to pi. + @end ifnottex + @tex + <> and <> return values in radians, in the range of <<0>> to $\pi$. + @end tex + + If <[x]> is not between @minus{}1 and 1, the returned value is NaN + (not a number) the global variable <> is set to <>, and a + <> message is sent as standard error output. + + You can modify error handling for these functions using <>. + + +QUICKREF ANSI SVID POSIX RENTRANT + acos y,y,y,m + acosf n,n,n,m + +MATHREF + acos, [-1,1], acos(arg),,, + acos, NAN, arg,DOMAIN,EDOM + +MATHREF + acosf, [-1,1], acosf(arg),,, + acosf, NAN, argf,DOMAIN,EDOM + +*/ + +/* + * wrap_acos(x) + */ + +#include "fdlibm.h" +#include + +#ifndef _DOUBLE_IS_32BITS + +#ifdef __STDC__ + double acos(double x) /* wrapper acos */ +#else + double acos(x) /* wrapper acos */ + double x; +#endif +{ +#ifdef _IEEE_LIBM + return __ieee754_acos(x); +#else + double z; + struct exception exc; + z = __ieee754_acos(x); + if(_LIB_VERSION == _IEEE_ || isnan(x)) return z; + if(fabs(x)>1.0) { + /* acos(|x|>1) */ + exc.type = DOMAIN; + exc.name = "acos"; + exc.err = 0; + exc.arg1 = exc.arg2 = x; + exc.retval = nan(""); + if (_LIB_VERSION == _POSIX_) + errno = EDOM; + else if (!matherr(&exc)) { + errno = EDOM; + } + if (exc.err != 0) + errno = exc.err; + return exc.retval; + } else + return z; +#endif +} + +#endif /* defined(_DOUBLE_IS_32BITS) */

w_acos.c Property changes : Added: svn:eol-style ## -0,0 +1 ## +native \ No newline at end of property Added: svn:keywords ## -0,0 +1 ## +Id \ No newline at end of property Index: ef_hypot.c =================================================================== --- ef_hypot.c (nonexistent) +++ ef_hypot.c (revision 158) @@ -0,0 +1,83 @@ +/* ef_hypot.c -- float version of e_hypot.c. + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + */ + +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#include "fdlibm.h" + +#ifdef __STDC__ + float __ieee754_hypotf(float x, float y) +#else + float __ieee754_hypotf(x,y) + float x, y; +#endif +{ + float a=x,b=y,t1,t2,y1,y2,w; + __int32_t j,k,ha,hb; + + GET_FLOAT_WORD(ha,x); + ha &= 0x7fffffffL; + GET_FLOAT_WORD(hb,y); + hb &= 0x7fffffffL; + if(hb > ha) {a=y;b=x;j=ha; ha=hb;hb=j;} else {a=x;b=y;} + SET_FLOAT_WORD(a,ha); /* a <- |a| */ + SET_FLOAT_WORD(b,hb); /* b <- |b| */ + if((ha-hb)>0xf000000L) {return a+b;} /* x/y > 2**30 */ + k=0; + if(ha > 0x58800000L) { /* a>2**50 */ + if(!FLT_UWORD_IS_FINITE(ha)) { /* Inf or NaN */ + w = a+b; /* for sNaN */ + if(FLT_UWORD_IS_INFINITE(ha)) w = a; + if(FLT_UWORD_IS_INFINITE(hb)) w = b; + return w; + } + /* scale a and b by 2**-68 */ + ha -= 0x22000000L; hb -= 0x22000000L; k += 68; + SET_FLOAT_WORD(a,ha); + SET_FLOAT_WORD(b,hb); + } + if(hb < 0x26800000L) { /* b < 2**-50 */ + if(FLT_UWORD_IS_ZERO(hb)) { + return a; + } else if(FLT_UWORD_IS_SUBNORMAL(hb)) { + SET_FLOAT_WORD(t1,0x7e800000L); /* t1=2^126 */ + b *= t1; + a *= t1; + k -= 126; + } else { /* scale a and b by 2^68 */ + ha += 0x22000000; /* a *= 2^68 */ + hb += 0x22000000; /* b *= 2^68 */ + k -= 68; + SET_FLOAT_WORD(a,ha); + SET_FLOAT_WORD(b,hb); + } + } + /* medium size a and b */ + w = a-b; + if (w>b) { + SET_FLOAT_WORD(t1,ha&0xfffff000L); + t2 = a-t1; + w = __ieee754_sqrtf(t1*t1-(b*(-b)-t2*(a+t1))); + } else { + a = a+a; + SET_FLOAT_WORD(y1,hb&0xfffff000L); + y2 = b - y1; + SET_FLOAT_WORD(t1,ha+0x00800000L); + t2 = a - t1; + w = __ieee754_sqrtf(t1*y1-(w*(-w)-(t1*y2+t2*b))); + } + if(k!=0) { + SET_FLOAT_WORD(t1,0x3f800000L+(k<<23)); + return t1*w; + } else return w; +}

ef_hypot.c Property changes : Added: svn:eol-style ## -0,0 +1 ## +native \ No newline at end of property Added: svn:keywords ## -0,0 +1 ## +Id \ No newline at end of property Index: sf_sin.c =================================================================== --- sf_sin.c (nonexistent) +++ sf_sin.c (revision 158) @@ -0,0 +1,62 @@ +/* sf_sin.c -- float version of s_sin.c. + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + */ + +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#include "fdlibm.h" + +#ifdef __STDC__ + float sinf(float x) +#else + float sinf(x) + float x; +#endif +{ + float y[2],z=0.0; + __int32_t n,ix; + + GET_FLOAT_WORD(ix,x); + + /* |x| ~< pi/4 */ + ix &= 0x7fffffff; + if(ix <= 0x3f490fd8) return __kernel_sinf(x,z,0); + + /* sin(Inf or NaN) is NaN */ + else if (!FLT_UWORD_IS_FINITE(ix)) return x-x; + + /* argument reduction needed */ + else { + n = __ieee754_rem_pio2f(x,y); + switch(n&3) { + case 0: return __kernel_sinf(y[0],y[1],1); + case 1: return __kernel_cosf(y[0],y[1]); + case 2: return -__kernel_sinf(y[0],y[1],1); + default: + return -__kernel_cosf(y[0],y[1]); + } + } +} + +#ifdef _DOUBLE_IS_32BITS + +#ifdef __STDC__ + double sin(double x) +#else + double sin(x) + double x; +#endif +{ + return (double) sinf((float) x); +} + +#endif /* defined(_DOUBLE_IS_32BITS) */

sf_sin.c Property changes : Added: svn:eol-style ## -0,0 +1 ## +native \ No newline at end of property Added: svn:keywords ## -0,0 +1 ## +Id \ No newline at end of property Index: w_cosh.c =================================================================== --- w_cosh.c (nonexistent) +++ w_cosh.c (revision 158) @@ -0,0 +1,116 @@ + +/* @(#)w_cosh.c 5.1 93/09/24 */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +/* + +FUNCTION + <>, <>---hyperbolic cosine + +ANSI_SYNOPSIS + #include + double cosh(double <[x]>); + float coshf(float <[x]>) + +TRAD_SYNOPSIS + #include + double cosh(<[x]>) + double <[x]>; + + float coshf(<[x]>) + float <[x]>; + +DESCRIPTION + + <> computes the hyperbolic cosine of the argument <[x]>. + <)>> is defined as + @ifnottex + . (exp(x) + exp(-x))/2 + @end ifnottex + @tex + $${(e^x + e^{-x})} \over 2$$ + @end tex + + Angles are specified in radians. + + <> is identical, save that it takes and returns <>. + +RETURNS + The computed value is returned. When the correct value would create + an overflow, <> returns the value <> with the + appropriate sign, and the global value <> is set to <>. + + You can modify error handling for these functions using the + function <>. + +PORTABILITY + <> is ANSI. + <> is an extension. + +QUICKREF + cosh ansi pure + coshf - pure +*/ + +/* + * wrapper cosh(x) + */ + +#include "fdlibm.h" +#include + +#ifndef _DOUBLE_IS_32BITS + +#ifdef __STDC__ + double cosh(double x) /* wrapper cosh */ +#else + double cosh(x) /* wrapper cosh */ + double x; +#endif +{ +#ifdef _IEEE_LIBM + return __ieee754_cosh(x); +#else + double z; + struct exception exc; + z = __ieee754_cosh(x); + if(_LIB_VERSION == _IEEE_ || isnan(x)) return z; + if(fabs(x)>7.10475860073943863426e+02) { + /* cosh(finite) overflow */ +#ifndef HUGE_VAL +#define HUGE_VAL inf + double inf = 0.0; + + SET_HIGH_WORD(inf,0x7ff00000); /* set inf to infinite */ +#endif + exc.type = OVERFLOW; + exc.name = "cosh"; + exc.err = 0; + exc.arg1 = exc.arg2 = x; + if (_LIB_VERSION == _SVID_) + exc.retval = HUGE; + else + exc.retval = HUGE_VAL; + if (_LIB_VERSION == _POSIX_) + errno = ERANGE; + else if (!matherr(&exc)) { + errno = ERANGE; + } + if (exc.err != 0) + errno = exc.err; + return exc.retval; + } else + return z; +#endif +} + +#endif /* defined(_DOUBLE_IS_32BITS) */

w_cosh.c Property changes : Added: svn:eol-style ## -0,0 +1 ## +native \ No newline at end of property Added: svn:keywords ## -0,0 +1 ## +Id \ No newline at end of property Index: s_asinh.c =================================================================== --- s_asinh.c (nonexistent) +++ s_asinh.c (revision 158) @@ -0,0 +1,107 @@ + +/* @(#)s_asinh.c 5.1 93/09/24 */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +/* +FUNCTION + <>, <>---inverse hyperbolic sine + +INDEX + asinh +INDEX + asinhf + +ANSI_SYNOPSIS + #include + double asinh(double <[x]>); + float asinhf(float <[x]>); + +TRAD_SYNOPSIS + #include + double asinh(<[x]>) + double <[x]>; + + float asinhf(<[x]>) + float <[x]>; + +DESCRIPTION +<> calculates the inverse hyperbolic sine of <[x]>. +<> is defined as +@ifnottex +. sgn(<[x]>) * log(abs(<[x]>) + sqrt(1+<[x]>*<[x]>)) +@end ifnottex +@tex +$$sign(x) \times ln\Bigl(|x| + \sqrt{1+x^2}\Bigr)$$ +@end tex + +<> is identical, other than taking and returning floats. + +RETURNS +<> and <> return the calculated value. + +PORTABILITY +Neither <> nor <> are ANSI C. + +*/ + +/* asinh(x) + * Method : + * Based on + * asinh(x) = sign(x) * log [ |x| + sqrt(x*x+1) ] + * we have + * asinh(x) := x if 1+x*x=1, + * := sign(x)*(log(x)+ln2)) for large |x|, else + * := sign(x)*log(2|x|+1/(|x|+sqrt(x*x+1))) if|x|>2, else + * := sign(x)*log1p(|x| + x^2/(1 + sqrt(1+x^2))) + */ + +#include "fdlibm.h" + +#ifndef _DOUBLE_IS_32BITS + +#ifdef __STDC__ +static const double +#else +static double +#endif +one = 1.00000000000000000000e+00, /* 0x3FF00000, 0x00000000 */ +ln2 = 6.93147180559945286227e-01, /* 0x3FE62E42, 0xFEFA39EF */ +huge= 1.00000000000000000000e+300; + +#ifdef __STDC__ + double asinh(double x) +#else + double asinh(x) + double x; +#endif +{ + double t,w; + __int32_t hx,ix; + GET_HIGH_WORD(hx,x); + ix = hx&0x7fffffff; + if(ix>=0x7ff00000) return x+x; /* x is inf or NaN */ + if(ix< 0x3e300000) { /* |x|<2**-28 */ + if(huge+x>one) return x; /* return x inexact except 0 */ + } + if(ix>0x41b00000) { /* |x| > 2**28 */ + w = __ieee754_log(fabs(x))+ln2; + } else if (ix>0x40000000) { /* 2**28 > |x| > 2.0 */ + t = fabs(x); + w = __ieee754_log(2.0*t+one/(__ieee754_sqrt(x*x+one)+t)); + } else { /* 2.0 > |x| > 2**-28 */ + t = x*x; + w =log1p(fabs(x)+t/(one+__ieee754_sqrt(one+t))); + } + if(hx>0) return w; else return -w; +} + +#endif /* _DOUBLE_IS_32BITS */

s_asinh.c Property changes : Added: svn:eol-style ## -0,0 +1 ## +native \ No newline at end of property Added: svn:keywords ## -0,0 +1 ## +Id \ No newline at end of property Index: wf_asin.c =================================================================== --- wf_asin.c (nonexistent) +++ wf_asin.c (revision 158) @@ -0,0 +1,71 @@ +/* wf_asin.c -- float version of w_asin.c. + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + */ + +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + * + */ + +/* + * wrapper asinf(x) + */ + + +#include "fdlibm.h" +#include + +#ifdef __STDC__ + float asinf(float x) /* wrapper asinf */ +#else + float asinf(x) /* wrapper asinf */ + float x; +#endif +{ +#ifdef _IEEE_LIBM + return __ieee754_asinf(x); +#else + float z; + struct exception exc; + z = __ieee754_asinf(x); + if(_LIB_VERSION == _IEEE_ || isnanf(x)) return z; + if(fabsf(x)>(float)1.0) { + /* asinf(|x|>1) */ + exc.type = DOMAIN; + exc.name = "asinf"; + exc.err = 0; + exc.arg1 = exc.arg2 = (double)x; + exc.retval = nan(""); + if(_LIB_VERSION == _POSIX_) + errno = EDOM; + else if (!matherr(&exc)) { + errno = EDOM; + } + if (exc.err != 0) + errno = exc.err; + return (float)exc.retval; + } else + return z; +#endif +} + +#ifdef _DOUBLE_IS_32BITS + +#ifdef __STDC__ + double asin(double x) +#else + double asin(x) + double x; +#endif +{ + return (double) asinf((float) x); +} + +#endif /* defined(_DOUBLE_IS_32BITS) */

wf_asin.c Property changes : Added: svn:eol-style ## -0,0 +1 ## +native \ No newline at end of property Added: svn:keywords ## -0,0 +1 ## +Id \ No newline at end of property Index: w_hypot.c =================================================================== --- w_hypot.c (nonexistent) +++ w_hypot.c (revision 158) @@ -0,0 +1,109 @@ + +/* @(#)w_hypot.c 5.1 93/09/24 */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +/* +FUNCTION + <>, <>---distance from origin +INDEX + hypot +INDEX + hypotf + +ANSI_SYNOPSIS + #include + double hypot(double <[x]>, double <[y]>); + float hypotf(float <[x]>, float <[y]>); + +TRAD_SYNOPSIS + double hypot(<[x]>, <[y]>) + double <[x]>, <[y]>; + + float hypotf(<[x]>, <[y]>) + float <[x]>, <[y]>; + +DESCRIPTION + <> calculates the Euclidean distance + @tex + $\sqrt{x^2+y^2}$ + @end tex + @ifnottex + <*<[x]> + <[y]>*<[y]>)>> + @end ifnottex + between the origin (0,0) and a point represented by the + Cartesian coordinates (<[x]>,<[y]>). <> differs only + in the type of its arguments and result. + +RETURNS + Normally, the distance value is returned. On overflow, + <> returns <> and sets <> to + <>. + + You can change the error treatment with <>. + +PORTABILITY + <> and <> are not ANSI C. */ + +/* + * wrapper hypot(x,y) + */ + +#include "fdlibm.h" +#include + +#ifndef _DOUBLE_IS_32BITS + +#ifdef __STDC__ + double hypot(double x, double y)/* wrapper hypot */ +#else + double hypot(x,y) /* wrapper hypot */ + double x,y; +#endif +{ +#ifdef _IEEE_LIBM + return __ieee754_hypot(x,y); +#else + double z; + struct exception exc; + z = __ieee754_hypot(x,y); + if(_LIB_VERSION == _IEEE_) return z; + if((!finite(z))&&finite(x)&&finite(y)) { + /* hypot(finite,finite) overflow */ +#ifndef HUGE_VAL +#define HUGE_VAL inf + double inf = 0.0; + + SET_HIGH_WORD(inf,0x7ff00000); /* set inf to infinite */ +#endif + exc.type = OVERFLOW; + exc.name = "hypot"; + exc.err = 0; + exc.arg1 = x; + exc.arg2 = y; + if (_LIB_VERSION == _SVID_) + exc.retval = HUGE; + else + exc.retval = HUGE_VAL; + if (_LIB_VERSION == _POSIX_) + errno = ERANGE; + else if (!matherr(&exc)) { + errno = ERANGE; + } + if (exc.err != 0) + errno = exc.err; + return exc.retval; + } else + return z; +#endif +} + +#endif /* defined(_DOUBLE_IS_32BITS) */

w_hypot.c Property changes : Added: svn:eol-style ## -0,0 +1 ## +native \ No newline at end of property Added: svn:keywords ## -0,0 +1 ## +Id \ No newline at end of property Index: s_erf.c =================================================================== --- s_erf.c (nonexistent) +++ s_erf.c (revision 158) @@ -0,0 +1,373 @@ + +/* @(#)s_erf.c 5.1 93/09/24 */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +/* +FUNCTION + <>, <>, <>, <>---error function +INDEX + erf +INDEX + erff +INDEX + erfc +INDEX + erfcf + +ANSI_SYNOPSIS + #include + double erf(double <[x]>); + float erff(float <[x]>); + double erfc(double <[x]>); + float erfcf(float <[x]>); +TRAD_SYNOPSIS + #include + + double erf(<[x]>) + double <[x]>; + + float erff(<[x]>) + float <[x]>; + + double erfc(<[x]>) + double <[x]>; + + float erfcf(<[x]>) + float <[x]>; + +DESCRIPTION + <> calculates an approximation to the ``error function'', + which estimates the probability that an observation will fall within + <[x]> standard deviations of the mean (assuming a normal + distribution). + @tex + The error function is defined as + $${2\over\sqrt\pi}\times\int_0^x e^{-t^2}dt$$ + @end tex + + <> calculates the complementary probability; that is, + <)>> is <<1 - erf(<[x]>)>>. <> is computed directly, + so that you can use it to avoid the loss of precision that would + result from subtracting large probabilities (on large <[x]>) from 1. + + <> and <> differ from <> and <> only in the + argument and result types. + +RETURNS + For positive arguments, <> and all its variants return a + probability---a number between 0 and 1. + +PORTABILITY + None of the variants of <> are ANSI C. +*/ + +/* double erf(double x) + * double erfc(double x) + * x + * 2 |\ + * erf(x) = --------- | exp(-t*t)dt + * sqrt(pi) \| + * 0 + * + * erfc(x) = 1-erf(x) + * Note that + * erf(-x) = -erf(x) + * erfc(-x) = 2 - erfc(x) + * + * Method: + * 1. For |x| in [0, 0.84375] + * erf(x) = x + x*R(x^2) + * erfc(x) = 1 - erf(x) if x in [-.84375,0.25] + * = 0.5 + ((0.5-x)-x*R) if x in [0.25,0.84375] + * where R = P/Q where P is an odd poly of degree 8 and + * Q is an odd poly of degree 10. + * -57.90 + * | R - (erf(x)-x)/x | <= 2 + * + * + * Remark. The formula is derived by noting + * erf(x) = (2/sqrt(pi))*(x - x^3/3 + x^5/10 - x^7/42 + ....) + * and that + * 2/sqrt(pi) = 1.128379167095512573896158903121545171688 + * is close to one. The interval is chosen because the fix + * point of erf(x) is near 0.6174 (i.e., erf(x)=x when x is + * near 0.6174), and by some experiment, 0.84375 is chosen to + * guarantee the error is less than one ulp for erf. + * + * 2. For |x| in [0.84375,1.25], let s = |x| - 1, and + * c = 0.84506291151 rounded to single (24 bits) + * erf(x) = sign(x) * (c + P1(s)/Q1(s)) + * erfc(x) = (1-c) - P1(s)/Q1(s) if x > 0 + * 1+(c+P1(s)/Q1(s)) if x < 0 + * |P1/Q1 - (erf(|x|)-c)| <= 2**-59.06 + * Remark: here we use the taylor series expansion at x=1. + * erf(1+s) = erf(1) + s*Poly(s) + * = 0.845.. + P1(s)/Q1(s) + * That is, we use rational approximation to approximate + * erf(1+s) - (c = (single)0.84506291151) + * Note that |P1/Q1|< 0.078 for x in [0.84375,1.25] + * where + * P1(s) = degree 6 poly in s + * Q1(s) = degree 6 poly in s + * + * 3. For x in [1.25,1/0.35(~2.857143)], + * erfc(x) = (1/x)*exp(-x*x-0.5625+R1/S1) + * erf(x) = 1 - erfc(x) + * where + * R1(z) = degree 7 poly in z, (z=1/x^2) + * S1(z) = degree 8 poly in z + * + * 4. For x in [1/0.35,28] + * erfc(x) = (1/x)*exp(-x*x-0.5625+R2/S2) if x > 0 + * = 2.0 - (1/x)*exp(-x*x-0.5625+R2/S2) if -6 x >= 28 + * erf(x) = sign(x) *(1 - tiny) (raise inexact) + * erfc(x) = tiny*tiny (raise underflow) if x > 0 + * = 2 - tiny if x<0 + * + * 7. Special case: + * erf(0) = 0, erf(inf) = 1, erf(-inf) = -1, + * erfc(0) = 1, erfc(inf) = 0, erfc(-inf) = 2, + * erfc/erf(NaN) is NaN + */ + + +#include "fdlibm.h" + +#ifndef _DOUBLE_IS_32BITS + +#ifdef __STDC__ +static const double +#else +static double +#endif +tiny = 1e-300, +half= 5.00000000000000000000e-01, /* 0x3FE00000, 0x00000000 */ +one = 1.00000000000000000000e+00, /* 0x3FF00000, 0x00000000 */ +two = 2.00000000000000000000e+00, /* 0x40000000, 0x00000000 */ + /* c = (float)0.84506291151 */ +erx = 8.45062911510467529297e-01, /* 0x3FEB0AC1, 0x60000000 */ +/* + * Coefficients for approximation to erf on [0,0.84375] + */ +efx = 1.28379167095512586316e-01, /* 0x3FC06EBA, 0x8214DB69 */ +efx8= 1.02703333676410069053e+00, /* 0x3FF06EBA, 0x8214DB69 */ +pp0 = 1.28379167095512558561e-01, /* 0x3FC06EBA, 0x8214DB68 */ +pp1 = -3.25042107247001499370e-01, /* 0xBFD4CD7D, 0x691CB913 */ +pp2 = -2.84817495755985104766e-02, /* 0xBF9D2A51, 0xDBD7194F */ +pp3 = -5.77027029648944159157e-03, /* 0xBF77A291, 0x236668E4 */ +pp4 = -2.37630166566501626084e-05, /* 0xBEF8EAD6, 0x120016AC */ +qq1 = 3.97917223959155352819e-01, /* 0x3FD97779, 0xCDDADC09 */ +qq2 = 6.50222499887672944485e-02, /* 0x3FB0A54C, 0x5536CEBA */ +qq3 = 5.08130628187576562776e-03, /* 0x3F74D022, 0xC4D36B0F */ +qq4 = 1.32494738004321644526e-04, /* 0x3F215DC9, 0x221C1A10 */ +qq5 = -3.96022827877536812320e-06, /* 0xBED09C43, 0x42A26120 */ +/* + * Coefficients for approximation to erf in [0.84375,1.25] + */ +pa0 = -2.36211856075265944077e-03, /* 0xBF6359B8, 0xBEF77538 */ +pa1 = 4.14856118683748331666e-01, /* 0x3FDA8D00, 0xAD92B34D */ +pa2 = -3.72207876035701323847e-01, /* 0xBFD7D240, 0xFBB8C3F1 */ +pa3 = 3.18346619901161753674e-01, /* 0x3FD45FCA, 0x805120E4 */ +pa4 = -1.10894694282396677476e-01, /* 0xBFBC6398, 0x3D3E28EC */ +pa5 = 3.54783043256182359371e-02, /* 0x3FA22A36, 0x599795EB */ +pa6 = -2.16637559486879084300e-03, /* 0xBF61BF38, 0x0A96073F */ +qa1 = 1.06420880400844228286e-01, /* 0x3FBB3E66, 0x18EEE323 */ +qa2 = 5.40397917702171048937e-01, /* 0x3FE14AF0, 0x92EB6F33 */ +qa3 = 7.18286544141962662868e-02, /* 0x3FB2635C, 0xD99FE9A7 */ +qa4 = 1.26171219808761642112e-01, /* 0x3FC02660, 0xE763351F */ +qa5 = 1.36370839120290507362e-02, /* 0x3F8BEDC2, 0x6B51DD1C */ +qa6 = 1.19844998467991074170e-02, /* 0x3F888B54, 0x5735151D */ +/* + * Coefficients for approximation to erfc in [1.25,1/0.35] + */ +ra0 = -9.86494403484714822705e-03, /* 0xBF843412, 0x600D6435 */ +ra1 = -6.93858572707181764372e-01, /* 0xBFE63416, 0xE4BA7360 */ +ra2 = -1.05586262253232909814e+01, /* 0xC0251E04, 0x41B0E726 */ +ra3 = -6.23753324503260060396e+01, /* 0xC04F300A, 0xE4CBA38D */ +ra4 = -1.62396669462573470355e+02, /* 0xC0644CB1, 0x84282266 */ +ra5 = -1.84605092906711035994e+02, /* 0xC067135C, 0xEBCCABB2 */ +ra6 = -8.12874355063065934246e+01, /* 0xC0545265, 0x57E4D2F2 */ +ra7 = -9.81432934416914548592e+00, /* 0xC023A0EF, 0xC69AC25C */ +sa1 = 1.96512716674392571292e+01, /* 0x4033A6B9, 0xBD707687 */ +sa2 = 1.37657754143519042600e+02, /* 0x4061350C, 0x526AE721 */ +sa3 = 4.34565877475229228821e+02, /* 0x407B290D, 0xD58A1A71 */ +sa4 = 6.45387271733267880336e+02, /* 0x40842B19, 0x21EC2868 */ +sa5 = 4.29008140027567833386e+02, /* 0x407AD021, 0x57700314 */ +sa6 = 1.08635005541779435134e+02, /* 0x405B28A3, 0xEE48AE2C */ +sa7 = 6.57024977031928170135e+00, /* 0x401A47EF, 0x8E484A93 */ +sa8 = -6.04244152148580987438e-02, /* 0xBFAEEFF2, 0xEE749A62 */ +/* + * Coefficients for approximation to erfc in [1/.35,28] + */ +rb0 = -9.86494292470009928597e-03, /* 0xBF843412, 0x39E86F4A */ +rb1 = -7.99283237680523006574e-01, /* 0xBFE993BA, 0x70C285DE */ +rb2 = -1.77579549177547519889e+01, /* 0xC031C209, 0x555F995A */ +rb3 = -1.60636384855821916062e+02, /* 0xC064145D, 0x43C5ED98 */ +rb4 = -6.37566443368389627722e+02, /* 0xC083EC88, 0x1375F228 */ +rb5 = -1.02509513161107724954e+03, /* 0xC0900461, 0x6A2E5992 */ +rb6 = -4.83519191608651397019e+02, /* 0xC07E384E, 0x9BDC383F */ +sb1 = 3.03380607434824582924e+01, /* 0x403E568B, 0x261D5190 */ +sb2 = 3.25792512996573918826e+02, /* 0x40745CAE, 0x221B9F0A */ +sb3 = 1.53672958608443695994e+03, /* 0x409802EB, 0x189D5118 */ +sb4 = 3.19985821950859553908e+03, /* 0x40A8FFB7, 0x688C246A */ +sb5 = 2.55305040643316442583e+03, /* 0x40A3F219, 0xCEDF3BE6 */ +sb6 = 4.74528541206955367215e+02, /* 0x407DA874, 0xE79FE763 */ +sb7 = -2.24409524465858183362e+01; /* 0xC03670E2, 0x42712D62 */ + +#ifdef __STDC__ + double erf(double x) +#else + double erf(x) + double x; +#endif +{ + __int32_t hx,ix,i; + double R,S,P,Q,s,y,z,r; + GET_HIGH_WORD(hx,x); + ix = hx&0x7fffffff; + if(ix>=0x7ff00000) { /* erf(nan)=nan */ + i = ((__uint32_t)hx>>31)<<1; + return (double)(1-i)+one/x; /* erf(+-inf)=+-1 */ + } + + if(ix < 0x3feb0000) { /* |x|<0.84375 */ + if(ix < 0x3e300000) { /* |x|<2**-28 */ + if (ix < 0x00800000) + return 0.125*(8.0*x+efx8*x); /*avoid underflow */ + return x + efx*x; + } + z = x*x; + r = pp0+z*(pp1+z*(pp2+z*(pp3+z*pp4))); + s = one+z*(qq1+z*(qq2+z*(qq3+z*(qq4+z*qq5)))); + y = r/s; + return x + x*y; + } + if(ix < 0x3ff40000) { /* 0.84375 <= |x| < 1.25 */ + s = fabs(x)-one; + P = pa0+s*(pa1+s*(pa2+s*(pa3+s*(pa4+s*(pa5+s*pa6))))); + Q = one+s*(qa1+s*(qa2+s*(qa3+s*(qa4+s*(qa5+s*qa6))))); + if(hx>=0) return erx + P/Q; else return -erx - P/Q; + } + if (ix >= 0x40180000) { /* inf>|x|>=6 */ + if(hx>=0) return one-tiny; else return tiny-one; + } + x = fabs(x); + s = one/(x*x); + if(ix< 0x4006DB6E) { /* |x| < 1/0.35 */ + R=ra0+s*(ra1+s*(ra2+s*(ra3+s*(ra4+s*( + ra5+s*(ra6+s*ra7)))))); + S=one+s*(sa1+s*(sa2+s*(sa3+s*(sa4+s*( + sa5+s*(sa6+s*(sa7+s*sa8))))))); + } else { /* |x| >= 1/0.35 */ + R=rb0+s*(rb1+s*(rb2+s*(rb3+s*(rb4+s*( + rb5+s*rb6))))); + S=one+s*(sb1+s*(sb2+s*(sb3+s*(sb4+s*( + sb5+s*(sb6+s*sb7)))))); + } + z = x; + SET_LOW_WORD(z,0); + r = __ieee754_exp(-z*z-0.5625)*__ieee754_exp((z-x)*(z+x)+R/S); + if(hx>=0) return one-r/x; else return r/x-one; +} + +#ifdef __STDC__ + double erfc(double x) +#else + double erfc(x) + double x; +#endif +{ + __int32_t hx,ix; + double R,S,P,Q,s,y,z,r; + GET_HIGH_WORD(hx,x); + ix = hx&0x7fffffff; + if(ix>=0x7ff00000) { /* erfc(nan)=nan */ + /* erfc(+-inf)=0,2 */ + return (double)(((__uint32_t)hx>>31)<<1)+one/x; + } + + if(ix < 0x3feb0000) { /* |x|<0.84375 */ + if(ix < 0x3c700000) /* |x|<2**-56 */ + return one-x; + z = x*x; + r = pp0+z*(pp1+z*(pp2+z*(pp3+z*pp4))); + s = one+z*(qq1+z*(qq2+z*(qq3+z*(qq4+z*qq5)))); + y = r/s; + if(hx < 0x3fd00000) { /* x<1/4 */ + return one-(x+x*y); + } else { + r = x*y; + r += (x-half); + return half - r ; + } + } + if(ix < 0x3ff40000) { /* 0.84375 <= |x| < 1.25 */ + s = fabs(x)-one; + P = pa0+s*(pa1+s*(pa2+s*(pa3+s*(pa4+s*(pa5+s*pa6))))); + Q = one+s*(qa1+s*(qa2+s*(qa3+s*(qa4+s*(qa5+s*qa6))))); + if(hx>=0) { + z = one-erx; return z - P/Q; + } else { + z = erx+P/Q; return one+z; + } + } + if (ix < 0x403c0000) { /* |x|<28 */ + x = fabs(x); + s = one/(x*x); + if(ix< 0x4006DB6D) { /* |x| < 1/.35 ~ 2.857143*/ + R=ra0+s*(ra1+s*(ra2+s*(ra3+s*(ra4+s*( + ra5+s*(ra6+s*ra7)))))); + S=one+s*(sa1+s*(sa2+s*(sa3+s*(sa4+s*( + sa5+s*(sa6+s*(sa7+s*sa8))))))); + } else { /* |x| >= 1/.35 ~ 2.857143 */ + if(hx<0&&ix>=0x40180000) return two-tiny;/* x < -6 */ + R=rb0+s*(rb1+s*(rb2+s*(rb3+s*(rb4+s*( + rb5+s*rb6))))); + S=one+s*(sb1+s*(sb2+s*(sb3+s*(sb4+s*( + sb5+s*(sb6+s*sb7)))))); + } + z = x; + SET_LOW_WORD(z,0); + r = __ieee754_exp(-z*z-0.5625)* + __ieee754_exp((z-x)*(z+x)+R/S); + if(hx>0) return r/x; else return two-r/x; + } else { + if(hx>0) return tiny*tiny; else return two-tiny; + } +} + +#endif /* _DOUBLE_IS_32BITS */

s_erf.c Property changes : Added: svn:eol-style ## -0,0 +1 ## +native \ No newline at end of property Added: svn:keywords ## -0,0 +1 ## +Id \ No newline at end of property Index: w_gamma.c =================================================================== --- w_gamma.c (nonexistent) +++ w_gamma.c (revision 158) @@ -0,0 +1,193 @@ + +/* @(#)w_gamma.c 5.1 93/09/24 */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + * + */ + +/* +FUNCTION + <>, <>, <>, <>, <>, + <>, <>, <>---logarithmic gamma + function +INDEX +gamma +INDEX +gammaf +INDEX +lgamma +INDEX +lgammaf +INDEX +gamma_r +INDEX +gammaf_r +INDEX +lgamma_r +INDEX +lgammaf_r + +ANSI_SYNOPSIS +#include +double gamma(double <[x]>); +float gammaf(float <[x]>); +double lgamma(double <[x]>); +float lgammaf(float <[x]>); +double gamma_r(double <[x]>, int *<[signgamp]>); +float gammaf_r(float <[x]>, int *<[signgamp]>); +double lgamma_r(double <[x]>, int *<[signgamp]>); +float lgammaf_r(float <[x]>, int *<[signgamp]>); + +TRAD_SYNOPSIS +#include +double gamma(<[x]>) +double <[x]>; +float gammaf(<[x]>) +float <[x]>; +double lgamma(<[x]>) +double <[x]>; +float lgammaf(<[x]>) +float <[x]>; +double gamma_r(<[x]>, <[signgamp]>) +double <[x]>; +int <[signgamp]>; +float gammaf_r(<[x]>, <[signgamp]>) +float <[x]>; +int <[signgamp]>; +double lgamma_r(<[x]>, <[signgamp]>) +double <[x]>; +int <[signgamp]>; +float lgammaf_r(<[x]>, <[signgamp]>) +float <[x]>; +int <[signgamp]>; + +DESCRIPTION +<> calculates +@tex +$\mit ln\bigl(\Gamma(x)\bigr)$, +@end tex +the natural logarithm of the gamma function of <[x]>. The gamma function +(<))>>) is a generalization of factorial, and retains +the property that +@ifnottex +<> is equivalent to <>. +@end ifnottex +@tex +$\mit \Gamma(N)\equiv N\times\Gamma(N-1)$. +@end tex +Accordingly, the results of the gamma function itself grow very +quickly. <> is defined as +@tex +$\mit ln\bigl(\Gamma(x)\bigr)$ rather than simply $\mit \Gamma(x)$ +@end tex +@ifnottex +the natural log of the gamma function, rather than the gamma function +itself, +@end ifnottex +to extend the useful range of results representable. + +The sign of the result is returned in the global variable <>, +which is declared in math.h. + +<> performs the same calculation as <>, but uses and +returns <> values. + +<> and <> are alternate names for <> and +<>. The use of <> instead of <> is a reminder +that these functions compute the log of the gamma function, rather +than the gamma function itself. + +The functions <>, <>, <>, and +<> are just like <>, <>, <>, and +<>, respectively, but take an additional argument. This +additional argument is a pointer to an integer. This additional +argument is used to return the sign of the result, and the global +variable <> is not used. These functions may be used for +reentrant calls (but they will still set the global variable <> +if an error occurs). + +RETURNS +Normally, the computed result is returned. + +When <[x]> is a nonpositive integer, <> returns <> +and <> is set to <>. If the result overflows, <> +returns <> and <> is set to <>. + +You can modify this error treatment using <>. + +PORTABILITY +Neither <> nor <> is ANSI C. */ + +/* double gamma(double x) + * Return the logarithm of the Gamma function of x. + * + * Method: call gamma_r + */ + +#include "fdlibm.h" +#include +#include + +#ifndef _DOUBLE_IS_32BITS + +#ifdef __STDC__ + double gamma(double x) +#else + double gamma(x) + double x; +#endif +{ +#ifdef _IEEE_LIBM + return __ieee754_gamma_r(x,&(_REENT_SIGNGAM(_REENT))); +#else + double y; + struct exception exc; + y = __ieee754_gamma_r(x,&(_REENT_SIGNGAM(_REENT))); + if(_LIB_VERSION == _IEEE_) return y; + if(!finite(y)&&finite(x)) { +#ifndef HUGE_VAL +#define HUGE_VAL inf + double inf = 0.0; + + SET_HIGH_WORD(inf,0x7ff00000); /* set inf to infinite */ +#endif + exc.name = "gamma"; + exc.err = 0; + exc.arg1 = exc.arg2 = x; + if (_LIB_VERSION == _SVID_) + exc.retval = HUGE; + else + exc.retval = HUGE_VAL; + if(floor(x)==x&&x<=0.0) { + /* gamma(-integer) or gamma(0) */ + exc.type = SING; + if (_LIB_VERSION == _POSIX_) + errno = EDOM; + else if (!matherr(&exc)) { + errno = EDOM; + } + } else { + /* gamma(finite) overflow */ + exc.type = OVERFLOW; + if (_LIB_VERSION == _POSIX_) + errno = ERANGE; + else if (!matherr(&exc)) { + errno = ERANGE; + } + } + if (exc.err != 0) + errno = exc.err; + return exc.retval; + } else + return y; +#endif +} + +#endif /* defined(_DOUBLE_IS_32BITS) */

w_gamma.c Property changes : Added: svn:eol-style ## -0,0 +1 ## +native \ No newline at end of property Added: svn:keywords ## -0,0 +1 ## +Id \ No newline at end of property Index: er_gamma.c =================================================================== --- er_gamma.c (nonexistent) +++ er_gamma.c (revision 158) @@ -0,0 +1,32 @@ + +/* @(#)er_gamma.c 5.1 93/09/24 */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + * + */ + +/* __ieee754_gamma_r(x, signgamp) + * Reentrant version of the logarithm of the Gamma function + * with user provide pointer for the sign of Gamma(x). + * + * Method: See __ieee754_lgamma_r + */ + +#include "fdlibm.h" + +#ifdef __STDC__ + double __ieee754_gamma_r(double x, int *signgamp) +#else + double __ieee754_gamma_r(x,signgamp) + double x; int *signgamp; +#endif +{ + return __ieee754_exp (__ieee754_lgamma_r(x,signgamp)); +}

er_gamma.c Property changes : Added: svn:eol-style ## -0,0 +1 ## +native \ No newline at end of property Added: svn:keywords ## -0,0 +1 ## +Id \ No newline at end of property Index: sf_floor.c =================================================================== --- sf_floor.c (nonexistent) +++ sf_floor.c (revision 158) @@ -0,0 +1,80 @@ +/* sf_floor.c -- float version of s_floor.c. + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + */ + +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +/* + * floorf(x) + * Return x rounded toward -inf to integral value + * Method: + * Bit twiddling. + * Exception: + * Inexact flag raised if x not equal to floorf(x). + */ + +#include "fdlibm.h" + +#ifdef __STDC__ +static const float huge = 1.0e30; +#else +static float huge = 1.0e30; +#endif + +#ifdef __STDC__ + float floorf(float x) +#else + float floorf(x) + float x; +#endif +{ + __int32_t i0,j0; + __uint32_t i,ix; + GET_FLOAT_WORD(i0,x); + ix = (i0&0x7fffffff); + j0 = (ix>>23)-0x7f; + if(j0<23) { + if(j0<0) { /* raise inexact if x != 0 */ + if(huge+x>(float)0.0) {/* return 0*sign(x) if |x|<1 */ + if(i0>=0) {i0=0;} + else if(!FLT_UWORD_IS_ZERO(ix)) + { i0=0xbf800000;} + } + } else { + i = (0x007fffff)>>j0; + if((i0&i)==0) return x; /* x is integral */ + if(huge+x>(float)0.0) { /* raise inexact flag */ + if(i0<0) i0 += (0x00800000)>>j0; + i0 &= (~i); + } + } + } else { + if(!FLT_UWORD_IS_FINITE(ix)) return x+x; /* inf or NaN */ + else return x; /* x is integral */ + } + SET_FLOAT_WORD(x,i0); + return x; +} + +#ifdef _DOUBLE_IS_32BITS + +#ifdef __STDC__ + double floor(double x) +#else + double floor(x) + double x; +#endif +{ + return (double) floorf((float) x); +} + +#endif /* defined(_DOUBLE_IS_32BITS) */

sf_floor.c Property changes : Added: svn:eol-style ## -0,0 +1 ## +native \ No newline at end of property Added: svn:keywords ## -0,0 +1 ## +Id \ No newline at end of property Index: e_remainder.c =================================================================== --- e_remainder.c (nonexistent) +++ e_remainder.c (revision 158) @@ -0,0 +1,80 @@ + +/* @(#)e_remainder.c 5.1 93/09/24 */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +/* __ieee754_remainder(x,p) + * Return : + * returns x REM p = x - [x/p]*p as if in infinite + * precise arithmetic, where [x/p] is the (infinite bit) + * integer nearest x/p (in half way case choose the even one). + * Method : + * Based on fmod() return x-[x/p]chopped*p exactlp. + */ + +#include "fdlibm.h" + +#ifndef _DOUBLE_IS_32BITS + +#ifdef __STDC__ +static const double zero = 0.0; +#else +static double zero = 0.0; +#endif + + +#ifdef __STDC__ + double __ieee754_remainder(double x, double p) +#else + double __ieee754_remainder(x,p) + double x,p; +#endif +{ + __int32_t hx,hp; + __uint32_t sx,lx,lp; + double p_half; + + EXTRACT_WORDS(hx,lx,x); + EXTRACT_WORDS(hp,lp,p); + sx = hx&0x80000000; + hp &= 0x7fffffff; + hx &= 0x7fffffff; + + /* purge off exception values */ + if((hp|lp)==0) return (x*p)/(x*p); /* p = 0 */ + if((hx>=0x7ff00000)|| /* x not finite */ + ((hp>=0x7ff00000)&& /* p is NaN */ + (((hp-0x7ff00000)|lp)!=0))) + return (x*p)/(x*p); + + + if (hp<=0x7fdfffff) x = __ieee754_fmod(x,p+p); /* now x < 2p */ + if (((hx-hp)|(lx-lp))==0) return zero*x; + x = fabs(x); + p = fabs(p); + if (hp<0x00200000) { + if(x+x>p) { + x-=p; + if(x+x>=p) x -= p; + } + } else { + p_half = 0.5*p; + if(x>p_half) { + x-=p; + if(x>=p_half) x -= p; + } + } + GET_HIGH_WORD(hx,x); + SET_HIGH_WORD(x,hx^sx); + return x; +} + +#endif /* defined(_DOUBLE_IS_32BITS) */

e_remainder.c Property changes : Added: svn:eol-style ## -0,0 +1 ## +native \ No newline at end of property Added: svn:keywords ## -0,0 +1 ## +Id \ No newline at end of property Index: k_standard.c =================================================================== --- k_standard.c (nonexistent) +++ k_standard.c (revision 158) @@ -0,0 +1,784 @@ + +/* @(#)k_standard.c 5.1 93/09/24 */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + * + */ + +#include "fdlibm.h" +#include + +#ifndef _USE_WRITE +#include /* fputs(), stderr */ +#define WRITE2(u,v) fputs(u, stderr) +#else /* !defined(_USE_WRITE) */ +#include /* write */ +#define WRITE2(u,v) write(2, u, v) +#undef fflush +#endif /* !defined(_USE_WRITE) */ + +#ifdef __STDC__ +static const double zero = 0.0; /* used as const */ +#else +static double zero = 0.0; /* used as const */ +#endif + +/* + * Standard conformance (non-IEEE) on exception cases. + * Mapping: + * 1 -- acos(|x|>1) + * 2 -- asin(|x|>1) + * 3 -- atan2(+-0,+-0) + * 4 -- hypot overflow + * 5 -- cosh overflow + * 6 -- exp overflow + * 7 -- exp underflow + * 8 -- y0(0) + * 9 -- y0(-ve) + * 10-- y1(0) + * 11-- y1(-ve) + * 12-- yn(0) + * 13-- yn(-ve) + * 14-- lgamma(finite) overflow + * 15-- lgamma(-integer) + * 16-- log(0) + * 17-- log(x<0) + * 18-- log10(0) + * 19-- log10(x<0) + * 20-- pow(0.0,0.0) + * 21-- pow(x,y) overflow + * 22-- pow(x,y) underflow + * 23-- pow(0,negative) + * 24-- pow(neg,non-integral) + * 25-- sinh(finite) overflow + * 26-- sqrt(negative) + * 27-- fmod(x,0) + * 28-- remainder(x,0) + * 29-- acosh(x<1) + * 30-- atanh(|x|>1) + * 31-- atanh(|x|=1) + * 32-- scalb overflow + * 33-- scalb underflow + * 34-- j0(|x|>X_TLOSS) + * 35-- y0(x>X_TLOSS) + * 36-- j1(|x|>X_TLOSS) + * 37-- y1(x>X_TLOSS) + * 38-- jn(|x|>X_TLOSS, n) + * 39-- yn(x>X_TLOSS, n) + * 40-- gamma(finite) overflow + * 41-- gamma(-integer) + * 42-- pow(NaN,0.0) + */ + + +#ifdef __STDC__ + double __kernel_standard(double x, double y, int type) +#else + double __kernel_standard(x,y,type) + double x,y; int type; +#endif +{ + struct exception exc; +#ifndef HUGE_VAL /* this is the only routine that uses HUGE_VAL */ +#define HUGE_VAL inf + double inf = 0.0; + + SET_HIGH_WORD(inf,0x7ff00000); /* set inf to infinite */ +#endif + +#ifdef _USE_WRITE + /* (void) fflush(_stdout_r(p)); */ +#endif + exc.arg1 = x; + exc.arg2 = y; + exc.err = 0; + switch(type) { + case 1: + case 101: + /* acos(|x|>1) */ + exc.type = DOMAIN; + exc.name = type < 100 ? "acos" : "acosf"; + exc.retval = zero; + if (_LIB_VERSION == _POSIX_) + errno = EDOM; + else if (!matherr(&exc)) { + /* if(_LIB_VERSION == _SVID_) { + (void) WRITE2("acos: DOMAIN error\n", 19); + } */ + errno = EDOM; + } + break; + case 2: + case 102: + /* asin(|x|>1) */ + exc.type = DOMAIN; + exc.name = type < 100 ? "asin" : "asinf"; + exc.retval = zero; + if(_LIB_VERSION == _POSIX_) + errno = EDOM; + else if (!matherr(&exc)) { + /* if(_LIB_VERSION == _SVID_) { + (void) WRITE2("asin: DOMAIN error\n", 19); + } */ + errno = EDOM; + } + break; + case 3: + case 103: + /* atan2(+-0,+-0) */ + exc.arg1 = y; + exc.arg2 = x; + exc.type = DOMAIN; + exc.name = type < 100 ? "atan2" : "atan2f"; + exc.retval = zero; + if(_LIB_VERSION == _POSIX_) + errno = EDOM; + else if (!matherr(&exc)) { + /* if(_LIB_VERSION == _SVID_) { + (void) WRITE2("atan2: DOMAIN error\n", 20); + } */ + errno = EDOM; + } + break; + case 4: + case 104: + /* hypot(finite,finite) overflow */ + exc.type = OVERFLOW; + exc.name = type < 100 ? "hypot" : "hypotf"; + if (_LIB_VERSION == _SVID_) + exc.retval = HUGE; + else + exc.retval = HUGE_VAL; + if (_LIB_VERSION == _POSIX_) + errno = ERANGE; + else if (!matherr(&exc)) { + errno = ERANGE; + } + break; + case 5: + case 105: + /* cosh(finite) overflow */ + exc.type = OVERFLOW; + exc.name = type < 100 ? "cosh" : "coshf"; + if (_LIB_VERSION == _SVID_) + exc.retval = HUGE; + else + exc.retval = HUGE_VAL; + if (_LIB_VERSION == _POSIX_) + errno = ERANGE; + else if (!matherr(&exc)) { + errno = ERANGE; + } + break; + case 6: + case 106: + /* exp(finite) overflow */ + exc.type = OVERFLOW; + exc.name = type < 100 ? "exp" : "expf"; + if (_LIB_VERSION == _SVID_) + exc.retval = HUGE; + else + exc.retval = HUGE_VAL; + if (_LIB_VERSION == _POSIX_) + errno = ERANGE; + else if (!matherr(&exc)) { + errno = ERANGE; + } + break; + case 7: + case 107: + /* exp(finite) underflow */ + exc.type = UNDERFLOW; + exc.name = type < 100 ? "exp" : "expf"; + exc.retval = zero; + if (_LIB_VERSION == _POSIX_) + errno = ERANGE; + else if (!matherr(&exc)) { + errno = ERANGE; + } + break; + case 8: + case 108: + /* y0(0) = -inf */ + exc.type = DOMAIN; /* should be SING for IEEE */ + exc.name = type < 100 ? "y0" : "y0f"; + if (_LIB_VERSION == _SVID_) + exc.retval = -HUGE; + else + exc.retval = -HUGE_VAL; + if (_LIB_VERSION == _POSIX_) + errno = EDOM; + else if (!matherr(&exc)) { + /* if (_LIB_VERSION == _SVID_) { + (void) WRITE2("y0: DOMAIN error\n", 17); + } */ + errno = EDOM; + } + break; + case 9: + case 109: + /* y0(x<0) = NaN */ + exc.type = DOMAIN; + exc.name = type < 100 ? "y0" : "y0f"; + if (_LIB_VERSION == _SVID_) + exc.retval = -HUGE; + else + exc.retval = -HUGE_VAL; + if (_LIB_VERSION == _POSIX_) + errno = EDOM; + else if (!matherr(&exc)) { + /*if (_LIB_VERSION == _SVID_) { + (void) WRITE2("y0: DOMAIN error\n", 17); + } */ + errno = EDOM; + } + break; + case 10: + case 110: + /* y1(0) = -inf */ + exc.type = DOMAIN; /* should be SING for IEEE */ + exc.name = type < 100 ? "y1" : "y1f"; + if (_LIB_VERSION == _SVID_) + exc.retval = -HUGE; + else + exc.retval = -HUGE_VAL; + if (_LIB_VERSION == _POSIX_) + errno = EDOM; + else if (!matherr(&exc)) { + /* if (_LIB_VERSION == _SVID_) { + (void) WRITE2("y1: DOMAIN error\n", 17); + } */ + errno = EDOM; + } + break; + case 11: + case 111: + /* y1(x<0) = NaN */ + exc.type = DOMAIN; + exc.name = type < 100 ? "y1" : "y1f"; + if (_LIB_VERSION == _SVID_) + exc.retval = -HUGE; + else + exc.retval = -HUGE_VAL; + if (_LIB_VERSION == _POSIX_) + errno = EDOM; + else if (!matherr(&exc)) { + /* if (_LIB_VERSION == _SVID_) { + (void) WRITE2("y1: DOMAIN error\n", 17); + } */ + errno = EDOM; + } + break; + case 12: + case 112: + /* yn(n,0) = -inf */ + exc.type = DOMAIN; /* should be SING for IEEE */ + exc.name = type < 100 ? "yn" : "ynf"; + if (_LIB_VERSION == _SVID_) + exc.retval = -HUGE; + else + exc.retval = -HUGE_VAL; + if (_LIB_VERSION == _POSIX_) + errno = EDOM; + else if (!matherr(&exc)) { + /* if (_LIB_VERSION == _SVID_) { + (void) WRITE2("yn: DOMAIN error\n", 17); + } */ + errno = EDOM; + } + break; + case 13: + case 113: + /* yn(x<0) = NaN */ + exc.type = DOMAIN; + exc.name = type < 100 ? "yn" : "ynf"; + if (_LIB_VERSION == _SVID_) + exc.retval = -HUGE; + else + exc.retval = -HUGE_VAL; + if (_LIB_VERSION == _POSIX_) + errno = EDOM; + else if (!matherr(&exc)) { + /* if (_LIB_VERSION == _SVID_) { + (void) WRITE2("yn: DOMAIN error\n", 17); + } */ + errno = EDOM; + } + break; + case 14: + case 114: + /* lgamma(finite) overflow */ + exc.type = OVERFLOW; + exc.name = type < 100 ? "lgamma" : "lgammaf"; + if (_LIB_VERSION == _SVID_) + exc.retval = HUGE; + else + exc.retval = HUGE_VAL; + if (_LIB_VERSION == _POSIX_) + errno = ERANGE; + else if (!matherr(&exc)) { + errno = ERANGE; + } + break; + case 15: + case 115: + /* lgamma(-integer) or lgamma(0) */ + exc.type = SING; + exc.name = type < 100 ? "lgamma" : "lgammaf"; + if (_LIB_VERSION == _SVID_) + exc.retval = HUGE; + else + exc.retval = HUGE_VAL; + if (_LIB_VERSION == _POSIX_) + errno = EDOM; + else if (!matherr(&exc)) { + /* if (_LIB_VERSION == _SVID_) { + (void) WRITE2("lgamma: SING error\n", 19); + } */ + errno = EDOM; + } + break; + case 16: + case 116: + /* log(0) */ + exc.type = SING; + exc.name = type < 100 ? "log" : "logf"; + if (_LIB_VERSION == _SVID_) + exc.retval = -HUGE; + else + exc.retval = -HUGE_VAL; + if (_LIB_VERSION == _POSIX_) + errno = ERANGE; + else if (!matherr(&exc)) { + /* if (_LIB_VERSION == _SVID_) { + (void) WRITE2("log: SING error\n", 16); + } */ + errno = EDOM; + } + break; + case 17: + case 117: + /* log(x<0) */ + exc.type = DOMAIN; + exc.name = type < 100 ? "log" : "logf"; + if (_LIB_VERSION == _SVID_) + exc.retval = -HUGE; + else + exc.retval = -HUGE_VAL; + if (_LIB_VERSION == _POSIX_) + errno = EDOM; + else if (!matherr(&exc)) { + /* if (_LIB_VERSION == _SVID_) { + (void) WRITE2("log: DOMAIN error\n", 18); + } */ + errno = EDOM; + } + break; + case 18: + case 118: + /* log10(0) */ + exc.type = SING; + exc.name = type < 100 ? "log10" : "log10f"; + if (_LIB_VERSION == _SVID_) + exc.retval = -HUGE; + else + exc.retval = -HUGE_VAL; + if (_LIB_VERSION == _POSIX_) + errno = ERANGE; + else if (!matherr(&exc)) { + /* if (_LIB_VERSION == _SVID_) { + (void) WRITE2("log10: SING error\n", 18); + } */ + errno = EDOM; + } + break; + case 19: + case 119: + /* log10(x<0) */ + exc.type = DOMAIN; + exc.name = type < 100 ? "log10" : "log10f"; + if (_LIB_VERSION == _SVID_) + exc.retval = -HUGE; + else + exc.retval = -HUGE_VAL; + if (_LIB_VERSION == _POSIX_) + errno = EDOM; + else if (!matherr(&exc)) { + /* if (_LIB_VERSION == _SVID_) { + (void) WRITE2("log10: DOMAIN error\n", 20); + } */ + errno = EDOM; + } + break; + case 20: + case 120: + /* pow(0.0,0.0) */ + /* error only if _LIB_VERSION == _SVID_ */ + exc.type = DOMAIN; + exc.name = type < 100 ? "pow" : "powf"; + exc.retval = zero; + if (_LIB_VERSION != _SVID_) exc.retval = 1.0; + else if (!matherr(&exc)) { + /* (void) WRITE2("pow(0,0): DOMAIN error\n", 23); */ + errno = EDOM; + } + break; + case 21: + case 121: + /* pow(x,y) overflow */ + exc.type = OVERFLOW; + exc.name = type < 100 ? "pow" : "powf"; + if (_LIB_VERSION == _SVID_) { + exc.retval = HUGE; + y *= 0.5; + if(xzero) ? HUGE : -HUGE); + else + exc.retval = ( (x>zero) ? HUGE_VAL : -HUGE_VAL); + if (_LIB_VERSION == _POSIX_) + errno = ERANGE; + else if (!matherr(&exc)) { + errno = ERANGE; + } + break; + case 26: + case 126: + /* sqrt(x<0) */ + exc.type = DOMAIN; + exc.name = type < 100 ? "sqrt" : "sqrtf"; + if (_LIB_VERSION == _SVID_) + exc.retval = zero; + else + exc.retval = zero/zero; + if (_LIB_VERSION == _POSIX_) + errno = EDOM; + else if (!matherr(&exc)) { + /* if (_LIB_VERSION == _SVID_) { + (void) WRITE2("sqrt: DOMAIN error\n", 19); + } */ + errno = EDOM; + } + break; + case 27: + case 127: + /* fmod(x,0) */ + exc.type = DOMAIN; + exc.name = type < 100 ? "fmod" : "fmodf"; + if (_LIB_VERSION == _SVID_) + exc.retval = x; + else + exc.retval = zero/zero; + if (_LIB_VERSION == _POSIX_) + errno = EDOM; + else if (!matherr(&exc)) { + /* if (_LIB_VERSION == _SVID_) { + (void) WRITE2("fmod: DOMAIN error\n", 20); + } */ + errno = EDOM; + } + break; + case 28: + case 128: + /* remainder(x,0) */ + exc.type = DOMAIN; + exc.name = type < 100 ? "remainder" : "remainderf"; + exc.retval = zero/zero; + if (_LIB_VERSION == _POSIX_) + errno = EDOM; + else if (!matherr(&exc)) { + /* if (_LIB_VERSION == _SVID_) { + (void) WRITE2("remainder: DOMAIN error\n", 24); + } */ + errno = EDOM; + } + break; + case 29: + case 129: + /* acosh(x<1) */ + exc.type = DOMAIN; + exc.name = type < 100 ? "acosh" : "acoshf"; + exc.retval = zero/zero; + if (_LIB_VERSION == _POSIX_) + errno = EDOM; + else if (!matherr(&exc)) { + /* if (_LIB_VERSION == _SVID_) { + (void) WRITE2("acosh: DOMAIN error\n", 20); + } */ + errno = EDOM; + } + break; + case 30: + case 130: + /* atanh(|x|>1) */ + exc.type = DOMAIN; + exc.name = type < 100 ? "atanh" : "atanhf"; + exc.retval = zero/zero; + if (_LIB_VERSION == _POSIX_) + errno = EDOM; + else if (!matherr(&exc)) { + /* if (_LIB_VERSION == _SVID_) { + (void) WRITE2("atanh: DOMAIN error\n", 20); + } */ + errno = EDOM; + } + break; + case 31: + case 131: + /* atanh(|x|=1) */ + exc.type = SING; + exc.name = type < 100 ? "atanh" : "atanhf"; + exc.retval = x/zero; /* sign(x)*inf */ + if (_LIB_VERSION == _POSIX_) + errno = EDOM; + else if (!matherr(&exc)) { + /* if (_LIB_VERSION == _SVID_) { + (void) WRITE2("atanh: SING error\n", 18); + } */ + errno = EDOM; + } + break; + case 32: + case 132: + /* scalb overflow; SVID also returns +-HUGE_VAL */ + exc.type = OVERFLOW; + exc.name = type < 100 ? "scalb" : "scalbf"; + exc.retval = x > zero ? HUGE_VAL : -HUGE_VAL; + if (_LIB_VERSION == _POSIX_) + errno = ERANGE; + else if (!matherr(&exc)) { + errno = ERANGE; + } + break; + case 33: + case 133: + /* scalb underflow */ + exc.type = UNDERFLOW; + exc.name = type < 100 ? "scalb" : "scalbf"; + exc.retval = copysign(zero,x); + if (_LIB_VERSION == _POSIX_) + errno = ERANGE; + else if (!matherr(&exc)) { + errno = ERANGE; + } + break; + case 34: + case 134: + /* j0(|x|>X_TLOSS) */ + exc.type = TLOSS; + exc.name = type < 100 ? "j0" : "j0f"; + exc.retval = zero; + if (_LIB_VERSION == _POSIX_) + errno = ERANGE; + else if (!matherr(&exc)) { + /* if (_LIB_VERSION == _SVID_) { + (void) WRITE2(exc.name, 2); + (void) WRITE2(": TLOSS error\n", 14); + } */ + errno = ERANGE; + } + break; + case 35: + case 135: + /* y0(x>X_TLOSS) */ + exc.type = TLOSS; + exc.name = type < 100 ? "y0" : "y0f"; + exc.retval = zero; + if (_LIB_VERSION == _POSIX_) + errno = ERANGE; + else if (!matherr(&exc)) { + /* if (_LIB_VERSION == _SVID_) { + (void) WRITE2(exc.name, 2); + (void) WRITE2(": TLOSS error\n", 14); + } */ + errno = ERANGE; + } + break; + case 36: + case 136: + /* j1(|x|>X_TLOSS) */ + exc.type = TLOSS; + exc.name = type < 100 ? "j1" : "j1f"; + exc.retval = zero; + if (_LIB_VERSION == _POSIX_) + errno = ERANGE; + else if (!matherr(&exc)) { + /* if (_LIB_VERSION == _SVID_) { + (void) WRITE2(exc.name, 2); + (void) WRITE2(": TLOSS error\n", 14); + } */ + errno = ERANGE; + } + break; + case 37: + case 137: + /* y1(x>X_TLOSS) */ + exc.type = TLOSS; + exc.name = type < 100 ? "y1" : "y1f"; + exc.retval = zero; + if (_LIB_VERSION == _POSIX_) + errno = ERANGE; + else if (!matherr(&exc)) { + /* if (_LIB_VERSION == _SVID_) { + (void) WRITE2(exc.name, 2); + (void) WRITE2(": TLOSS error\n", 14); + } */ + errno = ERANGE; + } + break; + case 38: + case 138: + /* jn(|x|>X_TLOSS) */ + exc.type = TLOSS; + exc.name = type < 100 ? "jn" : "jnf"; + exc.retval = zero; + if (_LIB_VERSION == _POSIX_) + errno = ERANGE; + else if (!matherr(&exc)) { + /* if (_LIB_VERSION == _SVID_) { + (void) WRITE2(exc.name, 2); + (void) WRITE2(": TLOSS error\n", 14); + } */ + errno = ERANGE; + } + break; + case 39: + case 139: + /* yn(x>X_TLOSS) */ + exc.type = TLOSS; + exc.name = type < 100 ? "yn" : "ynf"; + exc.retval = zero; + if (_LIB_VERSION == _POSIX_) + errno = ERANGE; + else if (!matherr(&exc)) { + /* if (_LIB_VERSION == _SVID_) { + (void) WRITE2(exc.name, 2); + (void) WRITE2(": TLOSS error\n", 14); + } */ + errno = ERANGE; + } + break; + case 40: + case 140: + /* gamma(finite) overflow */ + exc.type = OVERFLOW; + exc.name = type < 100 ? "gamma" : "gammaf"; + if (_LIB_VERSION == _SVID_) + exc.retval = HUGE; + else + exc.retval = HUGE_VAL; + if (_LIB_VERSION == _POSIX_) + errno = ERANGE; + else if (!matherr(&exc)) { + errno = ERANGE; + } + break; + case 41: + case 141: + /* gamma(-integer) or gamma(0) */ + exc.type = SING; + exc.name = type < 100 ? "gamma" : "gammaf"; + if (_LIB_VERSION == _SVID_) + exc.retval = HUGE; + else + exc.retval = HUGE_VAL; + if (_LIB_VERSION == _POSIX_) + errno = EDOM; + else if (!matherr(&exc)) { + /* if (_LIB_VERSION == _SVID_) { + (void) WRITE2("gamma: SING error\n", 18); + } */ + errno = EDOM; + } + break; + case 42: + case 142: + /* pow(NaN,0.0) */ + /* error only if _LIB_VERSION == _SVID_ & _XOPEN_ */ + exc.type = DOMAIN; + exc.name = type < 100 ? "pow" : "powf"; + exc.retval = x; + if (_LIB_VERSION == _IEEE_ || + _LIB_VERSION == _POSIX_) exc.retval = 1.0; + else if (!matherr(&exc)) { + errno = EDOM; + } + break; + } + if (exc.err != 0) + errno = exc.err; + return exc.retval; +} + +

k_standard.c Property changes : Added: svn:eol-style ## -0,0 +1 ## +native \ No newline at end of property Added: svn:keywords ## -0,0 +1 ## +Id \ No newline at end of property Index: e_jn.c =================================================================== --- e_jn.c (nonexistent) +++ e_jn.c (revision 158) @@ -0,0 +1,281 @@ + +/* @(#)e_jn.c 5.1 93/09/24 */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +/* + * __ieee754_jn(n, x), __ieee754_yn(n, x) + * floating point Bessel's function of the 1st and 2nd kind + * of order n + * + * Special cases: + * y0(0)=y1(0)=yn(n,0) = -inf with division by zero signal; + * y0(-ve)=y1(-ve)=yn(n,-ve) are NaN with invalid signal. + * Note 2. About jn(n,x), yn(n,x) + * For n=0, j0(x) is called, + * for n=1, j1(x) is called, + * for nx, a continued fraction approximation to + * j(n,x)/j(n-1,x) is evaluated and then backward + * recursion is used starting from a supposed value + * for j(n,x). The resulting value of j(0,x) is + * compared with the actual value to correct the + * supposed value of j(n,x). + * + * yn(n,x) is similar in all respects, except + * that forward recursion is used for all + * values of n>1. + * + */ + +#include "fdlibm.h" + +#ifndef _DOUBLE_IS_32BITS + +#ifdef __STDC__ +static const double +#else +static double +#endif +invsqrtpi= 5.64189583547756279280e-01, /* 0x3FE20DD7, 0x50429B6D */ +two = 2.00000000000000000000e+00, /* 0x40000000, 0x00000000 */ +one = 1.00000000000000000000e+00; /* 0x3FF00000, 0x00000000 */ + +#ifdef __STDC__ +static const double zero = 0.00000000000000000000e+00; +#else +static double zero = 0.00000000000000000000e+00; +#endif + +#ifdef __STDC__ + double __ieee754_jn(int n, double x) +#else + double __ieee754_jn(n,x) + int n; double x; +#endif +{ + __int32_t i,hx,ix,lx, sgn; + double a, b, temp, di; + double z, w; + + /* J(-n,x) = (-1)^n * J(n, x), J(n, -x) = (-1)^n * J(n, x) + * Thus, J(-n,x) = J(n,-x) + */ + EXTRACT_WORDS(hx,lx,x); + ix = 0x7fffffff&hx; + /* if J(n,NaN) is NaN */ + if((ix|((__uint32_t)(lx|-lx))>>31)>0x7ff00000) return x+x; + if(n<0){ + n = -n; + x = -x; + hx ^= 0x80000000; + } + if(n==0) return(__ieee754_j0(x)); + if(n==1) return(__ieee754_j1(x)); + sgn = (n&1)&(hx>>31); /* even n -- 0, odd n -- sign(x) */ + x = fabs(x); + if((ix|lx)==0||ix>=0x7ff00000) /* if x is 0 or inf */ + b = zero; + else if((double)n<=x) { + /* Safe to use J(n+1,x)=2n/x *J(n,x)-J(n-1,x) */ + if(ix>=0x52D00000) { /* x > 2**302 */ + /* (x >> n**2) + * Jn(x) = cos(x-(2n+1)*pi/4)*sqrt(2/x*pi) + * Yn(x) = sin(x-(2n+1)*pi/4)*sqrt(2/x*pi) + * Let s=sin(x), c=cos(x), + * xn=x-(2n+1)*pi/4, sqt2 = sqrt(2),then + * + * n sin(xn)*sqt2 cos(xn)*sqt2 + * ---------------------------------- + * 0 s-c c+s + * 1 -s-c -c+s + * 2 -s+c -c-s + * 3 s+c c-s + */ + switch(n&3) { + case 0: temp = cos(x)+sin(x); break; + case 1: temp = -cos(x)+sin(x); break; + case 2: temp = -cos(x)-sin(x); break; + case 3: temp = cos(x)-sin(x); break; + } + b = invsqrtpi*temp/__ieee754_sqrt(x); + } else { + a = __ieee754_j0(x); + b = __ieee754_j1(x); + for(i=1;i33) /* underflow */ + b = zero; + else { + temp = x*0.5; b = temp; + for (a=one,i=2;i<=n;i++) { + a *= (double)i; /* a = n! */ + b *= temp; /* b = (x/2)^n */ + } + b = b/a; + } + } else { + /* use backward recurrence */ + /* x x^2 x^2 + * J(n,x)/J(n-1,x) = ---- ------ ------ ..... + * 2n - 2(n+1) - 2(n+2) + * + * 1 1 1 + * (for large x) = ---- ------ ------ ..... + * 2n 2(n+1) 2(n+2) + * -- - ------ - ------ - + * x x x + * + * Let w = 2n/x and h=2/x, then the above quotient + * is equal to the continued fraction: + * 1 + * = ----------------------- + * 1 + * w - ----------------- + * 1 + * w+h - --------- + * w+2h - ... + * + * To determine how many terms needed, let + * Q(0) = w, Q(1) = w(w+h) - 1, + * Q(k) = (w+k*h)*Q(k-1) - Q(k-2), + * When Q(k) > 1e4 good for single + * When Q(k) > 1e9 good for double + * When Q(k) > 1e17 good for quadruple + */ + /* determine k */ + double t,v; + double q0,q1,h,tmp; __int32_t k,m; + w = (n+n)/(double)x; h = 2.0/(double)x; + q0 = w; z = w+h; q1 = w*z - 1.0; k=1; + while(q1<1.0e9) { + k += 1; z += h; + tmp = z*q1 - q0; + q0 = q1; + q1 = tmp; + } + m = n+n; + for(t=zero, i = 2*(n+k); i>=m; i -= 2) t = one/(i/x-t); + a = t; + b = one; + /* estimate log((2/x)^n*n!) = n*log(2/x)+n*ln(n) + * Hence, if n*(log(2n/x)) > ... + * single 8.8722839355e+01 + * double 7.09782712893383973096e+02 + * long double 1.1356523406294143949491931077970765006170e+04 + * then recurrent value may overflow and the result is + * likely underflow to zero + */ + tmp = n; + v = two/x; + tmp = tmp*__ieee754_log(fabs(v*tmp)); + if(tmp<7.09782712893383973096e+02) { + for(i=n-1,di=(double)(i+i);i>0;i--){ + temp = b; + b *= di; + b = b/x - a; + a = temp; + di -= two; + } + } else { + for(i=n-1,di=(double)(i+i);i>0;i--){ + temp = b; + b *= di; + b = b/x - a; + a = temp; + di -= two; + /* scale b to avoid spurious overflow */ + if(b>1e100) { + a /= b; + t /= b; + b = one; + } + } + } + b = (t*__ieee754_j0(x)/b); + } + } + if(sgn==1) return -b; else return b; +} + +#ifdef __STDC__ + double __ieee754_yn(int n, double x) +#else + double __ieee754_yn(n,x) + int n; double x; +#endif +{ + __int32_t i,hx,ix,lx; + __int32_t sign; + double a, b, temp; + + EXTRACT_WORDS(hx,lx,x); + ix = 0x7fffffff&hx; + /* if Y(n,NaN) is NaN */ + if((ix|((__uint32_t)(lx|-lx))>>31)>0x7ff00000) return x+x; + if((ix|lx)==0) return -one/zero; + if(hx<0) return zero/zero; + sign = 1; + if(n<0){ + n = -n; + sign = 1 - ((n&1)<<1); + } + if(n==0) return(__ieee754_y0(x)); + if(n==1) return(sign*__ieee754_y1(x)); + if(ix==0x7ff00000) return zero; + if(ix>=0x52D00000) { /* x > 2**302 */ + /* (x >> n**2) + * Jn(x) = cos(x-(2n+1)*pi/4)*sqrt(2/x*pi) + * Yn(x) = sin(x-(2n+1)*pi/4)*sqrt(2/x*pi) + * Let s=sin(x), c=cos(x), + * xn=x-(2n+1)*pi/4, sqt2 = sqrt(2),then + * + * n sin(xn)*sqt2 cos(xn)*sqt2 + * ---------------------------------- + * 0 s-c c+s + * 1 -s-c -c+s + * 2 -s+c -c-s + * 3 s+c c-s + */ + switch(n&3) { + case 0: temp = sin(x)-cos(x); break; + case 1: temp = -sin(x)-cos(x); break; + case 2: temp = -sin(x)+cos(x); break; + case 3: temp = sin(x)+cos(x); break; + } + b = invsqrtpi*temp/__ieee754_sqrt(x); + } else { + __uint32_t high; + a = __ieee754_y0(x); + b = __ieee754_y1(x); + /* quit if b is -inf */ + GET_HIGH_WORD(high,b); + for(i=1;i0) return b; else return -b; +} + +#endif /* defined(_DOUBLE_IS_32BITS) */

e_jn.c Property changes : Added: svn:eol-style ## -0,0 +1 ## +native \ No newline at end of property Added: svn:keywords ## -0,0 +1 ## +Id \ No newline at end of property Index: w_drem.c =================================================================== --- w_drem.c (nonexistent) +++ w_drem.c (revision 158) @@ -0,0 +1,15 @@ +/* + * drem() wrapper for remainder(). + * + * Written by J.T. Conklin, + * Placed into the Public Domain, 1994. + */ + +#include "fdlibm.h" + +double +drem(x, y) + double x, y; +{ + return remainder(x, y); +}

w_drem.c Property changes : Added: svn:eol-style ## -0,0 +1 ## +native \ No newline at end of property Added: svn:keywords ## -0,0 +1 ## +Id \ No newline at end of property Index: ef_remainder.c =================================================================== --- ef_remainder.c (nonexistent) +++ ef_remainder.c (revision 158) @@ -0,0 +1,68 @@ +/* ef_remainder.c -- float version of e_remainder.c. + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + */ + +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#include "fdlibm.h" + +#ifdef __STDC__ +static const float zero = 0.0; +#else +static float zero = 0.0; +#endif + + +#ifdef __STDC__ + float __ieee754_remainderf(float x, float p) +#else + float __ieee754_remainderf(x,p) + float x,p; +#endif +{ + __int32_t hx,hp; + __uint32_t sx; + float p_half; + + GET_FLOAT_WORD(hx,x); + GET_FLOAT_WORD(hp,p); + sx = hx&0x80000000; + hp &= 0x7fffffff; + hx &= 0x7fffffff; + + /* purge off exception values */ + if(FLT_UWORD_IS_ZERO(hp)|| + !FLT_UWORD_IS_FINITE(hx)|| + FLT_UWORD_IS_NAN(hp)) + return (x*p)/(x*p); + + + if (hp<=FLT_UWORD_HALF_MAX) x = __ieee754_fmodf(x,p+p); /* now x < 2p */ + if ((hx-hp)==0) return zero*x; + x = fabsf(x); + p = fabsf(p); + if (hp<0x01000000) { + if(x+x>p) { + x-=p; + if(x+x>=p) x -= p; + } + } else { + p_half = (float)0.5*p; + if(x>p_half) { + x-=p; + if(x>=p_half) x -= p; + } + } + GET_FLOAT_WORD(hx,x); + SET_FLOAT_WORD(x,hx^sx); + return x; +}

ef_remainder.c Property changes : Added: svn:eol-style ## -0,0 +1 ## +native \ No newline at end of property Added: svn:keywords ## -0,0 +1 ## +Id \ No newline at end of property Index: ef_j0.c =================================================================== --- ef_j0.c (nonexistent) +++ ef_j0.c (revision 158) @@ -0,0 +1,439 @@ +/* ef_j0.c -- float version of e_j0.c. + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + */ + +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#include "fdlibm.h" + +#ifdef __STDC__ +static float pzerof(float), qzerof(float); +#else +static float pzerof(), qzerof(); +#endif + +#ifdef __STDC__ +static const float +#else +static float +#endif +huge = 1e30, +one = 1.0, +invsqrtpi= 5.6418961287e-01, /* 0x3f106ebb */ +tpi = 6.3661974669e-01, /* 0x3f22f983 */ + /* R0/S0 on [0, 2.00] */ +R02 = 1.5625000000e-02, /* 0x3c800000 */ +R03 = -1.8997929874e-04, /* 0xb947352e */ +R04 = 1.8295404516e-06, /* 0x35f58e88 */ +R05 = -4.6183270541e-09, /* 0xb19eaf3c */ +S01 = 1.5619102865e-02, /* 0x3c7fe744 */ +S02 = 1.1692678527e-04, /* 0x38f53697 */ +S03 = 5.1354652442e-07, /* 0x3509daa6 */ +S04 = 1.1661400734e-09; /* 0x30a045e8 */ + +#ifdef __STDC__ +static const float zero = 0.0; +#else +static float zero = 0.0; +#endif + +#ifdef __STDC__ + float __ieee754_j0f(float x) +#else + float __ieee754_j0f(x) + float x; +#endif +{ + float z, s,c,ss,cc,r,u,v; + __int32_t hx,ix; + + GET_FLOAT_WORD(hx,x); + ix = hx&0x7fffffff; + if(!FLT_UWORD_IS_FINITE(ix)) return one/(x*x); + x = fabsf(x); + if(ix >= 0x40000000) { /* |x| >= 2.0 */ + s = sinf(x); + c = cosf(x); + ss = s-c; + cc = s+c; + if(ix<=FLT_UWORD_HALF_MAX) { /* make sure x+x not overflow */ + z = -cosf(x+x); + if ((s*c)0x80000000) z = (invsqrtpi*cc)/__ieee754_sqrtf(x); + else { + u = pzerof(x); v = qzerof(x); + z = invsqrtpi*(u*cc-v*ss)/__ieee754_sqrtf(x); + } + return z; + } + if(ix<0x39000000) { /* |x| < 2**-13 */ + if(huge+x>one) { /* raise inexact if x != 0 */ + if(ix<0x32000000) return one; /* |x|<2**-27 */ + else return one - (float)0.25*x*x; + } + } + z = x*x; + r = z*(R02+z*(R03+z*(R04+z*R05))); + s = one+z*(S01+z*(S02+z*(S03+z*S04))); + if(ix < 0x3F800000) { /* |x| < 1.00 */ + return one + z*((float)-0.25+(r/s)); + } else { + u = (float)0.5*x; + return((one+u)*(one-u)+z*(r/s)); + } +} + +#ifdef __STDC__ +static const float +#else +static float +#endif +u00 = -7.3804296553e-02, /* 0xbd9726b5 */ +u01 = 1.7666645348e-01, /* 0x3e34e80d */ +u02 = -1.3818567619e-02, /* 0xbc626746 */ +u03 = 3.4745343146e-04, /* 0x39b62a69 */ +u04 = -3.8140706238e-06, /* 0xb67ff53c */ +u05 = 1.9559013964e-08, /* 0x32a802ba */ +u06 = -3.9820518410e-11, /* 0xae2f21eb */ +v01 = 1.2730483897e-02, /* 0x3c509385 */ +v02 = 7.6006865129e-05, /* 0x389f65e0 */ +v03 = 2.5915085189e-07, /* 0x348b216c */ +v04 = 4.4111031494e-10; /* 0x2ff280c2 */ + +#ifdef __STDC__ + float __ieee754_y0f(float x) +#else + float __ieee754_y0f(x) + float x; +#endif +{ + float z, s,c,ss,cc,u,v; + __int32_t hx,ix; + + GET_FLOAT_WORD(hx,x); + ix = 0x7fffffff&hx; + /* Y0(NaN) is NaN, y0(-inf) is Nan, y0(inf) is 0 */ + if(!FLT_UWORD_IS_FINITE(ix)) return one/(x+x*x); + if(FLT_UWORD_IS_ZERO(ix)) return -one/zero; + if(hx<0) return zero/zero; + if(ix >= 0x40000000) { /* |x| >= 2.0 */ + /* y0(x) = sqrt(2/(pi*x))*(p0(x)*sin(x0)+q0(x)*cos(x0)) + * where x0 = x-pi/4 + * Better formula: + * cos(x0) = cos(x)cos(pi/4)+sin(x)sin(pi/4) + * = 1/sqrt(2) * (sin(x) + cos(x)) + * sin(x0) = sin(x)cos(3pi/4)-cos(x)sin(3pi/4) + * = 1/sqrt(2) * (sin(x) - cos(x)) + * To avoid cancellation, use + * sin(x) +- cos(x) = -cos(2x)/(sin(x) -+ cos(x)) + * to compute the worse one. + */ + s = sinf(x); + c = cosf(x); + ss = s-c; + cc = s+c; + /* + * j0(x) = 1/sqrt(pi) * (P(0,x)*cc - Q(0,x)*ss) / sqrt(x) + * y0(x) = 1/sqrt(pi) * (P(0,x)*ss + Q(0,x)*cc) / sqrt(x) + */ + if(ix<=FLT_UWORD_HALF_MAX) { /* make sure x+x not overflow */ + z = -cosf(x+x); + if ((s*c)0x80000000) z = (invsqrtpi*ss)/__ieee754_sqrtf(x); + else { + u = pzerof(x); v = qzerof(x); + z = invsqrtpi*(u*ss+v*cc)/__ieee754_sqrtf(x); + } + return z; + } + if(ix<=0x32000000) { /* x < 2**-27 */ + return(u00 + tpi*__ieee754_logf(x)); + } + z = x*x; + u = u00+z*(u01+z*(u02+z*(u03+z*(u04+z*(u05+z*u06))))); + v = one+z*(v01+z*(v02+z*(v03+z*v04))); + return(u/v + tpi*(__ieee754_j0f(x)*__ieee754_logf(x))); +} + +/* The asymptotic expansions of pzero is + * 1 - 9/128 s^2 + 11025/98304 s^4 - ..., where s = 1/x. + * For x >= 2, We approximate pzero by + * pzero(x) = 1 + (R/S) + * where R = pR0 + pR1*s^2 + pR2*s^4 + ... + pR5*s^10 + * S = 1 + pS0*s^2 + ... + pS4*s^10 + * and + * | pzero(x)-1-R/S | <= 2 ** ( -60.26) + */ +#ifdef __STDC__ +static const float pR8[6] = { /* for x in [inf, 8]=1/[0,0.125] */ +#else +static float pR8[6] = { /* for x in [inf, 8]=1/[0,0.125] */ +#endif + 0.0000000000e+00, /* 0x00000000 */ + -7.0312500000e-02, /* 0xbd900000 */ + -8.0816707611e+00, /* 0xc1014e86 */ + -2.5706311035e+02, /* 0xc3808814 */ + -2.4852163086e+03, /* 0xc51b5376 */ + -5.2530439453e+03, /* 0xc5a4285a */ +}; +#ifdef __STDC__ +static const float pS8[5] = { +#else +static float pS8[5] = { +#endif + 1.1653436279e+02, /* 0x42e91198 */ + 3.8337448730e+03, /* 0x456f9beb */ + 4.0597855469e+04, /* 0x471e95db */ + 1.1675296875e+05, /* 0x47e4087c */ + 4.7627726562e+04, /* 0x473a0bba */ +}; +#ifdef __STDC__ +static const float pR5[6] = { /* for x in [8,4.5454]=1/[0.125,0.22001] */ +#else +static float pR5[6] = { /* for x in [8,4.5454]=1/[0.125,0.22001] */ +#endif + -1.1412546255e-11, /* 0xad48c58a */ + -7.0312492549e-02, /* 0xbd8fffff */ + -4.1596107483e+00, /* 0xc0851b88 */ + -6.7674766541e+01, /* 0xc287597b */ + -3.3123129272e+02, /* 0xc3a59d9b */ + -3.4643338013e+02, /* 0xc3ad3779 */ +}; +#ifdef __STDC__ +static const float pS5[5] = { +#else +static float pS5[5] = { +#endif + 6.0753936768e+01, /* 0x42730408 */ + 1.0512523193e+03, /* 0x44836813 */ + 5.9789707031e+03, /* 0x45bad7c4 */ + 9.6254453125e+03, /* 0x461665c8 */ + 2.4060581055e+03, /* 0x451660ee */ +}; + +#ifdef __STDC__ +static const float pR3[6] = {/* for x in [4.547,2.8571]=1/[0.2199,0.35001] */ +#else +static float pR3[6] = {/* for x in [4.547,2.8571]=1/[0.2199,0.35001] */ +#endif + -2.5470459075e-09, /* 0xb12f081b */ + -7.0311963558e-02, /* 0xbd8fffb8 */ + -2.4090321064e+00, /* 0xc01a2d95 */ + -2.1965976715e+01, /* 0xc1afba52 */ + -5.8079170227e+01, /* 0xc2685112 */ + -3.1447946548e+01, /* 0xc1fb9565 */ +}; +#ifdef __STDC__ +static const float pS3[5] = { +#else +static float pS3[5] = { +#endif + 3.5856033325e+01, /* 0x420f6c94 */ + 3.6151397705e+02, /* 0x43b4c1ca */ + 1.1936077881e+03, /* 0x44953373 */ + 1.1279968262e+03, /* 0x448cffe6 */ + 1.7358093262e+02, /* 0x432d94b8 */ +}; + +#ifdef __STDC__ +static const float pR2[6] = {/* for x in [2.8570,2]=1/[0.3499,0.5] */ +#else +static float pR2[6] = {/* for x in [2.8570,2]=1/[0.3499,0.5] */ +#endif + -8.8753431271e-08, /* 0xb3be98b7 */ + -7.0303097367e-02, /* 0xbd8ffb12 */ + -1.4507384300e+00, /* 0xbfb9b1cc */ + -7.6356959343e+00, /* 0xc0f4579f */ + -1.1193166733e+01, /* 0xc1331736 */ + -3.2336456776e+00, /* 0xc04ef40d */ +}; +#ifdef __STDC__ +static const float pS2[5] = { +#else +static float pS2[5] = { +#endif + 2.2220300674e+01, /* 0x41b1c32d */ + 1.3620678711e+02, /* 0x430834f0 */ + 2.7047027588e+02, /* 0x43873c32 */ + 1.5387539673e+02, /* 0x4319e01a */ + 1.4657617569e+01, /* 0x416a859a */ +}; + +#ifdef __STDC__ + static float pzerof(float x) +#else + static float pzerof(x) + float x; +#endif +{ +#ifdef __STDC__ + const float *p,*q; +#else + float *p,*q; +#endif + float z,r,s; + __int32_t ix; + GET_FLOAT_WORD(ix,x); + ix &= 0x7fffffff; + if(ix>=0x41000000) {p = pR8; q= pS8;} + else if(ix>=0x40f71c58){p = pR5; q= pS5;} + else if(ix>=0x4036db68){p = pR3; q= pS3;} + else {p = pR2; q= pS2;} + z = one/(x*x); + r = p[0]+z*(p[1]+z*(p[2]+z*(p[3]+z*(p[4]+z*p[5])))); + s = one+z*(q[0]+z*(q[1]+z*(q[2]+z*(q[3]+z*q[4])))); + return one+ r/s; +} + + +/* For x >= 8, the asymptotic expansions of qzero is + * -1/8 s + 75/1024 s^3 - ..., where s = 1/x. + * We approximate qzero by + * qzero(x) = s*(-1.25 + (R/S)) + * where R = qR0 + qR1*s^2 + qR2*s^4 + ... + qR5*s^10 + * S = 1 + qS0*s^2 + ... + qS5*s^12 + * and + * | qzero(x)/s +1.25-R/S | <= 2 ** ( -61.22) + */ +#ifdef __STDC__ +static const float qR8[6] = { /* for x in [inf, 8]=1/[0,0.125] */ +#else +static float qR8[6] = { /* for x in [inf, 8]=1/[0,0.125] */ +#endif + 0.0000000000e+00, /* 0x00000000 */ + 7.3242187500e-02, /* 0x3d960000 */ + 1.1768206596e+01, /* 0x413c4a93 */ + 5.5767340088e+02, /* 0x440b6b19 */ + 8.8591972656e+03, /* 0x460a6cca */ + 3.7014625000e+04, /* 0x471096a0 */ +}; +#ifdef __STDC__ +static const float qS8[6] = { +#else +static float qS8[6] = { +#endif + 1.6377603149e+02, /* 0x4323c6aa */ + 8.0983447266e+03, /* 0x45fd12c2 */ + 1.4253829688e+05, /* 0x480b3293 */ + 8.0330925000e+05, /* 0x49441ed4 */ + 8.4050156250e+05, /* 0x494d3359 */ + -3.4389928125e+05, /* 0xc8a7eb69 */ +}; + +#ifdef __STDC__ +static const float qR5[6] = { /* for x in [8,4.5454]=1/[0.125,0.22001] */ +#else +static float qR5[6] = { /* for x in [8,4.5454]=1/[0.125,0.22001] */ +#endif + 1.8408595828e-11, /* 0x2da1ec79 */ + 7.3242180049e-02, /* 0x3d95ffff */ + 5.8356351852e+00, /* 0x40babd86 */ + 1.3511157227e+02, /* 0x43071c90 */ + 1.0272437744e+03, /* 0x448067cd */ + 1.9899779053e+03, /* 0x44f8bf4b */ +}; +#ifdef __STDC__ +static const float qS5[6] = { +#else +static float qS5[6] = { +#endif + 8.2776611328e+01, /* 0x42a58da0 */ + 2.0778142090e+03, /* 0x4501dd07 */ + 1.8847289062e+04, /* 0x46933e94 */ + 5.6751113281e+04, /* 0x475daf1d */ + 3.5976753906e+04, /* 0x470c88c1 */ + -5.3543427734e+03, /* 0xc5a752be */ +}; + +#ifdef __STDC__ +static const float qR3[6] = {/* for x in [4.547,2.8571]=1/[0.2199,0.35001] */ +#else +static float qR3[6] = {/* for x in [4.547,2.8571]=1/[0.2199,0.35001] */ +#endif + 4.3774099900e-09, /* 0x3196681b */ + 7.3241114616e-02, /* 0x3d95ff70 */ + 3.3442313671e+00, /* 0x405607e3 */ + 4.2621845245e+01, /* 0x422a7cc5 */ + 1.7080809021e+02, /* 0x432acedf */ + 1.6673394775e+02, /* 0x4326bbe4 */ +}; +#ifdef __STDC__ +static const float qS3[6] = { +#else +static float qS3[6] = { +#endif + 4.8758872986e+01, /* 0x42430916 */ + 7.0968920898e+02, /* 0x44316c1c */ + 3.7041481934e+03, /* 0x4567825f */ + 6.4604252930e+03, /* 0x45c9e367 */ + 2.5163337402e+03, /* 0x451d4557 */ + -1.4924745178e+02, /* 0xc3153f59 */ +}; + +#ifdef __STDC__ +static const float qR2[6] = {/* for x in [2.8570,2]=1/[0.3499,0.5] */ +#else +static float qR2[6] = {/* for x in [2.8570,2]=1/[0.3499,0.5] */ +#endif + 1.5044444979e-07, /* 0x342189db */ + 7.3223426938e-02, /* 0x3d95f62a */ + 1.9981917143e+00, /* 0x3fffc4bf */ + 1.4495602608e+01, /* 0x4167edfd */ + 3.1666231155e+01, /* 0x41fd5471 */ + 1.6252708435e+01, /* 0x4182058c */ +}; +#ifdef __STDC__ +static const float qS2[6] = { +#else +static float qS2[6] = { +#endif + 3.0365585327e+01, /* 0x41f2ecb8 */ + 2.6934811401e+02, /* 0x4386ac8f */ + 8.4478375244e+02, /* 0x44533229 */ + 8.8293585205e+02, /* 0x445cbbe5 */ + 2.1266638184e+02, /* 0x4354aa98 */ + -5.3109550476e+00, /* 0xc0a9f358 */ +}; + +#ifdef __STDC__ + static float qzerof(float x) +#else + static float qzerof(x) + float x; +#endif +{ +#ifdef __STDC__ + const float *p,*q; +#else + float *p,*q; +#endif + float s,r,z; + __int32_t ix; + GET_FLOAT_WORD(ix,x); + ix &= 0x7fffffff; + if(ix>=0x41000000) {p = qR8; q= qS8;} + else if(ix>=0x40f71c58){p = qR5; q= qS5;} + else if(ix>=0x4036db68){p = qR3; q= qS3;} + else {p = qR2; q= qS2;} + z = one/(x*x); + r = p[0]+z*(p[1]+z*(p[2]+z*(p[3]+z*(p[4]+z*p[5])))); + s = one+z*(q[0]+z*(q[1]+z*(q[2]+z*(q[3]+z*(q[4]+z*q[5]))))); + return (-(float).125 + r/s)/x; +}

ef_j0.c Property changes : Added: svn:eol-style ## -0,0 +1 ## +native \ No newline at end of property Added: svn:keywords ## -0,0 +1 ## +Id \ No newline at end of property Index: e_log.c =================================================================== --- e_log.c (nonexistent) +++ e_log.c (revision 158) @@ -0,0 +1,146 @@ + +/* @(#)e_log.c 5.1 93/09/24 */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +/* __ieee754_log(x) + * Return the logrithm of x + * + * Method : + * 1. Argument Reduction: find k and f such that + * x = 2^k * (1+f), + * where sqrt(2)/2 < 1+f < sqrt(2) . + * + * 2. Approximation of log(1+f). + * Let s = f/(2+f) ; based on log(1+f) = log(1+s) - log(1-s) + * = 2s + 2/3 s**3 + 2/5 s**5 + ....., + * = 2s + s*R + * We use a special Reme algorithm on [0,0.1716] to generate + * a polynomial of degree 14 to approximate R The maximum error + * of this polynomial approximation is bounded by 2**-58.45. In + * other words, + * 2 4 6 8 10 12 14 + * R(z) ~ Lg1*s +Lg2*s +Lg3*s +Lg4*s +Lg5*s +Lg6*s +Lg7*s + * (the values of Lg1 to Lg7 are listed in the program) + * and + * | 2 14 | -58.45 + * | Lg1*s +...+Lg7*s - R(z) | <= 2 + * | | + * Note that 2s = f - s*f = f - hfsq + s*hfsq, where hfsq = f*f/2. + * In order to guarantee error in log below 1ulp, we compute log + * by + * log(1+f) = f - s*(f - R) (if f is not too large) + * log(1+f) = f - (hfsq - s*(hfsq+R)). (better accuracy) + * + * 3. Finally, log(x) = k*ln2 + log(1+f). + * = k*ln2_hi+(f-(hfsq-(s*(hfsq+R)+k*ln2_lo))) + * Here ln2 is split into two floating point number: + * ln2_hi + ln2_lo, + * where n*ln2_hi is always exact for |n| < 2000. + * + * Special cases: + * log(x) is NaN with signal if x < 0 (including -INF) ; + * log(+INF) is +INF; log(0) is -INF with signal; + * log(NaN) is that NaN with no signal. + * + * Accuracy: + * according to an error analysis, the error is always less than + * 1 ulp (unit in the last place). + * + * Constants: + * The hexadecimal values are the intended ones for the following + * constants. The decimal values may be used, provided that the + * compiler will convert from decimal to binary accurately enough + * to produce the hexadecimal values shown. + */ + +#include "fdlibm.h" + +#ifndef _DOUBLE_IS_32BITS + +#ifdef __STDC__ +static const double +#else +static double +#endif +ln2_hi = 6.93147180369123816490e-01, /* 3fe62e42 fee00000 */ +ln2_lo = 1.90821492927058770002e-10, /* 3dea39ef 35793c76 */ +two54 = 1.80143985094819840000e+16, /* 43500000 00000000 */ +Lg1 = 6.666666666666735130e-01, /* 3FE55555 55555593 */ +Lg2 = 3.999999999940941908e-01, /* 3FD99999 9997FA04 */ +Lg3 = 2.857142874366239149e-01, /* 3FD24924 94229359 */ +Lg4 = 2.222219843214978396e-01, /* 3FCC71C5 1D8E78AF */ +Lg5 = 1.818357216161805012e-01, /* 3FC74664 96CB03DE */ +Lg6 = 1.531383769920937332e-01, /* 3FC39A09 D078C69F */ +Lg7 = 1.479819860511658591e-01; /* 3FC2F112 DF3E5244 */ + +#ifdef __STDC__ +static const double zero = 0.0; +#else +static double zero = 0.0; +#endif + +#ifdef __STDC__ + double __ieee754_log(double x) +#else + double __ieee754_log(x) + double x; +#endif +{ + double hfsq,f,s,z,R,w,t1,t2,dk; + __int32_t k,hx,i,j; + __uint32_t lx; + + EXTRACT_WORDS(hx,lx,x); + + k=0; + if (hx < 0x00100000) { /* x < 2**-1022 */ + if (((hx&0x7fffffff)|lx)==0) + return -two54/zero; /* log(+-0)=-inf */ + if (hx<0) return (x-x)/zero; /* log(-#) = NaN */ + k -= 54; x *= two54; /* subnormal number, scale up x */ + GET_HIGH_WORD(hx,x); + } + if (hx >= 0x7ff00000) return x+x; + k += (hx>>20)-1023; + hx &= 0x000fffff; + i = (hx+0x95f64)&0x100000; + SET_HIGH_WORD(x,hx|(i^0x3ff00000)); /* normalize x or x/2 */ + k += (i>>20); + f = x-1.0; + if((0x000fffff&(2+hx))<3) { /* |f| < 2**-20 */ + if(f==zero) { if(k==0) return zero; else {dk=(double)k; + return dk*ln2_hi+dk*ln2_lo;}} + R = f*f*(0.5-0.33333333333333333*f); + if(k==0) return f-R; else {dk=(double)k; + return dk*ln2_hi-((R-dk*ln2_lo)-f);} + } + s = f/(2.0+f); + dk = (double)k; + z = s*s; + i = hx-0x6147a; + w = z*z; + j = 0x6b851-hx; + t1= w*(Lg2+w*(Lg4+w*Lg6)); + t2= z*(Lg1+w*(Lg3+w*(Lg5+w*Lg7))); + i |= j; + R = t2+t1; + if(i>0) { + hfsq=0.5*f*f; + if(k==0) return f-(hfsq-s*(hfsq+R)); else + return dk*ln2_hi-((hfsq-(s*(hfsq+R)+dk*ln2_lo))-f); + } else { + if(k==0) return f-s*(f-R); else + return dk*ln2_hi-((s*(f-R)-dk*ln2_lo)-f); + } +} + +#endif /* defined(_DOUBLE_IS_32BITS) */

e_log.c Property changes : Added: svn:eol-style ## -0,0 +1 ## +native \ No newline at end of property Added: svn:keywords ## -0,0 +1 ## +Id \ No newline at end of property Index: w_sinh.c =================================================================== --- w_sinh.c (nonexistent) +++ w_sinh.c (revision 158) @@ -0,0 +1,120 @@ + +/* @(#)w_sinh.c 5.1 93/09/24 */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + + +/* +FUNCTION + <>, <>---hyperbolic sine + +INDEX + sinh +INDEX + sinhf + +ANSI_SYNOPSIS + #include + double sinh(double <[x]>); + float sinhf(float <[x]>); + +TRAD_SYNOPSIS + #include + double sinh(<[x]>) + double <[x]>; + + float sinhf(<[x]>) + float <[x]>; + +DESCRIPTION + <> computes the hyperbolic sine of the argument <[x]>. + Angles are specified in radians. <>(<[x]>) is defined as + @ifnottex + . (exp(<[x]>) - exp(-<[x]>))/2 + @end ifnottex + @tex + $${e^x - e^{-x}}\over 2$$ + @end tex + + <> is identical, save that it takes and returns <> values. + +RETURNS + The hyperbolic sine of <[x]> is returned. + + When the correct result is too large to be representable (an + overflow), <> returns <> with the + appropriate sign, and sets the global value <> to + <>. + + You can modify error handling for these functions with <>. + +PORTABILITY + <> is ANSI C. + <> is an extension. + +QUICKREF + sinh ansi pure + sinhf - pure +*/ + +/* + * wrapper sinh(x) + */ + +#include "fdlibm.h" +#include + +#ifndef _DOUBLE_IS_32BITS + +#ifdef __STDC__ + double sinh(double x) /* wrapper sinh */ +#else + double sinh(x) /* wrapper sinh */ + double x; +#endif +{ +#ifdef _IEEE_LIBM + return __ieee754_sinh(x); +#else + double z; + struct exception exc; + z = __ieee754_sinh(x); + if(_LIB_VERSION == _IEEE_) return z; + if(!finite(z)&&finite(x)) { + /* sinh(finite) overflow */ +#ifndef HUGE_VAL +#define HUGE_VAL inf + double inf = 0.0; + + SET_HIGH_WORD(inf,0x7ff00000); /* set inf to infinite */ +#endif + exc.type = OVERFLOW; + exc.name = "sinh"; + exc.err = 0; + exc.arg1 = exc.arg2 = x; + if (_LIB_VERSION == _SVID_) + exc.retval = ( (x>0.0) ? HUGE : -HUGE); + else + exc.retval = ( (x>0.0) ? HUGE_VAL : -HUGE_VAL); + if (_LIB_VERSION == _POSIX_) + errno = ERANGE; + else if (!matherr(&exc)) { + errno = ERANGE; + } + if (exc.err != 0) + errno = exc.err; + return exc.retval; + } else + return z; +#endif +} + +#endif /* defined(_DOUBLE_IS_32BITS) */

w_sinh.c Property changes : Added: svn:eol-style ## -0,0 +1 ## +native \ No newline at end of property Added: svn:keywords ## -0,0 +1 ## +Id \ No newline at end of property Index: e_scalb.c =================================================================== --- e_scalb.c (nonexistent) +++ e_scalb.c (revision 158) @@ -0,0 +1,55 @@ + +/* @(#)e_scalb.c 5.1 93/09/24 */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +/* + * __ieee754_scalb(x, fn) is provide for + * passing various standard test suite. One + * should use scalbn() instead. + */ + +#include "fdlibm.h" + +#ifndef _DOUBLE_IS_32BITS + +#ifdef _SCALB_INT +#ifdef __STDC__ + double __ieee754_scalb(double x, int fn) +#else + double __ieee754_scalb(x,fn) + double x; int fn; +#endif +#else +#ifdef __STDC__ + double __ieee754_scalb(double x, double fn) +#else + double __ieee754_scalb(x,fn) + double x, fn; +#endif +#endif +{ +#ifdef _SCALB_INT + return scalbn(x,fn); +#else + if (isnan(x)||isnan(fn)) return x*fn; + if (!finite(fn)) { + if(fn>0.0) return x*fn; + else return x/(-fn); + } + if (rint(fn)!=fn) return (fn-fn)/(fn-fn); + if ( fn > 65000.0) return scalbn(x, 65000); + if (-fn > 65000.0) return scalbn(x,-65000); + return scalbn(x,(int)fn); +#endif +} + +#endif /* defined(_DOUBLE_IS_32BITS) */

e_scalb.c Property changes : Added: svn:eol-style ## -0,0 +1 ## +native \ No newline at end of property Added: svn:keywords ## -0,0 +1 ## +Id \ No newline at end of property Index: e_acos.c =================================================================== --- e_acos.c (nonexistent) +++ e_acos.c (revision 158) @@ -0,0 +1,111 @@ + +/* @(#)e_acos.c 5.1 93/09/24 */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +/* __ieee754_acos(x) + * Method : + * acos(x) = pi/2 - asin(x) + * acos(-x) = pi/2 + asin(x) + * For |x|<=0.5 + * acos(x) = pi/2 - (x + x*x^2*R(x^2)) (see asin.c) + * For x>0.5 + * acos(x) = pi/2 - (pi/2 - 2asin(sqrt((1-x)/2))) + * = 2asin(sqrt((1-x)/2)) + * = 2s + 2s*z*R(z) ...z=(1-x)/2, s=sqrt(z) + * = 2f + (2c + 2s*z*R(z)) + * where f=hi part of s, and c = (z-f*f)/(s+f) is the correction term + * for f so that f+c ~ sqrt(z). + * For x<-0.5 + * acos(x) = pi - 2asin(sqrt((1-|x|)/2)) + * = pi - 0.5*(s+s*z*R(z)), where z=(1-|x|)/2,s=sqrt(z) + * + * Special cases: + * if x is NaN, return x itself; + * if |x|>1, return NaN with invalid signal. + * + * Function needed: sqrt + */ + +#include "fdlibm.h" + +#ifndef _DOUBLE_IS_32BITS + +#ifdef __STDC__ +static const double +#else +static double +#endif +one= 1.00000000000000000000e+00, /* 0x3FF00000, 0x00000000 */ +pi = 3.14159265358979311600e+00, /* 0x400921FB, 0x54442D18 */ +pio2_hi = 1.57079632679489655800e+00, /* 0x3FF921FB, 0x54442D18 */ +pio2_lo = 6.12323399573676603587e-17, /* 0x3C91A626, 0x33145C07 */ +pS0 = 1.66666666666666657415e-01, /* 0x3FC55555, 0x55555555 */ +pS1 = -3.25565818622400915405e-01, /* 0xBFD4D612, 0x03EB6F7D */ +pS2 = 2.01212532134862925881e-01, /* 0x3FC9C155, 0x0E884455 */ +pS3 = -4.00555345006794114027e-02, /* 0xBFA48228, 0xB5688F3B */ +pS4 = 7.91534994289814532176e-04, /* 0x3F49EFE0, 0x7501B288 */ +pS5 = 3.47933107596021167570e-05, /* 0x3F023DE1, 0x0DFDF709 */ +qS1 = -2.40339491173441421878e+00, /* 0xC0033A27, 0x1C8A2D4B */ +qS2 = 2.02094576023350569471e+00, /* 0x40002AE5, 0x9C598AC8 */ +qS3 = -6.88283971605453293030e-01, /* 0xBFE6066C, 0x1B8D0159 */ +qS4 = 7.70381505559019352791e-02; /* 0x3FB3B8C5, 0xB12E9282 */ + +#ifdef __STDC__ + double __ieee754_acos(double x) +#else + double __ieee754_acos(x) + double x; +#endif +{ + double z,p,q,r,w,s,c,df; + __int32_t hx,ix; + GET_HIGH_WORD(hx,x); + ix = hx&0x7fffffff; + if(ix>=0x3ff00000) { /* |x| >= 1 */ + __uint32_t lx; + GET_LOW_WORD(lx,x); + if(((ix-0x3ff00000)|lx)==0) { /* |x|==1 */ + if(hx>0) return 0.0; /* acos(1) = 0 */ + else return pi+2.0*pio2_lo; /* acos(-1)= pi */ + } + return (x-x)/(x-x); /* acos(|x|>1) is NaN */ + } + if(ix<0x3fe00000) { /* |x| < 0.5 */ + if(ix<=0x3c600000) return pio2_hi+pio2_lo;/*if|x|<2**-57*/ + z = x*x; + p = z*(pS0+z*(pS1+z*(pS2+z*(pS3+z*(pS4+z*pS5))))); + q = one+z*(qS1+z*(qS2+z*(qS3+z*qS4))); + r = p/q; + return pio2_hi - (x - (pio2_lo-x*r)); + } else if (hx<0) { /* x < -0.5 */ + z = (one+x)*0.5; + p = z*(pS0+z*(pS1+z*(pS2+z*(pS3+z*(pS4+z*pS5))))); + q = one+z*(qS1+z*(qS2+z*(qS3+z*qS4))); + s = __ieee754_sqrt(z); + r = p/q; + w = r*s-pio2_lo; + return pi - 2.0*(s+w); + } else { /* x > 0.5 */ + z = (one-x)*0.5; + s = __ieee754_sqrt(z); + df = s; + SET_LOW_WORD(df,0); + c = (z-df*df)/(s+df); + p = z*(pS0+z*(pS1+z*(pS2+z*(pS3+z*(pS4+z*pS5))))); + q = one+z*(qS1+z*(qS2+z*(qS3+z*qS4))); + r = p/q; + w = r*s+c; + return 2.0*(df+w); + } +} + +#endif /* defined(_DOUBLE_IS_32BITS) */

e_acos.c Property changes : Added: svn:eol-style ## -0,0 +1 ## +native \ No newline at end of property Added: svn:keywords ## -0,0 +1 ## +Id \ No newline at end of property Index: wf_acosh.c =================================================================== --- wf_acosh.c (nonexistent) +++ wf_acosh.c (revision 158) @@ -0,0 +1,70 @@ +/* wf_acosh.c -- float version of w_acosh.c. + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + */ + +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + * + */ + +/* + * wrapper acoshf(x) + */ + +#include "fdlibm.h" +#include + +#ifdef __STDC__ + float acoshf(float x) /* wrapper acoshf */ +#else + float acoshf(x) /* wrapper acoshf */ + float x; +#endif +{ +#ifdef _IEEE_LIBM + return __ieee754_acoshf(x); +#else + float z; + struct exception exc; + z = __ieee754_acoshf(x); + if(_LIB_VERSION == _IEEE_ || isnanf(x)) return z; + if(x<(float)1.0) { + /* acoshf(x<1) */ + exc.type = DOMAIN; + exc.name = "acoshf"; + exc.err = 0; + exc.arg1 = exc.arg2 = (double)x; + exc.retval = 0.0/0.0; + if (_LIB_VERSION == _POSIX_) + errno = EDOM; + else if (!matherr(&exc)) { + errno = EDOM; + } + if (exc.err != 0) + errno = exc.err; + return (float)exc.retval; + } else + return z; +#endif +} + +#ifdef _DOUBLE_IS_32BITS + +#ifdef __STDC__ + double acosh(double x) +#else + double acosh(x) + double x; +#endif +{ + return (double) acoshf((float) x); +} + +#endif /* defined(_DOUBLE_IS_32BITS) */

wf_acosh.c Property changes : Added: svn:eol-style ## -0,0 +1 ## +native \ No newline at end of property Added: svn:keywords ## -0,0 +1 ## +Id \ No newline at end of property Index: k_tan.c =================================================================== --- k_tan.c (nonexistent) +++ k_tan.c (revision 158) @@ -0,0 +1,132 @@ + +/* @(#)k_tan.c 5.1 93/09/24 */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +/* __kernel_tan( x, y, k ) + * kernel tan function on [-pi/4, pi/4], pi/4 ~ 0.7854 + * Input x is assumed to be bounded by ~pi/4 in magnitude. + * Input y is the tail of x. + * Input k indicates whether tan (if k=1) or + * -1/tan (if k= -1) is returned. + * + * Algorithm + * 1. Since tan(-x) = -tan(x), we need only to consider positive x. + * 2. if x < 2^-28 (hx<0x3e300000 0), return x with inexact if x!=0. + * 3. tan(x) is approximated by a odd polynomial of degree 27 on + * [0,0.67434] + * 3 27 + * tan(x) ~ x + T1*x + ... + T13*x + * where + * + * |tan(x) 2 4 26 | -59.2 + * |----- - (1+T1*x +T2*x +.... +T13*x )| <= 2 + * | x | + * + * Note: tan(x+y) = tan(x) + tan'(x)*y + * ~ tan(x) + (1+x*x)*y + * Therefore, for better accuracy in computing tan(x+y), let + * 3 2 2 2 2 + * r = x *(T2+x *(T3+x *(...+x *(T12+x *T13)))) + * then + * 3 2 + * tan(x+y) = x + (T1*x + (x *(r+y)+y)) + * + * 4. For x in [0.67434,pi/4], let y = pi/4 - x, then + * tan(x) = tan(pi/4-y) = (1-tan(y))/(1+tan(y)) + * = 1 - 2*(tan(y) - (tan(y)^2)/(1+tan(y))) + */ + +#include "fdlibm.h" + +#ifndef _DOUBLE_IS_32BITS + +#ifdef __STDC__ +static const double +#else +static double +#endif +one = 1.00000000000000000000e+00, /* 0x3FF00000, 0x00000000 */ +pio4 = 7.85398163397448278999e-01, /* 0x3FE921FB, 0x54442D18 */ +pio4lo= 3.06161699786838301793e-17, /* 0x3C81A626, 0x33145C07 */ +T[] = { + 3.33333333333334091986e-01, /* 0x3FD55555, 0x55555563 */ + 1.33333333333201242699e-01, /* 0x3FC11111, 0x1110FE7A */ + 5.39682539762260521377e-02, /* 0x3FABA1BA, 0x1BB341FE */ + 2.18694882948595424599e-02, /* 0x3F9664F4, 0x8406D637 */ + 8.86323982359930005737e-03, /* 0x3F8226E3, 0xE96E8493 */ + 3.59207910759131235356e-03, /* 0x3F6D6D22, 0xC9560328 */ + 1.45620945432529025516e-03, /* 0x3F57DBC8, 0xFEE08315 */ + 5.88041240820264096874e-04, /* 0x3F4344D8, 0xF2F26501 */ + 2.46463134818469906812e-04, /* 0x3F3026F7, 0x1A8D1068 */ + 7.81794442939557092300e-05, /* 0x3F147E88, 0xA03792A6 */ + 7.14072491382608190305e-05, /* 0x3F12B80F, 0x32F0A7E9 */ + -1.85586374855275456654e-05, /* 0xBEF375CB, 0xDB605373 */ + 2.59073051863633712884e-05, /* 0x3EFB2A70, 0x74BF7AD4 */ +}; + +#ifdef __STDC__ + double __kernel_tan(double x, double y, int iy) +#else + double __kernel_tan(x, y, iy) + double x,y; int iy; +#endif +{ + double z,r,v,w,s; + __int32_t ix,hx; + GET_HIGH_WORD(hx,x); + ix = hx&0x7fffffff; /* high word of |x| */ + if(ix<0x3e300000) /* x < 2**-28 */ + {if((int)x==0) { /* generate inexact */ + __uint32_t low; + GET_LOW_WORD(low,x); + if(((ix|low)|(iy+1))==0) return one/fabs(x); + else return (iy==1)? x: -one/x; + } + } + if(ix>=0x3FE59428) { /* |x|>=0.6744 */ + if(hx<0) {x = -x; y = -y;} + z = pio4-x; + w = pio4lo-y; + x = z+w; y = 0.0; + } + z = x*x; + w = z*z; + /* Break x^5*(T[1]+x^2*T[2]+...) into + * x^5(T[1]+x^4*T[3]+...+x^20*T[11]) + + * x^5(x^2*(T[2]+x^4*T[4]+...+x^22*[T12])) + */ + r = T[1]+w*(T[3]+w*(T[5]+w*(T[7]+w*(T[9]+w*T[11])))); + v = z*(T[2]+w*(T[4]+w*(T[6]+w*(T[8]+w*(T[10]+w*T[12]))))); + s = z*x; + r = y + z*(s*(r+v)+y); + r += T[0]*s; + w = x+r; + if(ix>=0x3FE59428) { + v = (double)iy; + return (double)(1-((hx>>30)&2))*(v-2.0*(x-(w*w/(w+v)-r))); + } + if(iy==1) return w; + else { /* if allow error up to 2 ulp, + simply return -1.0/(x+r) here */ + /* compute -1.0/(x+r) accurately */ + double a,t; + z = w; + SET_LOW_WORD(z,0); + v = r-(z - x); /* z+v = r+x */ + t = a = -1.0/w; /* a = -1.0/w */ + SET_LOW_WORD(t,0); + s = 1.0+t*z; + return t+a*(s+t*v); + } +} + +#endif /* defined(_DOUBLE_IS_32BITS) */

k_tan.c Property changes : Added: svn:eol-style ## -0,0 +1 ## +native \ No newline at end of property Added: svn:keywords ## -0,0 +1 ## +Id \ No newline at end of property Index: w_remainder.c =================================================================== --- w_remainder.c (nonexistent) +++ w_remainder.c (revision 158) @@ -0,0 +1,108 @@ + +/* @(#)w_remainder.c 5.1 93/09/24 */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +/* +FUNCTION +<>, <>---round and remainder +INDEX + remainder +INDEX + remainderf + +ANSI_SYNOPSIS + #include + double remainder(double <[x]>, double <[y]>); + float remainderf(float <[x]>, float <[y]>); + +TRAD_SYNOPSIS + #include + double remainder(<[x]>,<[y]>) + double <[x]>, <[y]>; + float remainderf(<[x]>,<[y]>) + float <[x]>, <[y]>; + +DESCRIPTION +<> and <> find the remainder of +<[x]>/<[y]>; this value is in the range -<[y]>/2 .. +<[y]>/2. + +RETURNS +<> returns the integer result as a double. + +PORTABILITY +<> is a System V release 4. +<> is an extension. + +*/ + +/* + * wrapper remainder(x,p) + */ + +#include "fdlibm.h" +#include + +#ifndef _DOUBLE_IS_32BITS + +#ifdef __STDC__ + double remainder(double x, double y) /* wrapper remainder */ +#else + double remainder(x,y) /* wrapper remainder */ + double x,y; +#endif +{ +#ifdef _IEEE_LIBM + return __ieee754_remainder(x,y); +#else + double z; + struct exception exc; + z = __ieee754_remainder(x,y); + if(_LIB_VERSION == _IEEE_ || isnan(y)) return z; + if(y==0.0) { + /* remainder(x,0) */ + exc.type = DOMAIN; + exc.name = "remainder"; + exc.err = 0; + exc.arg1 = x; + exc.arg2 = y; + exc.retval = 0.0/0.0; + if (_LIB_VERSION == _POSIX_) + errno = EDOM; + else if (!matherr(&exc)) { + errno = EDOM; + } + if (exc.err != 0) + errno = exc.err; + return exc.retval; + } else + return z; +#endif +} + +#endif /* defined(_DOUBLE_IS_32BITS) */ + + + + + + + + + + + + + + + + +

w_remainder.c Property changes : Added: svn:eol-style ## -0,0 +1 ## +native \ No newline at end of property Added: svn:keywords ## -0,0 +1 ## +Id \ No newline at end of property Index: ef_scalb.c =================================================================== --- ef_scalb.c (nonexistent) +++ ef_scalb.c (revision 158) @@ -0,0 +1,53 @@ +/* ef_scalb.c -- float version of e_scalb.c. + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + */ + +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#include "fdlibm.h" +#include + +#ifdef _SCALB_INT +#ifdef __STDC__ + float __ieee754_scalbf(float x, int fn) +#else + float __ieee754_scalbf(x,fn) + float x; int fn; +#endif +#else +#ifdef __STDC__ + float __ieee754_scalbf(float x, float fn) +#else + float __ieee754_scalbf(x,fn) + float x, fn; +#endif +#endif +{ +#ifdef _SCALB_INT + return scalbnf(x,fn); +#else + if (isnanf(x)||isnanf(fn)) return x*fn; + if (!finitef(fn)) { + if(fn>(float)0.0) return x*fn; + else return x/(-fn); + } + if (rintf(fn)!=fn) return (fn-fn)/(fn-fn); +#if INT_MAX > 65000 + if ( fn > (float)65000.0) return scalbnf(x, 65000); + if (-fn > (float)65000.0) return scalbnf(x,-65000); +#else + if ( fn > (float)32000.0) return scalbnf(x, 32000); + if (-fn > (float)32000.0) return scalbnf(x,-32000); +#endif + return scalbnf(x,(int)fn); +#endif +}

ef_scalb.c Property changes : Added: svn:eol-style ## -0,0 +1 ## +native \ No newline at end of property Added: svn:keywords ## -0,0 +1 ## +Id \ No newline at end of property Index: k_cos.c =================================================================== --- k_cos.c (nonexistent) +++ k_cos.c (revision 158) @@ -0,0 +1,96 @@ + +/* @(#)k_cos.c 5.1 93/09/24 */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +/* + * __kernel_cos( x, y ) + * kernel cos function on [-pi/4, pi/4], pi/4 ~ 0.785398164 + * Input x is assumed to be bounded by ~pi/4 in magnitude. + * Input y is the tail of x. + * + * Algorithm + * 1. Since cos(-x) = cos(x), we need only to consider positive x. + * 2. if x < 2^-27 (hx<0x3e400000 0), return 1 with inexact if x!=0. + * 3. cos(x) is approximated by a polynomial of degree 14 on + * [0,pi/4] + * 4 14 + * cos(x) ~ 1 - x*x/2 + C1*x + ... + C6*x + * where the remez error is + * + * | 2 4 6 8 10 12 14 | -58 + * |cos(x)-(1-.5*x +C1*x +C2*x +C3*x +C4*x +C5*x +C6*x )| <= 2 + * | | + * + * 4 6 8 10 12 14 + * 4. let r = C1*x +C2*x +C3*x +C4*x +C5*x +C6*x , then + * cos(x) = 1 - x*x/2 + r + * since cos(x+y) ~ cos(x) - sin(x)*y + * ~ cos(x) - x*y, + * a correction term is necessary in cos(x) and hence + * cos(x+y) = 1 - (x*x/2 - (r - x*y)) + * For better accuracy when x > 0.3, let qx = |x|/4 with + * the last 32 bits mask off, and if x > 0.78125, let qx = 0.28125. + * Then + * cos(x+y) = (1-qx) - ((x*x/2-qx) - (r-x*y)). + * Note that 1-qx and (x*x/2-qx) is EXACT here, and the + * magnitude of the latter is at least a quarter of x*x/2, + * thus, reducing the rounding error in the subtraction. + */ + +#include "fdlibm.h" + +#ifndef _DOUBLE_IS_32BITS + +#ifdef __STDC__ +static const double +#else +static double +#endif +one = 1.00000000000000000000e+00, /* 0x3FF00000, 0x00000000 */ +C1 = 4.16666666666666019037e-02, /* 0x3FA55555, 0x5555554C */ +C2 = -1.38888888888741095749e-03, /* 0xBF56C16C, 0x16C15177 */ +C3 = 2.48015872894767294178e-05, /* 0x3EFA01A0, 0x19CB1590 */ +C4 = -2.75573143513906633035e-07, /* 0xBE927E4F, 0x809C52AD */ +C5 = 2.08757232129817482790e-09, /* 0x3E21EE9E, 0xBDB4B1C4 */ +C6 = -1.13596475577881948265e-11; /* 0xBDA8FAE9, 0xBE8838D4 */ + +#ifdef __STDC__ + double __kernel_cos(double x, double y) +#else + double __kernel_cos(x, y) + double x,y; +#endif +{ + double a,hz,z,r,qx; + __int32_t ix; + GET_HIGH_WORD(ix,x); + ix &= 0x7fffffff; /* ix = |x|'s high word*/ + if(ix<0x3e400000) { /* if x < 2**27 */ + if(((int)x)==0) return one; /* generate inexact */ + } + z = x*x; + r = z*(C1+z*(C2+z*(C3+z*(C4+z*(C5+z*C6))))); + if(ix < 0x3FD33333) /* if |x| < 0.3 */ + return one - (0.5*z - (z*r - x*y)); + else { + if(ix > 0x3fe90000) { /* x > 0.78125 */ + qx = 0.28125; + } else { + INSERT_WORDS(qx,ix-0x00200000,0); /* x/4 */ + } + hz = 0.5*z-qx; + a = one-qx; + return a - (hz - (z*r-x*y)); + } +} + +#endif /* defined(_DOUBLE_IS_32BITS) */

k_cos.c Property changes : Added: svn:eol-style ## -0,0 +1 ## +native \ No newline at end of property Added: svn:keywords ## -0,0 +1 ## +Id \ No newline at end of property Index: e_cosh.c =================================================================== --- e_cosh.c (nonexistent) +++ e_cosh.c (revision 158) @@ -0,0 +1,93 @@ + +/* @(#)e_cosh.c 5.1 93/09/24 */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +/* __ieee754_cosh(x) + * Method : + * mathematically cosh(x) if defined to be (exp(x)+exp(-x))/2 + * 1. Replace x by |x| (cosh(x) = cosh(-x)). + * 2. + * [ exp(x) - 1 ]^2 + * 0 <= x <= ln2/2 : cosh(x) := 1 + ------------------- + * 2*exp(x) + * + * exp(x) + 1/exp(x) + * ln2/2 <= x <= 22 : cosh(x) := ------------------- + * 2 + * 22 <= x <= lnovft : cosh(x) := exp(x)/2 + * lnovft <= x <= ln2ovft: cosh(x) := exp(x/2)/2 * exp(x/2) + * ln2ovft < x : cosh(x) := huge*huge (overflow) + * + * Special cases: + * cosh(x) is |x| if x is +INF, -INF, or NaN. + * only cosh(0)=1 is exact for finite x. + */ + +#include "fdlibm.h" + +#ifndef _DOUBLE_IS_32BITS + +#ifdef __STDC__ +static const double one = 1.0, half=0.5, huge = 1.0e300; +#else +static double one = 1.0, half=0.5, huge = 1.0e300; +#endif + +#ifdef __STDC__ + double __ieee754_cosh(double x) +#else + double __ieee754_cosh(x) + double x; +#endif +{ + double t,w; + __int32_t ix; + __uint32_t lx; + + /* High word of |x|. */ + GET_HIGH_WORD(ix,x); + ix &= 0x7fffffff; + + /* x is INF or NaN */ + if(ix>=0x7ff00000) return x*x; + + /* |x| in [0,0.5*ln2], return 1+expm1(|x|)^2/(2*exp(|x|)) */ + if(ix<0x3fd62e43) { + t = expm1(fabs(x)); + w = one+t; + if (ix<0x3c800000) return w; /* cosh(tiny) = 1 */ + return one+(t*t)/(w+w); + } + + /* |x| in [0.5*ln2,22], return (exp(|x|)+1/exp(|x|)/2; */ + if (ix < 0x40360000) { + t = __ieee754_exp(fabs(x)); + return half*t+half/t; + } + + /* |x| in [22, log(maxdouble)] return half*exp(|x|) */ + if (ix < 0x40862E42) return half*__ieee754_exp(fabs(x)); + + /* |x| in [log(maxdouble), overflowthresold] */ + GET_LOW_WORD(lx,x); + if (ix<0x408633CE || + (ix==0x408633ce && lx<=(__uint32_t)0x8fb9f87d)) { + w = __ieee754_exp(half*fabs(x)); + t = half*w; + return t*w; + } + + /* |x| > overflowthresold, cosh(x) overflow */ + return huge*huge; +} + +#endif /* defined(_DOUBLE_IS_32BITS) */

e_cosh.c Property changes : Added: svn:eol-style ## -0,0 +1 ## +native \ No newline at end of property Added: svn:keywords ## -0,0 +1 ## +Id \ No newline at end of property Index: wf_atan2.c =================================================================== --- wf_atan2.c (nonexistent) +++ wf_atan2.c (revision 158) @@ -0,0 +1,46 @@ +/* wf_atan2.c -- float version of w_atan2.c. + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + */ + +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + * + */ + +/* + * wrapper atan2f(y,x) + */ + +#include "fdlibm.h" +#include + +#ifdef __STDC__ + float atan2f(float y, float x) /* wrapper atan2f */ +#else + float atan2f(y,x) /* wrapper atan2 */ + float y,x; +#endif +{ + return __ieee754_atan2f(y,x); +} + +#ifdef _DOUBLE_IS_32BITS + +#ifdef __STDC__ + double atan2(double y, double x) +#else + double atan2(y,x) + double y,x; +#endif +{ + return (double) atan2f((float) y, (float) x); +} + +#endif /* defined(_DOUBLE_IS_32BITS) */

wf_atan2.c Property changes : Added: svn:eol-style ## -0,0 +1 ## +native \ No newline at end of property Added: svn:keywords ## -0,0 +1 ## +Id \ No newline at end of property Index: ef_sqrt.c =================================================================== --- ef_sqrt.c (nonexistent) +++ ef_sqrt.c (revision 158) @@ -0,0 +1,90 @@ +/* ef_sqrtf.c -- float version of e_sqrt.c. + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + */ + +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#include "fdlibm.h" + +#ifdef __STDC__ +static const float one = 1.0, tiny=1.0e-30; +#else +static float one = 1.0, tiny=1.0e-30; +#endif + +#ifdef __STDC__ + float __ieee754_sqrtf(float x) +#else + float __ieee754_sqrtf(x) + float x; +#endif +{ + float z; + __int32_t sign = (__int32_t)0x80000000; + __uint32_t r,hx; + __int32_t ix,s,q,m,t,i; + + GET_FLOAT_WORD(ix,x); + hx = ix&0x7fffffff; + + /* take care of Inf and NaN */ + if(!FLT_UWORD_IS_FINITE(hx)) + return x*x+x; /* sqrt(NaN)=NaN, sqrt(+inf)=+inf + sqrt(-inf)=sNaN */ + /* take care of zero and -ves */ + if(FLT_UWORD_IS_ZERO(hx)) return x;/* sqrt(+-0) = +-0 */ + if(ix<0) return (x-x)/(x-x); /* sqrt(-ve) = sNaN */ + + /* normalize x */ + m = (ix>>23); + if(FLT_UWORD_IS_SUBNORMAL(hx)) { /* subnormal x */ + for(i=0;(ix&0x00800000L)==0;i++) ix<<=1; + m -= i-1; + } + m -= 127; /* unbias exponent */ + ix = (ix&0x007fffffL)|0x00800000L; + if(m&1) /* odd m, double x to make it even */ + ix += ix; + m >>= 1; /* m = [m/2] */ + + /* generate sqrt(x) bit by bit */ + ix += ix; + q = s = 0; /* q = sqrt(x) */ + r = 0x01000000L; /* r = moving bit from right to left */ + + while(r!=0) { + t = s+r; + if(t<=ix) { + s = t+r; + ix -= t; + q += r; + } + ix += ix; + r>>=1; + } + + /* use floating add to find out rounding direction */ + if(ix!=0) { + z = one-tiny; /* trigger inexact flag */ + if (z>=one) { + z = one+tiny; + if (z>one) + q += 2; + else + q += (q&1); + } + } + ix = (q>>1)+0x3f000000L; + ix += (m <<23); + SET_FLOAT_WORD(z,ix); + return z; +}

ef_sqrt.c Property changes : Added: svn:eol-style ## -0,0 +1 ## +native \ No newline at end of property Added: svn:keywords ## -0,0 +1 ## +Id \ No newline at end of property Index: s_tan.c =================================================================== --- s_tan.c (nonexistent) +++ s_tan.c (revision 158) @@ -0,0 +1,114 @@ + +/* @(#)s_tan.c 5.1 93/09/24 */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + + +/* + +FUNCTION + <>, <>---tangent + +INDEX +tan +INDEX +tanf + +ANSI_SYNOPSIS + #include + double tan(double <[x]>); + float tanf(float <[x]>); + +TRAD_SYNOPSIS + #include + double tan(<[x]>) + double <[x]>; + + float tanf(<[x]>) + float <[x]>; + + +DESCRIPTION +<> computes the tangent of the argument <[x]>. +Angles are specified in radians. + +<> is identical, save that it takes and returns <> values. + +RETURNS +The tangent of <[x]> is returned. + +PORTABILITY +<> is ANSI. <> is an extension. +*/ + +/* tan(x) + * Return tangent function of x. + * + * kernel function: + * __kernel_tan ... tangent function on [-pi/4,pi/4] + * __ieee754_rem_pio2 ... argument reduction routine + * + * Method. + * Let S,C and T denote the sin, cos and tan respectively on + * [-PI/4, +PI/4]. Reduce the argument x to y1+y2 = x-k*pi/2 + * in [-pi/4 , +pi/4], and let n = k mod 4. + * We have + * + * n sin(x) cos(x) tan(x) + * ---------------------------------------------------------- + * 0 S C T + * 1 C -S -1/T + * 2 -S -C T + * 3 -C S -1/T + * ---------------------------------------------------------- + * + * Special cases: + * Let trig be any of sin, cos, or tan. + * trig(+-INF) is NaN, with signals; + * trig(NaN) is that NaN; + * + * Accuracy: + * TRIG(x) returns trig(x) nearly rounded + */ + +#include "fdlibm.h" + +#ifndef _DOUBLE_IS_32BITS + +#ifdef __STDC__ + double tan(double x) +#else + double tan(x) + double x; +#endif +{ + double y[2],z=0.0; + __int32_t n,ix; + + /* High word of x. */ + GET_HIGH_WORD(ix,x); + + /* |x| ~< pi/4 */ + ix &= 0x7fffffff; + if(ix <= 0x3fe921fb) return __kernel_tan(x,z,1); + + /* tan(Inf or NaN) is NaN */ + else if (ix>=0x7ff00000) return x-x; /* NaN */ + + /* argument reduction needed */ + else { + n = __ieee754_rem_pio2(x,y); + return __kernel_tan(y[0],y[1],1-((n&1)<<1)); /* 1 -- n even + -1 -- n odd */ + } +} + +#endif /* _DOUBLE_IS_32BITS */

s_tan.c Property changes : Added: svn:eol-style ## -0,0 +1 ## +native \ No newline at end of property Added: svn:keywords ## -0,0 +1 ## +Id \ No newline at end of property Index: s_cos.c =================================================================== --- s_cos.c (nonexistent) +++ s_cos.c (revision 158) @@ -0,0 +1,82 @@ + +/* @(#)s_cos.c 5.1 93/09/24 */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +/* cos(x) + * Return cosine function of x. + * + * kernel function: + * __kernel_sin ... sine function on [-pi/4,pi/4] + * __kernel_cos ... cosine function on [-pi/4,pi/4] + * __ieee754_rem_pio2 ... argument reduction routine + * + * Method. + * Let S,C and T denote the sin, cos and tan respectively on + * [-PI/4, +PI/4]. Reduce the argument x to y1+y2 = x-k*pi/2 + * in [-pi/4 , +pi/4], and let n = k mod 4. + * We have + * + * n sin(x) cos(x) tan(x) + * ---------------------------------------------------------- + * 0 S C T + * 1 C -S -1/T + * 2 -S -C T + * 3 -C S -1/T + * ---------------------------------------------------------- + * + * Special cases: + * Let trig be any of sin, cos, or tan. + * trig(+-INF) is NaN, with signals; + * trig(NaN) is that NaN; + * + * Accuracy: + * TRIG(x) returns trig(x) nearly rounded + */ + +#include "fdlibm.h" + +#ifndef _DOUBLE_IS_32BITS + +#ifdef __STDC__ + double cos(double x) +#else + double cos(x) + double x; +#endif +{ + double y[2],z=0.0; + __int32_t n,ix; + + /* High word of x. */ + GET_HIGH_WORD(ix,x); + + /* |x| ~< pi/4 */ + ix &= 0x7fffffff; + if(ix <= 0x3fe921fb) return __kernel_cos(x,z); + + /* cos(Inf or NaN) is NaN */ + else if (ix>=0x7ff00000) return x-x; + + /* argument reduction needed */ + else { + n = __ieee754_rem_pio2(x,y); + switch(n&3) { + case 0: return __kernel_cos(y[0],y[1]); + case 1: return -__kernel_sin(y[0],y[1],1); + case 2: return -__kernel_cos(y[0],y[1]); + default: + return __kernel_sin(y[0],y[1],1); + } + } +} + +#endif /* _DOUBLE_IS_32BITS */

s_cos.c Property changes : Added: svn:eol-style ## -0,0 +1 ## +native \ No newline at end of property Added: svn:keywords ## -0,0 +1 ## +Id \ No newline at end of property Index: e_pow.c =================================================================== --- e_pow.c (nonexistent) +++ e_pow.c (revision 158) @@ -0,0 +1,314 @@ + +/* @(#)e_pow.c 5.1 93/09/24 */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +/* __ieee754_pow(x,y) return x**y + * + * n + * Method: Let x = 2 * (1+f) + * 1. Compute and return log2(x) in two pieces: + * log2(x) = w1 + w2, + * where w1 has 53-24 = 29 bit trailing zeros. + * 2. Perform y*log2(x) = n+y' by simulating multi-precision + * arithmetic, where |y'|<=0.5. + * 3. Return x**y = 2**n*exp(y'*log2) + * + * Special cases: + * 1. (anything) ** 0 is 1 + * 2. (anything) ** 1 is itself + * 3a. (anything) ** NAN is NAN except + * 3b. +1 ** NAN is 1 + * 4. NAN ** (anything except 0) is NAN + * 5. +-(|x| > 1) ** +INF is +INF + * 6. +-(|x| > 1) ** -INF is +0 + * 7. +-(|x| < 1) ** +INF is +0 + * 8. +-(|x| < 1) ** -INF is +INF + * 9. +-1 ** +-INF is 1 + * 10. +0 ** (+anything except 0, NAN) is +0 + * 11. -0 ** (+anything except 0, NAN, odd integer) is +0 + * 12. +0 ** (-anything except 0, NAN) is +INF + * 13. -0 ** (-anything except 0, NAN, odd integer) is +INF + * 14. -0 ** (odd integer) = -( +0 ** (odd integer) ) + * 15. +INF ** (+anything except 0,NAN) is +INF + * 16. +INF ** (-anything except 0,NAN) is +0 + * 17. -INF ** (anything) = -0 ** (-anything) + * 18. (-anything) ** (integer) is (-1)**(integer)*(+anything**integer) + * 19. (-anything except 0 and inf) ** (non-integer) is NAN + * + * Accuracy: + * pow(x,y) returns x**y nearly rounded. In particular + * pow(integer,integer) + * always returns the correct integer provided it is + * representable. + * + * Constants : + * The hexadecimal values are the intended ones for the following + * constants. The decimal values may be used, provided that the + * compiler will convert from decimal to binary accurately enough + * to produce the hexadecimal values shown. + */ + +#include "fdlibm.h" + +#ifndef _DOUBLE_IS_32BITS + +#ifdef __STDC__ +static const double +#else +static double +#endif +bp[] = {1.0, 1.5,}, +dp_h[] = { 0.0, 5.84962487220764160156e-01,}, /* 0x3FE2B803, 0x40000000 */ +dp_l[] = { 0.0, 1.35003920212974897128e-08,}, /* 0x3E4CFDEB, 0x43CFD006 */ +zero = 0.0, +one = 1.0, +two = 2.0, +two53 = 9007199254740992.0, /* 0x43400000, 0x00000000 */ +huge = 1.0e300, +tiny = 1.0e-300, + /* poly coefs for (3/2)*(log(x)-2s-2/3*s**3 */ +L1 = 5.99999999999994648725e-01, /* 0x3FE33333, 0x33333303 */ +L2 = 4.28571428578550184252e-01, /* 0x3FDB6DB6, 0xDB6FABFF */ +L3 = 3.33333329818377432918e-01, /* 0x3FD55555, 0x518F264D */ +L4 = 2.72728123808534006489e-01, /* 0x3FD17460, 0xA91D4101 */ +L5 = 2.30660745775561754067e-01, /* 0x3FCD864A, 0x93C9DB65 */ +L6 = 2.06975017800338417784e-01, /* 0x3FCA7E28, 0x4A454EEF */ +P1 = 1.66666666666666019037e-01, /* 0x3FC55555, 0x5555553E */ +P2 = -2.77777777770155933842e-03, /* 0xBF66C16C, 0x16BEBD93 */ +P3 = 6.61375632143793436117e-05, /* 0x3F11566A, 0xAF25DE2C */ +P4 = -1.65339022054652515390e-06, /* 0xBEBBBD41, 0xC5D26BF1 */ +P5 = 4.13813679705723846039e-08, /* 0x3E663769, 0x72BEA4D0 */ +lg2 = 6.93147180559945286227e-01, /* 0x3FE62E42, 0xFEFA39EF */ +lg2_h = 6.93147182464599609375e-01, /* 0x3FE62E43, 0x00000000 */ +lg2_l = -1.90465429995776804525e-09, /* 0xBE205C61, 0x0CA86C39 */ +ovt = 8.0085662595372944372e-0017, /* -(1024-log2(ovfl+.5ulp)) */ +cp = 9.61796693925975554329e-01, /* 0x3FEEC709, 0xDC3A03FD =2/(3ln2) */ +cp_h = 9.61796700954437255859e-01, /* 0x3FEEC709, 0xE0000000 =(float)cp */ +cp_l = -7.02846165095275826516e-09, /* 0xBE3E2FE0, 0x145B01F5 =tail of cp_h*/ +ivln2 = 1.44269504088896338700e+00, /* 0x3FF71547, 0x652B82FE =1/ln2 */ +ivln2_h = 1.44269502162933349609e+00, /* 0x3FF71547, 0x60000000 =24b 1/ln2*/ +ivln2_l = 1.92596299112661746887e-08; /* 0x3E54AE0B, 0xF85DDF44 =1/ln2 tail*/ + +#ifdef __STDC__ + double __ieee754_pow(double x, double y) +#else + double __ieee754_pow(x,y) + double x, y; +#endif +{ + double z,ax,z_h,z_l,p_h,p_l; + double y1,t1,t2,r,s,t,u,v,w; + __int32_t i,j,k,yisint,n; + __int32_t hx,hy,ix,iy; + __uint32_t lx,ly; + + EXTRACT_WORDS(hx,lx,x); + EXTRACT_WORDS(hy,ly,y); + ix = hx&0x7fffffff; iy = hy&0x7fffffff; + + /* y==zero: x**0 = 1 */ + if((iy|ly)==0) return one; + + /* x|y==NaN return NaN unless x==1 then return 1 */ + if(ix > 0x7ff00000 || ((ix==0x7ff00000)&&(lx!=0)) || + iy > 0x7ff00000 || ((iy==0x7ff00000)&&(ly!=0))) + if(((ix-0x3ff00000)|lx)==0) return one; + else return nan(""); + + /* determine if y is an odd int when x < 0 + * yisint = 0 ... y is not an integer + * yisint = 1 ... y is an odd int + * yisint = 2 ... y is an even int + */ + yisint = 0; + if(hx<0) { + if(iy>=0x43400000) yisint = 2; /* even integer y */ + else if(iy>=0x3ff00000) { + k = (iy>>20)-0x3ff; /* exponent */ + if(k>20) { + j = ly>>(52-k); + if((j<<(52-k))==ly) yisint = 2-(j&1); + } else if(ly==0) { + j = iy>>(20-k); + if((j<<(20-k))==iy) yisint = 2-(j&1); + } + } + } + + /* special value of y */ + if(ly==0) { + if (iy==0x7ff00000) { /* y is +-inf */ + if(((ix-0x3ff00000)|lx)==0) + return one; /* +-1**+-inf = 1 */ + else if (ix >= 0x3ff00000)/* (|x|>1)**+-inf = inf,0 */ + return (hy>=0)? y: zero; + else /* (|x|<1)**-,+inf = inf,0 */ + return (hy<0)?-y: zero; + } + if(iy==0x3ff00000) { /* y is +-1 */ + if(hy<0) return one/x; else return x; + } + if(hy==0x40000000) return x*x; /* y is 2 */ + if(hy==0x3fe00000) { /* y is 0.5 */ + if(hx>=0) /* x >= +0 */ + return __ieee754_sqrt(x); + } + } + + ax = fabs(x); + /* special value of x */ + if(lx==0) { + if(ix==0x7ff00000||ix==0||ix==0x3ff00000){ + z = ax; /*x is +-0,+-inf,+-1*/ + if(hy<0) z = one/z; /* z = (1/|x|) */ + if(hx<0) { + if(((ix-0x3ff00000)|yisint)==0) { + z = (z-z)/(z-z); /* (-1)**non-int is NaN */ + } else if(yisint==1) + z = -z; /* (x<0)**odd = -(|x|**odd) */ + } + return z; + } + } + + /* (x<0)**(non-int) is NaN */ + /* REDHAT LOCAL: This used to be + if((((hx>>31)+1)|yisint)==0) return (x-x)/(x-x); + but ANSI C says a right shift of a signed negative quantity is + implementation defined. */ + if(((((__uint32_t)hx>>31)-1)|yisint)==0) return (x-x)/(x-x); + + /* |y| is huge */ + if(iy>0x41e00000) { /* if |y| > 2**31 */ + if(iy>0x43f00000){ /* if |y| > 2**64, must o/uflow */ + if(ix<=0x3fefffff) return (hy<0)? huge*huge:tiny*tiny; + if(ix>=0x3ff00000) return (hy>0)? huge*huge:tiny*tiny; + } + /* over/underflow if x is not close to one */ + if(ix<0x3fefffff) return (hy<0)? huge*huge:tiny*tiny; + if(ix>0x3ff00000) return (hy>0)? huge*huge:tiny*tiny; + /* now |1-x| is tiny <= 2**-20, suffice to compute + log(x) by x-x^2/2+x^3/3-x^4/4 */ + t = ax-1; /* t has 20 trailing zeros */ + w = (t*t)*(0.5-t*(0.3333333333333333333333-t*0.25)); + u = ivln2_h*t; /* ivln2_h has 21 sig. bits */ + v = t*ivln2_l-w*ivln2; + t1 = u+v; + SET_LOW_WORD(t1,0); + t2 = v-(t1-u); + } else { + double s2,s_h,s_l,t_h,t_l; + n = 0; + /* take care subnormal number */ + if(ix<0x00100000) + {ax *= two53; n -= 53; GET_HIGH_WORD(ix,ax); } + n += ((ix)>>20)-0x3ff; + j = ix&0x000fffff; + /* determine interval */ + ix = j|0x3ff00000; /* normalize ix */ + if(j<=0x3988E) k=0; /* |x|>1)|0x20000000)+0x00080000+(k<<18)); + t_l = ax - (t_h-bp[k]); + s_l = v*((u-s_h*t_h)-s_h*t_l); + /* compute log(ax) */ + s2 = s*s; + r = s2*s2*(L1+s2*(L2+s2*(L3+s2*(L4+s2*(L5+s2*L6))))); + r += s_l*(s_h+s); + s2 = s_h*s_h; + t_h = 3.0+s2+r; + SET_LOW_WORD(t_h,0); + t_l = r-((t_h-3.0)-s2); + /* u+v = s*(1+...) */ + u = s_h*t_h; + v = s_l*t_h+t_l*s; + /* 2/(3log2)*(s+...) */ + p_h = u+v; + SET_LOW_WORD(p_h,0); + p_l = v-(p_h-u); + z_h = cp_h*p_h; /* cp_h+cp_l = 2/(3*log2) */ + z_l = cp_l*p_h+p_l*cp+dp_l[k]; + /* log2(ax) = (s+..)*2/(3*log2) = n + dp_h + z_h + z_l */ + t = (double)n; + t1 = (((z_h+z_l)+dp_h[k])+t); + SET_LOW_WORD(t1,0); + t2 = z_l-(((t1-t)-dp_h[k])-z_h); + } + + s = one; /* s (sign of result -ve**odd) = -1 else = 1 */ + if(((((__uint32_t)hx>>31)-1)|(yisint-1))==0) + s = -one;/* (-ve)**(odd int) */ + + /* split up y into y1+y2 and compute (y1+y2)*(t1+t2) */ + y1 = y; + SET_LOW_WORD(y1,0); + p_l = (y-y1)*t1+y*t2; + p_h = y1*t1; + z = p_l+p_h; + EXTRACT_WORDS(j,i,z); + if (j>=0x40900000) { /* z >= 1024 */ + if(((j-0x40900000)|i)!=0) /* if z > 1024 */ + return s*huge*huge; /* overflow */ + else { + if(p_l+ovt>z-p_h) return s*huge*huge; /* overflow */ + } + } else if((j&0x7fffffff)>=0x4090cc00 ) { /* z <= -1075 */ + if(((j-0xc090cc00)|i)!=0) /* z < -1075 */ + return s*tiny*tiny; /* underflow */ + else { + if(p_l<=z-p_h) return s*tiny*tiny; /* underflow */ + } + } + /* + * compute 2**(p_h+p_l) + */ + i = j&0x7fffffff; + k = (i>>20)-0x3ff; + n = 0; + if(i>0x3fe00000) { /* if |z| > 0.5, set n = [z+0.5] */ + n = j+(0x00100000>>(k+1)); + k = ((n&0x7fffffff)>>20)-0x3ff; /* new k for n */ + t = zero; + SET_HIGH_WORD(t,n&~(0x000fffff>>k)); + n = ((n&0x000fffff)|0x00100000)>>(20-k); + if(j<0) n = -n; + p_h -= t; + } + t = p_l+p_h; + SET_LOW_WORD(t,0); + u = t*lg2_h; + v = (p_l-(t-p_h))*lg2+t*lg2_l; + z = u+v; + w = v-(z-u); + t = z*z; + t1 = z - t*(P1+t*(P2+t*(P3+t*(P4+t*P5)))); + r = (z*t1)/(t1-two)-(w+z*w); + z = one-(r-z); + GET_HIGH_WORD(j,z); + j += (n<<20); + if((j>>20)<=0) z = scalbn(z,(int)n); /* subnormal output */ + else SET_HIGH_WORD(z,j); + return s*z; +} + +#endif /* defined(_DOUBLE_IS_32BITS) */

e_pow.c Property changes : Added: svn:eol-style ## -0,0 +1 ## +native \ No newline at end of property Added: svn:keywords ## -0,0 +1 ## +Id \ No newline at end of property Index: w_scalb.c =================================================================== --- w_scalb.c (nonexistent) +++ w_scalb.c (revision 158) @@ -0,0 +1,94 @@ + +/* @(#)w_scalb.c 5.1 93/09/24 */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +/* + * wrapper scalb(double x, double fn) is provide for + * passing various standard test suite. One + * should use scalbn() instead. + */ + +#include "fdlibm.h" +#include + +#ifndef _DOUBLE_IS_32BITS + +#ifdef __STDC__ +#ifdef _SCALB_INT + double scalb(double x, int fn) /* wrapper scalb */ +#else + double scalb(double x, double fn) /* wrapper scalb */ +#endif +#else + double scalb(x,fn) /* wrapper scalb */ +#ifdef _SCALB_INT + double x; int fn; +#else + double x,fn; +#endif +#endif +{ +#ifdef _IEEE_LIBM + return __ieee754_scalb(x,fn); +#else + double z; +#ifndef HUGE_VAL +#define HUGE_VAL inf + double inf = 0.0; + + SET_HIGH_WORD(inf,0x7ff00000); /* set inf to infinite */ +#endif + struct exception exc; + z = __ieee754_scalb(x,fn); + if(_LIB_VERSION == _IEEE_) return z; + if(!(finite(z)||isnan(z))&&finite(x)) { + /* scalb overflow; SVID also returns +-HUGE_VAL */ + exc.type = OVERFLOW; + exc.name = "scalb"; + exc.err = 0; + exc.arg1 = x; + exc.arg2 = fn; + exc.retval = x > 0.0 ? HUGE_VAL : -HUGE_VAL; + if (_LIB_VERSION == _POSIX_) + errno = ERANGE; + else if (!matherr(&exc)) { + errno = ERANGE; + } + if (exc.err != 0) + errno = exc.err; + return exc.retval; + } + if(z==0.0&&z!=x) { + /* scalb underflow */ + exc.type = UNDERFLOW; + exc.name = "scalb"; + exc.err = 0; + exc.arg1 = x; + exc.arg2 = fn; + exc.retval = copysign(0.0,x); + if (_LIB_VERSION == _POSIX_) + errno = ERANGE; + else if (!matherr(&exc)) { + errno = ERANGE; + } + if (exc.err != 0) + errno = exc.err; + return exc.retval; + } +#ifndef _SCALB_INT + if(!finite(fn)) errno = ERANGE; +#endif + return z; +#endif +} + +#endif /* defined(_DOUBLE_IS_32BITS) */

w_scalb.c Property changes : Added: svn:eol-style ## -0,0 +1 ## +native \ No newline at end of property Added: svn:keywords ## -0,0 +1 ## +Id \ No newline at end of property Index: s_tanh.c =================================================================== --- s_tanh.c (nonexistent) +++ s_tanh.c (revision 158) @@ -0,0 +1,128 @@ + +/* @(#)s_tanh.c 5.1 93/09/24 */ +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +/* + +FUNCTION + <>, <>---hyperbolic tangent + +INDEX +tanh +INDEX +tanhf + +ANSI_SYNOPSIS + #include + double tanh(double <[x]>); + float tanhf(float <[x]>); + +TRAD_SYNOPSIS + #include + double tanh(<[x]>) + double <[x]>; + + float tanhf(<[x]>) + float <[x]>; + + +DESCRIPTION + +<> computes the hyperbolic tangent of +the argument <[x]>. Angles are specified in radians. + +<)>> is defined as +. sinh(<[x]>)/cosh(<[x]>) + +<> is identical, save that it takes and returns <> values. + +RETURNS +The hyperbolic tangent of <[x]> is returned. + +PORTABILITY +<> is ANSI C. <> is an extension. + +*/ + +/* Tanh(x) + * Return the Hyperbolic Tangent of x + * + * Method : + * x -x + * e - e + * 0. tanh(x) is defined to be ----------- + * x -x + * e + e + * 1. reduce x to non-negative by tanh(-x) = -tanh(x). + * 2. 0 <= x <= 2**-55 : tanh(x) := x*(one+x) + * -t + * 2**-55 < x <= 1 : tanh(x) := -----; t = expm1(-2x) + * t + 2 + * 2 + * 1 <= x <= 22.0 : tanh(x) := 1- ----- ; t=expm1(2x) + * t + 2 + * 22.0 < x <= INF : tanh(x) := 1. + * + * Special cases: + * tanh(NaN) is NaN; + * only tanh(0)=0 is exact for finite argument. + */ + +#include "fdlibm.h" + +#ifndef _DOUBLE_IS_32BITS + +#ifdef __STDC__ +static const double one=1.0, two=2.0, tiny = 1.0e-300; +#else +static double one=1.0, two=2.0, tiny = 1.0e-300; +#endif + +#ifdef __STDC__ + double tanh(double x) +#else + double tanh(x) + double x; +#endif +{ + double t,z; + __int32_t jx,ix; + + /* High word of |x|. */ + GET_HIGH_WORD(jx,x); + ix = jx&0x7fffffff; + + /* x is INF or NaN */ + if(ix>=0x7ff00000) { + if (jx>=0) return one/x+one; /* tanh(+-inf)=+-1 */ + else return one/x-one; /* tanh(NaN) = NaN */ + } + + /* |x| < 22 */ + if (ix < 0x40360000) { /* |x|<22 */ + if (ix<0x3c800000) /* |x|<2**-55 */ + return x*(one+x); /* tanh(small) = small */ + if (ix>=0x3ff00000) { /* |x|>=1 */ + t = expm1(two*fabs(x)); + z = one - two/(t+two); + } else { + t = expm1(-two*fabs(x)); + z= -t/(t+two); + } + /* |x| > 22, return +-1 */ + } else { + z = one - tiny; /* raised inexact flag */ + } + return (jx>=0)? z: -z; +} + +#endif /* _DOUBLE_IS_32BITS */

s_tanh.c Property changes : Added: svn:eol-style ## -0,0 +1 ## +native \ No newline at end of property Added: svn:keywords ## -0,0 +1 ## +Id \ No newline at end of property Index: sf_tanh.c =================================================================== --- sf_tanh.c (nonexistent) +++ sf_tanh.c (revision 158) @@ -0,0 +1,73 @@ +/* sf_tanh.c -- float version of s_tanh.c. + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + */ + +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +#include "fdlibm.h" + +#ifdef __STDC__ +static const float one=1.0, two=2.0, tiny = 1.0e-30; +#else +static float one=1.0, two=2.0, tiny = 1.0e-30; +#endif + +#ifdef __STDC__ + float tanhf(float x) +#else + float tanhf(x) + float x; +#endif +{ + float t,z; + __int32_t jx,ix; + + GET_FLOAT_WORD(jx,x); + ix = jx&0x7fffffff; + + /* x is INF or NaN */ + if(!FLT_UWORD_IS_FINITE(ix)) { + if (jx>=0) return one/x+one; /* tanh(+-inf)=+-1 */ + else return one/x-one; /* tanh(NaN) = NaN */ + } + + /* |x| < 22 */ + if (ix < 0x41b00000) { /* |x|<22 */ + if (ix<0x24000000) /* |x|<2**-55 */ + return x*(one+x); /* tanh(small) = small */ + if (ix>=0x3f800000) { /* |x|>=1 */ + t = expm1f(two*fabsf(x)); + z = one - two/(t+two); + } else { + t = expm1f(-two*fabsf(x)); + z= -t/(t+two); + } + /* |x| > 22, return +-1 */ + } else { + z = one - tiny; /* raised inexact flag */ + } + return (jx>=0)? z: -z; +} + +#ifdef _DOUBLE_IS_32BITS + +#ifdef __STDC__ + double tanh(double x) +#else + double tanh(x) + double x; +#endif +{ + return (double) tanhf((float) x); +} + +#endif /* defined(_DOUBLE_IS_32BITS) */

sf_tanh.c Property changes : Added: svn:eol-style ## -0,0 +1 ## +native \ No newline at end of property Added: svn:keywords ## -0,0 +1 ## +Id \ No newline at end of property Index: wf_sqrt.c =================================================================== --- wf_sqrt.c (nonexistent) +++ wf_sqrt.c (revision 158) @@ -0,0 +1,72 @@ +/* wf_sqrt.c -- float version of w_sqrt.c. + * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. + */ + +/* + * ==================================================== + * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. + * + * Developed at SunPro, a Sun Microsystems, Inc. business. + * Permission to use, copy, modify, and distribute this + * software is freely granted, provided that this notice + * is preserved. + * ==================================================== + */ + +/* + * wrapper sqrtf(x) + */ + +#include "fdlibm.h" +#include + +#ifdef __STDC__ + float sqrtf(float x) /* wrapper sqrtf */ +#else + float sqrtf(x) /* wrapper sqrtf */ + float x; +#endif +{ +#ifdef _IEEE_LIBM + return __ieee754_sqrtf(x); +#else + float z; + struct exception exc; + z = __ieee754_sqrtf(x); + if(_LIB_VERSION == _IEEE_ || isnanf(x)) return z; + if(x<(float)0.0) { + /* sqrtf(negative) */ + exc.type = DOMAIN; + exc.name = "sqrtf"; + exc.err = 0; + exc.arg1 = exc.arg2 = (double)x; + if (_LIB_VERSION == _SVID_) + exc.retval = 0.0; + else + exc.retval = 0.0/0.0; + if (_LIB_VERSION == _POSIX_) + errno = EDOM; + else if (!matherr(&exc)) { + errno = EDOM; + } + if (exc.err != 0) + errno = exc.err; + return (float)exc.retval; + } else + return z; +#endif +} + +#ifdef _DOUBLE_IS_32BITS + +#ifdef __STDC__ + double sqrt(double x) +#else + double sqrt(x) + double x; +#endif +{ + return (double) sqrtf((float) x); +} + +#endif /* defined(_DOUBLE_IS_32BITS) */

wf_sqrt.c Property changes : Added: svn:eol-style ## -0,0 +1 ## +native \ No newline at end of property Added: svn:keywords ## -0,0 +1 ## +Id \ No newline at end of property

powered by: WebSVN 2.1.0